diff --git a/apps/design_system_gallery/lib/components/badge/stream_image_source_badge.dart b/apps/design_system_gallery/lib/components/badge/stream_image_source_badge.dart index e3ef9eff..c7e94fa6 100644 --- a/apps/design_system_gallery/lib/components/badge/stream_image_source_badge.dart +++ b/apps/design_system_gallery/lib/components/badge/stream_image_source_badge.dart @@ -81,9 +81,9 @@ Widget buildStreamImageSourceBadgePlayground(BuildContext context) { final leading = switch (leadingIcon) { _LeadingOption.giphy => SvgIcon(icons.giphy), _LeadingOption.imgur => SvgIcon(icons.imgur), - _LeadingOption.fileBend => Icon(icons.fileBend), - _LeadingOption.playSolid => Icon(icons.playSolid), - _LeadingOption.video => Icon(icons.video), + _LeadingOption.file20 => Icon(icons.file20), + _LeadingOption.playFill20 => Icon(icons.playFill20), + _LeadingOption.video20 => Icon(icons.video20), }; final badge = StreamImageSourceBadge( @@ -126,9 +126,9 @@ enum _BadgeVariant { enum _LeadingOption { giphy('Giphy (SVG)'), imgur('Imgur (SVG)'), - fileBend('File Icon'), - playSolid('Play Icon'), - video('Video Icon') + file20('File Icon'), + playFill20('Play Icon'), + video20('Video Icon') ; const _LeadingOption(this.label); diff --git a/apps/design_system_gallery/lib/components/context_menu/stream_context_menu.dart b/apps/design_system_gallery/lib/components/context_menu/stream_context_menu.dart index 8e668641..c6d2a322 100644 --- a/apps/design_system_gallery/lib/components/context_menu/stream_context_menu.dart +++ b/apps/design_system_gallery/lib/components/context_menu/stream_context_menu.dart @@ -69,14 +69,14 @@ class _PlaygroundDemoState extends State<_PlaygroundDemo> { ); final actionData = <({String label, IconData icon})>[ - (label: 'Reply', icon: icons.arrowShareLeft), - (label: 'Thread Reply', icon: icons.bubbleText6ChatMessage), - (label: 'Pin to Conversation', icon: icons.pin), - (label: 'Copy Message', icon: icons.squareBehindSquare2Copy), - (label: 'Mark Unread', icon: icons.bubbleWideNotificationChatMessage), - (label: 'Remind Me', icon: icons.bellNotification), - (label: 'Save For Later', icon: icons.fileBend), - (label: 'Flag Message', icon: icons.flag2), + (label: 'Reply', icon: icons.reply20), + (label: 'Thread Reply', icon: icons.thread20), + (label: 'Pin to Conversation', icon: icons.pin20), + (label: 'Copy Message', icon: icons.copy20), + (label: 'Mark Unread', icon: icons.notification20), + (label: 'Remind Me', icon: icons.bell20), + (label: 'Save For Later', icon: icons.file20), + (label: 'Flag Message', icon: icons.flag20), ]; List buildInlineActions() { @@ -86,7 +86,7 @@ class _PlaygroundDemoState extends State<_PlaygroundDemo> { value: actionData[i].label, label: Text(actionData[i].label), leading: showLeadingIcon ? Icon(actionData[i].icon) : null, - trailing: showTrailingIcon ? Icon(icons.chevronRight) : null, + trailing: showTrailingIcon ? Icon(icons.chevronRight20) : null, enabled: !(hasDisabledAction && i == 1), onTap: () => setState(() => _inlineTapped = actionData[i].label), ), @@ -95,7 +95,7 @@ class _PlaygroundDemoState extends State<_PlaygroundDemo> { StreamContextMenuAction.destructive( value: 'Delete Message', label: const Text('Delete Message'), - leading: showLeadingIcon ? Icon(icons.trashBin) : null, + leading: showLeadingIcon ? Icon(icons.delete20) : null, onTap: () => setState(() => _inlineTapped = 'Delete Message'), ), ]; @@ -108,7 +108,7 @@ class _PlaygroundDemoState extends State<_PlaygroundDemo> { value: actionData[i].label, label: Text(actionData[i].label), leading: showLeadingIcon ? Icon(actionData[i].icon) : null, - trailing: showTrailingIcon ? Icon(icons.chevronRight) : null, + trailing: showTrailingIcon ? Icon(icons.chevronRight20) : null, enabled: !(hasDisabledAction && i == 1), ), if (showSeparator && showDestructiveAction) const StreamContextMenuSeparator(), @@ -116,7 +116,7 @@ class _PlaygroundDemoState extends State<_PlaygroundDemo> { StreamContextMenuAction.destructive( value: 'Delete Message', label: const Text('Delete Message'), - leading: showLeadingIcon ? Icon(icons.trashBin) : null, + leading: showLeadingIcon ? Icon(icons.delete20) : null, ), ]; } @@ -286,20 +286,20 @@ class _NormalStatesCard extends StatelessWidget { maxLines: 1, overflow: TextOverflow.ellipsis, ), - leading: Icon(icons.plusLarge), - trailing: Icon(icons.chevronRight), + leading: Icon(icons.plus20), + trailing: Icon(icons.chevronRight20), ), StreamContextMenuAction( label: const Text('With Leading Only'), - leading: Icon(icons.plusLarge), + leading: Icon(icons.plus20), ), StreamContextMenuAction( label: const Text('Label Only'), ), StreamContextMenuAction( label: const Text('Disabled'), - leading: Icon(icons.plusLarge), - trailing: Icon(icons.chevronRight), + leading: Icon(icons.plus20), + trailing: Icon(icons.chevronRight20), enabled: false, ), ], @@ -329,20 +329,20 @@ class _DestructiveStatesCard extends StatelessWidget { maxLines: 1, overflow: TextOverflow.ellipsis, ), - leading: Icon(icons.trashBin), - trailing: Icon(icons.chevronRight), + leading: Icon(icons.delete20), + trailing: Icon(icons.chevronRight20), ), StreamContextMenuAction.destructive( label: const Text('With Leading Only'), - leading: Icon(icons.trashBin), + leading: Icon(icons.delete20), ), StreamContextMenuAction.destructive( label: const Text('Label Only'), ), StreamContextMenuAction.destructive( label: const Text('Disabled'), - leading: Icon(icons.trashBin), - trailing: Icon(icons.chevronRight), + leading: Icon(icons.delete20), + trailing: Icon(icons.chevronRight20), enabled: false, ), ], @@ -395,15 +395,15 @@ class _MenuCompositionsSection extends StatelessWidget { children: [ StreamContextMenuAction( label: const Text('Reply'), - leading: Icon(icons.arrowShareLeft), + leading: Icon(icons.reply20), ), StreamContextMenuAction( label: const Text('Copy Message'), - leading: Icon(icons.squareBehindSquare2Copy), + leading: Icon(icons.copy20), ), StreamContextMenuAction( label: const Text('Flag Message'), - leading: Icon(icons.flag2), + leading: Icon(icons.flag20), ), ], ), @@ -417,16 +417,16 @@ class _MenuCompositionsSection extends StatelessWidget { children: [ StreamContextMenuAction( label: const Text('Reply'), - leading: Icon(icons.arrowShareLeft), + leading: Icon(icons.reply20), ), StreamContextMenuAction( label: const Text('Copy Message'), - leading: Icon(icons.squareBehindSquare2Copy), + leading: Icon(icons.copy20), ), const StreamContextMenuSeparator(), StreamContextMenuAction.destructive( label: const Text('Delete'), - leading: Icon(icons.trashBin), + leading: Icon(icons.delete20), ), ], ), @@ -441,15 +441,15 @@ class _MenuCompositionsSection extends StatelessWidget { items: [ StreamContextMenuAction( label: const Text('Reply'), - leading: Icon(icons.arrowShareLeft), + leading: Icon(icons.reply20), ), StreamContextMenuAction( label: const Text('Copy Message'), - leading: Icon(icons.squareBehindSquare2Copy), + leading: Icon(icons.copy20), ), StreamContextMenuAction( label: const Text('Flag Message'), - leading: Icon(icons.flag2), + leading: Icon(icons.flag20), ), ], ), @@ -466,21 +466,21 @@ class _MenuCompositionsSection extends StatelessWidget { [ StreamContextMenuAction( label: const Text('Reply'), - leading: Icon(icons.arrowShareLeft), + leading: Icon(icons.reply20), ), StreamContextMenuAction( label: const Text('Copy Message'), - leading: Icon(icons.squareBehindSquare2Copy), + leading: Icon(icons.copy20), ), StreamContextMenuAction( label: const Text('Flag Message'), - leading: Icon(icons.flag2), + leading: Icon(icons.flag20), ), ], [ StreamContextMenuAction.destructive( label: const Text('Delete Message'), - leading: Icon(icons.trashBin), + leading: Icon(icons.delete20), ), ], ], @@ -497,19 +497,19 @@ class _MenuCompositionsSection extends StatelessWidget { items: [ StreamContextMenuAction( label: const Text('Reply'), - leading: Icon(icons.arrowShareLeft), + leading: Icon(icons.reply20), ), StreamContextMenuAction( label: const Text('Copy Message'), - leading: Icon(icons.squareBehindSquare2Copy), + leading: Icon(icons.copy20), ), StreamContextMenuAction( label: const Text('Flag Message'), - leading: Icon(icons.flag2), + leading: Icon(icons.flag20), ), StreamContextMenuAction.destructive( label: const Text('Delete Message'), - leading: Icon(icons.trashBin), + leading: Icon(icons.delete20), ), ], ), @@ -582,17 +582,17 @@ class _TypedValueReturnCardState extends State<_TypedValueReturnCard> { StreamContextMenuAction( value: 'reply', label: const Text('Reply'), - leading: Icon(icons.arrowShareLeft), + leading: Icon(icons.reply20), ), StreamContextMenuAction( value: 'copy', label: const Text('Copy Message'), - leading: Icon(icons.squareBehindSquare2Copy), + leading: Icon(icons.copy20), ), StreamContextMenuAction( value: 'flag', label: const Text('Flag Message'), - leading: Icon(icons.flag2), + leading: Icon(icons.flag20), ), ], ), @@ -648,23 +648,23 @@ class _EnumValueReturnCardState extends State<_EnumValueReturnCard> { StreamContextMenuAction<_SampleAction>( value: _SampleAction.reply, label: const Text('Reply'), - leading: Icon(icons.arrowShareLeft), + leading: Icon(icons.reply20), ), StreamContextMenuAction<_SampleAction>( value: _SampleAction.copy, label: const Text('Copy Message'), - leading: Icon(icons.squareBehindSquare2Copy), + leading: Icon(icons.copy20), ), StreamContextMenuAction<_SampleAction>( value: _SampleAction.flag, label: const Text('Flag Message'), - leading: Icon(icons.flag2), + leading: Icon(icons.flag20), ), const StreamContextMenuSeparator(), StreamContextMenuAction<_SampleAction>.destructive( value: _SampleAction.delete, label: const Text('Delete Message'), - leading: Icon(icons.trashBin), + leading: Icon(icons.delete20), ), ], ), @@ -720,15 +720,15 @@ class _CustomThemingSection extends StatelessWidget { children: [ StreamContextMenuAction( label: const Text('Reply'), - leading: Icon(icons.arrowShareLeft), + leading: Icon(icons.reply20), ), StreamContextMenuAction( label: const Text('Copy'), - leading: Icon(icons.squareBehindSquare2Copy), + leading: Icon(icons.copy20), ), StreamContextMenuAction( label: const Text('Flag'), - leading: Icon(icons.flag2), + leading: Icon(icons.flag20), ), ], ), @@ -754,16 +754,16 @@ class _CustomThemingSection extends StatelessWidget { ), child: StreamContextMenuAction( label: const Text('Reactions'), - leading: Icon(icons.chevronLeft), + leading: Icon(icons.chevronLeft20), ), ), StreamContextMenuAction( label: const Text('Love'), - leading: Icon(icons.heart2), + leading: Icon(icons.emoji20), ), StreamContextMenuAction( label: const Text('Smile'), - leading: Icon(icons.emojiSmile), + leading: Icon(icons.emoji20), ), ], ), @@ -799,44 +799,44 @@ class _RealWorldSection extends StatelessWidget { children: [ StreamContextMenuAction( label: const Text('Reply'), - leading: Icon(icons.arrowShareLeft), + leading: Icon(icons.reply20), ), StreamContextMenuAction( label: const Text('Thread Reply'), - leading: Icon(icons.bubbleText6ChatMessage), + leading: Icon(icons.thread20), ), StreamContextMenuAction( label: const Text('Pin to Conversation'), - leading: Icon(icons.pin), + leading: Icon(icons.pin20), ), StreamContextMenuAction( label: const Text('Copy Message'), - leading: Icon(icons.squareBehindSquare2Copy), + leading: Icon(icons.copy20), ), StreamContextMenuAction( label: const Text('Mark Unread'), - leading: Icon(icons.bubbleWideNotificationChatMessage), + leading: Icon(icons.notification20), ), StreamContextMenuAction( label: const Text('Remind Me'), - leading: Icon(icons.bellNotification), + leading: Icon(icons.bell20), ), StreamContextMenuAction( label: const Text('Save For Later'), - leading: Icon(icons.fileBend), + leading: Icon(icons.file20), ), StreamContextMenuAction( label: const Text('Flag Message'), - leading: Icon(icons.flag2), + leading: Icon(icons.flag20), ), StreamContextMenuAction( label: const Text('Mute User'), - leading: Icon(icons.mute), + leading: Icon(icons.mute20), ), const StreamContextMenuSeparator(), StreamContextMenuAction.destructive( label: const Text('Block User'), - leading: Icon(icons.circleBanSign), + leading: Icon(icons.noSign20), ), ], ), @@ -850,28 +850,28 @@ class _RealWorldSection extends StatelessWidget { children: [ StreamContextMenuAction( label: const Text('Reply'), - leading: Icon(icons.arrowShareLeft), + leading: Icon(icons.reply20), ), StreamContextMenuAction( label: const Text('Thread Reply'), - leading: Icon(icons.bubbleText6ChatMessage), + leading: Icon(icons.thread20), ), StreamContextMenuAction( label: const Text('Pin to Conversation'), - leading: Icon(icons.pin), + leading: Icon(icons.pin20), ), StreamContextMenuAction( label: const Text('Copy Message'), - leading: Icon(icons.squareBehindSquare2Copy), + leading: Icon(icons.copy20), ), StreamContextMenuAction( label: const Text('Edit Message'), - leading: Icon(icons.editBig), + leading: Icon(icons.edit20), ), const StreamContextMenuSeparator(), StreamContextMenuAction.destructive( label: const Text('Delete Message'), - leading: Icon(icons.trashBin), + leading: Icon(icons.delete20), ), ], ), diff --git a/apps/design_system_gallery/lib/components/message/stream_message_annotation.dart b/apps/design_system_gallery/lib/components/message/stream_message_annotation.dart index 57783bbd..f01b2c64 100644 --- a/apps/design_system_gallery/lib/components/message/stream_message_annotation.dart +++ b/apps/design_system_gallery/lib/components/message/stream_message_annotation.dart @@ -128,7 +128,7 @@ class _AnnotationTypesSection extends StatelessWidget { ), ), child: StreamMessageAnnotation( - leading: Icon(icons.bookmark), + leading: Icon(icons.save20), label: const Text('Saved for later'), ), ), @@ -136,7 +136,7 @@ class _AnnotationTypesSection extends StatelessWidget { _ExampleCard( label: 'Pinned', child: StreamMessageAnnotation( - leading: Icon(icons.pin), + leading: Icon(icons.pin20), label: const Text('Pinned by Alice'), ), ), @@ -144,7 +144,7 @@ class _AnnotationTypesSection extends StatelessWidget { label: 'Reminder (.rich)', subtitle: 'Bold label + regular timestamp via .rich constructor.', child: StreamMessageAnnotation.rich( - leading: Icon(icons.bellNotification), + leading: Icon(icons.bell20), label: 'Reminder set · ', spans: const [TextSpan(text: 'In 2 hours')], ), @@ -162,7 +162,7 @@ class _AnnotationTypesSection extends StatelessWidget { label: 'Also sent in channel (.rich)', subtitle: 'Bold label + link-colored span override.', child: StreamMessageAnnotation.rich( - leading: Icon(icons.arrowUp), + leading: Icon(icons.arrowUp20), label: 'Also sent in channel · ', spans: [ TextSpan( @@ -176,7 +176,7 @@ class _AnnotationTypesSection extends StatelessWidget { label: 'Replied to a thread (.rich)', subtitle: 'Bold label + link-colored span override.', child: StreamMessageAnnotation.rich( - leading: Icon(icons.arrowUp), + leading: Icon(icons.arrowUp20), label: 'Replied to a thread · ', spans: [ TextSpan( @@ -211,7 +211,7 @@ class _ThemeOverrideSection extends StatelessWidget { ), ), child: StreamMessageAnnotation( - leading: Icon(icons.bookmark), + leading: Icon(icons.save20), label: const Text('Saved for later'), ), ), @@ -226,7 +226,7 @@ class _ThemeOverrideSection extends StatelessWidget { ), ), child: StreamMessageAnnotation( - leading: Icon(icons.pin), + leading: Icon(icons.pin20), label: const Text('Pinned by Alice'), ), ), @@ -235,7 +235,7 @@ class _ThemeOverrideSection extends StatelessWidget { label: 'Custom spacing', subtitle: 'Wider gap (12px) between icon and label.', child: StreamMessageAnnotation( - leading: Icon(icons.bookmark), + leading: Icon(icons.save20), label: const Text('Saved for later'), style: StreamMessageAnnotationStyle.from(spacing: 12), ), @@ -276,7 +276,7 @@ class _RealWorldSection extends StatelessWidget { ), ), child: StreamMessageAnnotation( - leading: Icon(icons.bookmark), + leading: Icon(icons.save20), label: const Text('Saved for later'), ), ), @@ -293,7 +293,7 @@ class _RealWorldSection extends StatelessWidget { spacing: 4, children: [ StreamMessageAnnotation( - leading: Icon(icons.pin), + leading: Icon(icons.pin20), label: const Text('Pinned by Alice'), ), StreamMessageBubble( @@ -309,7 +309,7 @@ class _RealWorldSection extends StatelessWidget { spacing: 4, children: [ StreamMessageAnnotation.rich( - leading: Icon(icons.bellNotification), + leading: Icon(icons.bell20), label: 'Reminder set · ', spans: const [TextSpan(text: 'In 30 minutes')], ), @@ -326,7 +326,7 @@ class _RealWorldSection extends StatelessWidget { spacing: 4, children: [ StreamMessageAnnotation.rich( - leading: Icon(icons.arrowUp), + leading: Icon(icons.arrowUp20), label: 'Also sent in channel · ', spans: [ TextSpan( @@ -363,10 +363,10 @@ enum _IconOption { final String label; IconData resolve(StreamIcons icons) => switch (this) { - bookmark => icons.bookmark, - pin => icons.pin, - bellNotification => icons.bellNotification, - arrowUp => icons.arrowUp, + bookmark => icons.save20, + pin => icons.pin20, + bellNotification => icons.bell20, + arrowUp => icons.arrowUp20, translate => Icons.translate, }; } diff --git a/apps/design_system_gallery/lib/components/message/stream_message_content.dart b/apps/design_system_gallery/lib/components/message/stream_message_content.dart index 4f32b442..a5f060d9 100644 --- a/apps/design_system_gallery/lib/components/message/stream_message_content.dart +++ b/apps/design_system_gallery/lib/components/message/stream_message_content.dart @@ -148,7 +148,7 @@ Widget buildStreamMessageContentPlayground(BuildContext context) { child: StreamMessageContent( header: showHeader ? StreamMessageAnnotation( - leading: const Icon(StreamIconData.iconBellNotification), + leading: const Icon(StreamIconData.bell20), label: Text.rich( TextSpan( children: [ @@ -166,7 +166,7 @@ Widget buildStreamMessageContentPlayground(BuildContext context) { ? StreamMessageMetadata( timestamp: const Text('09:41'), username: const Text('Alice'), - status: const Icon(StreamIconData.iconDoupleCheckmark1Small), + status: const Icon(StreamIconData.checks12), edited: const Text('Edited'), ) : null, @@ -259,7 +259,7 @@ class _SlotCombinationsSection extends StatelessWidget { label: 'Header + child + footer', child: StreamMessageContent( header: StreamMessageAnnotation( - leading: const Icon(StreamIconData.iconBellNotification), + leading: const Icon(StreamIconData.bell20), label: Text.rich( TextSpan( children: [ @@ -275,7 +275,7 @@ class _SlotCombinationsSection extends StatelessWidget { footer: StreamMessageMetadata( timestamp: const Text('09:41'), username: const Text('Alice'), - status: const Icon(StreamIconData.iconDoupleCheckmark1Small), + status: const Icon(StreamIconData.checks12), ), child: StreamMessageBubble( child: StreamMessageText('Has anyone tried the new Flutter update?'), @@ -287,7 +287,7 @@ class _SlotCombinationsSection extends StatelessWidget { child: StreamMessageContent( footer: StreamMessageMetadata( timestamp: const Text('09:42'), - status: const Icon(StreamIconData.iconDoupleCheckmark1Small), + status: const Icon(StreamIconData.checks12), edited: const Text('Edited'), ), child: StreamMessageBubble( @@ -299,7 +299,7 @@ class _SlotCombinationsSection extends StatelessWidget { label: 'Header + child (no footer)', child: StreamMessageContent( header: StreamMessageAnnotation( - leading: const Icon(StreamIconData.iconBookmark), + leading: const Icon(StreamIconData.save20), label: const Text('Saved for later'), ), child: StreamMessageBubble( @@ -453,11 +453,11 @@ class _FullCompositionSection extends StatelessWidget { mainAxisSize: MainAxisSize.min, children: [ StreamMessageAnnotation( - leading: const Icon(StreamIconData.iconPin), + leading: const Icon(StreamIconData.pin20), label: const Text('Pinned'), ), StreamMessageAnnotation( - leading: const Icon(StreamIconData.iconBellNotification), + leading: const Icon(StreamIconData.bell20), label: Text.rich( TextSpan( children: [ @@ -475,7 +475,7 @@ class _FullCompositionSection extends StatelessWidget { footer: StreamMessageMetadata( timestamp: const Text('09:41'), username: const Text('Alice'), - status: const Icon(StreamIconData.iconDoupleCheckmark1Small), + status: const Icon(StreamIconData.checks12), edited: const Text('Edited'), ), child: StreamReactions.segmented( @@ -514,7 +514,7 @@ class _FullCompositionSection extends StatelessWidget { child: StreamMessageContent( footer: StreamMessageMetadata( timestamp: const Text('09:42'), - status: const Icon(StreamIconData.iconDoupleCheckmark1Small), + status: const Icon(StreamIconData.checks12), ), child: StreamReactions.segmented( alignment: .end, @@ -617,7 +617,7 @@ class _EmojiOnlySection extends StatelessWidget { child: StreamMessageContent( footer: StreamMessageMetadata( timestamp: const Text('09:51'), - status: const Icon(StreamIconData.iconDoupleCheckmark1Small), + status: const Icon(StreamIconData.checks12), ), child: StreamReactions.segmented( alignment: .end, diff --git a/apps/design_system_gallery/lib/components/message/stream_message_metadata.dart b/apps/design_system_gallery/lib/components/message/stream_message_metadata.dart index dbe51e64..5ec33fe8 100644 --- a/apps/design_system_gallery/lib/components/message/stream_message_metadata.dart +++ b/apps/design_system_gallery/lib/components/message/stream_message_metadata.dart @@ -156,7 +156,7 @@ class _SlotCombinationsSection extends StatelessWidget { label: 'Timestamp + status', child: StreamMessageMetadata( timestamp: const Text('09:41'), - status: const Icon(StreamIconData.iconDoupleCheckmark1Small), + status: const Icon(StreamIconData.checks12), ), ), _ExampleCard( @@ -170,7 +170,7 @@ class _SlotCombinationsSection extends StatelessWidget { label: 'All slots', child: StreamMessageMetadata( timestamp: const Text('09:41'), - status: const Icon(StreamIconData.iconDoupleCheckmark1Small), + status: const Icon(StreamIconData.checks12), username: const Text('Alice'), edited: const Text('Edited'), ), @@ -194,7 +194,7 @@ class _DeliveryStatusSection extends StatelessWidget { subtitle: 'Clock icon while message is in transit.', child: StreamMessageMetadata( timestamp: const Text('09:41'), - status: const Icon(StreamIconData.iconClock), + status: const Icon(StreamIconData.clock12), ), ), _ExampleCard( @@ -202,7 +202,7 @@ class _DeliveryStatusSection extends StatelessWidget { subtitle: 'Single checkmark after server acknowledgement.', child: StreamMessageMetadata( timestamp: const Text('09:41'), - status: const Icon(StreamIconData.iconCheckmark1Small), + status: const Icon(StreamIconData.checkmark12), ), ), _ExampleCard( @@ -210,7 +210,7 @@ class _DeliveryStatusSection extends StatelessWidget { subtitle: 'Double checkmark when received by recipient.', child: StreamMessageMetadata( timestamp: const Text('09:41'), - status: const Icon(StreamIconData.iconDoupleCheckmark1Small), + status: const Icon(StreamIconData.checks12), ), ), _ExampleCard( @@ -222,7 +222,7 @@ class _DeliveryStatusSection extends StatelessWidget { ), child: StreamMessageMetadata( timestamp: const Text('09:41'), - status: const Icon(StreamIconData.iconDoupleCheckmark1Small), + status: const Icon(StreamIconData.checks12), ), ), ), @@ -290,7 +290,7 @@ class _RealWorldSection extends StatelessWidget { ), StreamMessageMetadata( timestamp: const Text('09:42'), - status: const Icon(StreamIconData.iconClock), + status: const Icon(StreamIconData.clock12), ), ], ), @@ -320,7 +320,7 @@ class _RealWorldSection extends StatelessWidget { ), child: StreamMessageMetadata( timestamp: const Text('09:40'), - status: const Icon(StreamIconData.iconDoupleCheckmark1Small), + status: const Icon(StreamIconData.checks12), ), ), ], @@ -351,7 +351,7 @@ class _RealWorldSection extends StatelessWidget { ), child: StreamMessageMetadata( timestamp: const Text('09:40'), - status: const Icon(StreamIconData.iconDoupleCheckmark1Small), + status: const Icon(StreamIconData.checks12), edited: const Text('Edited'), ), ), @@ -392,7 +392,7 @@ class _ThemeOverrideSection extends StatelessWidget { child: StreamMessageMetadata( timestamp: const Text('09:41'), username: const Text('Alice'), - status: const Icon(StreamIconData.iconCheckmark1Small), + status: const Icon(StreamIconData.checkmark12), edited: const Text('Edited'), style: StreamMessageMetadataStyle.from(spacing: 16), ), @@ -540,10 +540,10 @@ class _ExampleCard extends StatelessWidget { // ============================================================================= enum _StatusOption { - sending('Sending', StreamIconData.iconClock), - sent('Sent', StreamIconData.iconCheckmark1Small), - delivered('Delivered', StreamIconData.iconDoupleCheckmark1Small), - read('Read', StreamIconData.iconDoupleCheckmark1Small) + sending('Sending', StreamIconData.clock12), + sent('Sent', StreamIconData.checkmark12), + delivered('Delivered', StreamIconData.checks12), + read('Read', StreamIconData.checks12) ; const _StatusOption(this.label, this.iconData); diff --git a/apps/design_system_gallery/lib/components/message/stream_message_text.dart b/apps/design_system_gallery/lib/components/message/stream_message_text.dart index 64b9fc96..0018b1d9 100644 --- a/apps/design_system_gallery/lib/components/message/stream_message_text.dart +++ b/apps/design_system_gallery/lib/components/message/stream_message_text.dart @@ -591,7 +591,7 @@ class _RealWorldSection extends StatelessWidget { subtitle: 'Annotation, bubble, metadata, and reply indicator.', child: StreamMessageContent( header: StreamMessageAnnotation( - leading: Icon(context.streamIcons.pin), + leading: Icon(context.streamIcons.pin20), label: const Text('Pinned by Alice'), ), footer: Column( diff --git a/apps/design_system_gallery/lib/primitives/icons.dart b/apps/design_system_gallery/lib/primitives/icons.dart index 3ec297ef..9f0fa2af 100644 --- a/apps/design_system_gallery/lib/primitives/icons.dart +++ b/apps/design_system_gallery/lib/primitives/icons.dart @@ -162,7 +162,7 @@ class _SearchBar extends StatelessWidget { prefixIcon: Padding( padding: EdgeInsets.only(left: spacing.md, right: spacing.sm), child: Icon( - icons.magnifyingGlassSearch, + icons.search20, size: 20, color: colorScheme.textTertiary, ), @@ -172,8 +172,8 @@ class _SearchBar extends StatelessWidget { ? IconButton( onPressed: onClear, icon: Icon( - icons.crossSmall, - size: 18, + icons.xmark16, + size: 16, color: colorScheme.textTertiary, ), ) @@ -272,7 +272,7 @@ class _IconCard extends StatelessWidget { ), child: Icon( icon, - size: 24, + size: 20, color: colorScheme.textPrimary, ), ), diff --git a/packages/stream_core_flutter/assets_source/icon_log.g.txt b/packages/stream_core_flutter/assets_source/icon_log.g.txt new file mode 100644 index 00000000..ab144efb --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icon_log.g.txt @@ -0,0 +1,357 @@ +## Log of icon set so we can preserve the order of icon font codePoints ## +trophy-32;2026331 +voice-20;2026331 +xmark-16;2026331 +pause-fill-12;2026331 +checkmark-20;2026331 +search-32;2026331 +refresh-32;2026331 +chevron-right-32;2026331 +sidebar-32;2026331 +reply-32;2026331 +send-32;2026331 +audio-32;2026331 +folder-32;2026331 +video-fill-32;2026331 +unpin-32;2026331 +user-check-32;2026331 +lock-32;2026331 +attachment-32;2026331 +leave-32;2026331 +no-sign-32;2026331 +arrow-down-circle-32;2026331 +mention-32;2026331 +image-32;2026331 +unsave-32;2026331 +camera-32;2026331 +edit-32;2026331 +message-bubble-32;2026331 +arrow-right-32;2026331 +voice-fill-32;2026331 +edit-12;2026331 +play-fill-32;2026331 +thread-32;2026331 +clock-32;2026331 +message-bubble-fill-32;2026331 +xmark-32;2026331 +unsave-12;2026331 +plus-32;2026331 +bell-off-32;2026331 +share-32;2026331 +archive-32;2026331 +thread-fill-32;2026331 +voice-32;2026331 +message-bubble-12;2026331 +notification-32;2026331 +info-32;2026331 +export-32;2026331 +account-32;2026331 +download-32;2026331 +upload-32;2026331 +copy-32;2026331 +gallery-32;2026331 +emoji-add-32;2026331 +pin-32;2026331 +minus-32;2026331 +emoji-32;2026331 +command-32;2026331 +chevron-up-32;2026331 +arrow-up-right-32;2026331 +file-32;2026331 +stop-fill-32;2026331 +quote-32;2026331 +arrow-up-32;2026331 +x-circle-32;2026331 +arrow-right-12;2026331 +checks-32;2026331 +pause-fill-32;2026331 +message-bubbles-32;2026331 +save-32;2026331 +user-remove-32;2026331 +user-add-32;2026331 +more-32;2026331 +link-32;2026331 +bell-32;2026331 +retry-32;2026331 +bolt-32;2026331 +users-32;2026331 +unlock-32;2026331 +flag-32;2026331 +translate-32;2026331 +arrow-down-32;2026331 +exclamation-circle-32;2026331 +chevron-down-32;2026331 +video-32;2026331 +arrow-left-32;2026331 +delete-32;2026331 +poll-32;2026331 +chevron-left-32;2026331 +checkmark-32;2026331 +eye-fill-32;2026331 +minus-circle-32;2026331 +mute-32;2026331 +exclamation-circle-fill-32;2026331 +reorder-32;2026331 +user-32;2026331 +location-32;2026331 +exclamation-triangle-fill-32;2026331 +leave-20;2026331 +no-sign-20;2026331 +arrow-down-circle-20;2026331 +mention-20;2026331 +image-20;2026331 +camera-20;2026331 +edit-20;2026331 +unsave-20;2026331 +message-bubble-20;2026331 +arrow-right-20;2026331 +thread-20;2026331 +voice-fill-20;2026331 +voice-fill-12;2026331 +play-fill-12;2026331 +play-fill-20;2026331 +clock-20;2026331 +exclamation-mark-fill-20;2026331 +search-20;2026331 +refresh-20;2026331 +chevron-right-20;2026331 +reply-20;2026331 +sidebar-20;2026331 +send-20;2026331 +audio-20;2026331 +video-fill-20;2026331 +folder-20;2026331 +unpin-20;2026331 +user-check-20;2026331 +lock-20;2026331 +attachment-20;2026331 +thread-fill-20;2026331 +exclamation-mark-fill-32;2026331 +notification-20;2026331 +info-20;2026331 +export-20;2026331 +account-20;2026331 +download-20;2026331 +upload-20;2026331 +copy-20;2026331 +pin-20;2026331 +emoji-add-20;2026331 +gallery-20;2026331 +minus-20;2026331 +message-bubble-fill-20;2026331 +xmark-20;2026331 +thread-12;2026331 +bell-off-20;2026331 +plus-20;2026331 +share-20;2026331 +archive-20;2026331 +user-add-20;2026331 +user-remove-20;2026331 +more-20;2026331 +link-20;2026331 +bell-20;2026331 +retry-20;2026331 +bolt-20;2026331 +users-20;2026331 +unlock-20;2026331 +flag-20;2026331 +translate-20;2026331 +emoji-20;2026331 +chevron-up-20;2026331 +command-20;2026331 +arrow-up-right-20;2026331 +file-20;2026331 +arrow-up-20;2026331 +quote-20;2026331 +stop-fill-20;2026331 +x-circle-20;2026331 +clock-12;2026331 +pause-fill-20;2026331 +checks-20;2026331 +message-bubbles-20;2026331 +trophy-20;2026331 +save-20;2026331 +eye-fill-20;2026331 +minus-circle-20;2026331 +mute-20;2026331 +exclamation-circle-fill-20;2026331 +reorder-20;2026331 +user-20;2026331 +location-20;2026331 +exclamation-triangle-fill-20;2026331 +arrow-down-20;2026331 +exclamation-circle-20;2026331 +chevron-down-20;2026331 +video-20;2026331 +arrow-left-20;2026331 +delete-20;2026331 +poll-20;2026331 +chevron-left-20;2026331 +user-16;2026331 +location-16;2026331 +exclamation-triangle-fill-16;2026331 +eye-fill-16;2026331 +minus-circle-16;2026331 +mute-16;2026331 +exclamation-circle-fill-16;2026331 +reorder-16;2026331 +arrow-left-16;2026331 +delete-16;2026331 +poll-16;2026331 +chevron-left-16;2026331 +checkmark-16;2026331 +arrow-down-16;2026331 +exclamation-circle-16;2026331 +chevron-down-16;2026331 +video-16;2026331 +bolt-16;2026331 +users-16;2026331 +unlock-16;2026331 +flag-16;2026331 +translate-16;2026331 +user-add-16;2026331 +user-remove-16;2026331 +more-16;2026331 +link-16;2026331 +bell-16;2026331 +retry-16;2026331 +x-circle-16;2026331 +leave-12;2026331 +pause-fill-16;2026331 +checks-16;2026331 +message-bubbles-16;2026331 +trophy-16;2026331 +save-16;2026331 +emoji-16;2026331 +chevron-up-16;2026331 +command-16;2026331 +arrow-up-right-16;2026331 +file-16;2026331 +arrow-up-16;2026331 +quote-16;2026331 +stop-fill-16;2026331 +export-16;2026331 +account-16;2026331 +download-16;2026331 +upload-16;2026331 +copy-16;2026331 +pin-16;2026331 +emoji-add-16;2026331 +gallery-16;2026331 +minus-16;2026331 +thread-fill-16;2026331 +voice-16;2026331 +notification-16;2026331 +info-16;2026331 +share-16;2026331 +archive-16;2026331 +message-bubble-fill-16;2026331 +camera-12;2026331 +bell-off-16;2026331 +plus-16;2026331 +camera-16;2026331 +edit-16;2026331 +unsave-16;2026331 +message-bubble-16;2026331 +arrow-right-16;2026331 +thread-16;2026331 +voice-fill-16;2026331 +no-sign-12;2026331 +play-fill-16;2026331 +clock-16;2026331 +leave-16;2026331 +no-sign-16;2026331 +arrow-down-circle-16;2026331 +mention-16;2026331 +image-16;2026331 +audio-16;2026331 +video-fill-16;2026331 +folder-16;2026331 +unpin-16;2026331 +user-check-16;2026331 +lock-16;2026331 +attachment-16;2026331 +exclamation-mark-fill-16;2026331 +search-16;2026331 +refresh-16;2026331 +chevron-right-16;2026331 +reply-16;2026331 +sidebar-16;2026331 +send-16;2026331 +video-12;2026331 +chevron-down-12;2026331 +exclamation-circle-12;2026331 +arrow-down-12;2026331 +checkmark-12;2026331 +chevron-left-12;2026331 +poll-12;2026331 +delete-12;2026331 +arrow-left-12;2026331 +reorder-12;2026331 +exclamation-circle-fill-12;2026331 +mute-12;2026331 +minus-circle-12;2026331 +eye-fill-12;2026331 +exclamation-triangle-fill-12;2026331 +location-12;2026331 +user-12;2026331 +stop-fill-12;2026331 +arrow-up-12;2026331 +quote-12;2026331 +file-12;2026331 +arrow-up-right-12;2026331 +command-12;2026331 +chevron-up-12;2026331 +emoji-12;2026331 +save-12;2026331 +trophy-12;2026331 +message-bubbles-12;2026331 +checks-12;2026331 +arrow-down-circle-12;2026331 +x-circle-12;2026331 +mention-12;2026331 +retry-12;2026331 +bell-12;2026331 +link-12;2026331 +more-12;2026331 +user-add-12;2026331 +user-remove-12;2026331 +translate-12;2026331 +flag-12;2026331 +unlock-12;2026331 +users-12;2026331 +bolt-12;2026331 +plus-12;2026331 +bell-off-12;2026331 +xmark-12;2026331 +image-12;2026331 +message-bubble-fill-12;2026331 +archive-12;2026331 +share-12;2026331 +info-12;2026331 +notification-12;2026331 +voice-12;2026331 +thread-fill-12;2026331 +minus-12;2026331 +gallery-12;2026331 +emoji-add-12;2026331 +pin-12;2026331 +copy-12;2026331 +upload-12;2026331 +download-12;2026331 +account-12;2026331 +export-12;2026331 +send-12;2026331 +reply-12;2026331 +sidebar-12;2026331 +chevron-right-12;2026331 +refresh-12;2026331 +search-12;2026331 +exclamation-mark-fill-12;2026331 +attachment-12;2026331 +lock-12;2026331 +user-check-12;2026331 +unpin-12;2026331 +video-fill-12;2026331 +folder-12;2026331 +audio-12;2026331 diff --git a/packages/stream_core_flutter/assets_source/icons/12/account-12.svg b/packages/stream_core_flutter/assets_source/icons/12/account-12.svg new file mode 100644 index 00000000..309e15ff --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/account-12.svg @@ -0,0 +1,10 @@ + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/archive-12.svg b/packages/stream_core_flutter/assets_source/icons/12/archive-12.svg new file mode 100644 index 00000000..ab7f60d7 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/archive-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/arrow-down-12.svg b/packages/stream_core_flutter/assets_source/icons/12/arrow-down-12.svg new file mode 100644 index 00000000..d8654bef --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/arrow-down-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/arrow-down-circle-12.svg b/packages/stream_core_flutter/assets_source/icons/12/arrow-down-circle-12.svg new file mode 100644 index 00000000..260556b7 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/arrow-down-circle-12.svg @@ -0,0 +1,10 @@ + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/arrow-left-12.svg b/packages/stream_core_flutter/assets_source/icons/12/arrow-left-12.svg new file mode 100644 index 00000000..8de97a86 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/arrow-left-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/arrow-right-12.svg b/packages/stream_core_flutter/assets_source/icons/12/arrow-right-12.svg new file mode 100644 index 00000000..8190bcae --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/arrow-right-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/arrow-up-12.svg b/packages/stream_core_flutter/assets_source/icons/12/arrow-up-12.svg new file mode 100644 index 00000000..0e0ee0a6 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/arrow-up-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/arrow-up-right-12.svg b/packages/stream_core_flutter/assets_source/icons/12/arrow-up-right-12.svg new file mode 100644 index 00000000..1076164a --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/arrow-up-right-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/attachment-12.svg b/packages/stream_core_flutter/assets_source/icons/12/attachment-12.svg new file mode 100644 index 00000000..6a74f98f --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/attachment-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/audio-12.svg b/packages/stream_core_flutter/assets_source/icons/12/audio-12.svg new file mode 100644 index 00000000..8be73308 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/audio-12.svg @@ -0,0 +1,10 @@ + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/bell-12.svg b/packages/stream_core_flutter/assets_source/icons/12/bell-12.svg new file mode 100644 index 00000000..62b2d469 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/bell-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/bell-off-12.svg b/packages/stream_core_flutter/assets_source/icons/12/bell-off-12.svg new file mode 100644 index 00000000..45bf4f3b --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/bell-off-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/bolt-12.svg b/packages/stream_core_flutter/assets_source/icons/12/bolt-12.svg new file mode 100644 index 00000000..b4f91a0e --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/bolt-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/camera-12.svg b/packages/stream_core_flutter/assets_source/icons/12/camera-12.svg new file mode 100644 index 00000000..ac3cdd9e --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/camera-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/checkmark-12.svg b/packages/stream_core_flutter/assets_source/icons/12/checkmark-12.svg new file mode 100644 index 00000000..7b349c16 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/checkmark-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/checks-12.svg b/packages/stream_core_flutter/assets_source/icons/12/checks-12.svg new file mode 100644 index 00000000..1b07c91d --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/checks-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/chevron-down-12.svg b/packages/stream_core_flutter/assets_source/icons/12/chevron-down-12.svg new file mode 100644 index 00000000..2e2652d0 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/chevron-down-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/chevron-left-12.svg b/packages/stream_core_flutter/assets_source/icons/12/chevron-left-12.svg new file mode 100644 index 00000000..04349fbe --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/chevron-left-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/chevron-right-12.svg b/packages/stream_core_flutter/assets_source/icons/12/chevron-right-12.svg new file mode 100644 index 00000000..41620eda --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/chevron-right-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/chevron-up-12.svg b/packages/stream_core_flutter/assets_source/icons/12/chevron-up-12.svg new file mode 100644 index 00000000..9a3b0976 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/chevron-up-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/clock-12.svg b/packages/stream_core_flutter/assets_source/icons/12/clock-12.svg new file mode 100644 index 00000000..0930f390 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/clock-12.svg @@ -0,0 +1,10 @@ + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/command-12.svg b/packages/stream_core_flutter/assets_source/icons/12/command-12.svg new file mode 100644 index 00000000..d8bc7e53 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/command-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/copy-12.svg b/packages/stream_core_flutter/assets_source/icons/12/copy-12.svg new file mode 100644 index 00000000..35a34ea0 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/copy-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/delete-12.svg b/packages/stream_core_flutter/assets_source/icons/12/delete-12.svg new file mode 100644 index 00000000..52a71f4e --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/delete-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/download-12.svg b/packages/stream_core_flutter/assets_source/icons/12/download-12.svg new file mode 100644 index 00000000..944fca81 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/download-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/edit-12.svg b/packages/stream_core_flutter/assets_source/icons/12/edit-12.svg new file mode 100644 index 00000000..f3523676 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/edit-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/emoji-12.svg b/packages/stream_core_flutter/assets_source/icons/12/emoji-12.svg new file mode 100644 index 00000000..a3a87da2 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/emoji-12.svg @@ -0,0 +1,13 @@ + + + + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/emoji-add-12.svg b/packages/stream_core_flutter/assets_source/icons/12/emoji-add-12.svg new file mode 100644 index 00000000..3c498ba6 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/emoji-add-12.svg @@ -0,0 +1,14 @@ + + + + + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/exclamation-circle-12.svg b/packages/stream_core_flutter/assets_source/icons/12/exclamation-circle-12.svg new file mode 100644 index 00000000..67416589 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/exclamation-circle-12.svg @@ -0,0 +1,12 @@ + + + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/exclamation-circle-fill-12.svg b/packages/stream_core_flutter/assets_source/icons/12/exclamation-circle-fill-12.svg new file mode 100644 index 00000000..dc17ba45 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/exclamation-circle-fill-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/exclamation-mark-fill-12.svg b/packages/stream_core_flutter/assets_source/icons/12/exclamation-mark-fill-12.svg new file mode 100644 index 00000000..620719e4 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/exclamation-mark-fill-12.svg @@ -0,0 +1,4 @@ + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/exclamation-triangle-fill-12.svg b/packages/stream_core_flutter/assets_source/icons/12/exclamation-triangle-fill-12.svg new file mode 100644 index 00000000..95c1a5e9 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/exclamation-triangle-fill-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/export-12.svg b/packages/stream_core_flutter/assets_source/icons/12/export-12.svg new file mode 100644 index 00000000..b37a519b --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/export-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/eye-fill-12.svg b/packages/stream_core_flutter/assets_source/icons/12/eye-fill-12.svg new file mode 100644 index 00000000..0a739c94 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/eye-fill-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/file-12.svg b/packages/stream_core_flutter/assets_source/icons/12/file-12.svg new file mode 100644 index 00000000..3fb51d05 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/file-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/flag-12.svg b/packages/stream_core_flutter/assets_source/icons/12/flag-12.svg new file mode 100644 index 00000000..e248643f --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/flag-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/folder-12.svg b/packages/stream_core_flutter/assets_source/icons/12/folder-12.svg new file mode 100644 index 00000000..5e994ad9 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/folder-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/gallery-12.svg b/packages/stream_core_flutter/assets_source/icons/12/gallery-12.svg new file mode 100644 index 00000000..c4418844 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/gallery-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/giphy-12.svg b/packages/stream_core_flutter/assets_source/icons/12/giphy-12.svg new file mode 100644 index 00000000..1e5821c0 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/giphy-12.svg @@ -0,0 +1,11 @@ + + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/image-12.svg b/packages/stream_core_flutter/assets_source/icons/12/image-12.svg new file mode 100644 index 00000000..ef1ef85c --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/image-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/imgur-12.svg b/packages/stream_core_flutter/assets_source/icons/12/imgur-12.svg new file mode 100644 index 00000000..a2b8cb31 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/imgur-12.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/info-12.svg b/packages/stream_core_flutter/assets_source/icons/12/info-12.svg new file mode 100644 index 00000000..aec75576 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/info-12.svg @@ -0,0 +1,12 @@ + + + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/leave-12.svg b/packages/stream_core_flutter/assets_source/icons/12/leave-12.svg new file mode 100644 index 00000000..c2a2699f --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/leave-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/link-12.svg b/packages/stream_core_flutter/assets_source/icons/12/link-12.svg new file mode 100644 index 00000000..ec4b3d48 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/link-12.svg @@ -0,0 +1,10 @@ + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/loading-12.svg b/packages/stream_core_flutter/assets_source/icons/12/loading-12.svg new file mode 100644 index 00000000..a6af339b --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/loading-12.svg @@ -0,0 +1,11 @@ + + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/location-12.svg b/packages/stream_core_flutter/assets_source/icons/12/location-12.svg new file mode 100644 index 00000000..2a4929a6 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/location-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/lock-12.svg b/packages/stream_core_flutter/assets_source/icons/12/lock-12.svg new file mode 100644 index 00000000..e3babc9b --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/lock-12.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/mention-12.svg b/packages/stream_core_flutter/assets_source/icons/12/mention-12.svg new file mode 100644 index 00000000..77f3cd88 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/mention-12.svg @@ -0,0 +1,10 @@ + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/message-bubble-12.svg b/packages/stream_core_flutter/assets_source/icons/12/message-bubble-12.svg new file mode 100644 index 00000000..b441b5e4 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/message-bubble-12.svg @@ -0,0 +1,10 @@ + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/message-bubble-fill-12.svg b/packages/stream_core_flutter/assets_source/icons/12/message-bubble-fill-12.svg new file mode 100644 index 00000000..c1a974cf --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/message-bubble-fill-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/message-bubbles-12.svg b/packages/stream_core_flutter/assets_source/icons/12/message-bubbles-12.svg new file mode 100644 index 00000000..920e276b --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/message-bubbles-12.svg @@ -0,0 +1,10 @@ + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/minus-12.svg b/packages/stream_core_flutter/assets_source/icons/12/minus-12.svg new file mode 100644 index 00000000..c52f8a6c --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/minus-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/minus-circle-12.svg b/packages/stream_core_flutter/assets_source/icons/12/minus-circle-12.svg new file mode 100644 index 00000000..e950eb02 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/minus-circle-12.svg @@ -0,0 +1,10 @@ + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/more-12.svg b/packages/stream_core_flutter/assets_source/icons/12/more-12.svg new file mode 100644 index 00000000..888a715f --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/more-12.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/mute-12.svg b/packages/stream_core_flutter/assets_source/icons/12/mute-12.svg new file mode 100644 index 00000000..054b911f --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/mute-12.svg @@ -0,0 +1,10 @@ + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/no-sign-12.svg b/packages/stream_core_flutter/assets_source/icons/12/no-sign-12.svg new file mode 100644 index 00000000..9862b82b --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/no-sign-12.svg @@ -0,0 +1,10 @@ + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/notification-12.svg b/packages/stream_core_flutter/assets_source/icons/12/notification-12.svg new file mode 100644 index 00000000..02d3ea76 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/notification-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/pause-fill-12.svg b/packages/stream_core_flutter/assets_source/icons/12/pause-fill-12.svg new file mode 100644 index 00000000..f04c92a4 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/pause-fill-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/pin-12.svg b/packages/stream_core_flutter/assets_source/icons/12/pin-12.svg new file mode 100644 index 00000000..250c03c3 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/pin-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/play-fill-12.svg b/packages/stream_core_flutter/assets_source/icons/12/play-fill-12.svg new file mode 100644 index 00000000..346ba668 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/play-fill-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/plus-12.svg b/packages/stream_core_flutter/assets_source/icons/12/plus-12.svg new file mode 100644 index 00000000..506fe338 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/plus-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/poll-12.svg b/packages/stream_core_flutter/assets_source/icons/12/poll-12.svg new file mode 100644 index 00000000..de189e4b --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/poll-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/quote-12.svg b/packages/stream_core_flutter/assets_source/icons/12/quote-12.svg new file mode 100644 index 00000000..4157b140 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/quote-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/refresh-12.svg b/packages/stream_core_flutter/assets_source/icons/12/refresh-12.svg new file mode 100644 index 00000000..697aeb56 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/refresh-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/reorder-12.svg b/packages/stream_core_flutter/assets_source/icons/12/reorder-12.svg new file mode 100644 index 00000000..bd487173 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/reorder-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/reply-12.svg b/packages/stream_core_flutter/assets_source/icons/12/reply-12.svg new file mode 100644 index 00000000..d63c51bb --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/reply-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/retry-12.svg b/packages/stream_core_flutter/assets_source/icons/12/retry-12.svg new file mode 100644 index 00000000..3a3be232 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/retry-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/save-12.svg b/packages/stream_core_flutter/assets_source/icons/12/save-12.svg new file mode 100644 index 00000000..6c64184f --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/save-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/search-12.svg b/packages/stream_core_flutter/assets_source/icons/12/search-12.svg new file mode 100644 index 00000000..043cecb4 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/search-12.svg @@ -0,0 +1,10 @@ + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/send-12.svg b/packages/stream_core_flutter/assets_source/icons/12/send-12.svg new file mode 100644 index 00000000..584d1e29 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/send-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/share-12.svg b/packages/stream_core_flutter/assets_source/icons/12/share-12.svg new file mode 100644 index 00000000..1fcb8eb4 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/share-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/sidebar-12.svg b/packages/stream_core_flutter/assets_source/icons/12/sidebar-12.svg new file mode 100644 index 00000000..61a53feb --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/sidebar-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/stop-fill-12.svg b/packages/stream_core_flutter/assets_source/icons/12/stop-fill-12.svg new file mode 100644 index 00000000..29d779de --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/stop-fill-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/thread-12.svg b/packages/stream_core_flutter/assets_source/icons/12/thread-12.svg new file mode 100644 index 00000000..e73223fd --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/thread-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/thread-fill-12.svg b/packages/stream_core_flutter/assets_source/icons/12/thread-fill-12.svg new file mode 100644 index 00000000..a62d6396 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/thread-fill-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/translate-12.svg b/packages/stream_core_flutter/assets_source/icons/12/translate-12.svg new file mode 100644 index 00000000..ddde99d5 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/translate-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/trophy-12.svg b/packages/stream_core_flutter/assets_source/icons/12/trophy-12.svg new file mode 100644 index 00000000..8d43117c --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/trophy-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/unlock-12.svg b/packages/stream_core_flutter/assets_source/icons/12/unlock-12.svg new file mode 100644 index 00000000..c954d4ab --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/unlock-12.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/unpin-12.svg b/packages/stream_core_flutter/assets_source/icons/12/unpin-12.svg new file mode 100644 index 00000000..e4416d97 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/unpin-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/unsave-12.svg b/packages/stream_core_flutter/assets_source/icons/12/unsave-12.svg new file mode 100644 index 00000000..adc90755 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/unsave-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/upload-12.svg b/packages/stream_core_flutter/assets_source/icons/12/upload-12.svg new file mode 100644 index 00000000..f225eb59 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/upload-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/user-12.svg b/packages/stream_core_flutter/assets_source/icons/12/user-12.svg new file mode 100644 index 00000000..d827d141 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/user-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/user-add-12.svg b/packages/stream_core_flutter/assets_source/icons/12/user-add-12.svg new file mode 100644 index 00000000..ac8d2612 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/user-add-12.svg @@ -0,0 +1,10 @@ + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/user-check-12.svg b/packages/stream_core_flutter/assets_source/icons/12/user-check-12.svg new file mode 100644 index 00000000..34354497 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/user-check-12.svg @@ -0,0 +1,10 @@ + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/user-remove-12.svg b/packages/stream_core_flutter/assets_source/icons/12/user-remove-12.svg new file mode 100644 index 00000000..a26d0829 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/user-remove-12.svg @@ -0,0 +1,10 @@ + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/users-12.svg b/packages/stream_core_flutter/assets_source/icons/12/users-12.svg new file mode 100644 index 00000000..37281fa2 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/users-12.svg @@ -0,0 +1,10 @@ + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/video-12.svg b/packages/stream_core_flutter/assets_source/icons/12/video-12.svg new file mode 100644 index 00000000..f3ad0f1b --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/video-12.svg @@ -0,0 +1,10 @@ + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/video-fill-12.svg b/packages/stream_core_flutter/assets_source/icons/12/video-fill-12.svg new file mode 100644 index 00000000..ae334be4 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/video-fill-12.svg @@ -0,0 +1,10 @@ + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/voice-12.svg b/packages/stream_core_flutter/assets_source/icons/12/voice-12.svg new file mode 100644 index 00000000..6adf5121 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/voice-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/voice-fill-12.svg b/packages/stream_core_flutter/assets_source/icons/12/voice-fill-12.svg new file mode 100644 index 00000000..bd9da6d1 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/voice-fill-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/x-circle-12.svg b/packages/stream_core_flutter/assets_source/icons/12/x-circle-12.svg new file mode 100644 index 00000000..336872ea --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/x-circle-12.svg @@ -0,0 +1,10 @@ + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/12/xmark-12.svg b/packages/stream_core_flutter/assets_source/icons/12/xmark-12.svg new file mode 100644 index 00000000..db746701 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/12/xmark-12.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/account-16.svg b/packages/stream_core_flutter/assets_source/icons/16/account-16.svg new file mode 100644 index 00000000..8005ad37 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/account-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/archive-16.svg b/packages/stream_core_flutter/assets_source/icons/16/archive-16.svg new file mode 100644 index 00000000..8f16f9a7 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/archive-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/arrow-down-16.svg b/packages/stream_core_flutter/assets_source/icons/16/arrow-down-16.svg new file mode 100644 index 00000000..c25affb2 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/arrow-down-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/arrow-down-circle-16.svg b/packages/stream_core_flutter/assets_source/icons/16/arrow-down-circle-16.svg new file mode 100644 index 00000000..0450eb1d --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/arrow-down-circle-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/arrow-left-16.svg b/packages/stream_core_flutter/assets_source/icons/16/arrow-left-16.svg new file mode 100644 index 00000000..1e57ba99 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/arrow-left-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/arrow-right-16.svg b/packages/stream_core_flutter/assets_source/icons/16/arrow-right-16.svg new file mode 100644 index 00000000..ed4481ed --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/arrow-right-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/arrow-up-16.svg b/packages/stream_core_flutter/assets_source/icons/16/arrow-up-16.svg new file mode 100644 index 00000000..a7c525c2 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/arrow-up-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/arrow-up-right-16.svg b/packages/stream_core_flutter/assets_source/icons/16/arrow-up-right-16.svg new file mode 100644 index 00000000..d7e73b82 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/arrow-up-right-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/attachment-16.svg b/packages/stream_core_flutter/assets_source/icons/16/attachment-16.svg new file mode 100644 index 00000000..f6616800 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/attachment-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/audio-16.svg b/packages/stream_core_flutter/assets_source/icons/16/audio-16.svg new file mode 100644 index 00000000..67ee129d --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/audio-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/bell-16.svg b/packages/stream_core_flutter/assets_source/icons/16/bell-16.svg new file mode 100644 index 00000000..f3adbb1f --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/bell-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/bell-off-16.svg b/packages/stream_core_flutter/assets_source/icons/16/bell-off-16.svg new file mode 100644 index 00000000..319d57d4 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/bell-off-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/bolt-16.svg b/packages/stream_core_flutter/assets_source/icons/16/bolt-16.svg new file mode 100644 index 00000000..4d4ec057 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/bolt-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/camera-16.svg b/packages/stream_core_flutter/assets_source/icons/16/camera-16.svg new file mode 100644 index 00000000..03578c5e --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/camera-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/checkmark-16.svg b/packages/stream_core_flutter/assets_source/icons/16/checkmark-16.svg new file mode 100644 index 00000000..ad23fd6d --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/checkmark-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/checks-16.svg b/packages/stream_core_flutter/assets_source/icons/16/checks-16.svg new file mode 100644 index 00000000..5ea26929 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/checks-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/chevron-down-16.svg b/packages/stream_core_flutter/assets_source/icons/16/chevron-down-16.svg new file mode 100644 index 00000000..967b89d3 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/chevron-down-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/chevron-left-16.svg b/packages/stream_core_flutter/assets_source/icons/16/chevron-left-16.svg new file mode 100644 index 00000000..812921cd --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/chevron-left-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/chevron-right-16.svg b/packages/stream_core_flutter/assets_source/icons/16/chevron-right-16.svg new file mode 100644 index 00000000..8c907e12 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/chevron-right-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/chevron-up-16.svg b/packages/stream_core_flutter/assets_source/icons/16/chevron-up-16.svg new file mode 100644 index 00000000..814a0426 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/chevron-up-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/clock-16.svg b/packages/stream_core_flutter/assets_source/icons/16/clock-16.svg new file mode 100644 index 00000000..06680368 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/clock-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/command-16.svg b/packages/stream_core_flutter/assets_source/icons/16/command-16.svg new file mode 100644 index 00000000..7b187aec --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/command-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/copy-16.svg b/packages/stream_core_flutter/assets_source/icons/16/copy-16.svg new file mode 100644 index 00000000..e04c7db5 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/copy-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/delete-16.svg b/packages/stream_core_flutter/assets_source/icons/16/delete-16.svg new file mode 100644 index 00000000..0311ae7d --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/delete-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/download-16.svg b/packages/stream_core_flutter/assets_source/icons/16/download-16.svg new file mode 100644 index 00000000..e903d788 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/download-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/edit-16.svg b/packages/stream_core_flutter/assets_source/icons/16/edit-16.svg new file mode 100644 index 00000000..72ed455b --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/edit-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/emoji-16.svg b/packages/stream_core_flutter/assets_source/icons/16/emoji-16.svg new file mode 100644 index 00000000..c3f51590 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/emoji-16.svg @@ -0,0 +1,6 @@ + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/emoji-add-16.svg b/packages/stream_core_flutter/assets_source/icons/16/emoji-add-16.svg new file mode 100644 index 00000000..db9ce38c --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/emoji-add-16.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/exclamation-circle-16.svg b/packages/stream_core_flutter/assets_source/icons/16/exclamation-circle-16.svg new file mode 100644 index 00000000..672ebc08 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/exclamation-circle-16.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/exclamation-circle-fill-16.svg b/packages/stream_core_flutter/assets_source/icons/16/exclamation-circle-fill-16.svg new file mode 100644 index 00000000..831bbb03 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/exclamation-circle-fill-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/exclamation-mark-fill-16.svg b/packages/stream_core_flutter/assets_source/icons/16/exclamation-mark-fill-16.svg new file mode 100644 index 00000000..7287746b --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/exclamation-mark-fill-16.svg @@ -0,0 +1,4 @@ + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/exclamation-triangle-fill-16.svg b/packages/stream_core_flutter/assets_source/icons/16/exclamation-triangle-fill-16.svg new file mode 100644 index 00000000..35fc98cd --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/exclamation-triangle-fill-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/export-16.svg b/packages/stream_core_flutter/assets_source/icons/16/export-16.svg new file mode 100644 index 00000000..b9a56a39 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/export-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/eye-fill-16.svg b/packages/stream_core_flutter/assets_source/icons/16/eye-fill-16.svg new file mode 100644 index 00000000..e7b236aa --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/eye-fill-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/file-16.svg b/packages/stream_core_flutter/assets_source/icons/16/file-16.svg new file mode 100644 index 00000000..d4048cc2 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/file-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/flag-16.svg b/packages/stream_core_flutter/assets_source/icons/16/flag-16.svg new file mode 100644 index 00000000..03199031 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/flag-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/folder-16.svg b/packages/stream_core_flutter/assets_source/icons/16/folder-16.svg new file mode 100644 index 00000000..e5bca44c --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/folder-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/gallery-16.svg b/packages/stream_core_flutter/assets_source/icons/16/gallery-16.svg new file mode 100644 index 00000000..4f10c22a --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/gallery-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/giphy-16.svg b/packages/stream_core_flutter/assets_source/icons/16/giphy-16.svg new file mode 100644 index 00000000..6c74675c --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/giphy-16.svg @@ -0,0 +1,11 @@ + + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/image-16.svg b/packages/stream_core_flutter/assets_source/icons/16/image-16.svg new file mode 100644 index 00000000..91cdef60 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/image-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/imgur-16.svg b/packages/stream_core_flutter/assets_source/icons/16/imgur-16.svg new file mode 100644 index 00000000..ee2c2da7 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/imgur-16.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/info-16.svg b/packages/stream_core_flutter/assets_source/icons/16/info-16.svg new file mode 100644 index 00000000..6d837bf3 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/info-16.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/leave-16.svg b/packages/stream_core_flutter/assets_source/icons/16/leave-16.svg new file mode 100644 index 00000000..3b61c621 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/leave-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/link-16.svg b/packages/stream_core_flutter/assets_source/icons/16/link-16.svg new file mode 100644 index 00000000..4165fbe1 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/link-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/loading-16.svg b/packages/stream_core_flutter/assets_source/icons/16/loading-16.svg new file mode 100644 index 00000000..64f4aa3d --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/loading-16.svg @@ -0,0 +1,4 @@ + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/location-16.svg b/packages/stream_core_flutter/assets_source/icons/16/location-16.svg new file mode 100644 index 00000000..e587406c --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/location-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/lock-16.svg b/packages/stream_core_flutter/assets_source/icons/16/lock-16.svg new file mode 100644 index 00000000..4cdf8139 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/lock-16.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/mention-16.svg b/packages/stream_core_flutter/assets_source/icons/16/mention-16.svg new file mode 100644 index 00000000..55d80aaf --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/mention-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/message-bubble-16.svg b/packages/stream_core_flutter/assets_source/icons/16/message-bubble-16.svg new file mode 100644 index 00000000..cd3d1989 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/message-bubble-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/message-bubble-fill-16.svg b/packages/stream_core_flutter/assets_source/icons/16/message-bubble-fill-16.svg new file mode 100644 index 00000000..e72bf75d --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/message-bubble-fill-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/message-bubbles-16.svg b/packages/stream_core_flutter/assets_source/icons/16/message-bubbles-16.svg new file mode 100644 index 00000000..77f90d76 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/message-bubbles-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/minus-16.svg b/packages/stream_core_flutter/assets_source/icons/16/minus-16.svg new file mode 100644 index 00000000..9465abc6 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/minus-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/minus-circle-16.svg b/packages/stream_core_flutter/assets_source/icons/16/minus-circle-16.svg new file mode 100644 index 00000000..2c6d6e2d --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/minus-circle-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/more-16.svg b/packages/stream_core_flutter/assets_source/icons/16/more-16.svg new file mode 100644 index 00000000..e712d053 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/more-16.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/mute-16.svg b/packages/stream_core_flutter/assets_source/icons/16/mute-16.svg new file mode 100644 index 00000000..c286cd5c --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/mute-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/no-sign-16.svg b/packages/stream_core_flutter/assets_source/icons/16/no-sign-16.svg new file mode 100644 index 00000000..175ae3b4 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/no-sign-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/notification-16.svg b/packages/stream_core_flutter/assets_source/icons/16/notification-16.svg new file mode 100644 index 00000000..2254c4cb --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/notification-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/pause-fill-16.svg b/packages/stream_core_flutter/assets_source/icons/16/pause-fill-16.svg new file mode 100644 index 00000000..c2e9d43f --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/pause-fill-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/pin-16.svg b/packages/stream_core_flutter/assets_source/icons/16/pin-16.svg new file mode 100644 index 00000000..da321d5b --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/pin-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/play-fill-16.svg b/packages/stream_core_flutter/assets_source/icons/16/play-fill-16.svg new file mode 100644 index 00000000..859890cc --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/play-fill-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/plus-16.svg b/packages/stream_core_flutter/assets_source/icons/16/plus-16.svg new file mode 100644 index 00000000..24c448ff --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/plus-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/poll-16.svg b/packages/stream_core_flutter/assets_source/icons/16/poll-16.svg new file mode 100644 index 00000000..ca77da30 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/poll-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/quote-16.svg b/packages/stream_core_flutter/assets_source/icons/16/quote-16.svg new file mode 100644 index 00000000..334a1e86 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/quote-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/refresh-16.svg b/packages/stream_core_flutter/assets_source/icons/16/refresh-16.svg new file mode 100644 index 00000000..697aeb56 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/refresh-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/reorder-16.svg b/packages/stream_core_flutter/assets_source/icons/16/reorder-16.svg new file mode 100644 index 00000000..263ca91d --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/reorder-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/reply-16.svg b/packages/stream_core_flutter/assets_source/icons/16/reply-16.svg new file mode 100644 index 00000000..1e49bca1 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/reply-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/retry-16.svg b/packages/stream_core_flutter/assets_source/icons/16/retry-16.svg new file mode 100644 index 00000000..76e4ba72 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/retry-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/save-16.svg b/packages/stream_core_flutter/assets_source/icons/16/save-16.svg new file mode 100644 index 00000000..b52f96fc --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/save-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/search-16.svg b/packages/stream_core_flutter/assets_source/icons/16/search-16.svg new file mode 100644 index 00000000..587018b0 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/search-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/send-16.svg b/packages/stream_core_flutter/assets_source/icons/16/send-16.svg new file mode 100644 index 00000000..4a250c21 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/send-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/share-16.svg b/packages/stream_core_flutter/assets_source/icons/16/share-16.svg new file mode 100644 index 00000000..6798e02f --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/share-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/sidebar-16.svg b/packages/stream_core_flutter/assets_source/icons/16/sidebar-16.svg new file mode 100644 index 00000000..93a5d75f --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/sidebar-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/stop-fill-16.svg b/packages/stream_core_flutter/assets_source/icons/16/stop-fill-16.svg new file mode 100644 index 00000000..2394b28e --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/stop-fill-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/thread-16.svg b/packages/stream_core_flutter/assets_source/icons/16/thread-16.svg new file mode 100644 index 00000000..cdc0ec16 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/thread-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/thread-fill-16.svg b/packages/stream_core_flutter/assets_source/icons/16/thread-fill-16.svg new file mode 100644 index 00000000..b87b7a1f --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/thread-fill-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/translate-16.svg b/packages/stream_core_flutter/assets_source/icons/16/translate-16.svg new file mode 100644 index 00000000..06d129f7 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/translate-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/trophy-16.svg b/packages/stream_core_flutter/assets_source/icons/16/trophy-16.svg new file mode 100644 index 00000000..d3e6e716 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/trophy-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/unlock-16.svg b/packages/stream_core_flutter/assets_source/icons/16/unlock-16.svg new file mode 100644 index 00000000..38f59ab2 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/unlock-16.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/unpin-16.svg b/packages/stream_core_flutter/assets_source/icons/16/unpin-16.svg new file mode 100644 index 00000000..1b128620 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/unpin-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/unsave-16.svg b/packages/stream_core_flutter/assets_source/icons/16/unsave-16.svg new file mode 100644 index 00000000..9b663205 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/unsave-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/upload-16.svg b/packages/stream_core_flutter/assets_source/icons/16/upload-16.svg new file mode 100644 index 00000000..997064ff --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/upload-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/user-16.svg b/packages/stream_core_flutter/assets_source/icons/16/user-16.svg new file mode 100644 index 00000000..360ede17 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/user-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/user-add-16.svg b/packages/stream_core_flutter/assets_source/icons/16/user-add-16.svg new file mode 100644 index 00000000..d73ae12f --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/user-add-16.svg @@ -0,0 +1,10 @@ + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/user-check-16.svg b/packages/stream_core_flutter/assets_source/icons/16/user-check-16.svg new file mode 100644 index 00000000..4425f43a --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/user-check-16.svg @@ -0,0 +1,10 @@ + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/user-remove-16.svg b/packages/stream_core_flutter/assets_source/icons/16/user-remove-16.svg new file mode 100644 index 00000000..7622072c --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/user-remove-16.svg @@ -0,0 +1,10 @@ + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/users-16.svg b/packages/stream_core_flutter/assets_source/icons/16/users-16.svg new file mode 100644 index 00000000..dd574e44 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/users-16.svg @@ -0,0 +1,10 @@ + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/video-16.svg b/packages/stream_core_flutter/assets_source/icons/16/video-16.svg new file mode 100644 index 00000000..f058d512 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/video-16.svg @@ -0,0 +1,10 @@ + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/video-fill-16.svg b/packages/stream_core_flutter/assets_source/icons/16/video-fill-16.svg new file mode 100644 index 00000000..cbdaaa49 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/video-fill-16.svg @@ -0,0 +1,10 @@ + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/voice-16.svg b/packages/stream_core_flutter/assets_source/icons/16/voice-16.svg new file mode 100644 index 00000000..2a8de253 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/voice-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/voice-fill-16.svg b/packages/stream_core_flutter/assets_source/icons/16/voice-fill-16.svg new file mode 100644 index 00000000..75602014 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/voice-fill-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/x-circle-16.svg b/packages/stream_core_flutter/assets_source/icons/16/x-circle-16.svg new file mode 100644 index 00000000..fd0f22c4 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/x-circle-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/16/xmark-16.svg b/packages/stream_core_flutter/assets_source/icons/16/xmark-16.svg new file mode 100644 index 00000000..d82c1b36 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/16/xmark-16.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/account-20.svg b/packages/stream_core_flutter/assets_source/icons/20/account-20.svg new file mode 100644 index 00000000..aa040aa7 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/account-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/archive-20.svg b/packages/stream_core_flutter/assets_source/icons/20/archive-20.svg new file mode 100644 index 00000000..452a2985 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/archive-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/arrow-down-20.svg b/packages/stream_core_flutter/assets_source/icons/20/arrow-down-20.svg new file mode 100644 index 00000000..f851d798 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/arrow-down-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/arrow-down-circle-20.svg b/packages/stream_core_flutter/assets_source/icons/20/arrow-down-circle-20.svg new file mode 100644 index 00000000..85489694 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/arrow-down-circle-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/arrow-left-20.svg b/packages/stream_core_flutter/assets_source/icons/20/arrow-left-20.svg new file mode 100644 index 00000000..09a6b741 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/arrow-left-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/arrow-right-20.svg b/packages/stream_core_flutter/assets_source/icons/20/arrow-right-20.svg new file mode 100644 index 00000000..fe90942f --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/arrow-right-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/arrow-up-20.svg b/packages/stream_core_flutter/assets_source/icons/20/arrow-up-20.svg new file mode 100644 index 00000000..c6bad306 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/arrow-up-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/arrow-up-right-20.svg b/packages/stream_core_flutter/assets_source/icons/20/arrow-up-right-20.svg new file mode 100644 index 00000000..bad98c0b --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/arrow-up-right-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/attachment-20.svg b/packages/stream_core_flutter/assets_source/icons/20/attachment-20.svg new file mode 100644 index 00000000..5efd80d8 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/attachment-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/audio-20.svg b/packages/stream_core_flutter/assets_source/icons/20/audio-20.svg new file mode 100644 index 00000000..6b780c9d --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/audio-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/bell-20.svg b/packages/stream_core_flutter/assets_source/icons/20/bell-20.svg new file mode 100644 index 00000000..95561111 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/bell-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/bell-off-20.svg b/packages/stream_core_flutter/assets_source/icons/20/bell-off-20.svg new file mode 100644 index 00000000..2402a2a7 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/bell-off-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/bolt-20.svg b/packages/stream_core_flutter/assets_source/icons/20/bolt-20.svg new file mode 100644 index 00000000..785ee09a --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/bolt-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/camera-20.svg b/packages/stream_core_flutter/assets_source/icons/20/camera-20.svg new file mode 100644 index 00000000..85d5eb4d --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/camera-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/checkmark-20.svg b/packages/stream_core_flutter/assets_source/icons/20/checkmark-20.svg new file mode 100644 index 00000000..07b7ea84 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/checkmark-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/checks-20.svg b/packages/stream_core_flutter/assets_source/icons/20/checks-20.svg new file mode 100644 index 00000000..74cc796a --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/checks-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/chevron-down-20.svg b/packages/stream_core_flutter/assets_source/icons/20/chevron-down-20.svg new file mode 100644 index 00000000..1ef1d4b4 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/chevron-down-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/chevron-left-20.svg b/packages/stream_core_flutter/assets_source/icons/20/chevron-left-20.svg new file mode 100644 index 00000000..628001ef --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/chevron-left-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/chevron-right-20.svg b/packages/stream_core_flutter/assets_source/icons/20/chevron-right-20.svg new file mode 100644 index 00000000..e14038bf --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/chevron-right-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/chevron-up-20.svg b/packages/stream_core_flutter/assets_source/icons/20/chevron-up-20.svg new file mode 100644 index 00000000..fb2d7895 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/chevron-up-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/clock-20.svg b/packages/stream_core_flutter/assets_source/icons/20/clock-20.svg new file mode 100644 index 00000000..c7a573d6 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/clock-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/command-20.svg b/packages/stream_core_flutter/assets_source/icons/20/command-20.svg new file mode 100644 index 00000000..a4d3f663 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/command-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/copy-20.svg b/packages/stream_core_flutter/assets_source/icons/20/copy-20.svg new file mode 100644 index 00000000..7c271b49 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/copy-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/delete-20.svg b/packages/stream_core_flutter/assets_source/icons/20/delete-20.svg new file mode 100644 index 00000000..92ad03d0 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/delete-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/download-20.svg b/packages/stream_core_flutter/assets_source/icons/20/download-20.svg new file mode 100644 index 00000000..e24be7bd --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/download-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/edit-20.svg b/packages/stream_core_flutter/assets_source/icons/20/edit-20.svg new file mode 100644 index 00000000..daf77f8f --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/edit-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/emoji-20.svg b/packages/stream_core_flutter/assets_source/icons/20/emoji-20.svg new file mode 100644 index 00000000..55f5f879 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/emoji-20.svg @@ -0,0 +1,6 @@ + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/emoji-add-20.svg b/packages/stream_core_flutter/assets_source/icons/20/emoji-add-20.svg new file mode 100644 index 00000000..a0bacdaa --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/emoji-add-20.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/exclamation-circle-20.svg b/packages/stream_core_flutter/assets_source/icons/20/exclamation-circle-20.svg new file mode 100644 index 00000000..de802faa --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/exclamation-circle-20.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/exclamation-circle-fill-20.svg b/packages/stream_core_flutter/assets_source/icons/20/exclamation-circle-fill-20.svg new file mode 100644 index 00000000..0d561e23 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/exclamation-circle-fill-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/exclamation-mark-fill-20.svg b/packages/stream_core_flutter/assets_source/icons/20/exclamation-mark-fill-20.svg new file mode 100644 index 00000000..39fffd84 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/exclamation-mark-fill-20.svg @@ -0,0 +1,4 @@ + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/exclamation-triangle-fill-20.svg b/packages/stream_core_flutter/assets_source/icons/20/exclamation-triangle-fill-20.svg new file mode 100644 index 00000000..d8ceab2b --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/exclamation-triangle-fill-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/export-20.svg b/packages/stream_core_flutter/assets_source/icons/20/export-20.svg new file mode 100644 index 00000000..3d488042 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/export-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/eye-fill-20.svg b/packages/stream_core_flutter/assets_source/icons/20/eye-fill-20.svg new file mode 100644 index 00000000..3cf5308e --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/eye-fill-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/file-20.svg b/packages/stream_core_flutter/assets_source/icons/20/file-20.svg new file mode 100644 index 00000000..dbd12a57 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/file-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/flag-20.svg b/packages/stream_core_flutter/assets_source/icons/20/flag-20.svg new file mode 100644 index 00000000..a36b0542 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/flag-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/folder-20.svg b/packages/stream_core_flutter/assets_source/icons/20/folder-20.svg new file mode 100644 index 00000000..776fa327 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/folder-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/gallery-20.svg b/packages/stream_core_flutter/assets_source/icons/20/gallery-20.svg new file mode 100644 index 00000000..01b3ca8e --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/gallery-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/giphy-20.svg b/packages/stream_core_flutter/assets_source/icons/20/giphy-20.svg new file mode 100644 index 00000000..71fdf81f --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/giphy-20.svg @@ -0,0 +1,11 @@ + + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/image-20.svg b/packages/stream_core_flutter/assets_source/icons/20/image-20.svg new file mode 100644 index 00000000..1a117f7b --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/image-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/imgur-20.svg b/packages/stream_core_flutter/assets_source/icons/20/imgur-20.svg new file mode 100644 index 00000000..0258687a --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/imgur-20.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/info-20.svg b/packages/stream_core_flutter/assets_source/icons/20/info-20.svg new file mode 100644 index 00000000..1282e1fb --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/info-20.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/leave-20.svg b/packages/stream_core_flutter/assets_source/icons/20/leave-20.svg new file mode 100644 index 00000000..a72003b4 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/leave-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/link-20.svg b/packages/stream_core_flutter/assets_source/icons/20/link-20.svg new file mode 100644 index 00000000..86844b06 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/link-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/loading-20.svg b/packages/stream_core_flutter/assets_source/icons/20/loading-20.svg new file mode 100644 index 00000000..716073b6 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/loading-20.svg @@ -0,0 +1,4 @@ + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/location-20.svg b/packages/stream_core_flutter/assets_source/icons/20/location-20.svg new file mode 100644 index 00000000..6a1dbd24 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/location-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/lock-20.svg b/packages/stream_core_flutter/assets_source/icons/20/lock-20.svg new file mode 100644 index 00000000..ca6b5cbf --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/lock-20.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/mention-20.svg b/packages/stream_core_flutter/assets_source/icons/20/mention-20.svg new file mode 100644 index 00000000..8475c947 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/mention-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/message-bubble-20.svg b/packages/stream_core_flutter/assets_source/icons/20/message-bubble-20.svg new file mode 100644 index 00000000..83e5341d --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/message-bubble-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/message-bubble-fill-20.svg b/packages/stream_core_flutter/assets_source/icons/20/message-bubble-fill-20.svg new file mode 100644 index 00000000..46a10bd8 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/message-bubble-fill-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/message-bubbles-20.svg b/packages/stream_core_flutter/assets_source/icons/20/message-bubbles-20.svg new file mode 100644 index 00000000..41720e9d --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/message-bubbles-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/minus-20.svg b/packages/stream_core_flutter/assets_source/icons/20/minus-20.svg new file mode 100644 index 00000000..d72b7602 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/minus-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/minus-circle-20.svg b/packages/stream_core_flutter/assets_source/icons/20/minus-circle-20.svg new file mode 100644 index 00000000..2e72f0a9 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/minus-circle-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/more-20.svg b/packages/stream_core_flutter/assets_source/icons/20/more-20.svg new file mode 100644 index 00000000..dd66fec2 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/more-20.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/mute-20.svg b/packages/stream_core_flutter/assets_source/icons/20/mute-20.svg new file mode 100644 index 00000000..9c278f54 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/mute-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/no-sign-20.svg b/packages/stream_core_flutter/assets_source/icons/20/no-sign-20.svg new file mode 100644 index 00000000..3d5fadf7 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/no-sign-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/notification-20.svg b/packages/stream_core_flutter/assets_source/icons/20/notification-20.svg new file mode 100644 index 00000000..1ab42418 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/notification-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/pause-fill-20.svg b/packages/stream_core_flutter/assets_source/icons/20/pause-fill-20.svg new file mode 100644 index 00000000..e058d179 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/pause-fill-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/pin-20.svg b/packages/stream_core_flutter/assets_source/icons/20/pin-20.svg new file mode 100644 index 00000000..a97611a4 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/pin-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/play-fill-20.svg b/packages/stream_core_flutter/assets_source/icons/20/play-fill-20.svg new file mode 100644 index 00000000..5897b389 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/play-fill-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/plus-20.svg b/packages/stream_core_flutter/assets_source/icons/20/plus-20.svg new file mode 100644 index 00000000..70857c68 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/plus-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/poll-20.svg b/packages/stream_core_flutter/assets_source/icons/20/poll-20.svg new file mode 100644 index 00000000..43ff0feb --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/poll-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/quote-20.svg b/packages/stream_core_flutter/assets_source/icons/20/quote-20.svg new file mode 100644 index 00000000..2db18847 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/quote-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/refresh-20.svg b/packages/stream_core_flutter/assets_source/icons/20/refresh-20.svg new file mode 100644 index 00000000..faabac54 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/refresh-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/reorder-20.svg b/packages/stream_core_flutter/assets_source/icons/20/reorder-20.svg new file mode 100644 index 00000000..1be07317 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/reorder-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/reply-20.svg b/packages/stream_core_flutter/assets_source/icons/20/reply-20.svg new file mode 100644 index 00000000..a849d5e4 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/reply-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/retry-20.svg b/packages/stream_core_flutter/assets_source/icons/20/retry-20.svg new file mode 100644 index 00000000..cea251ba --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/retry-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/save-20.svg b/packages/stream_core_flutter/assets_source/icons/20/save-20.svg new file mode 100644 index 00000000..552c1e35 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/save-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/search-20.svg b/packages/stream_core_flutter/assets_source/icons/20/search-20.svg new file mode 100644 index 00000000..e0a235d0 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/search-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/send-20.svg b/packages/stream_core_flutter/assets_source/icons/20/send-20.svg new file mode 100644 index 00000000..c2c36efc --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/send-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/share-20.svg b/packages/stream_core_flutter/assets_source/icons/20/share-20.svg new file mode 100644 index 00000000..abd038eb --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/share-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/sidebar-20.svg b/packages/stream_core_flutter/assets_source/icons/20/sidebar-20.svg new file mode 100644 index 00000000..d8e85ff0 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/sidebar-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/stop-fill-20.svg b/packages/stream_core_flutter/assets_source/icons/20/stop-fill-20.svg new file mode 100644 index 00000000..78a4a19a --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/stop-fill-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/thread-20.svg b/packages/stream_core_flutter/assets_source/icons/20/thread-20.svg new file mode 100644 index 00000000..e5dd0310 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/thread-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/thread-fill-20.svg b/packages/stream_core_flutter/assets_source/icons/20/thread-fill-20.svg new file mode 100644 index 00000000..dc0e8311 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/thread-fill-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/translate-20.svg b/packages/stream_core_flutter/assets_source/icons/20/translate-20.svg new file mode 100644 index 00000000..b5758653 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/translate-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/trophy-20.svg b/packages/stream_core_flutter/assets_source/icons/20/trophy-20.svg new file mode 100644 index 00000000..37f78a88 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/trophy-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/unlock-20.svg b/packages/stream_core_flutter/assets_source/icons/20/unlock-20.svg new file mode 100644 index 00000000..141def3b --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/unlock-20.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/unpin-20.svg b/packages/stream_core_flutter/assets_source/icons/20/unpin-20.svg new file mode 100644 index 00000000..7b2d4282 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/unpin-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/unsave-20.svg b/packages/stream_core_flutter/assets_source/icons/20/unsave-20.svg new file mode 100644 index 00000000..5041e4bb --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/unsave-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/upload-20.svg b/packages/stream_core_flutter/assets_source/icons/20/upload-20.svg new file mode 100644 index 00000000..b4055397 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/upload-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/user-20.svg b/packages/stream_core_flutter/assets_source/icons/20/user-20.svg new file mode 100644 index 00000000..2df8636b --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/user-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/user-add-20.svg b/packages/stream_core_flutter/assets_source/icons/20/user-add-20.svg new file mode 100644 index 00000000..40936f67 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/user-add-20.svg @@ -0,0 +1,10 @@ + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/user-check-20.svg b/packages/stream_core_flutter/assets_source/icons/20/user-check-20.svg new file mode 100644 index 00000000..e75425c9 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/user-check-20.svg @@ -0,0 +1,10 @@ + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/user-remove-20.svg b/packages/stream_core_flutter/assets_source/icons/20/user-remove-20.svg new file mode 100644 index 00000000..c7df63ef --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/user-remove-20.svg @@ -0,0 +1,10 @@ + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/users-20.svg b/packages/stream_core_flutter/assets_source/icons/20/users-20.svg new file mode 100644 index 00000000..750987bd --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/users-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/video-20.svg b/packages/stream_core_flutter/assets_source/icons/20/video-20.svg new file mode 100644 index 00000000..bdded5e9 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/video-20.svg @@ -0,0 +1,10 @@ + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/video-fill-20.svg b/packages/stream_core_flutter/assets_source/icons/20/video-fill-20.svg new file mode 100644 index 00000000..f575817e --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/video-fill-20.svg @@ -0,0 +1,10 @@ + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/voice-20.svg b/packages/stream_core_flutter/assets_source/icons/20/voice-20.svg new file mode 100644 index 00000000..017095c8 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/voice-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/voice-fill-20.svg b/packages/stream_core_flutter/assets_source/icons/20/voice-fill-20.svg new file mode 100644 index 00000000..a7c251da --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/voice-fill-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/x-circle-20.svg b/packages/stream_core_flutter/assets_source/icons/20/x-circle-20.svg new file mode 100644 index 00000000..7a205686 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/x-circle-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/20/xmark-20.svg b/packages/stream_core_flutter/assets_source/icons/20/xmark-20.svg new file mode 100644 index 00000000..715ac01a --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/20/xmark-20.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/account-32.svg b/packages/stream_core_flutter/assets_source/icons/32/account-32.svg new file mode 100644 index 00000000..964edaa4 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/account-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/archive-32.svg b/packages/stream_core_flutter/assets_source/icons/32/archive-32.svg new file mode 100644 index 00000000..2010c222 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/archive-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/arrow-down-32.svg b/packages/stream_core_flutter/assets_source/icons/32/arrow-down-32.svg new file mode 100644 index 00000000..df18605d --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/arrow-down-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/arrow-down-circle-32.svg b/packages/stream_core_flutter/assets_source/icons/32/arrow-down-circle-32.svg new file mode 100644 index 00000000..3a2e1bf3 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/arrow-down-circle-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/arrow-left-32.svg b/packages/stream_core_flutter/assets_source/icons/32/arrow-left-32.svg new file mode 100644 index 00000000..d17a519d --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/arrow-left-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/arrow-right-32.svg b/packages/stream_core_flutter/assets_source/icons/32/arrow-right-32.svg new file mode 100644 index 00000000..ba23f0c7 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/arrow-right-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/arrow-up-32.svg b/packages/stream_core_flutter/assets_source/icons/32/arrow-up-32.svg new file mode 100644 index 00000000..3da94d77 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/arrow-up-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/arrow-up-right-32.svg b/packages/stream_core_flutter/assets_source/icons/32/arrow-up-right-32.svg new file mode 100644 index 00000000..718a45ce --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/arrow-up-right-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/attachment-32.svg b/packages/stream_core_flutter/assets_source/icons/32/attachment-32.svg new file mode 100644 index 00000000..22e3aaeb --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/attachment-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/audio-32.svg b/packages/stream_core_flutter/assets_source/icons/32/audio-32.svg new file mode 100644 index 00000000..bfa72c8e --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/audio-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/bell-32.svg b/packages/stream_core_flutter/assets_source/icons/32/bell-32.svg new file mode 100644 index 00000000..72feba51 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/bell-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/bell-off-32.svg b/packages/stream_core_flutter/assets_source/icons/32/bell-off-32.svg new file mode 100644 index 00000000..dfacd85f --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/bell-off-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/bolt-32.svg b/packages/stream_core_flutter/assets_source/icons/32/bolt-32.svg new file mode 100644 index 00000000..db7d0666 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/bolt-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/camera-32.svg b/packages/stream_core_flutter/assets_source/icons/32/camera-32.svg new file mode 100644 index 00000000..b62ab4f2 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/camera-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/checkmark-32.svg b/packages/stream_core_flutter/assets_source/icons/32/checkmark-32.svg new file mode 100644 index 00000000..73b0c174 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/checkmark-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/checks-32.svg b/packages/stream_core_flutter/assets_source/icons/32/checks-32.svg new file mode 100644 index 00000000..d683b638 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/checks-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/chevron-down-32.svg b/packages/stream_core_flutter/assets_source/icons/32/chevron-down-32.svg new file mode 100644 index 00000000..ba9e99ef --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/chevron-down-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/chevron-left-32.svg b/packages/stream_core_flutter/assets_source/icons/32/chevron-left-32.svg new file mode 100644 index 00000000..c50908ac --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/chevron-left-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/chevron-right-32.svg b/packages/stream_core_flutter/assets_source/icons/32/chevron-right-32.svg new file mode 100644 index 00000000..553d60db --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/chevron-right-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/chevron-up-32.svg b/packages/stream_core_flutter/assets_source/icons/32/chevron-up-32.svg new file mode 100644 index 00000000..5b1c6ad1 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/chevron-up-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/clock-32.svg b/packages/stream_core_flutter/assets_source/icons/32/clock-32.svg new file mode 100644 index 00000000..cd6b8f1b --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/clock-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/command-32.svg b/packages/stream_core_flutter/assets_source/icons/32/command-32.svg new file mode 100644 index 00000000..a4d3f663 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/command-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/copy-32.svg b/packages/stream_core_flutter/assets_source/icons/32/copy-32.svg new file mode 100644 index 00000000..7439bc95 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/copy-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/delete-32.svg b/packages/stream_core_flutter/assets_source/icons/32/delete-32.svg new file mode 100644 index 00000000..2faa9a22 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/delete-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/download-32.svg b/packages/stream_core_flutter/assets_source/icons/32/download-32.svg new file mode 100644 index 00000000..da3cefc2 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/download-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/edit-32.svg b/packages/stream_core_flutter/assets_source/icons/32/edit-32.svg new file mode 100644 index 00000000..e35af4af --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/edit-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/emoji-32.svg b/packages/stream_core_flutter/assets_source/icons/32/emoji-32.svg new file mode 100644 index 00000000..85ed31b8 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/emoji-32.svg @@ -0,0 +1,6 @@ + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/emoji-add-32.svg b/packages/stream_core_flutter/assets_source/icons/32/emoji-add-32.svg new file mode 100644 index 00000000..8543dae7 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/emoji-add-32.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/exclamation-circle-32.svg b/packages/stream_core_flutter/assets_source/icons/32/exclamation-circle-32.svg new file mode 100644 index 00000000..772f883f --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/exclamation-circle-32.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/exclamation-circle-fill-32.svg b/packages/stream_core_flutter/assets_source/icons/32/exclamation-circle-fill-32.svg new file mode 100644 index 00000000..58975180 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/exclamation-circle-fill-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/exclamation-mark-fill-32.svg b/packages/stream_core_flutter/assets_source/icons/32/exclamation-mark-fill-32.svg new file mode 100644 index 00000000..b1b374f2 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/exclamation-mark-fill-32.svg @@ -0,0 +1,4 @@ + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/exclamation-triangle-fill-32.svg b/packages/stream_core_flutter/assets_source/icons/32/exclamation-triangle-fill-32.svg new file mode 100644 index 00000000..614b3746 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/exclamation-triangle-fill-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/export-32.svg b/packages/stream_core_flutter/assets_source/icons/32/export-32.svg new file mode 100644 index 00000000..3e1896b4 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/export-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/eye-fill-32.svg b/packages/stream_core_flutter/assets_source/icons/32/eye-fill-32.svg new file mode 100644 index 00000000..d79efd5a --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/eye-fill-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/file-32.svg b/packages/stream_core_flutter/assets_source/icons/32/file-32.svg new file mode 100644 index 00000000..ff2d2d3d --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/file-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/flag-32.svg b/packages/stream_core_flutter/assets_source/icons/32/flag-32.svg new file mode 100644 index 00000000..3ae47bca --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/flag-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/folder-32.svg b/packages/stream_core_flutter/assets_source/icons/32/folder-32.svg new file mode 100644 index 00000000..8c5168d9 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/folder-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/gallery-32.svg b/packages/stream_core_flutter/assets_source/icons/32/gallery-32.svg new file mode 100644 index 00000000..3f28a228 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/gallery-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/giphy-32.svg b/packages/stream_core_flutter/assets_source/icons/32/giphy-32.svg new file mode 100644 index 00000000..801c42b1 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/giphy-32.svg @@ -0,0 +1,11 @@ + + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/image-32.svg b/packages/stream_core_flutter/assets_source/icons/32/image-32.svg new file mode 100644 index 00000000..ca28402b --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/image-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/imgur-32.svg b/packages/stream_core_flutter/assets_source/icons/32/imgur-32.svg new file mode 100644 index 00000000..7de20bba --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/imgur-32.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/info-32.svg b/packages/stream_core_flutter/assets_source/icons/32/info-32.svg new file mode 100644 index 00000000..4e875a47 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/info-32.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/leave-32.svg b/packages/stream_core_flutter/assets_source/icons/32/leave-32.svg new file mode 100644 index 00000000..c77539ce --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/leave-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/link-32.svg b/packages/stream_core_flutter/assets_source/icons/32/link-32.svg new file mode 100644 index 00000000..3652c521 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/link-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/loading-32.svg b/packages/stream_core_flutter/assets_source/icons/32/loading-32.svg new file mode 100644 index 00000000..33d29972 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/loading-32.svg @@ -0,0 +1,4 @@ + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/location-32.svg b/packages/stream_core_flutter/assets_source/icons/32/location-32.svg new file mode 100644 index 00000000..558216f2 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/location-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/lock-32.svg b/packages/stream_core_flutter/assets_source/icons/32/lock-32.svg new file mode 100644 index 00000000..22054823 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/lock-32.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/mention-32.svg b/packages/stream_core_flutter/assets_source/icons/32/mention-32.svg new file mode 100644 index 00000000..618dc65e --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/mention-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/message-bubble-32.svg b/packages/stream_core_flutter/assets_source/icons/32/message-bubble-32.svg new file mode 100644 index 00000000..c490909a --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/message-bubble-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/message-bubble-fill-32.svg b/packages/stream_core_flutter/assets_source/icons/32/message-bubble-fill-32.svg new file mode 100644 index 00000000..cdb244c0 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/message-bubble-fill-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/message-bubbles-32.svg b/packages/stream_core_flutter/assets_source/icons/32/message-bubbles-32.svg new file mode 100644 index 00000000..e18c5873 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/message-bubbles-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/minus-32.svg b/packages/stream_core_flutter/assets_source/icons/32/minus-32.svg new file mode 100644 index 00000000..9d44c9c2 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/minus-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/minus-circle-32.svg b/packages/stream_core_flutter/assets_source/icons/32/minus-circle-32.svg new file mode 100644 index 00000000..140aaa0b --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/minus-circle-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/more-32.svg b/packages/stream_core_flutter/assets_source/icons/32/more-32.svg new file mode 100644 index 00000000..ab94b540 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/more-32.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/mute-32.svg b/packages/stream_core_flutter/assets_source/icons/32/mute-32.svg new file mode 100644 index 00000000..5d5d1458 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/mute-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/no-sign-32.svg b/packages/stream_core_flutter/assets_source/icons/32/no-sign-32.svg new file mode 100644 index 00000000..75a0ff7b --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/no-sign-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/notification-32.svg b/packages/stream_core_flutter/assets_source/icons/32/notification-32.svg new file mode 100644 index 00000000..e99148df --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/notification-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/pause-fill-32.svg b/packages/stream_core_flutter/assets_source/icons/32/pause-fill-32.svg new file mode 100644 index 00000000..02273bb0 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/pause-fill-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/pin-32.svg b/packages/stream_core_flutter/assets_source/icons/32/pin-32.svg new file mode 100644 index 00000000..2b9e1bcd --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/pin-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/play-fill-32.svg b/packages/stream_core_flutter/assets_source/icons/32/play-fill-32.svg new file mode 100644 index 00000000..800d3d5b --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/play-fill-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/plus-32.svg b/packages/stream_core_flutter/assets_source/icons/32/plus-32.svg new file mode 100644 index 00000000..a290cb2f --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/plus-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/poll-32.svg b/packages/stream_core_flutter/assets_source/icons/32/poll-32.svg new file mode 100644 index 00000000..3013f5b0 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/poll-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/quote-32.svg b/packages/stream_core_flutter/assets_source/icons/32/quote-32.svg new file mode 100644 index 00000000..72ffa94c --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/quote-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/refresh-32.svg b/packages/stream_core_flutter/assets_source/icons/32/refresh-32.svg new file mode 100644 index 00000000..4732c553 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/refresh-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/reorder-32.svg b/packages/stream_core_flutter/assets_source/icons/32/reorder-32.svg new file mode 100644 index 00000000..20524cac --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/reorder-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/reply-32.svg b/packages/stream_core_flutter/assets_source/icons/32/reply-32.svg new file mode 100644 index 00000000..70868790 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/reply-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/retry-32.svg b/packages/stream_core_flutter/assets_source/icons/32/retry-32.svg new file mode 100644 index 00000000..df4fce31 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/retry-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/save-32.svg b/packages/stream_core_flutter/assets_source/icons/32/save-32.svg new file mode 100644 index 00000000..bfb57b51 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/save-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/search-32.svg b/packages/stream_core_flutter/assets_source/icons/32/search-32.svg new file mode 100644 index 00000000..6d0f6262 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/search-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/send-32.svg b/packages/stream_core_flutter/assets_source/icons/32/send-32.svg new file mode 100644 index 00000000..83f5b34e --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/send-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/share-32.svg b/packages/stream_core_flutter/assets_source/icons/32/share-32.svg new file mode 100644 index 00000000..84179524 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/share-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/sidebar-32.svg b/packages/stream_core_flutter/assets_source/icons/32/sidebar-32.svg new file mode 100644 index 00000000..78dd9d01 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/sidebar-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/stop-fill-32.svg b/packages/stream_core_flutter/assets_source/icons/32/stop-fill-32.svg new file mode 100644 index 00000000..ac365149 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/stop-fill-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/thread-32.svg b/packages/stream_core_flutter/assets_source/icons/32/thread-32.svg new file mode 100644 index 00000000..c4c7a2a0 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/thread-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/thread-fill-32.svg b/packages/stream_core_flutter/assets_source/icons/32/thread-fill-32.svg new file mode 100644 index 00000000..d5746e4b --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/thread-fill-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/translate-32.svg b/packages/stream_core_flutter/assets_source/icons/32/translate-32.svg new file mode 100644 index 00000000..ac0c1e69 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/translate-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/trophy-32.svg b/packages/stream_core_flutter/assets_source/icons/32/trophy-32.svg new file mode 100644 index 00000000..39172bd2 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/trophy-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/unlock-32.svg b/packages/stream_core_flutter/assets_source/icons/32/unlock-32.svg new file mode 100644 index 00000000..672c1eb5 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/unlock-32.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/unpin-32.svg b/packages/stream_core_flutter/assets_source/icons/32/unpin-32.svg new file mode 100644 index 00000000..245a3363 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/unpin-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/unsave-32.svg b/packages/stream_core_flutter/assets_source/icons/32/unsave-32.svg new file mode 100644 index 00000000..1890d265 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/unsave-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/upload-32.svg b/packages/stream_core_flutter/assets_source/icons/32/upload-32.svg new file mode 100644 index 00000000..2d76d631 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/upload-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/user-32.svg b/packages/stream_core_flutter/assets_source/icons/32/user-32.svg new file mode 100644 index 00000000..def03668 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/user-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/user-add-32.svg b/packages/stream_core_flutter/assets_source/icons/32/user-add-32.svg new file mode 100644 index 00000000..d972f5ad --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/user-add-32.svg @@ -0,0 +1,10 @@ + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/user-check-32.svg b/packages/stream_core_flutter/assets_source/icons/32/user-check-32.svg new file mode 100644 index 00000000..09c8708d --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/user-check-32.svg @@ -0,0 +1,10 @@ + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/user-remove-32.svg b/packages/stream_core_flutter/assets_source/icons/32/user-remove-32.svg new file mode 100644 index 00000000..0edb137d --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/user-remove-32.svg @@ -0,0 +1,10 @@ + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/users-32.svg b/packages/stream_core_flutter/assets_source/icons/32/users-32.svg new file mode 100644 index 00000000..8555133f --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/users-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/video-32.svg b/packages/stream_core_flutter/assets_source/icons/32/video-32.svg new file mode 100644 index 00000000..58ec5728 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/video-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/video-fill-32.svg b/packages/stream_core_flutter/assets_source/icons/32/video-fill-32.svg new file mode 100644 index 00000000..2273cc81 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/video-fill-32.svg @@ -0,0 +1,10 @@ + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/voice-32.svg b/packages/stream_core_flutter/assets_source/icons/32/voice-32.svg new file mode 100644 index 00000000..f0eb240c --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/voice-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/voice-fill-32.svg b/packages/stream_core_flutter/assets_source/icons/32/voice-fill-32.svg new file mode 100644 index 00000000..966f5640 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/voice-fill-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/x-circle-32.svg b/packages/stream_core_flutter/assets_source/icons/32/x-circle-32.svg new file mode 100644 index 00000000..a5ef8925 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/x-circle-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/32/xmark-32.svg b/packages/stream_core_flutter/assets_source/icons/32/xmark-32.svg new file mode 100644 index 00000000..160ca23b --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/32/xmark-32.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconApiAggregate.svg b/packages/stream_core_flutter/assets_source/icons/IconApiAggregate.svg deleted file mode 100644 index a4071bc5..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconApiAggregate.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconApples.svg b/packages/stream_core_flutter/assets_source/icons/IconApples.svg deleted file mode 100644 index 43072529..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconApples.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconArchive1.svg b/packages/stream_core_flutter/assets_source/icons/IconArchive1.svg deleted file mode 100644 index c1db35af..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconArchive1.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconArrowBoxLeft.svg b/packages/stream_core_flutter/assets_source/icons/IconArrowBoxLeft.svg deleted file mode 100644 index 7464978b..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconArrowBoxLeft.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconArrowDown.svg b/packages/stream_core_flutter/assets_source/icons/IconArrowDown.svg deleted file mode 100644 index c7cdb950..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconArrowDown.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconArrowDownCircle.svg b/packages/stream_core_flutter/assets_source/icons/IconArrowDownCircle.svg deleted file mode 100644 index 37c5f4a3..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconArrowDownCircle.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconArrowLeft.svg b/packages/stream_core_flutter/assets_source/icons/IconArrowLeft.svg deleted file mode 100644 index e93e6fc4..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconArrowLeft.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconArrowRight.svg b/packages/stream_core_flutter/assets_source/icons/IconArrowRight.svg deleted file mode 100644 index c404975f..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconArrowRight.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconArrowRotateClockwise.svg b/packages/stream_core_flutter/assets_source/icons/IconArrowRotateClockwise.svg deleted file mode 100644 index 37b25cc8..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconArrowRotateClockwise.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconArrowRotateRightLeftRepeatRefresh.svg b/packages/stream_core_flutter/assets_source/icons/IconArrowRotateRightLeftRepeatRefresh.svg deleted file mode 100644 index 11cd1ee4..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconArrowRotateRightLeftRepeatRefresh.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconArrowShareLeft.svg b/packages/stream_core_flutter/assets_source/icons/IconArrowShareLeft.svg deleted file mode 100644 index adf17639..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconArrowShareLeft.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconArrowShareRight.svg b/packages/stream_core_flutter/assets_source/icons/IconArrowShareRight.svg deleted file mode 100644 index 892a319f..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconArrowShareRight.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconArrowUp.svg b/packages/stream_core_flutter/assets_source/icons/IconArrowUp.svg deleted file mode 100644 index ad258d40..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconArrowUp.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconArrowUpRight.svg b/packages/stream_core_flutter/assets_source/icons/IconArrowUpRight.svg deleted file mode 100644 index c8a584d1..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconArrowUpRight.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconArrowsRepeatLeftRight.svg b/packages/stream_core_flutter/assets_source/icons/IconArrowsRepeatLeftRight.svg deleted file mode 100644 index 6a7d826f..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconArrowsRepeatLeftRight.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconAt.svg b/packages/stream_core_flutter/assets_source/icons/IconAt.svg deleted file mode 100644 index 1c72f84e..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconAt.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconAtSolid.svg b/packages/stream_core_flutter/assets_source/icons/IconAtSolid.svg deleted file mode 100644 index 1659a761..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconAtSolid.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconBellNotification.svg b/packages/stream_core_flutter/assets_source/icons/IconBellNotification.svg deleted file mode 100644 index c8ff4b2f..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconBellNotification.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconBellOff.svg b/packages/stream_core_flutter/assets_source/icons/IconBellOff.svg deleted file mode 100644 index 4517ff02..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconBellOff.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconBookmark.svg b/packages/stream_core_flutter/assets_source/icons/IconBookmark.svg deleted file mode 100644 index 1fdb30e9..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconBookmark.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconBookmarkRemove.svg b/packages/stream_core_flutter/assets_source/icons/IconBookmarkRemove.svg deleted file mode 100644 index e7238c3e..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconBookmarkRemove.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconBrowserAISparkle.svg b/packages/stream_core_flutter/assets_source/icons/IconBrowserAISparkle.svg deleted file mode 100644 index 6023d0c3..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconBrowserAISparkle.svg +++ /dev/null @@ -1,6 +0,0 @@ - - - - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconBubble3ChatMessage.svg b/packages/stream_core_flutter/assets_source/icons/IconBubble3ChatMessage.svg deleted file mode 100644 index d20a3d17..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconBubble3ChatMessage.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconBubble3Solid.svg b/packages/stream_core_flutter/assets_source/icons/IconBubble3Solid.svg deleted file mode 100644 index 8878bcb0..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconBubble3Solid.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconBubbleAnnotation2ChatMessage.svg b/packages/stream_core_flutter/assets_source/icons/IconBubbleAnnotation2ChatMessage.svg deleted file mode 100644 index e61361d0..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconBubbleAnnotation2ChatMessage.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconBubbleText6ChatMessage.svg b/packages/stream_core_flutter/assets_source/icons/IconBubbleText6ChatMessage.svg deleted file mode 100644 index 7c501016..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconBubbleText6ChatMessage.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconBubbleText6Solid.svg b/packages/stream_core_flutter/assets_source/icons/IconBubbleText6Solid.svg deleted file mode 100644 index b6a3b01f..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconBubbleText6Solid.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconBubbleWideNotificationChatMessage.svg b/packages/stream_core_flutter/assets_source/icons/IconBubbleWideNotificationChatMessage.svg deleted file mode 100644 index 6560ae35..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconBubbleWideNotificationChatMessage.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconBubbleWideSparkleChatMessage.svg b/packages/stream_core_flutter/assets_source/icons/IconBubbleWideSparkleChatMessage.svg deleted file mode 100644 index c2a55f5c..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconBubbleWideSparkleChatMessage.svg +++ /dev/null @@ -1,4 +0,0 @@ - - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconBubbles.svg b/packages/stream_core_flutter/assets_source/icons/IconBubbles.svg deleted file mode 100644 index 478beb6b..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconBubbles.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconCalendar1.svg b/packages/stream_core_flutter/assets_source/icons/IconCalendar1.svg deleted file mode 100644 index 942727c7..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconCalendar1.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconCallCancel.svg b/packages/stream_core_flutter/assets_source/icons/IconCallCancel.svg deleted file mode 100644 index f482067a..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconCallCancel.svg +++ /dev/null @@ -1,4 +0,0 @@ - - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconCamera1.svg b/packages/stream_core_flutter/assets_source/icons/IconCamera1.svg deleted file mode 100644 index a032b33f..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconCamera1.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconCar1.svg b/packages/stream_core_flutter/assets_source/icons/IconCar1.svg deleted file mode 100644 index 21cd033f..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconCar1.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconCat.svg b/packages/stream_core_flutter/assets_source/icons/IconCat.svg deleted file mode 100644 index 01380a01..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconCat.svg +++ /dev/null @@ -1,6 +0,0 @@ - - - - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconChainLink3.svg b/packages/stream_core_flutter/assets_source/icons/IconChainLink3.svg deleted file mode 100644 index f76c455d..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconChainLink3.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconChart5.svg b/packages/stream_core_flutter/assets_source/icons/IconChart5.svg deleted file mode 100644 index b34ab605..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconChart5.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconCheckmark1Small.svg b/packages/stream_core_flutter/assets_source/icons/IconCheckmark1Small.svg deleted file mode 100644 index 82e46d85..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconCheckmark1Small.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconCheckmark2.svg b/packages/stream_core_flutter/assets_source/icons/IconCheckmark2.svg deleted file mode 100644 index 4eacbe5c..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconCheckmark2.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconCheckmark2Small.svg b/packages/stream_core_flutter/assets_source/icons/IconCheckmark2Small.svg deleted file mode 100644 index 7391a367..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconCheckmark2Small.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconChevronDown.svg b/packages/stream_core_flutter/assets_source/icons/IconChevronDown.svg deleted file mode 100644 index 9139e062..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconChevronDown.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconChevronGrabberVerticalSelector.svg b/packages/stream_core_flutter/assets_source/icons/IconChevronGrabberVerticalSelector.svg deleted file mode 100644 index d5202706..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconChevronGrabberVerticalSelector.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconChevronLeft.svg b/packages/stream_core_flutter/assets_source/icons/IconChevronLeft.svg deleted file mode 100644 index efd0513b..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconChevronLeft.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconChevronRight.svg b/packages/stream_core_flutter/assets_source/icons/IconChevronRight.svg deleted file mode 100644 index 41444f4e..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconChevronRight.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconChevronTop.svg b/packages/stream_core_flutter/assets_source/icons/IconChevronTop.svg deleted file mode 100644 index cfb943ec..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconChevronTop.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconCircleBanSign.svg b/packages/stream_core_flutter/assets_source/icons/IconCircleBanSign.svg deleted file mode 100644 index 90d83198..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconCircleBanSign.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconCircleCheck.svg b/packages/stream_core_flutter/assets_source/icons/IconCircleCheck.svg deleted file mode 100644 index ad1d204e..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconCircleCheck.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconCircleInfoTooltip.svg b/packages/stream_core_flutter/assets_source/icons/IconCircleInfoTooltip.svg deleted file mode 100644 index b174ee5f..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconCircleInfoTooltip.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconCircleMinus.svg b/packages/stream_core_flutter/assets_source/icons/IconCircleMinus.svg deleted file mode 100644 index 69104342..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconCircleMinus.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconCircleQuestionmark.svg b/packages/stream_core_flutter/assets_source/icons/IconCircleQuestionmark.svg deleted file mode 100644 index 1a5baaeb..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconCircleQuestionmark.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconCircleQuestionmarkFilled.svg b/packages/stream_core_flutter/assets_source/icons/IconCircleQuestionmarkFilled.svg deleted file mode 100644 index d8fd6c94..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconCircleQuestionmarkFilled.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconCircleX.svg b/packages/stream_core_flutter/assets_source/icons/IconCircleX.svg deleted file mode 100644 index da8414d0..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconCircleX.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconClock.svg b/packages/stream_core_flutter/assets_source/icons/IconClock.svg deleted file mode 100644 index d0f94125..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconClock.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconClockSolid.svg b/packages/stream_core_flutter/assets_source/icons/IconClockSolid.svg deleted file mode 100644 index aff9a086..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconClockSolid.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconCloseQuote2.svg b/packages/stream_core_flutter/assets_source/icons/IconCloseQuote2.svg deleted file mode 100644 index be23ec9f..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconCloseQuote2.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconCloudSimpleUpload.svg b/packages/stream_core_flutter/assets_source/icons/IconCloudSimpleUpload.svg deleted file mode 100644 index 3160a39f..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconCloudSimpleUpload.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconCode.svg b/packages/stream_core_flutter/assets_source/icons/IconCode.svg deleted file mode 100644 index 125a0a3b..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconCode.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconCodeBrackets.svg b/packages/stream_core_flutter/assets_source/icons/IconCodeBrackets.svg deleted file mode 100644 index 9a38a495..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconCodeBrackets.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconCodeEditorInsert.svg b/packages/stream_core_flutter/assets_source/icons/IconCodeEditorInsert.svg deleted file mode 100644 index ef8c7e8e..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconCodeEditorInsert.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconCompass.svg b/packages/stream_core_flutter/assets_source/icons/IconCompass.svg deleted file mode 100644 index 0e3af350..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconCompass.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconComponents.svg b/packages/stream_core_flutter/assets_source/icons/IconComponents.svg deleted file mode 100644 index 9ef41041..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconComponents.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconCreditCard2Billing.svg b/packages/stream_core_flutter/assets_source/icons/IconCreditCard2Billing.svg deleted file mode 100644 index 906472e2..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconCreditCard2Billing.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconCrossMedium.svg b/packages/stream_core_flutter/assets_source/icons/IconCrossMedium.svg deleted file mode 100644 index 3ef6d956..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconCrossMedium.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconCrossSmall.svg b/packages/stream_core_flutter/assets_source/icons/IconCrossSmall.svg deleted file mode 100644 index adbc8e37..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconCrossSmall.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconDotGrid1x3Horizontal.svg b/packages/stream_core_flutter/assets_source/icons/IconDotGrid1x3Horizontal.svg deleted file mode 100644 index e2d5e68d..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconDotGrid1x3Horizontal.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconDotGrid2x3.svg b/packages/stream_core_flutter/assets_source/icons/IconDotGrid2x3.svg deleted file mode 100644 index 412b10e1..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconDotGrid2x3.svg +++ /dev/null @@ -1,8 +0,0 @@ - - - - - - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconDotsGrid1x3Vertical.svg b/packages/stream_core_flutter/assets_source/icons/IconDotsGrid1x3Vertical.svg deleted file mode 100644 index 4f8368df..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconDotsGrid1x3Vertical.svg +++ /dev/null @@ -1,6 +0,0 @@ - - - - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconDoupleCheckmark1Small.svg b/packages/stream_core_flutter/assets_source/icons/IconDoupleCheckmark1Small.svg deleted file mode 100644 index f9a13f1a..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconDoupleCheckmark1Small.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconEditBig.svg b/packages/stream_core_flutter/assets_source/icons/IconEditBig.svg deleted file mode 100644 index 72e381e7..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconEditBig.svg +++ /dev/null @@ -1,4 +0,0 @@ - - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconEditBigSolid.svg b/packages/stream_core_flutter/assets_source/icons/IconEditBigSolid.svg deleted file mode 100644 index c5fe8b92..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconEditBigSolid.svg +++ /dev/null @@ -1,4 +0,0 @@ - - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconEmojiAddReaction.svg b/packages/stream_core_flutter/assets_source/icons/IconEmojiAddReaction.svg deleted file mode 100644 index 87b23694..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconEmojiAddReaction.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconEmojiSad.svg b/packages/stream_core_flutter/assets_source/icons/IconEmojiSad.svg deleted file mode 100644 index 6940d7e0..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconEmojiSad.svg +++ /dev/null @@ -1,6 +0,0 @@ - - - - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconEmojiSmile.svg b/packages/stream_core_flutter/assets_source/icons/IconEmojiSmile.svg deleted file mode 100644 index a6179dd6..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconEmojiSmile.svg +++ /dev/null @@ -1,6 +0,0 @@ - - - - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconExclamationCircle-1.svg b/packages/stream_core_flutter/assets_source/icons/IconExclamationCircle-1.svg deleted file mode 100644 index 39370b7d..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconExclamationCircle-1.svg +++ /dev/null @@ -1,5 +0,0 @@ - - - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconExclamationCircle.svg b/packages/stream_core_flutter/assets_source/icons/IconExclamationCircle.svg deleted file mode 100644 index f5bad009..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconExclamationCircle.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconExclamationTriangle-1.svg b/packages/stream_core_flutter/assets_source/icons/IconExclamationTriangle-1.svg deleted file mode 100644 index 2ce1db75..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconExclamationTriangle-1.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconExclamationTriangle.svg b/packages/stream_core_flutter/assets_source/icons/IconExclamationTriangle.svg deleted file mode 100644 index 2bfd4eaf..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconExclamationTriangle.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconEyeOpen.svg b/packages/stream_core_flutter/assets_source/icons/IconEyeOpen.svg deleted file mode 100644 index eaefa15b..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconEyeOpen.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconFileArrowLeftIn.svg b/packages/stream_core_flutter/assets_source/icons/IconFileArrowLeftIn.svg deleted file mode 100644 index 371f4a90..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconFileArrowLeftIn.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconFileBend.svg b/packages/stream_core_flutter/assets_source/icons/IconFileBend.svg deleted file mode 100644 index 5bc579cb..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconFileBend.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconFilledCircleInfoTooltip.svg b/packages/stream_core_flutter/assets_source/icons/IconFilledCircleInfoTooltip.svg deleted file mode 100644 index c8e6c3a4..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconFilledCircleInfoTooltip.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconFilter1.svg b/packages/stream_core_flutter/assets_source/icons/IconFilter1.svg deleted file mode 100644 index 627c10a8..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconFilter1.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconFlag2.svg b/packages/stream_core_flutter/assets_source/icons/IconFlag2.svg deleted file mode 100644 index 1f88282c..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconFlag2.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconFolder1.svg b/packages/stream_core_flutter/assets_source/icons/IconFolder1.svg deleted file mode 100644 index 5d74111e..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconFolder1.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconGauge.svg b/packages/stream_core_flutter/assets_source/icons/IconGauge.svg deleted file mode 100644 index e38e4e44..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconGauge.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconGoogle.svg b/packages/stream_core_flutter/assets_source/icons/IconGoogle.svg deleted file mode 100644 index f9d25501..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconGoogle.svg +++ /dev/null @@ -1,6 +0,0 @@ - - - - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconHashtagChannel.svg b/packages/stream_core_flutter/assets_source/icons/IconHashtagChannel.svg deleted file mode 100644 index ea4c3239..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconHashtagChannel.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconHeart2.svg b/packages/stream_core_flutter/assets_source/icons/IconHeart2.svg deleted file mode 100644 index cb40f130..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconHeart2.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconHistory.svg b/packages/stream_core_flutter/assets_source/icons/IconHistory.svg deleted file mode 100644 index df92a381..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconHistory.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconImages1Alt.svg b/packages/stream_core_flutter/assets_source/icons/IconImages1Alt.svg deleted file mode 100644 index 0bf92779..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconImages1Alt.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconInvite.svg b/packages/stream_core_flutter/assets_source/icons/IconInvite.svg deleted file mode 100644 index 708ea4fd..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconInvite.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconLayersBehind.svg b/packages/stream_core_flutter/assets_source/icons/IconLayersBehind.svg deleted file mode 100644 index aea5ebe9..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconLayersBehind.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconLayoutAlignLeft.svg b/packages/stream_core_flutter/assets_source/icons/IconLayoutAlignLeft.svg deleted file mode 100644 index ffb95aea..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconLayoutAlignLeft.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconLayoutGrid1.svg b/packages/stream_core_flutter/assets_source/icons/IconLayoutGrid1.svg deleted file mode 100644 index fcda5b2f..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconLayoutGrid1.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconLayoutGrid2.svg b/packages/stream_core_flutter/assets_source/icons/IconLayoutGrid2.svg deleted file mode 100644 index df662e4d..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconLayoutGrid2.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconLayoutLeft.svg b/packages/stream_core_flutter/assets_source/icons/IconLayoutLeft.svg deleted file mode 100644 index cf74cdc2..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconLayoutLeft.svg +++ /dev/null @@ -1,4 +0,0 @@ - - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconLightBulbSimple.svg b/packages/stream_core_flutter/assets_source/icons/IconLightBulbSimple.svg deleted file mode 100644 index 0e27d852..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconLightBulbSimple.svg +++ /dev/null @@ -1,4 +0,0 @@ - - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconLimits.svg b/packages/stream_core_flutter/assets_source/icons/IconLimits.svg deleted file mode 100644 index ca2866e0..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconLimits.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconLineChart3.svg b/packages/stream_core_flutter/assets_source/icons/IconLineChart3.svg deleted file mode 100644 index 1b137e29..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconLineChart3.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconLock.svg b/packages/stream_core_flutter/assets_source/icons/IconLock.svg deleted file mode 100644 index bdef94e5..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconLock.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconMagnifyingGlassSearch.svg b/packages/stream_core_flutter/assets_source/icons/IconMagnifyingGlassSearch.svg deleted file mode 100644 index 44f4ea73..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconMagnifyingGlassSearch.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconMapPin.svg b/packages/stream_core_flutter/assets_source/icons/IconMapPin.svg deleted file mode 100644 index c0145afc..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconMapPin.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconMicrophone.svg b/packages/stream_core_flutter/assets_source/icons/IconMicrophone.svg deleted file mode 100644 index 83bbc1ef..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconMicrophone.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconMicrophoneSolid.svg b/packages/stream_core_flutter/assets_source/icons/IconMicrophoneSolid.svg deleted file mode 100644 index d8e68674..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconMicrophoneSolid.svg +++ /dev/null @@ -1,4 +0,0 @@ - - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconMinusLarge.svg b/packages/stream_core_flutter/assets_source/icons/IconMinusLarge.svg deleted file mode 100644 index ee982bc4..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconMinusLarge.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconMinusSmall.svg b/packages/stream_core_flutter/assets_source/icons/IconMinusSmall.svg deleted file mode 100644 index 6999b738..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconMinusSmall.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconMute.svg b/packages/stream_core_flutter/assets_source/icons/IconMute.svg deleted file mode 100644 index 000eb9e1..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconMute.svg +++ /dev/null @@ -1,4 +0,0 @@ - - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconNewspaper2.svg b/packages/stream_core_flutter/assets_source/icons/IconNewspaper2.svg deleted file mode 100644 index b0af0dea..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconNewspaper2.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconOrganization.svg b/packages/stream_core_flutter/assets_source/icons/IconOrganization.svg deleted file mode 100644 index b3ebecf7..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconOrganization.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconPaperPlane.svg b/packages/stream_core_flutter/assets_source/icons/IconPaperPlane.svg deleted file mode 100644 index 7f5efa2f..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconPaperPlane.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconPaperPlaneTopRight.svg b/packages/stream_core_flutter/assets_source/icons/IconPaperPlaneTopRight.svg deleted file mode 100644 index 25fabb54..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconPaperPlaneTopRight.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconPaperclip1.svg b/packages/stream_core_flutter/assets_source/icons/IconPaperclip1.svg deleted file mode 100644 index d552945b..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconPaperclip1.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconParagraphsText.svg b/packages/stream_core_flutter/assets_source/icons/IconParagraphsText.svg deleted file mode 100644 index 5dfb4a69..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconParagraphsText.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconPause.svg b/packages/stream_core_flutter/assets_source/icons/IconPause.svg deleted file mode 100644 index 42dbbdeb..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconPause.svg +++ /dev/null @@ -1,4 +0,0 @@ - - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconPencil.svg b/packages/stream_core_flutter/assets_source/icons/IconPencil.svg deleted file mode 100644 index 6b4fb583..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconPencil.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconPeople.svg b/packages/stream_core_flutter/assets_source/icons/IconPeople.svg deleted file mode 100644 index 1f0e521e..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconPeople.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconPeople2.svg b/packages/stream_core_flutter/assets_source/icons/IconPeople2.svg deleted file mode 100644 index 1973d88f..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconPeople2.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconPeopleAdd.svg b/packages/stream_core_flutter/assets_source/icons/IconPeopleAdd.svg deleted file mode 100644 index 2011951e..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconPeopleAdd.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconPeopleAdded.svg b/packages/stream_core_flutter/assets_source/icons/IconPeopleAdded.svg deleted file mode 100644 index fdf85e3a..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconPeopleAdded.svg +++ /dev/null @@ -1,5 +0,0 @@ - - - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconPeopleCircle.svg b/packages/stream_core_flutter/assets_source/icons/IconPeopleCircle.svg deleted file mode 100644 index 9d1c7db2..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconPeopleCircle.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconPeopleCopy.svg b/packages/stream_core_flutter/assets_source/icons/IconPeopleCopy.svg deleted file mode 100644 index 9a0eb3aa..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconPeopleCopy.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconPeopleEditUserRights.svg b/packages/stream_core_flutter/assets_source/icons/IconPeopleEditUserRights.svg deleted file mode 100644 index b5679ac2..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconPeopleEditUserRights.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconPeopleRemove.svg b/packages/stream_core_flutter/assets_source/icons/IconPeopleRemove.svg deleted file mode 100644 index 9c07eacd..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconPeopleRemove.svg +++ /dev/null @@ -1,5 +0,0 @@ - - - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconPersona.svg b/packages/stream_core_flutter/assets_source/icons/IconPersona.svg deleted file mode 100644 index 75366bb6..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconPersona.svg +++ /dev/null @@ -1,17 +0,0 @@ - - - - - - - - - - - - - - - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconPin.svg b/packages/stream_core_flutter/assets_source/icons/IconPin.svg deleted file mode 100644 index f668c95f..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconPin.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconPlaySolid.svg b/packages/stream_core_flutter/assets_source/icons/IconPlaySolid.svg deleted file mode 100644 index 134c502a..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconPlaySolid.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconPlusLarge.svg b/packages/stream_core_flutter/assets_source/icons/IconPlusLarge.svg deleted file mode 100644 index 8cffdbb1..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconPlusLarge.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconPlusSmall.svg b/packages/stream_core_flutter/assets_source/icons/IconPlusSmall.svg deleted file mode 100644 index 6f01deff..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconPlusSmall.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconRunShortcut.svg b/packages/stream_core_flutter/assets_source/icons/IconRunShortcut.svg deleted file mode 100644 index 65c6395d..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconRunShortcut.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconSearchText.svg b/packages/stream_core_flutter/assets_source/icons/IconSearchText.svg deleted file mode 100644 index aafa7971..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconSearchText.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconSettingsGear2.svg b/packages/stream_core_flutter/assets_source/icons/IconSettingsGear2.svg deleted file mode 100644 index d081c18f..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconSettingsGear2.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconSettingsSliderVer.svg b/packages/stream_core_flutter/assets_source/icons/IconSettingsSliderVer.svg deleted file mode 100644 index b5b558ca..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconSettingsSliderVer.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconShapesPlusCloseSquareCircle.svg b/packages/stream_core_flutter/assets_source/icons/IconShapesPlusCloseSquareCircle.svg deleted file mode 100644 index df8c3116..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconShapesPlusCloseSquareCircle.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconShapesTriangleSquareCircle.svg b/packages/stream_core_flutter/assets_source/icons/IconShapesTriangleSquareCircle.svg deleted file mode 100644 index d602272a..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconShapesTriangleSquareCircle.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconShareOs.svg b/packages/stream_core_flutter/assets_source/icons/IconShareOs.svg deleted file mode 100644 index 33f09433..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconShareOs.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconShareRedirectLink.svg b/packages/stream_core_flutter/assets_source/icons/IconShareRedirectLink.svg deleted file mode 100644 index bb446ee6..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconShareRedirectLink.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconShield.svg b/packages/stream_core_flutter/assets_source/icons/IconShield.svg deleted file mode 100644 index 8adb39df..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconShield.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconSquareBehindSquare2_Copy.svg b/packages/stream_core_flutter/assets_source/icons/IconSquareBehindSquare2_Copy.svg deleted file mode 100644 index 823e9f18..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconSquareBehindSquare2_Copy.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconSquareCircleTopRightFeeds.svg b/packages/stream_core_flutter/assets_source/icons/IconSquareCircleTopRightFeeds.svg deleted file mode 100644 index a081e301..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconSquareCircleTopRightFeeds.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconStop.svg b/packages/stream_core_flutter/assets_source/icons/IconStop.svg deleted file mode 100644 index 26728fda..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconStop.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconTable.svg b/packages/stream_core_flutter/assets_source/icons/IconTable.svg deleted file mode 100644 index 11d3250a..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconTable.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconTeam.svg b/packages/stream_core_flutter/assets_source/icons/IconTeam.svg deleted file mode 100644 index 9c198b97..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconTeam.svg +++ /dev/null @@ -1,10 +0,0 @@ - - - - - - - - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconTennis.svg b/packages/stream_core_flutter/assets_source/icons/IconTennis.svg deleted file mode 100644 index 7bde408b..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconTennis.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconTextToImageURLEnrichment.svg b/packages/stream_core_flutter/assets_source/icons/IconTextToImageURLEnrichment.svg deleted file mode 100644 index 64a0ab3c..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconTextToImageURLEnrichment.svg +++ /dev/null @@ -1,8 +0,0 @@ - - - - - - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconThunder.svg b/packages/stream_core_flutter/assets_source/icons/IconThunder.svg deleted file mode 100644 index 0c772ea0..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconThunder.svg +++ /dev/null @@ -1,10 +0,0 @@ - - - - - - - - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconTranslate.svg b/packages/stream_core_flutter/assets_source/icons/IconTranslate.svg deleted file mode 100644 index c305fa99..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconTranslate.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconTrashBin.svg b/packages/stream_core_flutter/assets_source/icons/IconTrashBin.svg deleted file mode 100644 index c020235b..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconTrashBin.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconTrending4.svg b/packages/stream_core_flutter/assets_source/icons/IconTrending4.svg deleted file mode 100644 index 714767d1..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconTrending4.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconTrophy.svg b/packages/stream_core_flutter/assets_source/icons/IconTrophy.svg deleted file mode 100644 index 2baab779..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconTrophy.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconUnlocked.svg b/packages/stream_core_flutter/assets_source/icons/IconUnlocked.svg deleted file mode 100644 index 13d63981..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconUnlocked.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconUnpin.svg b/packages/stream_core_flutter/assets_source/icons/IconUnpin.svg deleted file mode 100644 index 030b714b..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconUnpin.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconUsers.svg b/packages/stream_core_flutter/assets_source/icons/IconUsers.svg deleted file mode 100644 index 245055d2..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconUsers.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconVideo.svg b/packages/stream_core_flutter/assets_source/icons/IconVideo.svg deleted file mode 100644 index f1056073..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconVideo.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconVideoSolid.svg b/packages/stream_core_flutter/assets_source/icons/IconVideoSolid.svg deleted file mode 100644 index ef432565..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconVideoSolid.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconVoiceAndVideo.svg b/packages/stream_core_flutter/assets_source/icons/IconVoiceAndVideo.svg deleted file mode 100644 index daf812fe..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconVoiceAndVideo.svg +++ /dev/null @@ -1,10 +0,0 @@ - - - - - - - - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconVoiceHigh.svg b/packages/stream_core_flutter/assets_source/icons/IconVoiceHigh.svg deleted file mode 100644 index 6558962c..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconVoiceHigh.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconVolumeFull.svg b/packages/stream_core_flutter/assets_source/icons/IconVolumeFull.svg deleted file mode 100644 index 22d105df..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconVolumeFull.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/assets_source/icons/IconWebhook.svg b/packages/stream_core_flutter/assets_source/icons/IconWebhook.svg deleted file mode 100644 index 0c285f36..00000000 --- a/packages/stream_core_flutter/assets_source/icons/IconWebhook.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/packages/stream_core_flutter/lib/fonts/stream_icons_font.otf b/packages/stream_core_flutter/lib/fonts/stream_icons_font.otf index 929a1cba..8d5f63f3 100644 Binary files a/packages/stream_core_flutter/lib/fonts/stream_icons_font.otf and b/packages/stream_core_flutter/lib/fonts/stream_icons_font.otf differ diff --git a/packages/stream_core_flutter/lib/src/components/avatar/stream_avatar_group.dart b/packages/stream_core_flutter/lib/src/components/avatar/stream_avatar_group.dart index 0190e303..249a8196 100644 --- a/packages/stream_core_flutter/lib/src/components/avatar/stream_avatar_group.dart +++ b/packages/stream_core_flutter/lib/src/components/avatar/stream_avatar_group.dart @@ -207,7 +207,7 @@ class DefaultStreamAvatarGroup extends StatelessWidget { child: Align( alignment: AlignmentDirectional.topStart, child: StreamAvatar( - placeholder: (context) => Icon(context.streamIcons.people), + placeholder: (context) => Icon(context.streamIcons.user20), ), ), ), diff --git a/packages/stream_core_flutter/lib/src/components/badge/stream_media_badge.dart b/packages/stream_core_flutter/lib/src/components/badge/stream_media_badge.dart index 654da628..12185041 100644 --- a/packages/stream_core_flutter/lib/src/components/badge/stream_media_badge.dart +++ b/packages/stream_core_flutter/lib/src/components/badge/stream_media_badge.dart @@ -56,8 +56,8 @@ class StreamMediaBadge extends StatelessWidget { children: [ Icon( switch (type) { - MediaBadgeType.video => icons.videoSolid, - MediaBadgeType.audio => icons.microphoneSolid, + MediaBadgeType.video => icons.videoFill12, + MediaBadgeType.audio => icons.voiceFill12, }, size: 12, color: colorScheme.textOnInverse, diff --git a/packages/stream_core_flutter/lib/src/components/badge/stream_retry_badge.dart b/packages/stream_core_flutter/lib/src/components/badge/stream_retry_badge.dart index e6d3b2e8..6db5f783 100644 --- a/packages/stream_core_flutter/lib/src/components/badge/stream_retry_badge.dart +++ b/packages/stream_core_flutter/lib/src/components/badge/stream_retry_badge.dart @@ -132,7 +132,7 @@ class DefaultStreamRetryBadge extends StatelessWidget { ), child: Center( child: Icon( - icons.arrowRotateClockwise, + icons.retry16, size: effectiveSize.iconSize, color: colorScheme.textOnAccent, ), diff --git a/packages/stream_core_flutter/lib/src/components/common/stream_checkbox.dart b/packages/stream_core_flutter/lib/src/components/common/stream_checkbox.dart index 5c9edf63..34d23871 100644 --- a/packages/stream_core_flutter/lib/src/components/common/stream_checkbox.dart +++ b/packages/stream_core_flutter/lib/src/components/common/stream_checkbox.dart @@ -189,7 +189,7 @@ class DefaultStreamCheckbox extends StatelessWidget { }, isSelected: props.value, iconSize: effectiveCheckSize, - icon: Icon(icons.checkmark2Small), + icon: Icon(icons.checkmark16), style: ButtonStyle( tapTargetSize: .shrinkWrap, visualDensity: .standard, diff --git a/packages/stream_core_flutter/lib/src/components/common/stream_network_image.dart b/packages/stream_core_flutter/lib/src/components/common/stream_network_image.dart index 32c966bb..b3c3307e 100644 --- a/packages/stream_core_flutter/lib/src/components/common/stream_network_image.dart +++ b/packages/stream_core_flutter/lib/src/components/common/stream_network_image.dart @@ -463,7 +463,7 @@ class StreamImageErrorPlaceholder extends StatelessWidget { child: Center( child: Icon( size: 32, - icons.images1Alt, + icons.image32, color: colorScheme.accentNeutral, ), ), diff --git a/packages/stream_core_flutter/lib/src/components/controls/stream_command_chip.dart b/packages/stream_core_flutter/lib/src/components/controls/stream_command_chip.dart index 69f6b9e6..0aaed811 100644 --- a/packages/stream_core_flutter/lib/src/components/controls/stream_command_chip.dart +++ b/packages/stream_core_flutter/lib/src/components/controls/stream_command_chip.dart @@ -95,7 +95,7 @@ class DefaultStreamCommandChip extends StatelessWidget { spacing: defaults.spacing.xxxs, children: [ Icon( - context.streamIcons.thunder, + context.streamIcons.bolt12, size: 12, color: effectiveForegroundColor, ), @@ -115,7 +115,7 @@ class DefaultStreamCommandChip extends StatelessWidget { width: 16, height: 16, child: Icon( - context.streamIcons.crossMedium, + context.streamIcons.xmark12, size: 12, color: effectiveForegroundColor, ), diff --git a/packages/stream_core_flutter/lib/src/components/controls/stream_emoji_chip.dart b/packages/stream_core_flutter/lib/src/components/controls/stream_emoji_chip.dart index a7a8f401..357d9048 100644 --- a/packages/stream_core_flutter/lib/src/components/controls/stream_emoji_chip.dart +++ b/packages/stream_core_flutter/lib/src/components/controls/stream_emoji_chip.dart @@ -233,7 +233,7 @@ class _AddEmojiIcon extends StatelessWidget { const _AddEmojiIcon(); @override - Widget build(BuildContext context) => Icon(context.streamIcons.emojiAddReaction); + Widget build(BuildContext context) => Icon(context.streamIcons.emojiAdd20); } // Overflow chip that renders `+N` as a single text label styled with the diff --git a/packages/stream_core_flutter/lib/src/components/controls/stream_remove_control.dart b/packages/stream_core_flutter/lib/src/components/controls/stream_remove_control.dart index 27c30151..61749dcb 100644 --- a/packages/stream_core_flutter/lib/src/components/controls/stream_remove_control.dart +++ b/packages/stream_core_flutter/lib/src/components/controls/stream_remove_control.dart @@ -26,7 +26,7 @@ class StreamRemoveControl extends StatelessWidget { height: 20, width: 20, child: Icon( - context.streamIcons.crossSmall, + context.streamIcons.xmark12, color: colorScheme.textOnInverse, size: 10, ), diff --git a/packages/stream_core_flutter/lib/src/components/message_composer/attachment/message_composer_link_preview_attachment.dart b/packages/stream_core_flutter/lib/src/components/message_composer/attachment/message_composer_link_preview_attachment.dart index ab53e092..f77d9c28 100644 --- a/packages/stream_core_flutter/lib/src/components/message_composer/attachment/message_composer_link_preview_attachment.dart +++ b/packages/stream_core_flutter/lib/src/components/message_composer/attachment/message_composer_link_preview_attachment.dart @@ -75,7 +75,7 @@ class MessageComposerLinkPreviewAttachment extends StatelessWidget { if (url case final url?) Row( children: [ - Icon(context.streamIcons.chainLink3, size: 12), + Icon(context.streamIcons.link12, size: 12), SizedBox(width: spacing.xxs), Expanded( child: Text( diff --git a/packages/stream_core_flutter/lib/src/components/message_composer/message_composer_input_trailing.dart b/packages/stream_core_flutter/lib/src/components/message_composer/message_composer_input_trailing.dart index a4e766dc..bf8654e8 100644 --- a/packages/stream_core_flutter/lib/src/components/message_composer/message_composer_input_trailing.dart +++ b/packages/stream_core_flutter/lib/src/components/message_composer/message_composer_input_trailing.dart @@ -36,8 +36,8 @@ class StreamCoreMessageComposerInputTrailing extends StatelessWidget { icon: buttonState == StreamMessageComposerInputTrailingState.edit || buttonState == StreamMessageComposerInputTrailingState.command - ? context.streamIcons.checkmark2Small - : context.streamIcons.paperPlane, + ? context.streamIcons.checkmark20 + : context.streamIcons.send20, size: StreamButtonSize.small, onTap: onSendPressed, ); @@ -81,7 +81,7 @@ class StreamVoiceRecordingButton extends StatelessWidget { ), ), child: StreamButton.icon( - icon: context.streamIcons.microphone, + icon: context.streamIcons.voice20, type: StreamButtonType.ghost, style: StreamButtonStyle.secondary, size: StreamButtonSize.small, diff --git a/packages/stream_core_flutter/lib/src/components/reaction/stream_reaction_picker.dart b/packages/stream_core_flutter/lib/src/components/reaction/stream_reaction_picker.dart index bf1f5193..9f603fe8 100644 --- a/packages/stream_core_flutter/lib/src/components/reaction/stream_reaction_picker.dart +++ b/packages/stream_core_flutter/lib/src/components/reaction/stream_reaction_picker.dart @@ -206,7 +206,7 @@ class DefaultStreamReactionPicker extends StatelessWidget { size: .small, type: .outline, style: .secondary, - icon: icons.plusLarge, + icon: icons.plus20, onTap: props.onAddReactionTap, ), ], diff --git a/packages/stream_core_flutter/lib/src/theme/primitives/stream_icons.dart b/packages/stream_core_flutter/lib/src/theme/primitives/stream_icons.dart index 3d1b0c61..ec779204 100644 --- a/packages/stream_core_flutter/lib/src/theme/primitives/stream_icons.dart +++ b/packages/stream_core_flutter/lib/src/theme/primitives/stream_icons.dart @@ -58,641 +58,1433 @@ part 'stream_icons.g.dart'; class StreamIcons with _$StreamIcons { /// Creates an icon set with optional overrides. const StreamIcons({ - this.apiAggregate = StreamIconData.iconApiAggregate, - this.apples = StreamIconData.iconApples, - this.archive1 = StreamIconData.iconArchive1, - this.arrowBoxLeft = StreamIconData.iconArrowBoxLeft, - this.arrowDown = StreamIconData.iconArrowDown, - this.arrowDownCircle = StreamIconData.iconArrowDownCircle, - this.arrowLeft = StreamIconData.iconArrowLeft, - this.arrowRight = StreamIconData.iconArrowRight, - this.arrowRotateClockwise = StreamIconData.iconArrowRotateClockwise, - this.arrowRotateRightLeftRepeatRefresh = StreamIconData.iconArrowRotateRightLeftRepeatRefresh, - this.arrowShareLeft = StreamIconData.iconArrowShareLeft, - this.arrowShareRight = StreamIconData.iconArrowShareRight, - this.arrowUp = StreamIconData.iconArrowUp, - this.arrowUpRight = StreamIconData.iconArrowUpRight, - this.arrowsRepeatLeftRight = StreamIconData.iconArrowsRepeatLeftRight, - this.at = StreamIconData.iconAt, - this.atSolid = StreamIconData.iconAtSolid, - this.bellNotification = StreamIconData.iconBellNotification, - this.bellOff = StreamIconData.iconBellOff, - this.bookmark = StreamIconData.iconBookmark, - this.bookmarkRemove = StreamIconData.iconBookmarkRemove, - this.browserAISparkle = StreamIconData.iconBrowserAISparkle, - this.bubble3ChatMessage = StreamIconData.iconBubble3ChatMessage, - this.bubble3Solid = StreamIconData.iconBubble3Solid, - this.bubbleAnnotation2ChatMessage = StreamIconData.iconBubbleAnnotation2ChatMessage, - this.bubbleText6ChatMessage = StreamIconData.iconBubbleText6ChatMessage, - this.bubbleText6Solid = StreamIconData.iconBubbleText6Solid, - this.bubbleWideNotificationChatMessage = StreamIconData.iconBubbleWideNotificationChatMessage, - this.bubbleWideSparkleChatMessage = StreamIconData.iconBubbleWideSparkleChatMessage, - this.bubbles = StreamIconData.iconBubbles, - this.calendar1 = StreamIconData.iconCalendar1, - this.callCancel = StreamIconData.iconCallCancel, - this.camera1 = StreamIconData.iconCamera1, - this.car1 = StreamIconData.iconCar1, - this.cat = StreamIconData.iconCat, - this.chainLink3 = StreamIconData.iconChainLink3, - this.chart5 = StreamIconData.iconChart5, - this.checkmark1Small = StreamIconData.iconCheckmark1Small, - this.checkmark2 = StreamIconData.iconCheckmark2, - this.checkmark2Small = StreamIconData.iconCheckmark2Small, - this.chevronDown = StreamIconData.iconChevronDown, - this.chevronGrabberVerticalSelector = StreamIconData.iconChevronGrabberVerticalSelector, - this.chevronLeft = StreamIconData.iconChevronLeft, - this.chevronRight = StreamIconData.iconChevronRight, - this.chevronTop = StreamIconData.iconChevronTop, - this.circleBanSign = StreamIconData.iconCircleBanSign, - this.circleCheck = StreamIconData.iconCircleCheck, - this.circleInfoTooltip = StreamIconData.iconCircleInfoTooltip, - this.circleMinus = StreamIconData.iconCircleMinus, - this.circleQuestionmark = StreamIconData.iconCircleQuestionmark, - this.circleQuestionmarkFilled = StreamIconData.iconCircleQuestionmarkFilled, - this.circleX = StreamIconData.iconCircleX, - this.clock = StreamIconData.iconClock, - this.clockSolid = StreamIconData.iconClockSolid, - this.closeQuote2 = StreamIconData.iconCloseQuote2, - this.cloudSimpleUpload = StreamIconData.iconCloudSimpleUpload, - this.code = StreamIconData.iconCode, - this.codeBrackets = StreamIconData.iconCodeBrackets, - this.codeEditorInsert = StreamIconData.iconCodeEditorInsert, - this.compass = StreamIconData.iconCompass, - this.components = StreamIconData.iconComponents, - this.creditCard2Billing = StreamIconData.iconCreditCard2Billing, - this.crossMedium = StreamIconData.iconCrossMedium, - this.crossSmall = StreamIconData.iconCrossSmall, - this.dotGrid1x3Horizontal = StreamIconData.iconDotGrid1x3Horizontal, - this.dotGrid2x3 = StreamIconData.iconDotGrid2x3, - this.dotsGrid1x3Vertical = StreamIconData.iconDotsGrid1x3Vertical, - this.doupleCheckmark1Small = StreamIconData.iconDoupleCheckmark1Small, - this.editBig = StreamIconData.iconEditBig, - this.editBigSolid = StreamIconData.iconEditBigSolid, - this.emojiAddReaction = StreamIconData.iconEmojiAddReaction, - this.emojiSad = StreamIconData.iconEmojiSad, - this.emojiSmile = StreamIconData.iconEmojiSmile, - this.exclamationCircle = StreamIconData.iconExclamationCircle, - this.exclamationCircle1 = StreamIconData.iconExclamationCircle1, - this.exclamationTriangle = StreamIconData.iconExclamationTriangle, - this.exclamationTriangle1 = StreamIconData.iconExclamationTriangle1, - this.eyeOpen = StreamIconData.iconEyeOpen, - this.fileArrowLeftIn = StreamIconData.iconFileArrowLeftIn, - this.fileBend = StreamIconData.iconFileBend, - this.filledCircleInfoTooltip = StreamIconData.iconFilledCircleInfoTooltip, - this.filter1 = StreamIconData.iconFilter1, - this.flag2 = StreamIconData.iconFlag2, - this.folder1 = StreamIconData.iconFolder1, - this.gauge = StreamIconData.iconGauge, - this.google = StreamIconData.iconGoogle, - this.hashtagChannel = StreamIconData.iconHashtagChannel, - this.heart2 = StreamIconData.iconHeart2, - this.history = StreamIconData.iconHistory, - this.images1Alt = StreamIconData.iconImages1Alt, - this.invite = StreamIconData.iconInvite, - this.layersBehind = StreamIconData.iconLayersBehind, - this.layoutAlignLeft = StreamIconData.iconLayoutAlignLeft, - this.layoutGrid1 = StreamIconData.iconLayoutGrid1, - this.layoutGrid2 = StreamIconData.iconLayoutGrid2, - this.layoutLeft = StreamIconData.iconLayoutLeft, - this.lightBulbSimple = StreamIconData.iconLightBulbSimple, - this.limits = StreamIconData.iconLimits, - this.lineChart3 = StreamIconData.iconLineChart3, - this.lock = StreamIconData.iconLock, - this.magnifyingGlassSearch = StreamIconData.iconMagnifyingGlassSearch, - this.mapPin = StreamIconData.iconMapPin, - this.microphone = StreamIconData.iconMicrophone, - this.microphoneSolid = StreamIconData.iconMicrophoneSolid, - this.minusLarge = StreamIconData.iconMinusLarge, - this.minusSmall = StreamIconData.iconMinusSmall, - this.mute = StreamIconData.iconMute, - this.newspaper2 = StreamIconData.iconNewspaper2, - this.organization = StreamIconData.iconOrganization, - this.paperPlane = StreamIconData.iconPaperPlane, - this.paperPlaneTopRight = StreamIconData.iconPaperPlaneTopRight, - this.paperclip1 = StreamIconData.iconPaperclip1, - this.paragraphsText = StreamIconData.iconParagraphsText, - this.pause = StreamIconData.iconPause, - this.pencil = StreamIconData.iconPencil, - this.people = StreamIconData.iconPeople, - this.people2 = StreamIconData.iconPeople2, - this.peopleAdd = StreamIconData.iconPeopleAdd, - this.peopleAdded = StreamIconData.iconPeopleAdded, - this.peopleCircle = StreamIconData.iconPeopleCircle, - this.peopleCopy = StreamIconData.iconPeopleCopy, - this.peopleEditUserRights = StreamIconData.iconPeopleEditUserRights, - this.peopleRemove = StreamIconData.iconPeopleRemove, - this.persona = StreamIconData.iconPersona, - this.pin = StreamIconData.iconPin, - this.playSolid = StreamIconData.iconPlaySolid, - this.plusLarge = StreamIconData.iconPlusLarge, - this.plusSmall = StreamIconData.iconPlusSmall, - this.runShortcut = StreamIconData.iconRunShortcut, - this.searchText = StreamIconData.iconSearchText, - this.settingsGear2 = StreamIconData.iconSettingsGear2, - this.settingsSliderVer = StreamIconData.iconSettingsSliderVer, - this.shapesPlusCloseSquareCircle = StreamIconData.iconShapesPlusCloseSquareCircle, - this.shapesTriangleSquareCircle = StreamIconData.iconShapesTriangleSquareCircle, - this.shareOs = StreamIconData.iconShareOs, - this.shareRedirectLink = StreamIconData.iconShareRedirectLink, - this.shield = StreamIconData.iconShield, - this.squareBehindSquare2Copy = StreamIconData.iconSquareBehindSquare2Copy, - this.squareCircleTopRightFeeds = StreamIconData.iconSquareCircleTopRightFeeds, - this.stop = StreamIconData.iconStop, - this.table = StreamIconData.iconTable, - this.team = StreamIconData.iconTeam, - this.tennis = StreamIconData.iconTennis, - this.textToImageURLEnrichment = StreamIconData.iconTextToImageURLEnrichment, - this.thunder = StreamIconData.iconThunder, - this.translate = StreamIconData.iconTranslate, - this.trashBin = StreamIconData.iconTrashBin, - this.trending4 = StreamIconData.iconTrending4, - this.trophy = StreamIconData.iconTrophy, - this.unlocked = StreamIconData.iconUnlocked, - this.unpin = StreamIconData.iconUnpin, - this.users = StreamIconData.iconUsers, - this.video = StreamIconData.iconVideo, - this.videoSolid = StreamIconData.iconVideoSolid, - this.voiceAndVideo = StreamIconData.iconVoiceAndVideo, - this.voiceHigh = StreamIconData.iconVoiceHigh, - this.volumeFull = StreamIconData.iconVolumeFull, - this.webhook = StreamIconData.iconWebhook, + this.account12 = StreamIconData.account12, + this.account16 = StreamIconData.account16, + this.account20 = StreamIconData.account20, + this.account32 = StreamIconData.account32, + this.archive12 = StreamIconData.archive12, + this.archive16 = StreamIconData.archive16, + this.archive20 = StreamIconData.archive20, + this.archive32 = StreamIconData.archive32, + this.arrowDown12 = StreamIconData.arrowDown12, + this.arrowDown16 = StreamIconData.arrowDown16, + this.arrowDown20 = StreamIconData.arrowDown20, + this.arrowDown32 = StreamIconData.arrowDown32, + this.arrowDownCircle12 = StreamIconData.arrowDownCircle12, + this.arrowDownCircle16 = StreamIconData.arrowDownCircle16, + this.arrowDownCircle20 = StreamIconData.arrowDownCircle20, + this.arrowDownCircle32 = StreamIconData.arrowDownCircle32, + this.arrowLeft12 = StreamIconData.arrowLeft12, + this.arrowLeft16 = StreamIconData.arrowLeft16, + this.arrowLeft20 = StreamIconData.arrowLeft20, + this.arrowLeft32 = StreamIconData.arrowLeft32, + this.arrowRight12 = StreamIconData.arrowRight12, + this.arrowRight16 = StreamIconData.arrowRight16, + this.arrowRight20 = StreamIconData.arrowRight20, + this.arrowRight32 = StreamIconData.arrowRight32, + this.arrowUp12 = StreamIconData.arrowUp12, + this.arrowUp16 = StreamIconData.arrowUp16, + this.arrowUp20 = StreamIconData.arrowUp20, + this.arrowUp32 = StreamIconData.arrowUp32, + this.arrowUpRight12 = StreamIconData.arrowUpRight12, + this.arrowUpRight16 = StreamIconData.arrowUpRight16, + this.arrowUpRight20 = StreamIconData.arrowUpRight20, + this.arrowUpRight32 = StreamIconData.arrowUpRight32, + this.attachment12 = StreamIconData.attachment12, + this.attachment16 = StreamIconData.attachment16, + this.attachment20 = StreamIconData.attachment20, + this.attachment32 = StreamIconData.attachment32, + this.audio12 = StreamIconData.audio12, + this.audio16 = StreamIconData.audio16, + this.audio20 = StreamIconData.audio20, + this.audio32 = StreamIconData.audio32, + this.bell12 = StreamIconData.bell12, + this.bell16 = StreamIconData.bell16, + this.bell20 = StreamIconData.bell20, + this.bell32 = StreamIconData.bell32, + this.bellOff12 = StreamIconData.bellOff12, + this.bellOff16 = StreamIconData.bellOff16, + this.bellOff20 = StreamIconData.bellOff20, + this.bellOff32 = StreamIconData.bellOff32, + this.bolt12 = StreamIconData.bolt12, + this.bolt16 = StreamIconData.bolt16, + this.bolt20 = StreamIconData.bolt20, + this.bolt32 = StreamIconData.bolt32, + this.camera12 = StreamIconData.camera12, + this.camera16 = StreamIconData.camera16, + this.camera20 = StreamIconData.camera20, + this.camera32 = StreamIconData.camera32, + this.checkmark12 = StreamIconData.checkmark12, + this.checkmark16 = StreamIconData.checkmark16, + this.checkmark20 = StreamIconData.checkmark20, + this.checkmark32 = StreamIconData.checkmark32, + this.checks12 = StreamIconData.checks12, + this.checks16 = StreamIconData.checks16, + this.checks20 = StreamIconData.checks20, + this.checks32 = StreamIconData.checks32, + this.chevronDown12 = StreamIconData.chevronDown12, + this.chevronDown16 = StreamIconData.chevronDown16, + this.chevronDown20 = StreamIconData.chevronDown20, + this.chevronDown32 = StreamIconData.chevronDown32, + this.chevronLeft12 = StreamIconData.chevronLeft12, + this.chevronLeft16 = StreamIconData.chevronLeft16, + this.chevronLeft20 = StreamIconData.chevronLeft20, + this.chevronLeft32 = StreamIconData.chevronLeft32, + this.chevronRight12 = StreamIconData.chevronRight12, + this.chevronRight16 = StreamIconData.chevronRight16, + this.chevronRight20 = StreamIconData.chevronRight20, + this.chevronRight32 = StreamIconData.chevronRight32, + this.chevronUp12 = StreamIconData.chevronUp12, + this.chevronUp16 = StreamIconData.chevronUp16, + this.chevronUp20 = StreamIconData.chevronUp20, + this.chevronUp32 = StreamIconData.chevronUp32, + this.clock12 = StreamIconData.clock12, + this.clock16 = StreamIconData.clock16, + this.clock20 = StreamIconData.clock20, + this.clock32 = StreamIconData.clock32, + this.command12 = StreamIconData.command12, + this.command16 = StreamIconData.command16, + this.command20 = StreamIconData.command20, + this.command32 = StreamIconData.command32, + this.copy12 = StreamIconData.copy12, + this.copy16 = StreamIconData.copy16, + this.copy20 = StreamIconData.copy20, + this.copy32 = StreamIconData.copy32, + this.delete12 = StreamIconData.delete12, + this.delete16 = StreamIconData.delete16, + this.delete20 = StreamIconData.delete20, + this.delete32 = StreamIconData.delete32, + this.download12 = StreamIconData.download12, + this.download16 = StreamIconData.download16, + this.download20 = StreamIconData.download20, + this.download32 = StreamIconData.download32, + this.edit12 = StreamIconData.edit12, + this.edit16 = StreamIconData.edit16, + this.edit20 = StreamIconData.edit20, + this.edit32 = StreamIconData.edit32, + this.emoji12 = StreamIconData.emoji12, + this.emoji16 = StreamIconData.emoji16, + this.emoji20 = StreamIconData.emoji20, + this.emoji32 = StreamIconData.emoji32, + this.emojiAdd12 = StreamIconData.emojiAdd12, + this.emojiAdd16 = StreamIconData.emojiAdd16, + this.emojiAdd20 = StreamIconData.emojiAdd20, + this.emojiAdd32 = StreamIconData.emojiAdd32, + this.exclamationCircle12 = StreamIconData.exclamationCircle12, + this.exclamationCircle16 = StreamIconData.exclamationCircle16, + this.exclamationCircle20 = StreamIconData.exclamationCircle20, + this.exclamationCircle32 = StreamIconData.exclamationCircle32, + this.exclamationCircleFill12 = StreamIconData.exclamationCircleFill12, + this.exclamationCircleFill16 = StreamIconData.exclamationCircleFill16, + this.exclamationCircleFill20 = StreamIconData.exclamationCircleFill20, + this.exclamationCircleFill32 = StreamIconData.exclamationCircleFill32, + this.exclamationMarkFill12 = StreamIconData.exclamationMarkFill12, + this.exclamationMarkFill16 = StreamIconData.exclamationMarkFill16, + this.exclamationMarkFill20 = StreamIconData.exclamationMarkFill20, + this.exclamationMarkFill32 = StreamIconData.exclamationMarkFill32, + this.exclamationTriangleFill12 = StreamIconData.exclamationTriangleFill12, + this.exclamationTriangleFill16 = StreamIconData.exclamationTriangleFill16, + this.exclamationTriangleFill20 = StreamIconData.exclamationTriangleFill20, + this.exclamationTriangleFill32 = StreamIconData.exclamationTriangleFill32, + this.export12 = StreamIconData.export12, + this.export16 = StreamIconData.export16, + this.export20 = StreamIconData.export20, + this.export32 = StreamIconData.export32, + this.eyeFill12 = StreamIconData.eyeFill12, + this.eyeFill16 = StreamIconData.eyeFill16, + this.eyeFill20 = StreamIconData.eyeFill20, + this.eyeFill32 = StreamIconData.eyeFill32, + this.file12 = StreamIconData.file12, + this.file16 = StreamIconData.file16, + this.file20 = StreamIconData.file20, + this.file32 = StreamIconData.file32, + this.flag12 = StreamIconData.flag12, + this.flag16 = StreamIconData.flag16, + this.flag20 = StreamIconData.flag20, + this.flag32 = StreamIconData.flag32, + this.folder12 = StreamIconData.folder12, + this.folder16 = StreamIconData.folder16, + this.folder20 = StreamIconData.folder20, + this.folder32 = StreamIconData.folder32, + this.gallery12 = StreamIconData.gallery12, + this.gallery16 = StreamIconData.gallery16, + this.gallery20 = StreamIconData.gallery20, + this.gallery32 = StreamIconData.gallery32, + this.image12 = StreamIconData.image12, + this.image16 = StreamIconData.image16, + this.image20 = StreamIconData.image20, + this.image32 = StreamIconData.image32, + this.info12 = StreamIconData.info12, + this.info16 = StreamIconData.info16, + this.info20 = StreamIconData.info20, + this.info32 = StreamIconData.info32, + this.leave12 = StreamIconData.leave12, + this.leave16 = StreamIconData.leave16, + this.leave20 = StreamIconData.leave20, + this.leave32 = StreamIconData.leave32, + this.link12 = StreamIconData.link12, + this.link16 = StreamIconData.link16, + this.link20 = StreamIconData.link20, + this.link32 = StreamIconData.link32, + this.location12 = StreamIconData.location12, + this.location16 = StreamIconData.location16, + this.location20 = StreamIconData.location20, + this.location32 = StreamIconData.location32, + this.lock12 = StreamIconData.lock12, + this.lock16 = StreamIconData.lock16, + this.lock20 = StreamIconData.lock20, + this.lock32 = StreamIconData.lock32, + this.mention12 = StreamIconData.mention12, + this.mention16 = StreamIconData.mention16, + this.mention20 = StreamIconData.mention20, + this.mention32 = StreamIconData.mention32, + this.messageBubble12 = StreamIconData.messageBubble12, + this.messageBubble16 = StreamIconData.messageBubble16, + this.messageBubble20 = StreamIconData.messageBubble20, + this.messageBubble32 = StreamIconData.messageBubble32, + this.messageBubbleFill12 = StreamIconData.messageBubbleFill12, + this.messageBubbleFill16 = StreamIconData.messageBubbleFill16, + this.messageBubbleFill20 = StreamIconData.messageBubbleFill20, + this.messageBubbleFill32 = StreamIconData.messageBubbleFill32, + this.messageBubbles12 = StreamIconData.messageBubbles12, + this.messageBubbles16 = StreamIconData.messageBubbles16, + this.messageBubbles20 = StreamIconData.messageBubbles20, + this.messageBubbles32 = StreamIconData.messageBubbles32, + this.minus12 = StreamIconData.minus12, + this.minus16 = StreamIconData.minus16, + this.minus20 = StreamIconData.minus20, + this.minus32 = StreamIconData.minus32, + this.minusCircle12 = StreamIconData.minusCircle12, + this.minusCircle16 = StreamIconData.minusCircle16, + this.minusCircle20 = StreamIconData.minusCircle20, + this.minusCircle32 = StreamIconData.minusCircle32, + this.more12 = StreamIconData.more12, + this.more16 = StreamIconData.more16, + this.more20 = StreamIconData.more20, + this.more32 = StreamIconData.more32, + this.mute12 = StreamIconData.mute12, + this.mute16 = StreamIconData.mute16, + this.mute20 = StreamIconData.mute20, + this.mute32 = StreamIconData.mute32, + this.noSign12 = StreamIconData.noSign12, + this.noSign16 = StreamIconData.noSign16, + this.noSign20 = StreamIconData.noSign20, + this.noSign32 = StreamIconData.noSign32, + this.notification12 = StreamIconData.notification12, + this.notification16 = StreamIconData.notification16, + this.notification20 = StreamIconData.notification20, + this.notification32 = StreamIconData.notification32, + this.pauseFill12 = StreamIconData.pauseFill12, + this.pauseFill16 = StreamIconData.pauseFill16, + this.pauseFill20 = StreamIconData.pauseFill20, + this.pauseFill32 = StreamIconData.pauseFill32, + this.pin12 = StreamIconData.pin12, + this.pin16 = StreamIconData.pin16, + this.pin20 = StreamIconData.pin20, + this.pin32 = StreamIconData.pin32, + this.playFill12 = StreamIconData.playFill12, + this.playFill16 = StreamIconData.playFill16, + this.playFill20 = StreamIconData.playFill20, + this.playFill32 = StreamIconData.playFill32, + this.plus12 = StreamIconData.plus12, + this.plus16 = StreamIconData.plus16, + this.plus20 = StreamIconData.plus20, + this.plus32 = StreamIconData.plus32, + this.poll12 = StreamIconData.poll12, + this.poll16 = StreamIconData.poll16, + this.poll20 = StreamIconData.poll20, + this.poll32 = StreamIconData.poll32, + this.quote12 = StreamIconData.quote12, + this.quote16 = StreamIconData.quote16, + this.quote20 = StreamIconData.quote20, + this.quote32 = StreamIconData.quote32, + this.refresh12 = StreamIconData.refresh12, + this.refresh16 = StreamIconData.refresh16, + this.refresh20 = StreamIconData.refresh20, + this.refresh32 = StreamIconData.refresh32, + this.reorder12 = StreamIconData.reorder12, + this.reorder16 = StreamIconData.reorder16, + this.reorder20 = StreamIconData.reorder20, + this.reorder32 = StreamIconData.reorder32, + this.reply12 = StreamIconData.reply12, + this.reply16 = StreamIconData.reply16, + this.reply20 = StreamIconData.reply20, + this.reply32 = StreamIconData.reply32, + this.retry12 = StreamIconData.retry12, + this.retry16 = StreamIconData.retry16, + this.retry20 = StreamIconData.retry20, + this.retry32 = StreamIconData.retry32, + this.save12 = StreamIconData.save12, + this.save16 = StreamIconData.save16, + this.save20 = StreamIconData.save20, + this.save32 = StreamIconData.save32, + this.search12 = StreamIconData.search12, + this.search16 = StreamIconData.search16, + this.search20 = StreamIconData.search20, + this.search32 = StreamIconData.search32, + this.send12 = StreamIconData.send12, + this.send16 = StreamIconData.send16, + this.send20 = StreamIconData.send20, + this.send32 = StreamIconData.send32, + this.share12 = StreamIconData.share12, + this.share16 = StreamIconData.share16, + this.share20 = StreamIconData.share20, + this.share32 = StreamIconData.share32, + this.sidebar12 = StreamIconData.sidebar12, + this.sidebar16 = StreamIconData.sidebar16, + this.sidebar20 = StreamIconData.sidebar20, + this.sidebar32 = StreamIconData.sidebar32, + this.stopFill12 = StreamIconData.stopFill12, + this.stopFill16 = StreamIconData.stopFill16, + this.stopFill20 = StreamIconData.stopFill20, + this.stopFill32 = StreamIconData.stopFill32, + this.thread12 = StreamIconData.thread12, + this.thread16 = StreamIconData.thread16, + this.thread20 = StreamIconData.thread20, + this.thread32 = StreamIconData.thread32, + this.threadFill12 = StreamIconData.threadFill12, + this.threadFill16 = StreamIconData.threadFill16, + this.threadFill20 = StreamIconData.threadFill20, + this.threadFill32 = StreamIconData.threadFill32, + this.translate12 = StreamIconData.translate12, + this.translate16 = StreamIconData.translate16, + this.translate20 = StreamIconData.translate20, + this.translate32 = StreamIconData.translate32, + this.trophy12 = StreamIconData.trophy12, + this.trophy16 = StreamIconData.trophy16, + this.trophy20 = StreamIconData.trophy20, + this.trophy32 = StreamIconData.trophy32, + this.unlock12 = StreamIconData.unlock12, + this.unlock16 = StreamIconData.unlock16, + this.unlock20 = StreamIconData.unlock20, + this.unlock32 = StreamIconData.unlock32, + this.unpin12 = StreamIconData.unpin12, + this.unpin16 = StreamIconData.unpin16, + this.unpin20 = StreamIconData.unpin20, + this.unpin32 = StreamIconData.unpin32, + this.unsave12 = StreamIconData.unsave12, + this.unsave16 = StreamIconData.unsave16, + this.unsave20 = StreamIconData.unsave20, + this.unsave32 = StreamIconData.unsave32, + this.upload12 = StreamIconData.upload12, + this.upload16 = StreamIconData.upload16, + this.upload20 = StreamIconData.upload20, + this.upload32 = StreamIconData.upload32, + this.user12 = StreamIconData.user12, + this.user16 = StreamIconData.user16, + this.user20 = StreamIconData.user20, + this.user32 = StreamIconData.user32, + this.userAdd12 = StreamIconData.userAdd12, + this.userAdd16 = StreamIconData.userAdd16, + this.userAdd20 = StreamIconData.userAdd20, + this.userAdd32 = StreamIconData.userAdd32, + this.userCheck12 = StreamIconData.userCheck12, + this.userCheck16 = StreamIconData.userCheck16, + this.userCheck20 = StreamIconData.userCheck20, + this.userCheck32 = StreamIconData.userCheck32, + this.userRemove12 = StreamIconData.userRemove12, + this.userRemove16 = StreamIconData.userRemove16, + this.userRemove20 = StreamIconData.userRemove20, + this.userRemove32 = StreamIconData.userRemove32, + this.users12 = StreamIconData.users12, + this.users16 = StreamIconData.users16, + this.users20 = StreamIconData.users20, + this.users32 = StreamIconData.users32, + this.video12 = StreamIconData.video12, + this.video16 = StreamIconData.video16, + this.video20 = StreamIconData.video20, + this.video32 = StreamIconData.video32, + this.videoFill12 = StreamIconData.videoFill12, + this.videoFill16 = StreamIconData.videoFill16, + this.videoFill20 = StreamIconData.videoFill20, + this.videoFill32 = StreamIconData.videoFill32, + this.voice12 = StreamIconData.voice12, + this.voice16 = StreamIconData.voice16, + this.voice20 = StreamIconData.voice20, + this.voice32 = StreamIconData.voice32, + this.voiceFill12 = StreamIconData.voiceFill12, + this.voiceFill16 = StreamIconData.voiceFill16, + this.voiceFill20 = StreamIconData.voiceFill20, + this.voiceFill32 = StreamIconData.voiceFill32, + this.xCircle12 = StreamIconData.xCircle12, + this.xCircle16 = StreamIconData.xCircle16, + this.xCircle20 = StreamIconData.xCircle20, + this.xCircle32 = StreamIconData.xCircle32, + this.xmark12 = StreamIconData.xmark12, + this.xmark16 = StreamIconData.xmark16, + this.xmark20 = StreamIconData.xmark20, + this.xmark32 = StreamIconData.xmark32, this.giphy = StreamSvgIconData.giphy, this.imgur = StreamSvgIconData.imgur, }); - /// The api aggregate icon. - final IconData apiAggregate; + /// The account12 icon. + final IconData account12; - /// The apples icon. - final IconData apples; + /// The account16 icon. + final IconData account16; - /// The archive1 icon. - final IconData archive1; + /// The account20 icon. + final IconData account20; - /// The arrow box left icon. - final IconData arrowBoxLeft; + /// The account32 icon. + final IconData account32; - /// The arrow down icon. - final IconData arrowDown; + /// The archive12 icon. + final IconData archive12; - /// The arrow down circle icon. - final IconData arrowDownCircle; + /// The archive16 icon. + final IconData archive16; - /// The arrow left icon. - final IconData arrowLeft; + /// The archive20 icon. + final IconData archive20; - /// The arrow right icon. - final IconData arrowRight; + /// The archive32 icon. + final IconData archive32; - /// The arrow rotate clockwise icon. - final IconData arrowRotateClockwise; + /// The arrow down12 icon. + final IconData arrowDown12; - /// The arrow rotate right left repeat refresh icon. - final IconData arrowRotateRightLeftRepeatRefresh; + /// The arrow down16 icon. + final IconData arrowDown16; - /// The arrow share left icon. - final IconData arrowShareLeft; + /// The arrow down20 icon. + final IconData arrowDown20; - /// The arrow share right icon. - final IconData arrowShareRight; + /// The arrow down32 icon. + final IconData arrowDown32; - /// The arrow up icon. - final IconData arrowUp; + /// The arrow down circle12 icon. + final IconData arrowDownCircle12; - /// The arrow up right icon. - final IconData arrowUpRight; + /// The arrow down circle16 icon. + final IconData arrowDownCircle16; - /// The arrows repeat left right icon. - final IconData arrowsRepeatLeftRight; + /// The arrow down circle20 icon. + final IconData arrowDownCircle20; - /// The at icon. - final IconData at; + /// The arrow down circle32 icon. + final IconData arrowDownCircle32; - /// The at solid icon. - final IconData atSolid; + /// The arrow left12 icon. + final IconData arrowLeft12; - /// The bell notification icon. - final IconData bellNotification; + /// The arrow left16 icon. + final IconData arrowLeft16; - /// The bell off icon. - final IconData bellOff; + /// The arrow left20 icon. + final IconData arrowLeft20; - /// The bookmark icon. - final IconData bookmark; + /// The arrow left32 icon. + final IconData arrowLeft32; - /// The bookmark remove icon. - final IconData bookmarkRemove; + /// The arrow right12 icon. + final IconData arrowRight12; - /// The browser a i sparkle icon. - final IconData browserAISparkle; + /// The arrow right16 icon. + final IconData arrowRight16; - /// The bubble3 chat message icon. - final IconData bubble3ChatMessage; + /// The arrow right20 icon. + final IconData arrowRight20; - /// The bubble3 solid icon. - final IconData bubble3Solid; + /// The arrow right32 icon. + final IconData arrowRight32; - /// The bubble annotation2 chat message icon. - final IconData bubbleAnnotation2ChatMessage; + /// The arrow up12 icon. + final IconData arrowUp12; - /// The bubble text6 chat message icon. - final IconData bubbleText6ChatMessage; + /// The arrow up16 icon. + final IconData arrowUp16; - /// The bubble text6 solid icon. - final IconData bubbleText6Solid; + /// The arrow up20 icon. + final IconData arrowUp20; - /// The bubble wide notification chat message icon. - final IconData bubbleWideNotificationChatMessage; + /// The arrow up32 icon. + final IconData arrowUp32; - /// The bubble wide sparkle chat message icon. - final IconData bubbleWideSparkleChatMessage; + /// The arrow up right12 icon. + final IconData arrowUpRight12; - /// The bubbles icon. - final IconData bubbles; + /// The arrow up right16 icon. + final IconData arrowUpRight16; - /// The calendar1 icon. - final IconData calendar1; + /// The arrow up right20 icon. + final IconData arrowUpRight20; - /// The call cancel icon. - final IconData callCancel; + /// The arrow up right32 icon. + final IconData arrowUpRight32; - /// The camera1 icon. - final IconData camera1; + /// The attachment12 icon. + final IconData attachment12; - /// The car1 icon. - final IconData car1; + /// The attachment16 icon. + final IconData attachment16; - /// The cat icon. - final IconData cat; + /// The attachment20 icon. + final IconData attachment20; - /// The chain link3 icon. - final IconData chainLink3; + /// The attachment32 icon. + final IconData attachment32; - /// The chart5 icon. - final IconData chart5; + /// The audio12 icon. + final IconData audio12; - /// The checkmark1 small icon. - final IconData checkmark1Small; + /// The audio16 icon. + final IconData audio16; - /// The checkmark2 icon. - final IconData checkmark2; + /// The audio20 icon. + final IconData audio20; - /// The checkmark2 small icon. - final IconData checkmark2Small; + /// The audio32 icon. + final IconData audio32; - /// The chevron down icon. - final IconData chevronDown; + /// The bell12 icon. + final IconData bell12; - /// The chevron grabber vertical selector icon. - final IconData chevronGrabberVerticalSelector; + /// The bell16 icon. + final IconData bell16; - /// The chevron left icon. - final IconData chevronLeft; + /// The bell20 icon. + final IconData bell20; - /// The chevron right icon. - final IconData chevronRight; + /// The bell32 icon. + final IconData bell32; - /// The chevron top icon. - final IconData chevronTop; + /// The bell off12 icon. + final IconData bellOff12; - /// The circle ban sign icon. - final IconData circleBanSign; + /// The bell off16 icon. + final IconData bellOff16; - /// The circle check icon. - final IconData circleCheck; + /// The bell off20 icon. + final IconData bellOff20; - /// The circle info tooltip icon. - final IconData circleInfoTooltip; + /// The bell off32 icon. + final IconData bellOff32; - /// The circle minus icon. - final IconData circleMinus; + /// The bolt12 icon. + final IconData bolt12; - /// The circle questionmark icon. - final IconData circleQuestionmark; + /// The bolt16 icon. + final IconData bolt16; - /// The circle questionmark filled icon. - final IconData circleQuestionmarkFilled; + /// The bolt20 icon. + final IconData bolt20; - /// The circle x icon. - final IconData circleX; + /// The bolt32 icon. + final IconData bolt32; - /// The clock icon. - final IconData clock; + /// The camera12 icon. + final IconData camera12; - /// The clock solid icon. - final IconData clockSolid; + /// The camera16 icon. + final IconData camera16; - /// The close quote2 icon. - final IconData closeQuote2; + /// The camera20 icon. + final IconData camera20; - /// The cloud simple upload icon. - final IconData cloudSimpleUpload; + /// The camera32 icon. + final IconData camera32; - /// The code icon. - final IconData code; + /// The checkmark12 icon. + final IconData checkmark12; - /// The code brackets icon. - final IconData codeBrackets; + /// The checkmark16 icon. + final IconData checkmark16; - /// The code editor insert icon. - final IconData codeEditorInsert; + /// The checkmark20 icon. + final IconData checkmark20; - /// The compass icon. - final IconData compass; + /// The checkmark32 icon. + final IconData checkmark32; - /// The components icon. - final IconData components; + /// The checks12 icon. + final IconData checks12; - /// The credit card2 billing icon. - final IconData creditCard2Billing; + /// The checks16 icon. + final IconData checks16; - /// The cross medium icon. - final IconData crossMedium; + /// The checks20 icon. + final IconData checks20; - /// The cross small icon. - final IconData crossSmall; + /// The checks32 icon. + final IconData checks32; - /// The dot grid1x3 horizontal icon. - final IconData dotGrid1x3Horizontal; + /// The chevron down12 icon. + final IconData chevronDown12; - /// The dot grid2x3 icon. - final IconData dotGrid2x3; + /// The chevron down16 icon. + final IconData chevronDown16; - /// The dots grid1x3 vertical icon. - final IconData dotsGrid1x3Vertical; + /// The chevron down20 icon. + final IconData chevronDown20; - /// The douple checkmark1 small icon. - final IconData doupleCheckmark1Small; + /// The chevron down32 icon. + final IconData chevronDown32; - /// The edit big icon. - final IconData editBig; + /// The chevron left12 icon. + final IconData chevronLeft12; - /// The edit big solid icon. - final IconData editBigSolid; + /// The chevron left16 icon. + final IconData chevronLeft16; - /// The emoji add reaction icon. - final IconData emojiAddReaction; + /// The chevron left20 icon. + final IconData chevronLeft20; - /// The emoji sad icon. - final IconData emojiSad; + /// The chevron left32 icon. + final IconData chevronLeft32; - /// The emoji smile icon. - final IconData emojiSmile; + /// The chevron right12 icon. + final IconData chevronRight12; - /// The exclamation circle icon. - final IconData exclamationCircle; + /// The chevron right16 icon. + final IconData chevronRight16; - /// The exclamation circle1 icon. - final IconData exclamationCircle1; + /// The chevron right20 icon. + final IconData chevronRight20; - /// The exclamation triangle icon. - final IconData exclamationTriangle; + /// The chevron right32 icon. + final IconData chevronRight32; - /// The exclamation triangle1 icon. - final IconData exclamationTriangle1; + /// The chevron up12 icon. + final IconData chevronUp12; - /// The eye open icon. - final IconData eyeOpen; + /// The chevron up16 icon. + final IconData chevronUp16; - /// The file arrow left in icon. - final IconData fileArrowLeftIn; + /// The chevron up20 icon. + final IconData chevronUp20; - /// The file bend icon. - final IconData fileBend; + /// The chevron up32 icon. + final IconData chevronUp32; - /// The filled circle info tooltip icon. - final IconData filledCircleInfoTooltip; + /// The clock12 icon. + final IconData clock12; - /// The filter1 icon. - final IconData filter1; + /// The clock16 icon. + final IconData clock16; - /// The flag2 icon. - final IconData flag2; + /// The clock20 icon. + final IconData clock20; - /// The folder1 icon. - final IconData folder1; + /// The clock32 icon. + final IconData clock32; - /// The gauge icon. - final IconData gauge; + /// The command12 icon. + final IconData command12; - /// The google icon. - final IconData google; + /// The command16 icon. + final IconData command16; - /// The hashtag channel icon. - final IconData hashtagChannel; + /// The command20 icon. + final IconData command20; - /// The heart2 icon. - final IconData heart2; + /// The command32 icon. + final IconData command32; - /// The history icon. - final IconData history; + /// The copy12 icon. + final IconData copy12; - /// The images1 alt icon. - final IconData images1Alt; + /// The copy16 icon. + final IconData copy16; - /// The invite icon. - final IconData invite; + /// The copy20 icon. + final IconData copy20; - /// The layers behind icon. - final IconData layersBehind; + /// The copy32 icon. + final IconData copy32; - /// The layout align left icon. - final IconData layoutAlignLeft; + /// The delete12 icon. + final IconData delete12; - /// The layout grid1 icon. - final IconData layoutGrid1; + /// The delete16 icon. + final IconData delete16; - /// The layout grid2 icon. - final IconData layoutGrid2; + /// The delete20 icon. + final IconData delete20; - /// The layout left icon. - final IconData layoutLeft; + /// The delete32 icon. + final IconData delete32; - /// The light bulb simple icon. - final IconData lightBulbSimple; + /// The download12 icon. + final IconData download12; - /// The limits icon. - final IconData limits; + /// The download16 icon. + final IconData download16; - /// The line chart3 icon. - final IconData lineChart3; + /// The download20 icon. + final IconData download20; - /// The lock icon. - final IconData lock; + /// The download32 icon. + final IconData download32; - /// The magnifying glass search icon. - final IconData magnifyingGlassSearch; + /// The edit12 icon. + final IconData edit12; - /// The map pin icon. - final IconData mapPin; + /// The edit16 icon. + final IconData edit16; - /// The microphone icon. - final IconData microphone; + /// The edit20 icon. + final IconData edit20; - /// The microphone solid icon. - final IconData microphoneSolid; + /// The edit32 icon. + final IconData edit32; - /// The minus large icon. - final IconData minusLarge; + /// The emoji12 icon. + final IconData emoji12; - /// The minus small icon. - final IconData minusSmall; + /// The emoji16 icon. + final IconData emoji16; - /// The mute icon. - final IconData mute; + /// The emoji20 icon. + final IconData emoji20; - /// The newspaper2 icon. - final IconData newspaper2; + /// The emoji32 icon. + final IconData emoji32; - /// The organization icon. - final IconData organization; + /// The emoji add12 icon. + final IconData emojiAdd12; - /// The paper plane icon. - final IconData paperPlane; + /// The emoji add16 icon. + final IconData emojiAdd16; - /// The paper plane top right icon. - final IconData paperPlaneTopRight; + /// The emoji add20 icon. + final IconData emojiAdd20; - /// The paperclip1 icon. - final IconData paperclip1; + /// The emoji add32 icon. + final IconData emojiAdd32; - /// The paragraphs text icon. - final IconData paragraphsText; + /// The exclamation circle12 icon. + final IconData exclamationCircle12; - /// The pause icon. - final IconData pause; + /// The exclamation circle16 icon. + final IconData exclamationCircle16; - /// The pencil icon. - final IconData pencil; + /// The exclamation circle20 icon. + final IconData exclamationCircle20; - /// The people icon. - final IconData people; + /// The exclamation circle32 icon. + final IconData exclamationCircle32; - /// The people2 icon. - final IconData people2; + /// The exclamation circle fill12 icon. + final IconData exclamationCircleFill12; - /// The people add icon. - final IconData peopleAdd; + /// The exclamation circle fill16 icon. + final IconData exclamationCircleFill16; - /// The people added icon. - final IconData peopleAdded; + /// The exclamation circle fill20 icon. + final IconData exclamationCircleFill20; - /// The people circle icon. - final IconData peopleCircle; + /// The exclamation circle fill32 icon. + final IconData exclamationCircleFill32; - /// The people copy icon. - final IconData peopleCopy; + /// The exclamation mark fill12 icon. + final IconData exclamationMarkFill12; - /// The people edit user rights icon. - final IconData peopleEditUserRights; + /// The exclamation mark fill16 icon. + final IconData exclamationMarkFill16; - /// The people remove icon. - final IconData peopleRemove; + /// The exclamation mark fill20 icon. + final IconData exclamationMarkFill20; - /// The persona icon. - final IconData persona; + /// The exclamation mark fill32 icon. + final IconData exclamationMarkFill32; - /// The pin icon. - final IconData pin; + /// The exclamation triangle fill12 icon. + final IconData exclamationTriangleFill12; - /// The play solid icon. - final IconData playSolid; + /// The exclamation triangle fill16 icon. + final IconData exclamationTriangleFill16; - /// The plus large icon. - final IconData plusLarge; + /// The exclamation triangle fill20 icon. + final IconData exclamationTriangleFill20; - /// The plus small icon. - final IconData plusSmall; + /// The exclamation triangle fill32 icon. + final IconData exclamationTriangleFill32; - /// The run shortcut icon. - final IconData runShortcut; + /// The export12 icon. + final IconData export12; - /// The search text icon. - final IconData searchText; + /// The export16 icon. + final IconData export16; - /// The settings gear2 icon. - final IconData settingsGear2; + /// The export20 icon. + final IconData export20; - /// The settings slider ver icon. - final IconData settingsSliderVer; + /// The export32 icon. + final IconData export32; - /// The shapes plus close square circle icon. - final IconData shapesPlusCloseSquareCircle; + /// The eye fill12 icon. + final IconData eyeFill12; - /// The shapes triangle square circle icon. - final IconData shapesTriangleSquareCircle; + /// The eye fill16 icon. + final IconData eyeFill16; - /// The share os icon. - final IconData shareOs; + /// The eye fill20 icon. + final IconData eyeFill20; - /// The share redirect link icon. - final IconData shareRedirectLink; + /// The eye fill32 icon. + final IconData eyeFill32; - /// The shield icon. - final IconData shield; + /// The file12 icon. + final IconData file12; - /// The square behind square2 copy icon. - final IconData squareBehindSquare2Copy; + /// The file16 icon. + final IconData file16; - /// The square circle top right feeds icon. - final IconData squareCircleTopRightFeeds; + /// The file20 icon. + final IconData file20; - /// The stop icon. - final IconData stop; + /// The file32 icon. + final IconData file32; - /// The table icon. - final IconData table; + /// The flag12 icon. + final IconData flag12; - /// The team icon. - final IconData team; + /// The flag16 icon. + final IconData flag16; - /// The tennis icon. - final IconData tennis; + /// The flag20 icon. + final IconData flag20; - /// The text to image u r l enrichment icon. - final IconData textToImageURLEnrichment; + /// The flag32 icon. + final IconData flag32; - /// The thunder icon. - final IconData thunder; + /// The folder12 icon. + final IconData folder12; - /// The translate icon. - final IconData translate; + /// The folder16 icon. + final IconData folder16; - /// The trash bin icon. - final IconData trashBin; + /// The folder20 icon. + final IconData folder20; - /// The trending4 icon. - final IconData trending4; + /// The folder32 icon. + final IconData folder32; - /// The trophy icon. - final IconData trophy; + /// The gallery12 icon. + final IconData gallery12; - /// The unlocked icon. - final IconData unlocked; + /// The gallery16 icon. + final IconData gallery16; - /// The unpin icon. - final IconData unpin; + /// The gallery20 icon. + final IconData gallery20; - /// The users icon. - final IconData users; + /// The gallery32 icon. + final IconData gallery32; - /// The video icon. - final IconData video; + /// The image12 icon. + final IconData image12; - /// The video solid icon. - final IconData videoSolid; + /// The image16 icon. + final IconData image16; - /// The voice and video icon. - final IconData voiceAndVideo; + /// The image20 icon. + final IconData image20; - /// The voice high icon. - final IconData voiceHigh; + /// The image32 icon. + final IconData image32; - /// The volume full icon. - final IconData volumeFull; + /// The info12 icon. + final IconData info12; - /// The webhook icon. - final IconData webhook; + /// The info16 icon. + final IconData info16; + + /// The info20 icon. + final IconData info20; + + /// The info32 icon. + final IconData info32; + + /// The leave12 icon. + final IconData leave12; + + /// The leave16 icon. + final IconData leave16; + + /// The leave20 icon. + final IconData leave20; + + /// The leave32 icon. + final IconData leave32; + + /// The link12 icon. + final IconData link12; + + /// The link16 icon. + final IconData link16; + + /// The link20 icon. + final IconData link20; + + /// The link32 icon. + final IconData link32; + + /// The location12 icon. + final IconData location12; + + /// The location16 icon. + final IconData location16; + + /// The location20 icon. + final IconData location20; + + /// The location32 icon. + final IconData location32; + + /// The lock12 icon. + final IconData lock12; + + /// The lock16 icon. + final IconData lock16; + + /// The lock20 icon. + final IconData lock20; + + /// The lock32 icon. + final IconData lock32; + + /// The mention12 icon. + final IconData mention12; + + /// The mention16 icon. + final IconData mention16; + + /// The mention20 icon. + final IconData mention20; + + /// The mention32 icon. + final IconData mention32; + + /// The message bubble12 icon. + final IconData messageBubble12; + + /// The message bubble16 icon. + final IconData messageBubble16; + + /// The message bubble20 icon. + final IconData messageBubble20; + + /// The message bubble32 icon. + final IconData messageBubble32; + + /// The message bubble fill12 icon. + final IconData messageBubbleFill12; + + /// The message bubble fill16 icon. + final IconData messageBubbleFill16; + + /// The message bubble fill20 icon. + final IconData messageBubbleFill20; + + /// The message bubble fill32 icon. + final IconData messageBubbleFill32; + + /// The message bubbles12 icon. + final IconData messageBubbles12; + + /// The message bubbles16 icon. + final IconData messageBubbles16; + + /// The message bubbles20 icon. + final IconData messageBubbles20; + + /// The message bubbles32 icon. + final IconData messageBubbles32; + + /// The minus12 icon. + final IconData minus12; + + /// The minus16 icon. + final IconData minus16; + + /// The minus20 icon. + final IconData minus20; + + /// The minus32 icon. + final IconData minus32; + + /// The minus circle12 icon. + final IconData minusCircle12; + + /// The minus circle16 icon. + final IconData minusCircle16; + + /// The minus circle20 icon. + final IconData minusCircle20; + + /// The minus circle32 icon. + final IconData minusCircle32; + + /// The more12 icon. + final IconData more12; + + /// The more16 icon. + final IconData more16; + + /// The more20 icon. + final IconData more20; + + /// The more32 icon. + final IconData more32; + + /// The mute12 icon. + final IconData mute12; + + /// The mute16 icon. + final IconData mute16; + + /// The mute20 icon. + final IconData mute20; + + /// The mute32 icon. + final IconData mute32; + + /// The no sign12 icon. + final IconData noSign12; + + /// The no sign16 icon. + final IconData noSign16; + + /// The no sign20 icon. + final IconData noSign20; + + /// The no sign32 icon. + final IconData noSign32; + + /// The notification12 icon. + final IconData notification12; + + /// The notification16 icon. + final IconData notification16; + + /// The notification20 icon. + final IconData notification20; + + /// The notification32 icon. + final IconData notification32; + + /// The pause fill12 icon. + final IconData pauseFill12; + + /// The pause fill16 icon. + final IconData pauseFill16; + + /// The pause fill20 icon. + final IconData pauseFill20; + + /// The pause fill32 icon. + final IconData pauseFill32; + + /// The pin12 icon. + final IconData pin12; + + /// The pin16 icon. + final IconData pin16; + + /// The pin20 icon. + final IconData pin20; + + /// The pin32 icon. + final IconData pin32; + + /// The play fill12 icon. + final IconData playFill12; + + /// The play fill16 icon. + final IconData playFill16; + + /// The play fill20 icon. + final IconData playFill20; + + /// The play fill32 icon. + final IconData playFill32; + + /// The plus12 icon. + final IconData plus12; + + /// The plus16 icon. + final IconData plus16; + + /// The plus20 icon. + final IconData plus20; + + /// The plus32 icon. + final IconData plus32; + + /// The poll12 icon. + final IconData poll12; + + /// The poll16 icon. + final IconData poll16; + + /// The poll20 icon. + final IconData poll20; + + /// The poll32 icon. + final IconData poll32; + + /// The quote12 icon. + final IconData quote12; + + /// The quote16 icon. + final IconData quote16; + + /// The quote20 icon. + final IconData quote20; + + /// The quote32 icon. + final IconData quote32; + + /// The refresh12 icon. + final IconData refresh12; + + /// The refresh16 icon. + final IconData refresh16; + + /// The refresh20 icon. + final IconData refresh20; + + /// The refresh32 icon. + final IconData refresh32; + + /// The reorder12 icon. + final IconData reorder12; + + /// The reorder16 icon. + final IconData reorder16; + + /// The reorder20 icon. + final IconData reorder20; + + /// The reorder32 icon. + final IconData reorder32; + + /// The reply12 icon. + final IconData reply12; + + /// The reply16 icon. + final IconData reply16; + + /// The reply20 icon. + final IconData reply20; + + /// The reply32 icon. + final IconData reply32; + + /// The retry12 icon. + final IconData retry12; + + /// The retry16 icon. + final IconData retry16; + + /// The retry20 icon. + final IconData retry20; + + /// The retry32 icon. + final IconData retry32; + + /// The save12 icon. + final IconData save12; + + /// The save16 icon. + final IconData save16; + + /// The save20 icon. + final IconData save20; + + /// The save32 icon. + final IconData save32; + + /// The search12 icon. + final IconData search12; + + /// The search16 icon. + final IconData search16; + + /// The search20 icon. + final IconData search20; + + /// The search32 icon. + final IconData search32; + + /// The send12 icon. + final IconData send12; + + /// The send16 icon. + final IconData send16; + + /// The send20 icon. + final IconData send20; + + /// The send32 icon. + final IconData send32; + + /// The share12 icon. + final IconData share12; + + /// The share16 icon. + final IconData share16; + + /// The share20 icon. + final IconData share20; + + /// The share32 icon. + final IconData share32; + + /// The sidebar12 icon. + final IconData sidebar12; + + /// The sidebar16 icon. + final IconData sidebar16; + + /// The sidebar20 icon. + final IconData sidebar20; + + /// The sidebar32 icon. + final IconData sidebar32; + + /// The stop fill12 icon. + final IconData stopFill12; + + /// The stop fill16 icon. + final IconData stopFill16; + + /// The stop fill20 icon. + final IconData stopFill20; + + /// The stop fill32 icon. + final IconData stopFill32; + + /// The thread12 icon. + final IconData thread12; + + /// The thread16 icon. + final IconData thread16; + + /// The thread20 icon. + final IconData thread20; + + /// The thread32 icon. + final IconData thread32; + + /// The thread fill12 icon. + final IconData threadFill12; + + /// The thread fill16 icon. + final IconData threadFill16; + + /// The thread fill20 icon. + final IconData threadFill20; + + /// The thread fill32 icon. + final IconData threadFill32; + + /// The translate12 icon. + final IconData translate12; + + /// The translate16 icon. + final IconData translate16; + + /// The translate20 icon. + final IconData translate20; + + /// The translate32 icon. + final IconData translate32; + + /// The trophy12 icon. + final IconData trophy12; + + /// The trophy16 icon. + final IconData trophy16; + + /// The trophy20 icon. + final IconData trophy20; + + /// The trophy32 icon. + final IconData trophy32; + + /// The unlock12 icon. + final IconData unlock12; + + /// The unlock16 icon. + final IconData unlock16; + + /// The unlock20 icon. + final IconData unlock20; + + /// The unlock32 icon. + final IconData unlock32; + + /// The unpin12 icon. + final IconData unpin12; + + /// The unpin16 icon. + final IconData unpin16; + + /// The unpin20 icon. + final IconData unpin20; + + /// The unpin32 icon. + final IconData unpin32; + + /// The unsave12 icon. + final IconData unsave12; + + /// The unsave16 icon. + final IconData unsave16; + + /// The unsave20 icon. + final IconData unsave20; + + /// The unsave32 icon. + final IconData unsave32; + + /// The upload12 icon. + final IconData upload12; + + /// The upload16 icon. + final IconData upload16; + + /// The upload20 icon. + final IconData upload20; + + /// The upload32 icon. + final IconData upload32; + + /// The user12 icon. + final IconData user12; + + /// The user16 icon. + final IconData user16; + + /// The user20 icon. + final IconData user20; + + /// The user32 icon. + final IconData user32; + + /// The user add12 icon. + final IconData userAdd12; + + /// The user add16 icon. + final IconData userAdd16; + + /// The user add20 icon. + final IconData userAdd20; + + /// The user add32 icon. + final IconData userAdd32; + + /// The user check12 icon. + final IconData userCheck12; + + /// The user check16 icon. + final IconData userCheck16; + + /// The user check20 icon. + final IconData userCheck20; + + /// The user check32 icon. + final IconData userCheck32; + + /// The user remove12 icon. + final IconData userRemove12; + + /// The user remove16 icon. + final IconData userRemove16; + + /// The user remove20 icon. + final IconData userRemove20; + + /// The user remove32 icon. + final IconData userRemove32; + + /// The users12 icon. + final IconData users12; + + /// The users16 icon. + final IconData users16; + + /// The users20 icon. + final IconData users20; + + /// The users32 icon. + final IconData users32; + + /// The video12 icon. + final IconData video12; + + /// The video16 icon. + final IconData video16; + + /// The video20 icon. + final IconData video20; + + /// The video32 icon. + final IconData video32; + + /// The video fill12 icon. + final IconData videoFill12; + + /// The video fill16 icon. + final IconData videoFill16; + + /// The video fill20 icon. + final IconData videoFill20; + + /// The video fill32 icon. + final IconData videoFill32; + + /// The voice12 icon. + final IconData voice12; + + /// The voice16 icon. + final IconData voice16; + + /// The voice20 icon. + final IconData voice20; + + /// The voice32 icon. + final IconData voice32; + + /// The voice fill12 icon. + final IconData voiceFill12; + + /// The voice fill16 icon. + final IconData voiceFill16; + + /// The voice fill20 icon. + final IconData voiceFill20; + + /// The voice fill32 icon. + final IconData voiceFill32; + + /// The x circle12 icon. + final IconData xCircle12; + + /// The x circle16 icon. + final IconData xCircle16; + + /// The x circle20 icon. + final IconData xCircle20; + + /// The x circle32 icon. + final IconData xCircle32; + + /// The xmark12 icon. + final IconData xmark12; + + /// The xmark16 icon. + final IconData xmark16; + + /// The xmark20 icon. + final IconData xmark20; + + /// The xmark32 icon. + final IconData xmark32; /// The giphy colored SVG icon. /// @@ -712,164 +1504,362 @@ class StreamIcons with _$StreamIcons { /// final icon = context.streamIcons.allIcons['settingsGear2']; /// ``` Map get allIcons => { - 'apiAggregate': apiAggregate, - 'apples': apples, - 'archive1': archive1, - 'arrowBoxLeft': arrowBoxLeft, - 'arrowDown': arrowDown, - 'arrowDownCircle': arrowDownCircle, - 'arrowLeft': arrowLeft, - 'arrowRight': arrowRight, - 'arrowRotateClockwise': arrowRotateClockwise, - 'arrowRotateRightLeftRepeatRefresh': arrowRotateRightLeftRepeatRefresh, - 'arrowShareLeft': arrowShareLeft, - 'arrowShareRight': arrowShareRight, - 'arrowUp': arrowUp, - 'arrowUpRight': arrowUpRight, - 'arrowsRepeatLeftRight': arrowsRepeatLeftRight, - 'at': at, - 'atSolid': atSolid, - 'bellNotification': bellNotification, - 'bellOff': bellOff, - 'bookmark': bookmark, - 'bookmarkRemove': bookmarkRemove, - 'browserAISparkle': browserAISparkle, - 'bubble3ChatMessage': bubble3ChatMessage, - 'bubble3Solid': bubble3Solid, - 'bubbleAnnotation2ChatMessage': bubbleAnnotation2ChatMessage, - 'bubbleText6ChatMessage': bubbleText6ChatMessage, - 'bubbleText6Solid': bubbleText6Solid, - 'bubbleWideNotificationChatMessage': bubbleWideNotificationChatMessage, - 'bubbleWideSparkleChatMessage': bubbleWideSparkleChatMessage, - 'bubbles': bubbles, - 'calendar1': calendar1, - 'callCancel': callCancel, - 'camera1': camera1, - 'car1': car1, - 'cat': cat, - 'chainLink3': chainLink3, - 'chart5': chart5, - 'checkmark1Small': checkmark1Small, - 'checkmark2': checkmark2, - 'checkmark2Small': checkmark2Small, - 'chevronDown': chevronDown, - 'chevronGrabberVerticalSelector': chevronGrabberVerticalSelector, - 'chevronLeft': chevronLeft, - 'chevronRight': chevronRight, - 'chevronTop': chevronTop, - 'circleBanSign': circleBanSign, - 'circleCheck': circleCheck, - 'circleInfoTooltip': circleInfoTooltip, - 'circleMinus': circleMinus, - 'circleQuestionmark': circleQuestionmark, - 'circleQuestionmarkFilled': circleQuestionmarkFilled, - 'circleX': circleX, - 'clock': clock, - 'clockSolid': clockSolid, - 'closeQuote2': closeQuote2, - 'cloudSimpleUpload': cloudSimpleUpload, - 'code': code, - 'codeBrackets': codeBrackets, - 'codeEditorInsert': codeEditorInsert, - 'compass': compass, - 'components': components, - 'creditCard2Billing': creditCard2Billing, - 'crossMedium': crossMedium, - 'crossSmall': crossSmall, - 'dotGrid1x3Horizontal': dotGrid1x3Horizontal, - 'dotGrid2x3': dotGrid2x3, - 'dotsGrid1x3Vertical': dotsGrid1x3Vertical, - 'doupleCheckmark1Small': doupleCheckmark1Small, - 'editBig': editBig, - 'editBigSolid': editBigSolid, - 'emojiAddReaction': emojiAddReaction, - 'emojiSad': emojiSad, - 'emojiSmile': emojiSmile, - 'exclamationCircle': exclamationCircle, - 'exclamationCircle1': exclamationCircle1, - 'exclamationTriangle': exclamationTriangle, - 'exclamationTriangle1': exclamationTriangle1, - 'eyeOpen': eyeOpen, - 'fileArrowLeftIn': fileArrowLeftIn, - 'fileBend': fileBend, - 'filledCircleInfoTooltip': filledCircleInfoTooltip, - 'filter1': filter1, - 'flag2': flag2, - 'folder1': folder1, - 'gauge': gauge, - 'google': google, - 'hashtagChannel': hashtagChannel, - 'heart2': heart2, - 'history': history, - 'images1Alt': images1Alt, - 'invite': invite, - 'layersBehind': layersBehind, - 'layoutAlignLeft': layoutAlignLeft, - 'layoutGrid1': layoutGrid1, - 'layoutGrid2': layoutGrid2, - 'layoutLeft': layoutLeft, - 'lightBulbSimple': lightBulbSimple, - 'limits': limits, - 'lineChart3': lineChart3, - 'lock': lock, - 'magnifyingGlassSearch': magnifyingGlassSearch, - 'mapPin': mapPin, - 'microphone': microphone, - 'microphoneSolid': microphoneSolid, - 'minusLarge': minusLarge, - 'minusSmall': minusSmall, - 'mute': mute, - 'newspaper2': newspaper2, - 'organization': organization, - 'paperPlane': paperPlane, - 'paperPlaneTopRight': paperPlaneTopRight, - 'paperclip1': paperclip1, - 'paragraphsText': paragraphsText, - 'pause': pause, - 'pencil': pencil, - 'people': people, - 'people2': people2, - 'peopleAdd': peopleAdd, - 'peopleAdded': peopleAdded, - 'peopleCircle': peopleCircle, - 'peopleCopy': peopleCopy, - 'peopleEditUserRights': peopleEditUserRights, - 'peopleRemove': peopleRemove, - 'persona': persona, - 'pin': pin, - 'playSolid': playSolid, - 'plusLarge': plusLarge, - 'plusSmall': plusSmall, - 'runShortcut': runShortcut, - 'searchText': searchText, - 'settingsGear2': settingsGear2, - 'settingsSliderVer': settingsSliderVer, - 'shapesPlusCloseSquareCircle': shapesPlusCloseSquareCircle, - 'shapesTriangleSquareCircle': shapesTriangleSquareCircle, - 'shareOs': shareOs, - 'shareRedirectLink': shareRedirectLink, - 'shield': shield, - 'squareBehindSquare2Copy': squareBehindSquare2Copy, - 'squareCircleTopRightFeeds': squareCircleTopRightFeeds, - 'stop': stop, - 'table': table, - 'team': team, - 'tennis': tennis, - 'textToImageURLEnrichment': textToImageURLEnrichment, - 'thunder': thunder, - 'translate': translate, - 'trashBin': trashBin, - 'trending4': trending4, - 'trophy': trophy, - 'unlocked': unlocked, - 'unpin': unpin, - 'users': users, - 'video': video, - 'videoSolid': videoSolid, - 'voiceAndVideo': voiceAndVideo, - 'voiceHigh': voiceHigh, - 'volumeFull': volumeFull, - 'webhook': webhook, + 'account12': account12, + 'account16': account16, + 'account20': account20, + 'account32': account32, + 'archive12': archive12, + 'archive16': archive16, + 'archive20': archive20, + 'archive32': archive32, + 'arrowDown12': arrowDown12, + 'arrowDown16': arrowDown16, + 'arrowDown20': arrowDown20, + 'arrowDown32': arrowDown32, + 'arrowDownCircle12': arrowDownCircle12, + 'arrowDownCircle16': arrowDownCircle16, + 'arrowDownCircle20': arrowDownCircle20, + 'arrowDownCircle32': arrowDownCircle32, + 'arrowLeft12': arrowLeft12, + 'arrowLeft16': arrowLeft16, + 'arrowLeft20': arrowLeft20, + 'arrowLeft32': arrowLeft32, + 'arrowRight12': arrowRight12, + 'arrowRight16': arrowRight16, + 'arrowRight20': arrowRight20, + 'arrowRight32': arrowRight32, + 'arrowUp12': arrowUp12, + 'arrowUp16': arrowUp16, + 'arrowUp20': arrowUp20, + 'arrowUp32': arrowUp32, + 'arrowUpRight12': arrowUpRight12, + 'arrowUpRight16': arrowUpRight16, + 'arrowUpRight20': arrowUpRight20, + 'arrowUpRight32': arrowUpRight32, + 'attachment12': attachment12, + 'attachment16': attachment16, + 'attachment20': attachment20, + 'attachment32': attachment32, + 'audio12': audio12, + 'audio16': audio16, + 'audio20': audio20, + 'audio32': audio32, + 'bell12': bell12, + 'bell16': bell16, + 'bell20': bell20, + 'bell32': bell32, + 'bellOff12': bellOff12, + 'bellOff16': bellOff16, + 'bellOff20': bellOff20, + 'bellOff32': bellOff32, + 'bolt12': bolt12, + 'bolt16': bolt16, + 'bolt20': bolt20, + 'bolt32': bolt32, + 'camera12': camera12, + 'camera16': camera16, + 'camera20': camera20, + 'camera32': camera32, + 'checkmark12': checkmark12, + 'checkmark16': checkmark16, + 'checkmark20': checkmark20, + 'checkmark32': checkmark32, + 'checks12': checks12, + 'checks16': checks16, + 'checks20': checks20, + 'checks32': checks32, + 'chevronDown12': chevronDown12, + 'chevronDown16': chevronDown16, + 'chevronDown20': chevronDown20, + 'chevronDown32': chevronDown32, + 'chevronLeft12': chevronLeft12, + 'chevronLeft16': chevronLeft16, + 'chevronLeft20': chevronLeft20, + 'chevronLeft32': chevronLeft32, + 'chevronRight12': chevronRight12, + 'chevronRight16': chevronRight16, + 'chevronRight20': chevronRight20, + 'chevronRight32': chevronRight32, + 'chevronUp12': chevronUp12, + 'chevronUp16': chevronUp16, + 'chevronUp20': chevronUp20, + 'chevronUp32': chevronUp32, + 'clock12': clock12, + 'clock16': clock16, + 'clock20': clock20, + 'clock32': clock32, + 'command12': command12, + 'command16': command16, + 'command20': command20, + 'command32': command32, + 'copy12': copy12, + 'copy16': copy16, + 'copy20': copy20, + 'copy32': copy32, + 'delete12': delete12, + 'delete16': delete16, + 'delete20': delete20, + 'delete32': delete32, + 'download12': download12, + 'download16': download16, + 'download20': download20, + 'download32': download32, + 'edit12': edit12, + 'edit16': edit16, + 'edit20': edit20, + 'edit32': edit32, + 'emoji12': emoji12, + 'emoji16': emoji16, + 'emoji20': emoji20, + 'emoji32': emoji32, + 'emojiAdd12': emojiAdd12, + 'emojiAdd16': emojiAdd16, + 'emojiAdd20': emojiAdd20, + 'emojiAdd32': emojiAdd32, + 'exclamationCircle12': exclamationCircle12, + 'exclamationCircle16': exclamationCircle16, + 'exclamationCircle20': exclamationCircle20, + 'exclamationCircle32': exclamationCircle32, + 'exclamationCircleFill12': exclamationCircleFill12, + 'exclamationCircleFill16': exclamationCircleFill16, + 'exclamationCircleFill20': exclamationCircleFill20, + 'exclamationCircleFill32': exclamationCircleFill32, + 'exclamationMarkFill12': exclamationMarkFill12, + 'exclamationMarkFill16': exclamationMarkFill16, + 'exclamationMarkFill20': exclamationMarkFill20, + 'exclamationMarkFill32': exclamationMarkFill32, + 'exclamationTriangleFill12': exclamationTriangleFill12, + 'exclamationTriangleFill16': exclamationTriangleFill16, + 'exclamationTriangleFill20': exclamationTriangleFill20, + 'exclamationTriangleFill32': exclamationTriangleFill32, + 'export12': export12, + 'export16': export16, + 'export20': export20, + 'export32': export32, + 'eyeFill12': eyeFill12, + 'eyeFill16': eyeFill16, + 'eyeFill20': eyeFill20, + 'eyeFill32': eyeFill32, + 'file12': file12, + 'file16': file16, + 'file20': file20, + 'file32': file32, + 'flag12': flag12, + 'flag16': flag16, + 'flag20': flag20, + 'flag32': flag32, + 'folder12': folder12, + 'folder16': folder16, + 'folder20': folder20, + 'folder32': folder32, + 'gallery12': gallery12, + 'gallery16': gallery16, + 'gallery20': gallery20, + 'gallery32': gallery32, + 'image12': image12, + 'image16': image16, + 'image20': image20, + 'image32': image32, + 'info12': info12, + 'info16': info16, + 'info20': info20, + 'info32': info32, + 'leave12': leave12, + 'leave16': leave16, + 'leave20': leave20, + 'leave32': leave32, + 'link12': link12, + 'link16': link16, + 'link20': link20, + 'link32': link32, + 'location12': location12, + 'location16': location16, + 'location20': location20, + 'location32': location32, + 'lock12': lock12, + 'lock16': lock16, + 'lock20': lock20, + 'lock32': lock32, + 'mention12': mention12, + 'mention16': mention16, + 'mention20': mention20, + 'mention32': mention32, + 'messageBubble12': messageBubble12, + 'messageBubble16': messageBubble16, + 'messageBubble20': messageBubble20, + 'messageBubble32': messageBubble32, + 'messageBubbleFill12': messageBubbleFill12, + 'messageBubbleFill16': messageBubbleFill16, + 'messageBubbleFill20': messageBubbleFill20, + 'messageBubbleFill32': messageBubbleFill32, + 'messageBubbles12': messageBubbles12, + 'messageBubbles16': messageBubbles16, + 'messageBubbles20': messageBubbles20, + 'messageBubbles32': messageBubbles32, + 'minus12': minus12, + 'minus16': minus16, + 'minus20': minus20, + 'minus32': minus32, + 'minusCircle12': minusCircle12, + 'minusCircle16': minusCircle16, + 'minusCircle20': minusCircle20, + 'minusCircle32': minusCircle32, + 'more12': more12, + 'more16': more16, + 'more20': more20, + 'more32': more32, + 'mute12': mute12, + 'mute16': mute16, + 'mute20': mute20, + 'mute32': mute32, + 'noSign12': noSign12, + 'noSign16': noSign16, + 'noSign20': noSign20, + 'noSign32': noSign32, + 'notification12': notification12, + 'notification16': notification16, + 'notification20': notification20, + 'notification32': notification32, + 'pauseFill12': pauseFill12, + 'pauseFill16': pauseFill16, + 'pauseFill20': pauseFill20, + 'pauseFill32': pauseFill32, + 'pin12': pin12, + 'pin16': pin16, + 'pin20': pin20, + 'pin32': pin32, + 'playFill12': playFill12, + 'playFill16': playFill16, + 'playFill20': playFill20, + 'playFill32': playFill32, + 'plus12': plus12, + 'plus16': plus16, + 'plus20': plus20, + 'plus32': plus32, + 'poll12': poll12, + 'poll16': poll16, + 'poll20': poll20, + 'poll32': poll32, + 'quote12': quote12, + 'quote16': quote16, + 'quote20': quote20, + 'quote32': quote32, + 'refresh12': refresh12, + 'refresh16': refresh16, + 'refresh20': refresh20, + 'refresh32': refresh32, + 'reorder12': reorder12, + 'reorder16': reorder16, + 'reorder20': reorder20, + 'reorder32': reorder32, + 'reply12': reply12, + 'reply16': reply16, + 'reply20': reply20, + 'reply32': reply32, + 'retry12': retry12, + 'retry16': retry16, + 'retry20': retry20, + 'retry32': retry32, + 'save12': save12, + 'save16': save16, + 'save20': save20, + 'save32': save32, + 'search12': search12, + 'search16': search16, + 'search20': search20, + 'search32': search32, + 'send12': send12, + 'send16': send16, + 'send20': send20, + 'send32': send32, + 'share12': share12, + 'share16': share16, + 'share20': share20, + 'share32': share32, + 'sidebar12': sidebar12, + 'sidebar16': sidebar16, + 'sidebar20': sidebar20, + 'sidebar32': sidebar32, + 'stopFill12': stopFill12, + 'stopFill16': stopFill16, + 'stopFill20': stopFill20, + 'stopFill32': stopFill32, + 'thread12': thread12, + 'thread16': thread16, + 'thread20': thread20, + 'thread32': thread32, + 'threadFill12': threadFill12, + 'threadFill16': threadFill16, + 'threadFill20': threadFill20, + 'threadFill32': threadFill32, + 'translate12': translate12, + 'translate16': translate16, + 'translate20': translate20, + 'translate32': translate32, + 'trophy12': trophy12, + 'trophy16': trophy16, + 'trophy20': trophy20, + 'trophy32': trophy32, + 'unlock12': unlock12, + 'unlock16': unlock16, + 'unlock20': unlock20, + 'unlock32': unlock32, + 'unpin12': unpin12, + 'unpin16': unpin16, + 'unpin20': unpin20, + 'unpin32': unpin32, + 'unsave12': unsave12, + 'unsave16': unsave16, + 'unsave20': unsave20, + 'unsave32': unsave32, + 'upload12': upload12, + 'upload16': upload16, + 'upload20': upload20, + 'upload32': upload32, + 'user12': user12, + 'user16': user16, + 'user20': user20, + 'user32': user32, + 'userAdd12': userAdd12, + 'userAdd16': userAdd16, + 'userAdd20': userAdd20, + 'userAdd32': userAdd32, + 'userCheck12': userCheck12, + 'userCheck16': userCheck16, + 'userCheck20': userCheck20, + 'userCheck32': userCheck32, + 'userRemove12': userRemove12, + 'userRemove16': userRemove16, + 'userRemove20': userRemove20, + 'userRemove32': userRemove32, + 'users12': users12, + 'users16': users16, + 'users20': users20, + 'users32': users32, + 'video12': video12, + 'video16': video16, + 'video20': video20, + 'video32': video32, + 'videoFill12': videoFill12, + 'videoFill16': videoFill16, + 'videoFill20': videoFill20, + 'videoFill32': videoFill32, + 'voice12': voice12, + 'voice16': voice16, + 'voice20': voice20, + 'voice32': voice32, + 'voiceFill12': voiceFill12, + 'voiceFill16': voiceFill16, + 'voiceFill20': voiceFill20, + 'voiceFill32': voiceFill32, + 'xCircle12': xCircle12, + 'xCircle16': xCircle16, + 'xCircle20': xCircle20, + 'xCircle32': xCircle32, + 'xmark12': xmark12, + 'xmark16': xmark16, + 'xmark20': xmark20, + 'xmark32': xmark32, }; /// A map of all colored SVG icons keyed by their field name. diff --git a/packages/stream_core_flutter/lib/src/theme/primitives/stream_icons.g.dart b/packages/stream_core_flutter/lib/src/theme/primitives/stream_icons.g.dart index f63d09cf..d6e9c7dc 100644 --- a/packages/stream_core_flutter/lib/src/theme/primitives/stream_icons.g.dart +++ b/packages/stream_core_flutter/lib/src/theme/primitives/stream_icons.g.dart @@ -29,975 +29,1865 @@ class StreamIconData { static const iconFontFamily = 'Stream Icons'; static const iconFontPackage = 'stream_core_flutter'; - /// Font icon named "__IconApiAggregate__" + /// Font icon named "__account12__" /// - /// - static const IconData iconApiAggregate = IconData(0xe000, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData account12 = IconData(0xe000, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconApples__" + /// Font icon named "__account16__" /// - /// - static const IconData iconApples = IconData(0xe001, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData account16 = IconData(0xe001, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconArchive1__" + /// Font icon named "__account20__" /// - /// - static const IconData iconArchive1 = IconData(0xe002, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData account20 = IconData(0xe002, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconArrowBoxLeft__" + /// Font icon named "__account32__" /// - /// - static const IconData iconArrowBoxLeft = IconData(0xe003, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData account32 = IconData(0xe003, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconArrowDown__" + /// Font icon named "__archive12__" /// - /// - static const IconData iconArrowDown = IconData(0xe004, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData archive12 = IconData(0xe004, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconArrowDownCircle__" + /// Font icon named "__archive16__" /// - /// - static const IconData iconArrowDownCircle = IconData( - 0xe005, - fontFamily: iconFontFamily, - fontPackage: iconFontPackage, - ); + /// + static const IconData archive16 = IconData(0xe005, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconArrowLeft__" + /// Font icon named "__archive20__" /// - /// - static const IconData iconArrowLeft = IconData(0xe006, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData archive20 = IconData(0xe006, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconArrowRight__" + /// Font icon named "__archive32__" /// - /// - static const IconData iconArrowRight = IconData(0xe007, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData archive32 = IconData(0xe007, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconArrowRotateClockwise__" + /// Font icon named "__arrowDown12__" /// - /// - static const IconData iconArrowRotateClockwise = IconData( - 0xe008, - fontFamily: iconFontFamily, - fontPackage: iconFontPackage, - ); + /// + static const IconData arrowDown12 = IconData(0xe008, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconArrowRotateRightLeftRepeatRefresh__" + /// Font icon named "__arrowDown16__" /// - /// - static const IconData iconArrowRotateRightLeftRepeatRefresh = IconData( - 0xe009, - fontFamily: iconFontFamily, - fontPackage: iconFontPackage, - ); + /// + static const IconData arrowDown16 = IconData(0xe009, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconArrowShareLeft__" + /// Font icon named "__arrowDown20__" /// - /// - static const IconData iconArrowShareLeft = IconData(0xe00a, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData arrowDown20 = IconData(0xe00a, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconArrowShareRight__" + /// Font icon named "__arrowDown32__" /// - /// - static const IconData iconArrowShareRight = IconData( - 0xe00b, - fontFamily: iconFontFamily, - fontPackage: iconFontPackage, - ); + /// + static const IconData arrowDown32 = IconData(0xe00b, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconArrowUp__" + /// Font icon named "__arrowDownCircle12__" /// - /// - static const IconData iconArrowUp = IconData(0xe00c, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData arrowDownCircle12 = IconData(0xe00c, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconArrowUpRight__" + /// Font icon named "__arrowDownCircle16__" /// - /// - static const IconData iconArrowUpRight = IconData(0xe00d, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData arrowDownCircle16 = IconData(0xe00d, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconArrowsRepeatLeftRight__" + /// Font icon named "__arrowDownCircle20__" /// - /// - static const IconData iconArrowsRepeatLeftRight = IconData( - 0xe00e, - fontFamily: iconFontFamily, - fontPackage: iconFontPackage, - ); + /// + static const IconData arrowDownCircle20 = IconData(0xe00e, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconAt__" + /// Font icon named "__arrowDownCircle32__" /// - /// - static const IconData iconAt = IconData(0xe00f, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData arrowDownCircle32 = IconData(0xe00f, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconAtSolid__" + /// Font icon named "__arrowLeft12__" /// - /// - static const IconData iconAtSolid = IconData(0xe010, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData arrowLeft12 = IconData(0xe010, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconBellNotification__" + /// Font icon named "__arrowLeft16__" /// - /// - static const IconData iconBellNotification = IconData( - 0xe011, - fontFamily: iconFontFamily, - fontPackage: iconFontPackage, - ); + /// + static const IconData arrowLeft16 = IconData(0xe011, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconBellOff__" + /// Font icon named "__arrowLeft20__" /// - /// - static const IconData iconBellOff = IconData(0xe012, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData arrowLeft20 = IconData(0xe012, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconBookmark__" + /// Font icon named "__arrowLeft32__" /// - /// - static const IconData iconBookmark = IconData(0xe013, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData arrowLeft32 = IconData(0xe013, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconBookmarkRemove__" + /// Font icon named "__arrowRight12__" /// - /// - static const IconData iconBookmarkRemove = IconData(0xe014, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData arrowRight12 = IconData(0xe014, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconBrowserAISparkle__" + /// Font icon named "__arrowRight16__" /// - /// - static const IconData iconBrowserAISparkle = IconData( - 0xe015, - fontFamily: iconFontFamily, - fontPackage: iconFontPackage, - ); + /// + static const IconData arrowRight16 = IconData(0xe015, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconBubble3ChatMessage__" + /// Font icon named "__arrowRight20__" /// - /// - static const IconData iconBubble3ChatMessage = IconData( - 0xe016, - fontFamily: iconFontFamily, - fontPackage: iconFontPackage, - ); + /// + static const IconData arrowRight20 = IconData(0xe016, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconBubble3Solid__" + /// Font icon named "__arrowRight32__" /// - /// - static const IconData iconBubble3Solid = IconData(0xe017, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData arrowRight32 = IconData(0xe017, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconBubbleAnnotation2ChatMessage__" + /// Font icon named "__arrowUp12__" /// - /// - static const IconData iconBubbleAnnotation2ChatMessage = IconData( - 0xe018, - fontFamily: iconFontFamily, - fontPackage: iconFontPackage, - ); + /// + static const IconData arrowUp12 = IconData(0xe018, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconBubbleText6ChatMessage__" + /// Font icon named "__arrowUp16__" /// - /// - static const IconData iconBubbleText6ChatMessage = IconData( - 0xe019, - fontFamily: iconFontFamily, - fontPackage: iconFontPackage, - ); + /// + static const IconData arrowUp16 = IconData(0xe019, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconBubbleText6Solid__" + /// Font icon named "__arrowUp20__" /// - /// - static const IconData iconBubbleText6Solid = IconData( - 0xe01a, - fontFamily: iconFontFamily, - fontPackage: iconFontPackage, - ); + /// + static const IconData arrowUp20 = IconData(0xe01a, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconBubbleWideNotificationChatMessage__" + /// Font icon named "__arrowUp32__" /// - /// - static const IconData iconBubbleWideNotificationChatMessage = IconData( - 0xe01b, - fontFamily: iconFontFamily, - fontPackage: iconFontPackage, - ); + /// + static const IconData arrowUp32 = IconData(0xe01b, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconBubbleWideSparkleChatMessage__" + /// Font icon named "__arrowUpRight12__" /// - /// - static const IconData iconBubbleWideSparkleChatMessage = IconData( - 0xe01c, - fontFamily: iconFontFamily, - fontPackage: iconFontPackage, - ); + /// + static const IconData arrowUpRight12 = IconData(0xe01c, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconBubbles__" + /// Font icon named "__arrowUpRight16__" /// - /// - static const IconData iconBubbles = IconData(0xe01d, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData arrowUpRight16 = IconData(0xe01d, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconCalendar1__" + /// Font icon named "__arrowUpRight20__" /// - /// - static const IconData iconCalendar1 = IconData(0xe01e, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData arrowUpRight20 = IconData(0xe01e, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconCallCancel__" + /// Font icon named "__arrowUpRight32__" /// - /// - static const IconData iconCallCancel = IconData(0xe01f, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData arrowUpRight32 = IconData(0xe01f, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconCamera1__" + /// Font icon named "__attachment12__" /// - /// - static const IconData iconCamera1 = IconData(0xe020, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData attachment12 = IconData(0xe020, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconCar1__" + /// Font icon named "__attachment16__" /// - /// - static const IconData iconCar1 = IconData(0xe021, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData attachment16 = IconData(0xe021, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconCat__" + /// Font icon named "__attachment20__" /// - /// - static const IconData iconCat = IconData(0xe022, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData attachment20 = IconData(0xe022, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconChainLink3__" + /// Font icon named "__attachment32__" /// - /// - static const IconData iconChainLink3 = IconData(0xe023, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData attachment32 = IconData(0xe023, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconChart5__" + /// Font icon named "__audio12__" /// - /// - static const IconData iconChart5 = IconData(0xe024, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData audio12 = IconData(0xe024, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconCheckmark1Small__" + /// Font icon named "__audio16__" /// - /// - static const IconData iconCheckmark1Small = IconData( - 0xe025, - fontFamily: iconFontFamily, - fontPackage: iconFontPackage, - ); + /// + static const IconData audio16 = IconData(0xe025, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconCheckmark2__" + /// Font icon named "__audio20__" /// - /// - static const IconData iconCheckmark2 = IconData(0xe026, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData audio20 = IconData(0xe026, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconCheckmark2Small__" + /// Font icon named "__audio32__" /// - /// - static const IconData iconCheckmark2Small = IconData( - 0xe027, - fontFamily: iconFontFamily, - fontPackage: iconFontPackage, - ); + /// + static const IconData audio32 = IconData(0xe027, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconChevronDown__" + /// Font icon named "__bell12__" /// - /// - static const IconData iconChevronDown = IconData(0xe028, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData bell12 = IconData(0xe028, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconChevronGrabberVerticalSelector__" + /// Font icon named "__bell16__" /// - /// - static const IconData iconChevronGrabberVerticalSelector = IconData( - 0xe029, - fontFamily: iconFontFamily, - fontPackage: iconFontPackage, - ); + /// + static const IconData bell16 = IconData(0xe029, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconChevronLeft__" + /// Font icon named "__bell20__" /// - /// - static const IconData iconChevronLeft = IconData(0xe02a, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData bell20 = IconData(0xe02a, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconChevronRight__" + /// Font icon named "__bell32__" /// - /// - static const IconData iconChevronRight = IconData(0xe02b, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData bell32 = IconData(0xe02b, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconChevronTop__" + /// Font icon named "__bellOff12__" /// - /// - static const IconData iconChevronTop = IconData(0xe02c, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData bellOff12 = IconData(0xe02c, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconCircleBanSign__" + /// Font icon named "__bellOff16__" /// - /// - static const IconData iconCircleBanSign = IconData(0xe02d, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData bellOff16 = IconData(0xe02d, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconCircleCheck__" + /// Font icon named "__bellOff20__" /// - /// - static const IconData iconCircleCheck = IconData(0xe02e, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData bellOff20 = IconData(0xe02e, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconCircleInfoTooltip__" + /// Font icon named "__bellOff32__" /// - /// - static const IconData iconCircleInfoTooltip = IconData( - 0xe02f, - fontFamily: iconFontFamily, - fontPackage: iconFontPackage, - ); + /// + static const IconData bellOff32 = IconData(0xe02f, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconCircleMinus__" + /// Font icon named "__bolt12__" /// - /// - static const IconData iconCircleMinus = IconData(0xe030, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData bolt12 = IconData(0xe030, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconCircleQuestionmark__" + /// Font icon named "__bolt16__" /// - /// - static const IconData iconCircleQuestionmark = IconData( - 0xe031, - fontFamily: iconFontFamily, - fontPackage: iconFontPackage, - ); + /// + static const IconData bolt16 = IconData(0xe031, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconCircleQuestionmarkFilled__" + /// Font icon named "__bolt20__" /// - /// - static const IconData iconCircleQuestionmarkFilled = IconData( - 0xe032, - fontFamily: iconFontFamily, - fontPackage: iconFontPackage, - ); + /// + static const IconData bolt20 = IconData(0xe032, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconCircleX__" + /// Font icon named "__bolt32__" /// - /// - static const IconData iconCircleX = IconData(0xe033, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData bolt32 = IconData(0xe033, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconClock__" + /// Font icon named "__camera12__" /// - /// - static const IconData iconClock = IconData(0xe034, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData camera12 = IconData(0xe034, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconClockSolid__" + /// Font icon named "__camera16__" /// - /// - static const IconData iconClockSolid = IconData(0xe035, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData camera16 = IconData(0xe035, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconCloseQuote2__" + /// Font icon named "__camera20__" /// - /// - static const IconData iconCloseQuote2 = IconData(0xe036, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData camera20 = IconData(0xe036, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconCloudSimpleUpload__" + /// Font icon named "__camera32__" /// - /// - static const IconData iconCloudSimpleUpload = IconData( - 0xe037, - fontFamily: iconFontFamily, - fontPackage: iconFontPackage, - ); + /// + static const IconData camera32 = IconData(0xe037, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconCode__" + /// Font icon named "__checkmark12__" /// - /// - static const IconData iconCode = IconData(0xe038, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData checkmark12 = IconData(0xe038, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconCodeBrackets__" + /// Font icon named "__checkmark16__" /// - /// - static const IconData iconCodeBrackets = IconData(0xe039, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData checkmark16 = IconData(0xe039, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconCodeEditorInsert__" + /// Font icon named "__checkmark20__" /// - /// - static const IconData iconCodeEditorInsert = IconData( - 0xe03a, - fontFamily: iconFontFamily, - fontPackage: iconFontPackage, - ); + /// + static const IconData checkmark20 = IconData(0xe03a, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconCompass__" + /// Font icon named "__checkmark32__" /// - /// - static const IconData iconCompass = IconData(0xe03b, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData checkmark32 = IconData(0xe03b, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconComponents__" + /// Font icon named "__checks12__" /// - /// - static const IconData iconComponents = IconData(0xe03c, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData checks12 = IconData(0xe03c, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconCreditCard2Billing__" + /// Font icon named "__checks16__" /// - /// - static const IconData iconCreditCard2Billing = IconData( - 0xe03d, - fontFamily: iconFontFamily, - fontPackage: iconFontPackage, - ); + /// + static const IconData checks16 = IconData(0xe03d, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__checks20__" + /// + /// + static const IconData checks20 = IconData(0xe03e, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__checks32__" + /// + /// + static const IconData checks32 = IconData(0xe03f, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__chevronDown12__" + /// + /// + static const IconData chevronDown12 = IconData(0xe040, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__chevronDown16__" + /// + /// + static const IconData chevronDown16 = IconData(0xe041, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__chevronDown20__" + /// + /// + static const IconData chevronDown20 = IconData(0xe042, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__chevronDown32__" + /// + /// + static const IconData chevronDown32 = IconData(0xe043, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__chevronLeft12__" + /// + /// + static const IconData chevronLeft12 = IconData(0xe044, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__chevronLeft16__" + /// + /// + static const IconData chevronLeft16 = IconData(0xe045, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__chevronLeft20__" + /// + /// + static const IconData chevronLeft20 = IconData(0xe046, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__chevronLeft32__" + /// + /// + static const IconData chevronLeft32 = IconData(0xe047, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__chevronRight12__" + /// + /// + static const IconData chevronRight12 = IconData(0xe048, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__chevronRight16__" + /// + /// + static const IconData chevronRight16 = IconData(0xe049, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__chevronRight20__" + /// + /// + static const IconData chevronRight20 = IconData(0xe04a, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__chevronRight32__" + /// + /// + static const IconData chevronRight32 = IconData(0xe04b, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__chevronUp12__" + /// + /// + static const IconData chevronUp12 = IconData(0xe04c, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__chevronUp16__" + /// + /// + static const IconData chevronUp16 = IconData(0xe04d, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__chevronUp20__" + /// + /// + static const IconData chevronUp20 = IconData(0xe04e, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__chevronUp32__" + /// + /// + static const IconData chevronUp32 = IconData(0xe04f, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__clock12__" + /// + /// + static const IconData clock12 = IconData(0xe050, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__clock16__" + /// + /// + static const IconData clock16 = IconData(0xe051, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__clock20__" + /// + /// + static const IconData clock20 = IconData(0xe052, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__clock32__" + /// + /// + static const IconData clock32 = IconData(0xe053, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__command12__" + /// + /// + static const IconData command12 = IconData(0xe054, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__command16__" + /// + /// + static const IconData command16 = IconData(0xe055, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__command20__" + /// + /// + static const IconData command20 = IconData(0xe056, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__command32__" + /// + /// + static const IconData command32 = IconData(0xe057, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__copy12__" + /// + /// + static const IconData copy12 = IconData(0xe058, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__copy16__" + /// + /// + static const IconData copy16 = IconData(0xe059, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__copy20__" + /// + /// + static const IconData copy20 = IconData(0xe05a, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__copy32__" + /// + /// + static const IconData copy32 = IconData(0xe05b, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__delete12__" + /// + /// + static const IconData delete12 = IconData(0xe05c, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconCrossMedium__" + /// Font icon named "__delete16__" /// - /// - static const IconData iconCrossMedium = IconData(0xe03e, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData delete16 = IconData(0xe05d, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconCrossSmall__" + /// Font icon named "__delete20__" /// - /// - static const IconData iconCrossSmall = IconData(0xe03f, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData delete20 = IconData(0xe05e, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconDotGrid1x3Horizontal__" + /// Font icon named "__delete32__" /// - /// - static const IconData iconDotGrid1x3Horizontal = IconData( - 0xe040, + /// + static const IconData delete32 = IconData(0xe05f, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__download12__" + /// + /// + static const IconData download12 = IconData(0xe060, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__download16__" + /// + /// + static const IconData download16 = IconData(0xe061, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__download20__" + /// + /// + static const IconData download20 = IconData(0xe062, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__download32__" + /// + /// + static const IconData download32 = IconData(0xe063, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__edit12__" + /// + /// + static const IconData edit12 = IconData(0xe064, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__edit16__" + /// + /// + static const IconData edit16 = IconData(0xe065, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__edit20__" + /// + /// + static const IconData edit20 = IconData(0xe066, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__edit32__" + /// + /// + static const IconData edit32 = IconData(0xe067, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__emoji12__" + /// + /// + static const IconData emoji12 = IconData(0xe068, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__emoji16__" + /// + /// + static const IconData emoji16 = IconData(0xe069, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__emoji20__" + /// + /// + static const IconData emoji20 = IconData(0xe06a, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__emoji32__" + /// + /// + static const IconData emoji32 = IconData(0xe06b, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__emojiAdd12__" + /// + /// + static const IconData emojiAdd12 = IconData(0xe06c, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__emojiAdd16__" + /// + /// + static const IconData emojiAdd16 = IconData(0xe06d, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__emojiAdd20__" + /// + /// + static const IconData emojiAdd20 = IconData(0xe06e, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__emojiAdd32__" + /// + /// + static const IconData emojiAdd32 = IconData(0xe06f, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__exclamationCircle12__" + /// + /// + static const IconData exclamationCircle12 = IconData( + 0xe070, fontFamily: iconFontFamily, fontPackage: iconFontPackage, ); - /// Font icon named "__IconDotGrid2x3__" - /// - /// - static const IconData iconDotGrid2x3 = IconData(0xe041, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - - /// Font icon named "__IconDotsGrid1x3Vertical__" + /// Font icon named "__exclamationCircle16__" /// - /// - static const IconData iconDotsGrid1x3Vertical = IconData( - 0xe042, + /// + static const IconData exclamationCircle16 = IconData( + 0xe071, fontFamily: iconFontFamily, fontPackage: iconFontPackage, ); - /// Font icon named "__IconDoupleCheckmark1Small__" + /// Font icon named "__exclamationCircle20__" /// - /// - static const IconData iconDoupleCheckmark1Small = IconData( - 0xe043, + /// + static const IconData exclamationCircle20 = IconData( + 0xe072, fontFamily: iconFontFamily, fontPackage: iconFontPackage, ); - /// Font icon named "__IconEditBig__" + /// Font icon named "__exclamationCircle32__" /// - /// - static const IconData iconEditBig = IconData(0xe044, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData exclamationCircle32 = IconData( + 0xe073, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); - /// Font icon named "__IconEditBigSolid__" + /// Font icon named "__exclamationCircleFill12__" /// - /// - static const IconData iconEditBigSolid = IconData(0xe045, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData exclamationCircleFill12 = IconData( + 0xe074, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); - /// Font icon named "__IconEmojiAddReaction__" + /// Font icon named "__exclamationCircleFill16__" /// - /// - static const IconData iconEmojiAddReaction = IconData( - 0xe046, + /// + static const IconData exclamationCircleFill16 = IconData( + 0xe075, fontFamily: iconFontFamily, fontPackage: iconFontPackage, ); - /// Font icon named "__IconEmojiSad__" + /// Font icon named "__exclamationCircleFill20__" /// - /// - static const IconData iconEmojiSad = IconData(0xe047, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData exclamationCircleFill20 = IconData( + 0xe076, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); - /// Font icon named "__IconEmojiSmile__" + /// Font icon named "__exclamationCircleFill32__" /// - /// - static const IconData iconEmojiSmile = IconData(0xe048, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData exclamationCircleFill32 = IconData( + 0xe077, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); - /// Font icon named "__IconExclamationCircle-1__" + /// Font icon named "__exclamationMarkFill12__" /// - /// - static const IconData iconExclamationCircle1 = IconData( - 0xe049, + /// + static const IconData exclamationMarkFill12 = IconData( + 0xe078, fontFamily: iconFontFamily, fontPackage: iconFontPackage, ); - /// Font icon named "__IconExclamationCircle__" + /// Font icon named "__exclamationMarkFill16__" /// - /// - static const IconData iconExclamationCircle = IconData( - 0xe04a, + /// + static const IconData exclamationMarkFill16 = IconData( + 0xe079, fontFamily: iconFontFamily, fontPackage: iconFontPackage, ); - /// Font icon named "__IconExclamationTriangle-1__" + /// Font icon named "__exclamationMarkFill20__" /// - /// - static const IconData iconExclamationTriangle1 = IconData( - 0xe04b, + /// + static const IconData exclamationMarkFill20 = IconData( + 0xe07a, fontFamily: iconFontFamily, fontPackage: iconFontPackage, ); - /// Font icon named "__IconExclamationTriangle__" + /// Font icon named "__exclamationMarkFill32__" /// - /// - static const IconData iconExclamationTriangle = IconData( - 0xe04c, + /// + static const IconData exclamationMarkFill32 = IconData( + 0xe07b, fontFamily: iconFontFamily, fontPackage: iconFontPackage, ); - /// Font icon named "__IconEyeOpen__" + /// Font icon named "__exclamationTriangleFill12__" /// - /// - static const IconData iconEyeOpen = IconData(0xe04d, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData exclamationTriangleFill12 = IconData( + 0xe07c, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); - /// Font icon named "__IconFileArrowLeftIn__" + /// Font icon named "__exclamationTriangleFill16__" /// - /// - static const IconData iconFileArrowLeftIn = IconData( - 0xe04e, + /// + static const IconData exclamationTriangleFill16 = IconData( + 0xe07d, fontFamily: iconFontFamily, fontPackage: iconFontPackage, ); - /// Font icon named "__IconFileBend__" + /// Font icon named "__exclamationTriangleFill20__" /// - /// - static const IconData iconFileBend = IconData(0xe04f, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData exclamationTriangleFill20 = IconData( + 0xe07e, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); - /// Font icon named "__IconFilledCircleInfoTooltip__" + /// Font icon named "__exclamationTriangleFill32__" /// - /// - static const IconData iconFilledCircleInfoTooltip = IconData( - 0xe050, + /// + static const IconData exclamationTriangleFill32 = IconData( + 0xe07f, fontFamily: iconFontFamily, fontPackage: iconFontPackage, ); - /// Font icon named "__IconFilter1__" + /// Font icon named "__export12__" /// - /// - static const IconData iconFilter1 = IconData(0xe051, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData export12 = IconData(0xe080, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconFlag2__" + /// Font icon named "__export16__" /// - /// - static const IconData iconFlag2 = IconData(0xe052, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData export16 = IconData(0xe081, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconFolder1__" + /// Font icon named "__export20__" /// - /// - static const IconData iconFolder1 = IconData(0xe053, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData export20 = IconData(0xe082, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconGauge__" + /// Font icon named "__export32__" /// - /// - static const IconData iconGauge = IconData(0xe054, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData export32 = IconData(0xe083, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconGoogle__" + /// Font icon named "__eyeFill12__" /// - /// - static const IconData iconGoogle = IconData(0xe055, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData eyeFill12 = IconData(0xe084, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconHashtagChannel__" + /// Font icon named "__eyeFill16__" /// - /// - static const IconData iconHashtagChannel = IconData(0xe056, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData eyeFill16 = IconData(0xe085, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconHeart2__" + /// Font icon named "__eyeFill20__" /// - /// - static const IconData iconHeart2 = IconData(0xe057, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData eyeFill20 = IconData(0xe086, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconHistory__" + /// Font icon named "__eyeFill32__" /// - /// - static const IconData iconHistory = IconData(0xe058, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData eyeFill32 = IconData(0xe087, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconImages1Alt__" + /// Font icon named "__file12__" /// - /// - static const IconData iconImages1Alt = IconData(0xe059, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData file12 = IconData(0xe088, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconInvite__" + /// Font icon named "__file16__" /// - /// - static const IconData iconInvite = IconData(0xe05a, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData file16 = IconData(0xe089, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconLayersBehind__" + /// Font icon named "__file20__" /// - /// - static const IconData iconLayersBehind = IconData(0xe05b, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData file20 = IconData(0xe08a, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconLayoutAlignLeft__" + /// Font icon named "__file32__" /// - /// - static const IconData iconLayoutAlignLeft = IconData( - 0xe05c, - fontFamily: iconFontFamily, - fontPackage: iconFontPackage, - ); + /// + static const IconData file32 = IconData(0xe08b, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconLayoutGrid1__" + /// Font icon named "__flag12__" /// - /// - static const IconData iconLayoutGrid1 = IconData(0xe05d, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData flag12 = IconData(0xe08c, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconLayoutGrid2__" + /// Font icon named "__flag16__" /// - /// - static const IconData iconLayoutGrid2 = IconData(0xe05e, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData flag16 = IconData(0xe08d, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconLayoutLeft__" + /// Font icon named "__flag20__" /// - /// - static const IconData iconLayoutLeft = IconData(0xe05f, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData flag20 = IconData(0xe08e, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconLightBulbSimple__" + /// Font icon named "__flag32__" /// - /// - static const IconData iconLightBulbSimple = IconData( - 0xe060, - fontFamily: iconFontFamily, - fontPackage: iconFontPackage, - ); + /// + static const IconData flag32 = IconData(0xe08f, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconLimits__" + /// Font icon named "__folder12__" /// - /// - static const IconData iconLimits = IconData(0xe061, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData folder12 = IconData(0xe090, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconLineChart3__" + /// Font icon named "__folder16__" /// - /// - static const IconData iconLineChart3 = IconData(0xe062, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData folder16 = IconData(0xe091, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconLock__" + /// Font icon named "__folder20__" /// - /// - static const IconData iconLock = IconData(0xe063, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData folder20 = IconData(0xe092, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconMagnifyingGlassSearch__" + /// Font icon named "__folder32__" /// - /// - static const IconData iconMagnifyingGlassSearch = IconData( - 0xe064, - fontFamily: iconFontFamily, - fontPackage: iconFontPackage, - ); + /// + static const IconData folder32 = IconData(0xe093, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconMapPin__" + /// Font icon named "__gallery12__" /// - /// - static const IconData iconMapPin = IconData(0xe065, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData gallery12 = IconData(0xe094, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconMicrophone__" + /// Font icon named "__gallery16__" /// - /// - static const IconData iconMicrophone = IconData(0xe066, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData gallery16 = IconData(0xe095, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconMicrophoneSolid__" + /// Font icon named "__gallery20__" /// - /// - static const IconData iconMicrophoneSolid = IconData( - 0xe067, - fontFamily: iconFontFamily, - fontPackage: iconFontPackage, - ); + /// + static const IconData gallery20 = IconData(0xe096, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconMinusLarge__" + /// Font icon named "__gallery32__" /// - /// - static const IconData iconMinusLarge = IconData(0xe068, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData gallery32 = IconData(0xe097, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconMinusSmall__" + /// Font icon named "__image12__" /// - /// - static const IconData iconMinusSmall = IconData(0xe069, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData image12 = IconData(0xe098, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconMute__" + /// Font icon named "__image16__" /// - /// - static const IconData iconMute = IconData(0xe06a, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData image16 = IconData(0xe099, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconNewspaper2__" + /// Font icon named "__image20__" /// - /// - static const IconData iconNewspaper2 = IconData(0xe06b, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData image20 = IconData(0xe09a, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconOrganization__" + /// Font icon named "__image32__" /// - /// - static const IconData iconOrganization = IconData(0xe06c, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData image32 = IconData(0xe09b, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconPaperPlane__" + /// Font icon named "__info12__" /// - /// - static const IconData iconPaperPlane = IconData(0xe06d, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData info12 = IconData(0xe09c, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconPaperPlaneTopRight__" + /// Font icon named "__info16__" /// - /// - static const IconData iconPaperPlaneTopRight = IconData( - 0xe06e, - fontFamily: iconFontFamily, - fontPackage: iconFontPackage, - ); + /// + static const IconData info16 = IconData(0xe09d, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconPaperclip1__" + /// Font icon named "__info20__" /// - /// - static const IconData iconPaperclip1 = IconData(0xe06f, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData info20 = IconData(0xe09e, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconParagraphsText__" + /// Font icon named "__info32__" /// - /// - static const IconData iconParagraphsText = IconData(0xe070, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData info32 = IconData(0xe09f, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconPause__" + /// Font icon named "__leave12__" /// - /// - static const IconData iconPause = IconData(0xe071, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData leave12 = IconData(0xe0a0, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconPencil__" + /// Font icon named "__leave16__" /// - /// - static const IconData iconPencil = IconData(0xe072, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData leave16 = IconData(0xe0a1, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconPeople__" + /// Font icon named "__leave20__" /// - /// - static const IconData iconPeople = IconData(0xe073, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData leave20 = IconData(0xe0a2, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconPeople2__" + /// Font icon named "__leave32__" /// - /// - static const IconData iconPeople2 = IconData(0xe074, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData leave32 = IconData(0xe0a3, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconPeopleAdd__" + /// Font icon named "__link12__" /// - /// - static const IconData iconPeopleAdd = IconData(0xe075, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData link12 = IconData(0xe0a4, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconPeopleAdded__" + /// Font icon named "__link16__" /// - /// - static const IconData iconPeopleAdded = IconData(0xe076, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData link16 = IconData(0xe0a5, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconPeopleCircle__" + /// Font icon named "__link20__" /// - /// - static const IconData iconPeopleCircle = IconData(0xe077, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData link20 = IconData(0xe0a6, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconPeopleCopy__" + /// Font icon named "__link32__" /// - /// - static const IconData iconPeopleCopy = IconData(0xe078, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData link32 = IconData(0xe0a7, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconPeopleEditUserRights__" + /// Font icon named "__location12__" /// - /// - static const IconData iconPeopleEditUserRights = IconData( - 0xe079, - fontFamily: iconFontFamily, - fontPackage: iconFontPackage, - ); + /// + static const IconData location12 = IconData(0xe0a8, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__location16__" + /// + /// + static const IconData location16 = IconData(0xe0a9, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__location20__" + /// + /// + static const IconData location20 = IconData(0xe0aa, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__location32__" + /// + /// + static const IconData location32 = IconData(0xe0ab, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconPeopleRemove__" + /// Font icon named "__lock12__" /// - /// - static const IconData iconPeopleRemove = IconData(0xe07a, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData lock12 = IconData(0xe0ac, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconPersona__" + /// Font icon named "__lock16__" /// - /// - static const IconData iconPersona = IconData(0xe07b, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData lock16 = IconData(0xe0ad, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconPin__" + /// Font icon named "__lock20__" /// - /// - static const IconData iconPin = IconData(0xe07c, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData lock20 = IconData(0xe0ae, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconPlaySolid__" + /// Font icon named "__lock32__" /// - /// - static const IconData iconPlaySolid = IconData(0xe07d, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData lock32 = IconData(0xe0af, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconPlusLarge__" + /// Font icon named "__mention12__" /// - /// - static const IconData iconPlusLarge = IconData(0xe07e, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData mention12 = IconData(0xe0b0, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconPlusSmall__" + /// Font icon named "__mention16__" /// - /// - static const IconData iconPlusSmall = IconData(0xe07f, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData mention16 = IconData(0xe0b1, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconRunShortcut__" + /// Font icon named "__mention20__" /// - /// - static const IconData iconRunShortcut = IconData(0xe080, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData mention20 = IconData(0xe0b2, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconSearchText__" + /// Font icon named "__mention32__" /// - /// - static const IconData iconSearchText = IconData(0xe081, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData mention32 = IconData(0xe0b3, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconSettingsGear2__" + /// Font icon named "__messageBubble12__" /// - /// - static const IconData iconSettingsGear2 = IconData(0xe082, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData messageBubble12 = IconData(0xe0b4, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconSettingsSliderVer__" + /// Font icon named "__messageBubble16__" /// - /// - static const IconData iconSettingsSliderVer = IconData( - 0xe083, + /// + static const IconData messageBubble16 = IconData(0xe0b5, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__messageBubble20__" + /// + /// + static const IconData messageBubble20 = IconData(0xe0b6, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__messageBubble32__" + /// + /// + static const IconData messageBubble32 = IconData(0xe0b7, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__messageBubbleFill12__" + /// + /// + static const IconData messageBubbleFill12 = IconData( + 0xe0b8, fontFamily: iconFontFamily, fontPackage: iconFontPackage, ); - /// Font icon named "__IconShapesPlusCloseSquareCircle__" + /// Font icon named "__messageBubbleFill16__" /// - /// - static const IconData iconShapesPlusCloseSquareCircle = IconData( - 0xe084, + /// + static const IconData messageBubbleFill16 = IconData( + 0xe0b9, fontFamily: iconFontFamily, fontPackage: iconFontPackage, ); - /// Font icon named "__IconShapesTriangleSquareCircle__" + /// Font icon named "__messageBubbleFill20__" /// - /// - static const IconData iconShapesTriangleSquareCircle = IconData( - 0xe085, + /// + static const IconData messageBubbleFill20 = IconData( + 0xe0ba, fontFamily: iconFontFamily, fontPackage: iconFontPackage, ); - /// Font icon named "__IconShareOs__" - /// - /// - static const IconData iconShareOs = IconData(0xe086, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - - /// Font icon named "__IconShareRedirectLink__" + /// Font icon named "__messageBubbleFill32__" /// - /// - static const IconData iconShareRedirectLink = IconData( - 0xe087, + /// + static const IconData messageBubbleFill32 = IconData( + 0xe0bb, fontFamily: iconFontFamily, fontPackage: iconFontPackage, ); - /// Font icon named "__IconShield__" + /// Font icon named "__messageBubbles12__" /// - /// - static const IconData iconShield = IconData(0xe088, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData messageBubbles12 = IconData(0xe0bc, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconSquareBehindSquare2_Copy__" + /// Font icon named "__messageBubbles16__" /// - /// - static const IconData iconSquareBehindSquare2Copy = IconData( - 0xe089, - fontFamily: iconFontFamily, - fontPackage: iconFontPackage, - ); + /// + static const IconData messageBubbles16 = IconData(0xe0bd, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconSquareCircleTopRightFeeds__" + /// Font icon named "__messageBubbles20__" /// - /// - static const IconData iconSquareCircleTopRightFeeds = IconData( - 0xe08a, - fontFamily: iconFontFamily, - fontPackage: iconFontPackage, - ); + /// + static const IconData messageBubbles20 = IconData(0xe0be, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconStop__" + /// Font icon named "__messageBubbles32__" /// - /// - static const IconData iconStop = IconData(0xe08b, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData messageBubbles32 = IconData(0xe0bf, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconTable__" + /// Font icon named "__minus12__" /// - /// - static const IconData iconTable = IconData(0xe08c, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData minus12 = IconData(0xe0c0, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconTeam__" + /// Font icon named "__minus16__" /// - /// - static const IconData iconTeam = IconData(0xe08d, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData minus16 = IconData(0xe0c1, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconTennis__" + /// Font icon named "__minus20__" /// - /// - static const IconData iconTennis = IconData(0xe08e, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData minus20 = IconData(0xe0c2, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconTextToImageURLEnrichment__" + /// Font icon named "__minus32__" /// - /// - static const IconData iconTextToImageURLEnrichment = IconData( - 0xe08f, - fontFamily: iconFontFamily, - fontPackage: iconFontPackage, - ); + /// + static const IconData minus32 = IconData(0xe0c3, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__minusCircle12__" + /// + /// + static const IconData minusCircle12 = IconData(0xe0c4, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__minusCircle16__" + /// + /// + static const IconData minusCircle16 = IconData(0xe0c5, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__minusCircle20__" + /// + /// + static const IconData minusCircle20 = IconData(0xe0c6, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__minusCircle32__" + /// + /// + static const IconData minusCircle32 = IconData(0xe0c7, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__more12__" + /// + /// + static const IconData more12 = IconData(0xe0c8, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__more16__" + /// + /// + static const IconData more16 = IconData(0xe0c9, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__more20__" + /// + /// + static const IconData more20 = IconData(0xe0ca, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__more32__" + /// + /// + static const IconData more32 = IconData(0xe0cb, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__mute12__" + /// + /// + static const IconData mute12 = IconData(0xe0cc, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__mute16__" + /// + /// + static const IconData mute16 = IconData(0xe0cd, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__mute20__" + /// + /// + static const IconData mute20 = IconData(0xe0ce, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__mute32__" + /// + /// + static const IconData mute32 = IconData(0xe0cf, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__noSign12__" + /// + /// + static const IconData noSign12 = IconData(0xe0d0, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__noSign16__" + /// + /// + static const IconData noSign16 = IconData(0xe0d1, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__noSign20__" + /// + /// + static const IconData noSign20 = IconData(0xe0d2, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__noSign32__" + /// + /// + static const IconData noSign32 = IconData(0xe0d3, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__notification12__" + /// + /// + static const IconData notification12 = IconData(0xe0d4, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__notification16__" + /// + /// + static const IconData notification16 = IconData(0xe0d5, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__notification20__" + /// + /// + static const IconData notification20 = IconData(0xe0d6, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__notification32__" + /// + /// + static const IconData notification32 = IconData(0xe0d7, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__pauseFill12__" + /// + /// + static const IconData pauseFill12 = IconData(0xe0d8, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__pauseFill16__" + /// + /// + static const IconData pauseFill16 = IconData(0xe0d9, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__pauseFill20__" + /// + /// + static const IconData pauseFill20 = IconData(0xe0da, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__pauseFill32__" + /// + /// + static const IconData pauseFill32 = IconData(0xe0db, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__pin12__" + /// + /// + static const IconData pin12 = IconData(0xe0dc, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__pin16__" + /// + /// + static const IconData pin16 = IconData(0xe0dd, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__pin20__" + /// + /// + static const IconData pin20 = IconData(0xe0de, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__pin32__" + /// + /// + static const IconData pin32 = IconData(0xe0df, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__playFill12__" + /// + /// + static const IconData playFill12 = IconData(0xe0e0, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__playFill16__" + /// + /// + static const IconData playFill16 = IconData(0xe0e1, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__playFill20__" + /// + /// + static const IconData playFill20 = IconData(0xe0e2, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__playFill32__" + /// + /// + static const IconData playFill32 = IconData(0xe0e3, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__plus12__" + /// + /// + static const IconData plus12 = IconData(0xe0e4, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__plus16__" + /// + /// + static const IconData plus16 = IconData(0xe0e5, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__plus20__" + /// + /// + static const IconData plus20 = IconData(0xe0e6, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__plus32__" + /// + /// + static const IconData plus32 = IconData(0xe0e7, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__poll12__" + /// + /// + static const IconData poll12 = IconData(0xe0e8, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__poll16__" + /// + /// + static const IconData poll16 = IconData(0xe0e9, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__poll20__" + /// + /// + static const IconData poll20 = IconData(0xe0ea, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__poll32__" + /// + /// + static const IconData poll32 = IconData(0xe0eb, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__quote12__" + /// + /// + static const IconData quote12 = IconData(0xe0ec, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__quote16__" + /// + /// + static const IconData quote16 = IconData(0xe0ed, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__quote20__" + /// + /// + static const IconData quote20 = IconData(0xe0ee, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__quote32__" + /// + /// + static const IconData quote32 = IconData(0xe0ef, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__refresh12__" + /// + /// + static const IconData refresh12 = IconData(0xe0f0, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__refresh16__" + /// + /// + static const IconData refresh16 = IconData(0xe0f1, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__refresh20__" + /// + /// + static const IconData refresh20 = IconData(0xe0f2, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__refresh32__" + /// + /// + static const IconData refresh32 = IconData(0xe0f3, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__reorder12__" + /// + /// + static const IconData reorder12 = IconData(0xe0f4, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__reorder16__" + /// + /// + static const IconData reorder16 = IconData(0xe0f5, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__reorder20__" + /// + /// + static const IconData reorder20 = IconData(0xe0f6, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__reorder32__" + /// + /// + static const IconData reorder32 = IconData(0xe0f7, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__reply12__" + /// + /// + static const IconData reply12 = IconData(0xe0f8, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__reply16__" + /// + /// + static const IconData reply16 = IconData(0xe0f9, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__reply20__" + /// + /// + static const IconData reply20 = IconData(0xe0fa, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__reply32__" + /// + /// + static const IconData reply32 = IconData(0xe0fb, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__retry12__" + /// + /// + static const IconData retry12 = IconData(0xe0fc, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__retry16__" + /// + /// + static const IconData retry16 = IconData(0xe0fd, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__retry20__" + /// + /// + static const IconData retry20 = IconData(0xe0fe, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__retry32__" + /// + /// + static const IconData retry32 = IconData(0xe0ff, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__save12__" + /// + /// + static const IconData save12 = IconData(0xe100, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__save16__" + /// + /// + static const IconData save16 = IconData(0xe101, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__save20__" + /// + /// + static const IconData save20 = IconData(0xe102, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__save32__" + /// + /// + static const IconData save32 = IconData(0xe103, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__search12__" + /// + /// + static const IconData search12 = IconData(0xe104, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__search16__" + /// + /// + static const IconData search16 = IconData(0xe105, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__search20__" + /// + /// + static const IconData search20 = IconData(0xe106, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__search32__" + /// + /// + static const IconData search32 = IconData(0xe107, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__send12__" + /// + /// + static const IconData send12 = IconData(0xe108, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__send16__" + /// + /// + static const IconData send16 = IconData(0xe109, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__send20__" + /// + /// + static const IconData send20 = IconData(0xe10a, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__send32__" + /// + /// + static const IconData send32 = IconData(0xe10b, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__share12__" + /// + /// + static const IconData share12 = IconData(0xe10c, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__share16__" + /// + /// + static const IconData share16 = IconData(0xe10d, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__share20__" + /// + /// + static const IconData share20 = IconData(0xe10e, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__share32__" + /// + /// + static const IconData share32 = IconData(0xe10f, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__sidebar12__" + /// + /// + static const IconData sidebar12 = IconData(0xe110, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__sidebar16__" + /// + /// + static const IconData sidebar16 = IconData(0xe111, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__sidebar20__" + /// + /// + static const IconData sidebar20 = IconData(0xe112, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__sidebar32__" + /// + /// + static const IconData sidebar32 = IconData(0xe113, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__stopFill12__" + /// + /// + static const IconData stopFill12 = IconData(0xe114, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__stopFill16__" + /// + /// + static const IconData stopFill16 = IconData(0xe115, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__stopFill20__" + /// + /// + static const IconData stopFill20 = IconData(0xe116, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__stopFill32__" + /// + /// + static const IconData stopFill32 = IconData(0xe117, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__thread12__" + /// + /// + static const IconData thread12 = IconData(0xe118, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__thread16__" + /// + /// + static const IconData thread16 = IconData(0xe119, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__thread20__" + /// + /// + static const IconData thread20 = IconData(0xe11a, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__thread32__" + /// + /// + static const IconData thread32 = IconData(0xe11b, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__threadFill12__" + /// + /// + static const IconData threadFill12 = IconData(0xe11c, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__threadFill16__" + /// + /// + static const IconData threadFill16 = IconData(0xe11d, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__threadFill20__" + /// + /// + static const IconData threadFill20 = IconData(0xe11e, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__threadFill32__" + /// + /// + static const IconData threadFill32 = IconData(0xe11f, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__translate12__" + /// + /// + static const IconData translate12 = IconData(0xe120, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__translate16__" + /// + /// + static const IconData translate16 = IconData(0xe121, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__translate20__" + /// + /// + static const IconData translate20 = IconData(0xe122, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__translate32__" + /// + /// + static const IconData translate32 = IconData(0xe123, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__trophy12__" + /// + /// + static const IconData trophy12 = IconData(0xe124, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__trophy16__" + /// + /// + static const IconData trophy16 = IconData(0xe125, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__trophy20__" + /// + /// + static const IconData trophy20 = IconData(0xe126, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__trophy32__" + /// + /// + static const IconData trophy32 = IconData(0xe127, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__unlock12__" + /// + /// + static const IconData unlock12 = IconData(0xe128, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__unlock16__" + /// + /// + static const IconData unlock16 = IconData(0xe129, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__unlock20__" + /// + /// + static const IconData unlock20 = IconData(0xe12a, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__unlock32__" + /// + /// + static const IconData unlock32 = IconData(0xe12b, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__unpin12__" + /// + /// + static const IconData unpin12 = IconData(0xe12c, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__unpin16__" + /// + /// + static const IconData unpin16 = IconData(0xe12d, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__unpin20__" + /// + /// + static const IconData unpin20 = IconData(0xe12e, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__unpin32__" + /// + /// + static const IconData unpin32 = IconData(0xe12f, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__unsave12__" + /// + /// + static const IconData unsave12 = IconData(0xe130, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__unsave16__" + /// + /// + static const IconData unsave16 = IconData(0xe131, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__unsave20__" + /// + /// + static const IconData unsave20 = IconData(0xe132, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__unsave32__" + /// + /// + static const IconData unsave32 = IconData(0xe133, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__upload12__" + /// + /// + static const IconData upload12 = IconData(0xe134, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__upload16__" + /// + /// + static const IconData upload16 = IconData(0xe135, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__upload20__" + /// + /// + static const IconData upload20 = IconData(0xe136, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__upload32__" + /// + /// + static const IconData upload32 = IconData(0xe137, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__user12__" + /// + /// + static const IconData user12 = IconData(0xe138, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__user16__" + /// + /// + static const IconData user16 = IconData(0xe139, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__user20__" + /// + /// + static const IconData user20 = IconData(0xe13a, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__user32__" + /// + /// + static const IconData user32 = IconData(0xe13b, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__userAdd12__" + /// + /// + static const IconData userAdd12 = IconData(0xe13c, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__userAdd16__" + /// + /// + static const IconData userAdd16 = IconData(0xe13d, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__userAdd20__" + /// + /// + static const IconData userAdd20 = IconData(0xe13e, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__userAdd32__" + /// + /// + static const IconData userAdd32 = IconData(0xe13f, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__userCheck12__" + /// + /// + static const IconData userCheck12 = IconData(0xe140, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__userCheck16__" + /// + /// + static const IconData userCheck16 = IconData(0xe141, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__userCheck20__" + /// + /// + static const IconData userCheck20 = IconData(0xe142, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__userCheck32__" + /// + /// + static const IconData userCheck32 = IconData(0xe143, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__userRemove12__" + /// + /// + static const IconData userRemove12 = IconData(0xe144, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__userRemove16__" + /// + /// + static const IconData userRemove16 = IconData(0xe145, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__userRemove20__" + /// + /// + static const IconData userRemove20 = IconData(0xe146, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__userRemove32__" + /// + /// + static const IconData userRemove32 = IconData(0xe147, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__users12__" + /// + /// + static const IconData users12 = IconData(0xe148, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__users16__" + /// + /// + static const IconData users16 = IconData(0xe149, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__users20__" + /// + /// + static const IconData users20 = IconData(0xe14a, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__users32__" + /// + /// + static const IconData users32 = IconData(0xe14b, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__video12__" + /// + /// + static const IconData video12 = IconData(0xe14c, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__video16__" + /// + /// + static const IconData video16 = IconData(0xe14d, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__video20__" + /// + /// + static const IconData video20 = IconData(0xe14e, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__video32__" + /// + /// + static const IconData video32 = IconData(0xe14f, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__videoFill12__" + /// + /// + static const IconData videoFill12 = IconData(0xe150, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__videoFill16__" + /// + /// + static const IconData videoFill16 = IconData(0xe151, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__videoFill20__" + /// + /// + static const IconData videoFill20 = IconData(0xe152, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__videoFill32__" + /// + /// + static const IconData videoFill32 = IconData(0xe153, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__voice12__" + /// + /// + static const IconData voice12 = IconData(0xe154, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__voice16__" + /// + /// + static const IconData voice16 = IconData(0xe155, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconThunder__" + /// Font icon named "__voice20__" /// - /// - static const IconData iconThunder = IconData(0xe090, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData voice20 = IconData(0xe156, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconTranslate__" + /// Font icon named "__voice32__" /// - /// - static const IconData iconTranslate = IconData(0xe091, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData voice32 = IconData(0xe157, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconTrashBin__" + /// Font icon named "__voiceFill12__" /// - /// - static const IconData iconTrashBin = IconData(0xe092, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData voiceFill12 = IconData(0xe158, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconTrending4__" + /// Font icon named "__voiceFill16__" /// - /// - static const IconData iconTrending4 = IconData(0xe093, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData voiceFill16 = IconData(0xe159, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconTrophy__" + /// Font icon named "__voiceFill20__" /// - /// - static const IconData iconTrophy = IconData(0xe094, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData voiceFill20 = IconData(0xe15a, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconUnlocked__" + /// Font icon named "__voiceFill32__" /// - /// - static const IconData iconUnlocked = IconData(0xe095, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData voiceFill32 = IconData(0xe15b, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconUnpin__" + /// Font icon named "__xCircle12__" /// - /// - static const IconData iconUnpin = IconData(0xe096, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData xCircle12 = IconData(0xe15c, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconUsers__" + /// Font icon named "__xCircle16__" /// - /// - static const IconData iconUsers = IconData(0xe097, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData xCircle16 = IconData(0xe15d, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconVideo__" + /// Font icon named "__xCircle20__" /// - /// - static const IconData iconVideo = IconData(0xe098, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData xCircle20 = IconData(0xe15e, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconVideoSolid__" + /// Font icon named "__xCircle32__" /// - /// - static const IconData iconVideoSolid = IconData(0xe099, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData xCircle32 = IconData(0xe15f, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconVoiceAndVideo__" + /// Font icon named "__xmark12__" /// - /// - static const IconData iconVoiceAndVideo = IconData(0xe09a, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData xmark12 = IconData(0xe160, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconVoiceHigh__" + /// Font icon named "__xmark16__" /// - /// - static const IconData iconVoiceHigh = IconData(0xe09b, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData xmark16 = IconData(0xe161, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconVolumeFull__" + /// Font icon named "__xmark20__" /// - /// - static const IconData iconVolumeFull = IconData(0xe09c, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData xmark20 = IconData(0xe162, fontFamily: iconFontFamily, fontPackage: iconFontPackage); - /// Font icon named "__IconWebhook__" + /// Font icon named "__xmark32__" /// - /// - static const IconData iconWebhook = IconData(0xe09d, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + /// + static const IconData xmark32 = IconData(0xe163, fontFamily: iconFontFamily, fontPackage: iconFontPackage); } /// Colored SVG icon data constants. diff --git a/packages/stream_core_flutter/lib/src/theme/primitives/stream_icons.g.theme.dart b/packages/stream_core_flutter/lib/src/theme/primitives/stream_icons.g.theme.dart index 9975022d..f8d2ba4a 100644 --- a/packages/stream_core_flutter/lib/src/theme/primitives/stream_icons.g.theme.dart +++ b/packages/stream_core_flutter/lib/src/theme/primitives/stream_icons.g.theme.dart @@ -26,555 +26,1138 @@ mixin _$StreamIcons { } return StreamIcons( - apiAggregate: t < 0.5 ? a.apiAggregate : b.apiAggregate, - apples: t < 0.5 ? a.apples : b.apples, - archive1: t < 0.5 ? a.archive1 : b.archive1, - arrowBoxLeft: t < 0.5 ? a.arrowBoxLeft : b.arrowBoxLeft, - arrowDown: t < 0.5 ? a.arrowDown : b.arrowDown, - arrowDownCircle: t < 0.5 ? a.arrowDownCircle : b.arrowDownCircle, - arrowLeft: t < 0.5 ? a.arrowLeft : b.arrowLeft, - arrowRight: t < 0.5 ? a.arrowRight : b.arrowRight, - arrowRotateClockwise: t < 0.5 - ? a.arrowRotateClockwise - : b.arrowRotateClockwise, - arrowRotateRightLeftRepeatRefresh: t < 0.5 - ? a.arrowRotateRightLeftRepeatRefresh - : b.arrowRotateRightLeftRepeatRefresh, - arrowShareLeft: t < 0.5 ? a.arrowShareLeft : b.arrowShareLeft, - arrowShareRight: t < 0.5 ? a.arrowShareRight : b.arrowShareRight, - arrowUp: t < 0.5 ? a.arrowUp : b.arrowUp, - arrowUpRight: t < 0.5 ? a.arrowUpRight : b.arrowUpRight, - arrowsRepeatLeftRight: t < 0.5 - ? a.arrowsRepeatLeftRight - : b.arrowsRepeatLeftRight, - at: t < 0.5 ? a.at : b.at, - atSolid: t < 0.5 ? a.atSolid : b.atSolid, - bellNotification: t < 0.5 ? a.bellNotification : b.bellNotification, - bellOff: t < 0.5 ? a.bellOff : b.bellOff, - bookmark: t < 0.5 ? a.bookmark : b.bookmark, - bookmarkRemove: t < 0.5 ? a.bookmarkRemove : b.bookmarkRemove, - browserAISparkle: t < 0.5 ? a.browserAISparkle : b.browserAISparkle, - bubble3ChatMessage: t < 0.5 ? a.bubble3ChatMessage : b.bubble3ChatMessage, - bubble3Solid: t < 0.5 ? a.bubble3Solid : b.bubble3Solid, - bubbleAnnotation2ChatMessage: t < 0.5 - ? a.bubbleAnnotation2ChatMessage - : b.bubbleAnnotation2ChatMessage, - bubbleText6ChatMessage: t < 0.5 - ? a.bubbleText6ChatMessage - : b.bubbleText6ChatMessage, - bubbleText6Solid: t < 0.5 ? a.bubbleText6Solid : b.bubbleText6Solid, - bubbleWideNotificationChatMessage: t < 0.5 - ? a.bubbleWideNotificationChatMessage - : b.bubbleWideNotificationChatMessage, - bubbleWideSparkleChatMessage: t < 0.5 - ? a.bubbleWideSparkleChatMessage - : b.bubbleWideSparkleChatMessage, - bubbles: t < 0.5 ? a.bubbles : b.bubbles, - calendar1: t < 0.5 ? a.calendar1 : b.calendar1, - callCancel: t < 0.5 ? a.callCancel : b.callCancel, - camera1: t < 0.5 ? a.camera1 : b.camera1, - car1: t < 0.5 ? a.car1 : b.car1, - cat: t < 0.5 ? a.cat : b.cat, - chainLink3: t < 0.5 ? a.chainLink3 : b.chainLink3, - chart5: t < 0.5 ? a.chart5 : b.chart5, - checkmark1Small: t < 0.5 ? a.checkmark1Small : b.checkmark1Small, - checkmark2: t < 0.5 ? a.checkmark2 : b.checkmark2, - checkmark2Small: t < 0.5 ? a.checkmark2Small : b.checkmark2Small, - chevronDown: t < 0.5 ? a.chevronDown : b.chevronDown, - chevronGrabberVerticalSelector: t < 0.5 - ? a.chevronGrabberVerticalSelector - : b.chevronGrabberVerticalSelector, - chevronLeft: t < 0.5 ? a.chevronLeft : b.chevronLeft, - chevronRight: t < 0.5 ? a.chevronRight : b.chevronRight, - chevronTop: t < 0.5 ? a.chevronTop : b.chevronTop, - circleBanSign: t < 0.5 ? a.circleBanSign : b.circleBanSign, - circleCheck: t < 0.5 ? a.circleCheck : b.circleCheck, - circleInfoTooltip: t < 0.5 ? a.circleInfoTooltip : b.circleInfoTooltip, - circleMinus: t < 0.5 ? a.circleMinus : b.circleMinus, - circleQuestionmark: t < 0.5 ? a.circleQuestionmark : b.circleQuestionmark, - circleQuestionmarkFilled: t < 0.5 - ? a.circleQuestionmarkFilled - : b.circleQuestionmarkFilled, - circleX: t < 0.5 ? a.circleX : b.circleX, - clock: t < 0.5 ? a.clock : b.clock, - clockSolid: t < 0.5 ? a.clockSolid : b.clockSolid, - closeQuote2: t < 0.5 ? a.closeQuote2 : b.closeQuote2, - cloudSimpleUpload: t < 0.5 ? a.cloudSimpleUpload : b.cloudSimpleUpload, - code: t < 0.5 ? a.code : b.code, - codeBrackets: t < 0.5 ? a.codeBrackets : b.codeBrackets, - codeEditorInsert: t < 0.5 ? a.codeEditorInsert : b.codeEditorInsert, - compass: t < 0.5 ? a.compass : b.compass, - components: t < 0.5 ? a.components : b.components, - creditCard2Billing: t < 0.5 ? a.creditCard2Billing : b.creditCard2Billing, - crossMedium: t < 0.5 ? a.crossMedium : b.crossMedium, - crossSmall: t < 0.5 ? a.crossSmall : b.crossSmall, - dotGrid1x3Horizontal: t < 0.5 - ? a.dotGrid1x3Horizontal - : b.dotGrid1x3Horizontal, - dotGrid2x3: t < 0.5 ? a.dotGrid2x3 : b.dotGrid2x3, - dotsGrid1x3Vertical: t < 0.5 - ? a.dotsGrid1x3Vertical - : b.dotsGrid1x3Vertical, - doupleCheckmark1Small: t < 0.5 - ? a.doupleCheckmark1Small - : b.doupleCheckmark1Small, - editBig: t < 0.5 ? a.editBig : b.editBig, - editBigSolid: t < 0.5 ? a.editBigSolid : b.editBigSolid, - emojiAddReaction: t < 0.5 ? a.emojiAddReaction : b.emojiAddReaction, - emojiSad: t < 0.5 ? a.emojiSad : b.emojiSad, - emojiSmile: t < 0.5 ? a.emojiSmile : b.emojiSmile, - exclamationCircle: t < 0.5 ? a.exclamationCircle : b.exclamationCircle, - exclamationCircle1: t < 0.5 ? a.exclamationCircle1 : b.exclamationCircle1, - exclamationTriangle: t < 0.5 - ? a.exclamationTriangle - : b.exclamationTriangle, - exclamationTriangle1: t < 0.5 - ? a.exclamationTriangle1 - : b.exclamationTriangle1, - eyeOpen: t < 0.5 ? a.eyeOpen : b.eyeOpen, - fileArrowLeftIn: t < 0.5 ? a.fileArrowLeftIn : b.fileArrowLeftIn, - fileBend: t < 0.5 ? a.fileBend : b.fileBend, - filledCircleInfoTooltip: t < 0.5 - ? a.filledCircleInfoTooltip - : b.filledCircleInfoTooltip, - filter1: t < 0.5 ? a.filter1 : b.filter1, - flag2: t < 0.5 ? a.flag2 : b.flag2, - folder1: t < 0.5 ? a.folder1 : b.folder1, - gauge: t < 0.5 ? a.gauge : b.gauge, - google: t < 0.5 ? a.google : b.google, - hashtagChannel: t < 0.5 ? a.hashtagChannel : b.hashtagChannel, - heart2: t < 0.5 ? a.heart2 : b.heart2, - history: t < 0.5 ? a.history : b.history, - images1Alt: t < 0.5 ? a.images1Alt : b.images1Alt, - invite: t < 0.5 ? a.invite : b.invite, - layersBehind: t < 0.5 ? a.layersBehind : b.layersBehind, - layoutAlignLeft: t < 0.5 ? a.layoutAlignLeft : b.layoutAlignLeft, - layoutGrid1: t < 0.5 ? a.layoutGrid1 : b.layoutGrid1, - layoutGrid2: t < 0.5 ? a.layoutGrid2 : b.layoutGrid2, - layoutLeft: t < 0.5 ? a.layoutLeft : b.layoutLeft, - lightBulbSimple: t < 0.5 ? a.lightBulbSimple : b.lightBulbSimple, - limits: t < 0.5 ? a.limits : b.limits, - lineChart3: t < 0.5 ? a.lineChart3 : b.lineChart3, - lock: t < 0.5 ? a.lock : b.lock, - magnifyingGlassSearch: t < 0.5 - ? a.magnifyingGlassSearch - : b.magnifyingGlassSearch, - mapPin: t < 0.5 ? a.mapPin : b.mapPin, - microphone: t < 0.5 ? a.microphone : b.microphone, - microphoneSolid: t < 0.5 ? a.microphoneSolid : b.microphoneSolid, - minusLarge: t < 0.5 ? a.minusLarge : b.minusLarge, - minusSmall: t < 0.5 ? a.minusSmall : b.minusSmall, - mute: t < 0.5 ? a.mute : b.mute, - newspaper2: t < 0.5 ? a.newspaper2 : b.newspaper2, - organization: t < 0.5 ? a.organization : b.organization, - paperPlane: t < 0.5 ? a.paperPlane : b.paperPlane, - paperPlaneTopRight: t < 0.5 ? a.paperPlaneTopRight : b.paperPlaneTopRight, - paperclip1: t < 0.5 ? a.paperclip1 : b.paperclip1, - paragraphsText: t < 0.5 ? a.paragraphsText : b.paragraphsText, - pause: t < 0.5 ? a.pause : b.pause, - pencil: t < 0.5 ? a.pencil : b.pencil, - people: t < 0.5 ? a.people : b.people, - people2: t < 0.5 ? a.people2 : b.people2, - peopleAdd: t < 0.5 ? a.peopleAdd : b.peopleAdd, - peopleAdded: t < 0.5 ? a.peopleAdded : b.peopleAdded, - peopleCircle: t < 0.5 ? a.peopleCircle : b.peopleCircle, - peopleCopy: t < 0.5 ? a.peopleCopy : b.peopleCopy, - peopleEditUserRights: t < 0.5 - ? a.peopleEditUserRights - : b.peopleEditUserRights, - peopleRemove: t < 0.5 ? a.peopleRemove : b.peopleRemove, - persona: t < 0.5 ? a.persona : b.persona, - pin: t < 0.5 ? a.pin : b.pin, - playSolid: t < 0.5 ? a.playSolid : b.playSolid, - plusLarge: t < 0.5 ? a.plusLarge : b.plusLarge, - plusSmall: t < 0.5 ? a.plusSmall : b.plusSmall, - runShortcut: t < 0.5 ? a.runShortcut : b.runShortcut, - searchText: t < 0.5 ? a.searchText : b.searchText, - settingsGear2: t < 0.5 ? a.settingsGear2 : b.settingsGear2, - settingsSliderVer: t < 0.5 ? a.settingsSliderVer : b.settingsSliderVer, - shapesPlusCloseSquareCircle: t < 0.5 - ? a.shapesPlusCloseSquareCircle - : b.shapesPlusCloseSquareCircle, - shapesTriangleSquareCircle: t < 0.5 - ? a.shapesTriangleSquareCircle - : b.shapesTriangleSquareCircle, - shareOs: t < 0.5 ? a.shareOs : b.shareOs, - shareRedirectLink: t < 0.5 ? a.shareRedirectLink : b.shareRedirectLink, - shield: t < 0.5 ? a.shield : b.shield, - squareBehindSquare2Copy: t < 0.5 - ? a.squareBehindSquare2Copy - : b.squareBehindSquare2Copy, - squareCircleTopRightFeeds: t < 0.5 - ? a.squareCircleTopRightFeeds - : b.squareCircleTopRightFeeds, - stop: t < 0.5 ? a.stop : b.stop, - table: t < 0.5 ? a.table : b.table, - team: t < 0.5 ? a.team : b.team, - tennis: t < 0.5 ? a.tennis : b.tennis, - textToImageURLEnrichment: t < 0.5 - ? a.textToImageURLEnrichment - : b.textToImageURLEnrichment, - thunder: t < 0.5 ? a.thunder : b.thunder, - translate: t < 0.5 ? a.translate : b.translate, - trashBin: t < 0.5 ? a.trashBin : b.trashBin, - trending4: t < 0.5 ? a.trending4 : b.trending4, - trophy: t < 0.5 ? a.trophy : b.trophy, - unlocked: t < 0.5 ? a.unlocked : b.unlocked, - unpin: t < 0.5 ? a.unpin : b.unpin, - users: t < 0.5 ? a.users : b.users, - video: t < 0.5 ? a.video : b.video, - videoSolid: t < 0.5 ? a.videoSolid : b.videoSolid, - voiceAndVideo: t < 0.5 ? a.voiceAndVideo : b.voiceAndVideo, - voiceHigh: t < 0.5 ? a.voiceHigh : b.voiceHigh, - volumeFull: t < 0.5 ? a.volumeFull : b.volumeFull, - webhook: t < 0.5 ? a.webhook : b.webhook, + account12: t < 0.5 ? a.account12 : b.account12, + account16: t < 0.5 ? a.account16 : b.account16, + account20: t < 0.5 ? a.account20 : b.account20, + account32: t < 0.5 ? a.account32 : b.account32, + archive12: t < 0.5 ? a.archive12 : b.archive12, + archive16: t < 0.5 ? a.archive16 : b.archive16, + archive20: t < 0.5 ? a.archive20 : b.archive20, + archive32: t < 0.5 ? a.archive32 : b.archive32, + arrowDown12: t < 0.5 ? a.arrowDown12 : b.arrowDown12, + arrowDown16: t < 0.5 ? a.arrowDown16 : b.arrowDown16, + arrowDown20: t < 0.5 ? a.arrowDown20 : b.arrowDown20, + arrowDown32: t < 0.5 ? a.arrowDown32 : b.arrowDown32, + arrowDownCircle12: t < 0.5 ? a.arrowDownCircle12 : b.arrowDownCircle12, + arrowDownCircle16: t < 0.5 ? a.arrowDownCircle16 : b.arrowDownCircle16, + arrowDownCircle20: t < 0.5 ? a.arrowDownCircle20 : b.arrowDownCircle20, + arrowDownCircle32: t < 0.5 ? a.arrowDownCircle32 : b.arrowDownCircle32, + arrowLeft12: t < 0.5 ? a.arrowLeft12 : b.arrowLeft12, + arrowLeft16: t < 0.5 ? a.arrowLeft16 : b.arrowLeft16, + arrowLeft20: t < 0.5 ? a.arrowLeft20 : b.arrowLeft20, + arrowLeft32: t < 0.5 ? a.arrowLeft32 : b.arrowLeft32, + arrowRight12: t < 0.5 ? a.arrowRight12 : b.arrowRight12, + arrowRight16: t < 0.5 ? a.arrowRight16 : b.arrowRight16, + arrowRight20: t < 0.5 ? a.arrowRight20 : b.arrowRight20, + arrowRight32: t < 0.5 ? a.arrowRight32 : b.arrowRight32, + arrowUp12: t < 0.5 ? a.arrowUp12 : b.arrowUp12, + arrowUp16: t < 0.5 ? a.arrowUp16 : b.arrowUp16, + arrowUp20: t < 0.5 ? a.arrowUp20 : b.arrowUp20, + arrowUp32: t < 0.5 ? a.arrowUp32 : b.arrowUp32, + arrowUpRight12: t < 0.5 ? a.arrowUpRight12 : b.arrowUpRight12, + arrowUpRight16: t < 0.5 ? a.arrowUpRight16 : b.arrowUpRight16, + arrowUpRight20: t < 0.5 ? a.arrowUpRight20 : b.arrowUpRight20, + arrowUpRight32: t < 0.5 ? a.arrowUpRight32 : b.arrowUpRight32, + attachment12: t < 0.5 ? a.attachment12 : b.attachment12, + attachment16: t < 0.5 ? a.attachment16 : b.attachment16, + attachment20: t < 0.5 ? a.attachment20 : b.attachment20, + attachment32: t < 0.5 ? a.attachment32 : b.attachment32, + audio12: t < 0.5 ? a.audio12 : b.audio12, + audio16: t < 0.5 ? a.audio16 : b.audio16, + audio20: t < 0.5 ? a.audio20 : b.audio20, + audio32: t < 0.5 ? a.audio32 : b.audio32, + bell12: t < 0.5 ? a.bell12 : b.bell12, + bell16: t < 0.5 ? a.bell16 : b.bell16, + bell20: t < 0.5 ? a.bell20 : b.bell20, + bell32: t < 0.5 ? a.bell32 : b.bell32, + bellOff12: t < 0.5 ? a.bellOff12 : b.bellOff12, + bellOff16: t < 0.5 ? a.bellOff16 : b.bellOff16, + bellOff20: t < 0.5 ? a.bellOff20 : b.bellOff20, + bellOff32: t < 0.5 ? a.bellOff32 : b.bellOff32, + bolt12: t < 0.5 ? a.bolt12 : b.bolt12, + bolt16: t < 0.5 ? a.bolt16 : b.bolt16, + bolt20: t < 0.5 ? a.bolt20 : b.bolt20, + bolt32: t < 0.5 ? a.bolt32 : b.bolt32, + camera12: t < 0.5 ? a.camera12 : b.camera12, + camera16: t < 0.5 ? a.camera16 : b.camera16, + camera20: t < 0.5 ? a.camera20 : b.camera20, + camera32: t < 0.5 ? a.camera32 : b.camera32, + checkmark12: t < 0.5 ? a.checkmark12 : b.checkmark12, + checkmark16: t < 0.5 ? a.checkmark16 : b.checkmark16, + checkmark20: t < 0.5 ? a.checkmark20 : b.checkmark20, + checkmark32: t < 0.5 ? a.checkmark32 : b.checkmark32, + checks12: t < 0.5 ? a.checks12 : b.checks12, + checks16: t < 0.5 ? a.checks16 : b.checks16, + checks20: t < 0.5 ? a.checks20 : b.checks20, + checks32: t < 0.5 ? a.checks32 : b.checks32, + chevronDown12: t < 0.5 ? a.chevronDown12 : b.chevronDown12, + chevronDown16: t < 0.5 ? a.chevronDown16 : b.chevronDown16, + chevronDown20: t < 0.5 ? a.chevronDown20 : b.chevronDown20, + chevronDown32: t < 0.5 ? a.chevronDown32 : b.chevronDown32, + chevronLeft12: t < 0.5 ? a.chevronLeft12 : b.chevronLeft12, + chevronLeft16: t < 0.5 ? a.chevronLeft16 : b.chevronLeft16, + chevronLeft20: t < 0.5 ? a.chevronLeft20 : b.chevronLeft20, + chevronLeft32: t < 0.5 ? a.chevronLeft32 : b.chevronLeft32, + chevronRight12: t < 0.5 ? a.chevronRight12 : b.chevronRight12, + chevronRight16: t < 0.5 ? a.chevronRight16 : b.chevronRight16, + chevronRight20: t < 0.5 ? a.chevronRight20 : b.chevronRight20, + chevronRight32: t < 0.5 ? a.chevronRight32 : b.chevronRight32, + chevronUp12: t < 0.5 ? a.chevronUp12 : b.chevronUp12, + chevronUp16: t < 0.5 ? a.chevronUp16 : b.chevronUp16, + chevronUp20: t < 0.5 ? a.chevronUp20 : b.chevronUp20, + chevronUp32: t < 0.5 ? a.chevronUp32 : b.chevronUp32, + clock12: t < 0.5 ? a.clock12 : b.clock12, + clock16: t < 0.5 ? a.clock16 : b.clock16, + clock20: t < 0.5 ? a.clock20 : b.clock20, + clock32: t < 0.5 ? a.clock32 : b.clock32, + command12: t < 0.5 ? a.command12 : b.command12, + command16: t < 0.5 ? a.command16 : b.command16, + command20: t < 0.5 ? a.command20 : b.command20, + command32: t < 0.5 ? a.command32 : b.command32, + copy12: t < 0.5 ? a.copy12 : b.copy12, + copy16: t < 0.5 ? a.copy16 : b.copy16, + copy20: t < 0.5 ? a.copy20 : b.copy20, + copy32: t < 0.5 ? a.copy32 : b.copy32, + delete12: t < 0.5 ? a.delete12 : b.delete12, + delete16: t < 0.5 ? a.delete16 : b.delete16, + delete20: t < 0.5 ? a.delete20 : b.delete20, + delete32: t < 0.5 ? a.delete32 : b.delete32, + download12: t < 0.5 ? a.download12 : b.download12, + download16: t < 0.5 ? a.download16 : b.download16, + download20: t < 0.5 ? a.download20 : b.download20, + download32: t < 0.5 ? a.download32 : b.download32, + edit12: t < 0.5 ? a.edit12 : b.edit12, + edit16: t < 0.5 ? a.edit16 : b.edit16, + edit20: t < 0.5 ? a.edit20 : b.edit20, + edit32: t < 0.5 ? a.edit32 : b.edit32, + emoji12: t < 0.5 ? a.emoji12 : b.emoji12, + emoji16: t < 0.5 ? a.emoji16 : b.emoji16, + emoji20: t < 0.5 ? a.emoji20 : b.emoji20, + emoji32: t < 0.5 ? a.emoji32 : b.emoji32, + emojiAdd12: t < 0.5 ? a.emojiAdd12 : b.emojiAdd12, + emojiAdd16: t < 0.5 ? a.emojiAdd16 : b.emojiAdd16, + emojiAdd20: t < 0.5 ? a.emojiAdd20 : b.emojiAdd20, + emojiAdd32: t < 0.5 ? a.emojiAdd32 : b.emojiAdd32, + exclamationCircle12: t < 0.5 + ? a.exclamationCircle12 + : b.exclamationCircle12, + exclamationCircle16: t < 0.5 + ? a.exclamationCircle16 + : b.exclamationCircle16, + exclamationCircle20: t < 0.5 + ? a.exclamationCircle20 + : b.exclamationCircle20, + exclamationCircle32: t < 0.5 + ? a.exclamationCircle32 + : b.exclamationCircle32, + exclamationCircleFill12: t < 0.5 + ? a.exclamationCircleFill12 + : b.exclamationCircleFill12, + exclamationCircleFill16: t < 0.5 + ? a.exclamationCircleFill16 + : b.exclamationCircleFill16, + exclamationCircleFill20: t < 0.5 + ? a.exclamationCircleFill20 + : b.exclamationCircleFill20, + exclamationCircleFill32: t < 0.5 + ? a.exclamationCircleFill32 + : b.exclamationCircleFill32, + exclamationMarkFill12: t < 0.5 + ? a.exclamationMarkFill12 + : b.exclamationMarkFill12, + exclamationMarkFill16: t < 0.5 + ? a.exclamationMarkFill16 + : b.exclamationMarkFill16, + exclamationMarkFill20: t < 0.5 + ? a.exclamationMarkFill20 + : b.exclamationMarkFill20, + exclamationMarkFill32: t < 0.5 + ? a.exclamationMarkFill32 + : b.exclamationMarkFill32, + exclamationTriangleFill12: t < 0.5 + ? a.exclamationTriangleFill12 + : b.exclamationTriangleFill12, + exclamationTriangleFill16: t < 0.5 + ? a.exclamationTriangleFill16 + : b.exclamationTriangleFill16, + exclamationTriangleFill20: t < 0.5 + ? a.exclamationTriangleFill20 + : b.exclamationTriangleFill20, + exclamationTriangleFill32: t < 0.5 + ? a.exclamationTriangleFill32 + : b.exclamationTriangleFill32, + export12: t < 0.5 ? a.export12 : b.export12, + export16: t < 0.5 ? a.export16 : b.export16, + export20: t < 0.5 ? a.export20 : b.export20, + export32: t < 0.5 ? a.export32 : b.export32, + eyeFill12: t < 0.5 ? a.eyeFill12 : b.eyeFill12, + eyeFill16: t < 0.5 ? a.eyeFill16 : b.eyeFill16, + eyeFill20: t < 0.5 ? a.eyeFill20 : b.eyeFill20, + eyeFill32: t < 0.5 ? a.eyeFill32 : b.eyeFill32, + file12: t < 0.5 ? a.file12 : b.file12, + file16: t < 0.5 ? a.file16 : b.file16, + file20: t < 0.5 ? a.file20 : b.file20, + file32: t < 0.5 ? a.file32 : b.file32, + flag12: t < 0.5 ? a.flag12 : b.flag12, + flag16: t < 0.5 ? a.flag16 : b.flag16, + flag20: t < 0.5 ? a.flag20 : b.flag20, + flag32: t < 0.5 ? a.flag32 : b.flag32, + folder12: t < 0.5 ? a.folder12 : b.folder12, + folder16: t < 0.5 ? a.folder16 : b.folder16, + folder20: t < 0.5 ? a.folder20 : b.folder20, + folder32: t < 0.5 ? a.folder32 : b.folder32, + gallery12: t < 0.5 ? a.gallery12 : b.gallery12, + gallery16: t < 0.5 ? a.gallery16 : b.gallery16, + gallery20: t < 0.5 ? a.gallery20 : b.gallery20, + gallery32: t < 0.5 ? a.gallery32 : b.gallery32, + image12: t < 0.5 ? a.image12 : b.image12, + image16: t < 0.5 ? a.image16 : b.image16, + image20: t < 0.5 ? a.image20 : b.image20, + image32: t < 0.5 ? a.image32 : b.image32, + info12: t < 0.5 ? a.info12 : b.info12, + info16: t < 0.5 ? a.info16 : b.info16, + info20: t < 0.5 ? a.info20 : b.info20, + info32: t < 0.5 ? a.info32 : b.info32, + leave12: t < 0.5 ? a.leave12 : b.leave12, + leave16: t < 0.5 ? a.leave16 : b.leave16, + leave20: t < 0.5 ? a.leave20 : b.leave20, + leave32: t < 0.5 ? a.leave32 : b.leave32, + link12: t < 0.5 ? a.link12 : b.link12, + link16: t < 0.5 ? a.link16 : b.link16, + link20: t < 0.5 ? a.link20 : b.link20, + link32: t < 0.5 ? a.link32 : b.link32, + location12: t < 0.5 ? a.location12 : b.location12, + location16: t < 0.5 ? a.location16 : b.location16, + location20: t < 0.5 ? a.location20 : b.location20, + location32: t < 0.5 ? a.location32 : b.location32, + lock12: t < 0.5 ? a.lock12 : b.lock12, + lock16: t < 0.5 ? a.lock16 : b.lock16, + lock20: t < 0.5 ? a.lock20 : b.lock20, + lock32: t < 0.5 ? a.lock32 : b.lock32, + mention12: t < 0.5 ? a.mention12 : b.mention12, + mention16: t < 0.5 ? a.mention16 : b.mention16, + mention20: t < 0.5 ? a.mention20 : b.mention20, + mention32: t < 0.5 ? a.mention32 : b.mention32, + messageBubble12: t < 0.5 ? a.messageBubble12 : b.messageBubble12, + messageBubble16: t < 0.5 ? a.messageBubble16 : b.messageBubble16, + messageBubble20: t < 0.5 ? a.messageBubble20 : b.messageBubble20, + messageBubble32: t < 0.5 ? a.messageBubble32 : b.messageBubble32, + messageBubbleFill12: t < 0.5 + ? a.messageBubbleFill12 + : b.messageBubbleFill12, + messageBubbleFill16: t < 0.5 + ? a.messageBubbleFill16 + : b.messageBubbleFill16, + messageBubbleFill20: t < 0.5 + ? a.messageBubbleFill20 + : b.messageBubbleFill20, + messageBubbleFill32: t < 0.5 + ? a.messageBubbleFill32 + : b.messageBubbleFill32, + messageBubbles12: t < 0.5 ? a.messageBubbles12 : b.messageBubbles12, + messageBubbles16: t < 0.5 ? a.messageBubbles16 : b.messageBubbles16, + messageBubbles20: t < 0.5 ? a.messageBubbles20 : b.messageBubbles20, + messageBubbles32: t < 0.5 ? a.messageBubbles32 : b.messageBubbles32, + minus12: t < 0.5 ? a.minus12 : b.minus12, + minus16: t < 0.5 ? a.minus16 : b.minus16, + minus20: t < 0.5 ? a.minus20 : b.minus20, + minus32: t < 0.5 ? a.minus32 : b.minus32, + minusCircle12: t < 0.5 ? a.minusCircle12 : b.minusCircle12, + minusCircle16: t < 0.5 ? a.minusCircle16 : b.minusCircle16, + minusCircle20: t < 0.5 ? a.minusCircle20 : b.minusCircle20, + minusCircle32: t < 0.5 ? a.minusCircle32 : b.minusCircle32, + more12: t < 0.5 ? a.more12 : b.more12, + more16: t < 0.5 ? a.more16 : b.more16, + more20: t < 0.5 ? a.more20 : b.more20, + more32: t < 0.5 ? a.more32 : b.more32, + mute12: t < 0.5 ? a.mute12 : b.mute12, + mute16: t < 0.5 ? a.mute16 : b.mute16, + mute20: t < 0.5 ? a.mute20 : b.mute20, + mute32: t < 0.5 ? a.mute32 : b.mute32, + noSign12: t < 0.5 ? a.noSign12 : b.noSign12, + noSign16: t < 0.5 ? a.noSign16 : b.noSign16, + noSign20: t < 0.5 ? a.noSign20 : b.noSign20, + noSign32: t < 0.5 ? a.noSign32 : b.noSign32, + notification12: t < 0.5 ? a.notification12 : b.notification12, + notification16: t < 0.5 ? a.notification16 : b.notification16, + notification20: t < 0.5 ? a.notification20 : b.notification20, + notification32: t < 0.5 ? a.notification32 : b.notification32, + pauseFill12: t < 0.5 ? a.pauseFill12 : b.pauseFill12, + pauseFill16: t < 0.5 ? a.pauseFill16 : b.pauseFill16, + pauseFill20: t < 0.5 ? a.pauseFill20 : b.pauseFill20, + pauseFill32: t < 0.5 ? a.pauseFill32 : b.pauseFill32, + pin12: t < 0.5 ? a.pin12 : b.pin12, + pin16: t < 0.5 ? a.pin16 : b.pin16, + pin20: t < 0.5 ? a.pin20 : b.pin20, + pin32: t < 0.5 ? a.pin32 : b.pin32, + playFill12: t < 0.5 ? a.playFill12 : b.playFill12, + playFill16: t < 0.5 ? a.playFill16 : b.playFill16, + playFill20: t < 0.5 ? a.playFill20 : b.playFill20, + playFill32: t < 0.5 ? a.playFill32 : b.playFill32, + plus12: t < 0.5 ? a.plus12 : b.plus12, + plus16: t < 0.5 ? a.plus16 : b.plus16, + plus20: t < 0.5 ? a.plus20 : b.plus20, + plus32: t < 0.5 ? a.plus32 : b.plus32, + poll12: t < 0.5 ? a.poll12 : b.poll12, + poll16: t < 0.5 ? a.poll16 : b.poll16, + poll20: t < 0.5 ? a.poll20 : b.poll20, + poll32: t < 0.5 ? a.poll32 : b.poll32, + quote12: t < 0.5 ? a.quote12 : b.quote12, + quote16: t < 0.5 ? a.quote16 : b.quote16, + quote20: t < 0.5 ? a.quote20 : b.quote20, + quote32: t < 0.5 ? a.quote32 : b.quote32, + refresh12: t < 0.5 ? a.refresh12 : b.refresh12, + refresh16: t < 0.5 ? a.refresh16 : b.refresh16, + refresh20: t < 0.5 ? a.refresh20 : b.refresh20, + refresh32: t < 0.5 ? a.refresh32 : b.refresh32, + reorder12: t < 0.5 ? a.reorder12 : b.reorder12, + reorder16: t < 0.5 ? a.reorder16 : b.reorder16, + reorder20: t < 0.5 ? a.reorder20 : b.reorder20, + reorder32: t < 0.5 ? a.reorder32 : b.reorder32, + reply12: t < 0.5 ? a.reply12 : b.reply12, + reply16: t < 0.5 ? a.reply16 : b.reply16, + reply20: t < 0.5 ? a.reply20 : b.reply20, + reply32: t < 0.5 ? a.reply32 : b.reply32, + retry12: t < 0.5 ? a.retry12 : b.retry12, + retry16: t < 0.5 ? a.retry16 : b.retry16, + retry20: t < 0.5 ? a.retry20 : b.retry20, + retry32: t < 0.5 ? a.retry32 : b.retry32, + save12: t < 0.5 ? a.save12 : b.save12, + save16: t < 0.5 ? a.save16 : b.save16, + save20: t < 0.5 ? a.save20 : b.save20, + save32: t < 0.5 ? a.save32 : b.save32, + search12: t < 0.5 ? a.search12 : b.search12, + search16: t < 0.5 ? a.search16 : b.search16, + search20: t < 0.5 ? a.search20 : b.search20, + search32: t < 0.5 ? a.search32 : b.search32, + send12: t < 0.5 ? a.send12 : b.send12, + send16: t < 0.5 ? a.send16 : b.send16, + send20: t < 0.5 ? a.send20 : b.send20, + send32: t < 0.5 ? a.send32 : b.send32, + share12: t < 0.5 ? a.share12 : b.share12, + share16: t < 0.5 ? a.share16 : b.share16, + share20: t < 0.5 ? a.share20 : b.share20, + share32: t < 0.5 ? a.share32 : b.share32, + sidebar12: t < 0.5 ? a.sidebar12 : b.sidebar12, + sidebar16: t < 0.5 ? a.sidebar16 : b.sidebar16, + sidebar20: t < 0.5 ? a.sidebar20 : b.sidebar20, + sidebar32: t < 0.5 ? a.sidebar32 : b.sidebar32, + stopFill12: t < 0.5 ? a.stopFill12 : b.stopFill12, + stopFill16: t < 0.5 ? a.stopFill16 : b.stopFill16, + stopFill20: t < 0.5 ? a.stopFill20 : b.stopFill20, + stopFill32: t < 0.5 ? a.stopFill32 : b.stopFill32, + thread12: t < 0.5 ? a.thread12 : b.thread12, + thread16: t < 0.5 ? a.thread16 : b.thread16, + thread20: t < 0.5 ? a.thread20 : b.thread20, + thread32: t < 0.5 ? a.thread32 : b.thread32, + threadFill12: t < 0.5 ? a.threadFill12 : b.threadFill12, + threadFill16: t < 0.5 ? a.threadFill16 : b.threadFill16, + threadFill20: t < 0.5 ? a.threadFill20 : b.threadFill20, + threadFill32: t < 0.5 ? a.threadFill32 : b.threadFill32, + translate12: t < 0.5 ? a.translate12 : b.translate12, + translate16: t < 0.5 ? a.translate16 : b.translate16, + translate20: t < 0.5 ? a.translate20 : b.translate20, + translate32: t < 0.5 ? a.translate32 : b.translate32, + trophy12: t < 0.5 ? a.trophy12 : b.trophy12, + trophy16: t < 0.5 ? a.trophy16 : b.trophy16, + trophy20: t < 0.5 ? a.trophy20 : b.trophy20, + trophy32: t < 0.5 ? a.trophy32 : b.trophy32, + unlock12: t < 0.5 ? a.unlock12 : b.unlock12, + unlock16: t < 0.5 ? a.unlock16 : b.unlock16, + unlock20: t < 0.5 ? a.unlock20 : b.unlock20, + unlock32: t < 0.5 ? a.unlock32 : b.unlock32, + unpin12: t < 0.5 ? a.unpin12 : b.unpin12, + unpin16: t < 0.5 ? a.unpin16 : b.unpin16, + unpin20: t < 0.5 ? a.unpin20 : b.unpin20, + unpin32: t < 0.5 ? a.unpin32 : b.unpin32, + unsave12: t < 0.5 ? a.unsave12 : b.unsave12, + unsave16: t < 0.5 ? a.unsave16 : b.unsave16, + unsave20: t < 0.5 ? a.unsave20 : b.unsave20, + unsave32: t < 0.5 ? a.unsave32 : b.unsave32, + upload12: t < 0.5 ? a.upload12 : b.upload12, + upload16: t < 0.5 ? a.upload16 : b.upload16, + upload20: t < 0.5 ? a.upload20 : b.upload20, + upload32: t < 0.5 ? a.upload32 : b.upload32, + user12: t < 0.5 ? a.user12 : b.user12, + user16: t < 0.5 ? a.user16 : b.user16, + user20: t < 0.5 ? a.user20 : b.user20, + user32: t < 0.5 ? a.user32 : b.user32, + userAdd12: t < 0.5 ? a.userAdd12 : b.userAdd12, + userAdd16: t < 0.5 ? a.userAdd16 : b.userAdd16, + userAdd20: t < 0.5 ? a.userAdd20 : b.userAdd20, + userAdd32: t < 0.5 ? a.userAdd32 : b.userAdd32, + userCheck12: t < 0.5 ? a.userCheck12 : b.userCheck12, + userCheck16: t < 0.5 ? a.userCheck16 : b.userCheck16, + userCheck20: t < 0.5 ? a.userCheck20 : b.userCheck20, + userCheck32: t < 0.5 ? a.userCheck32 : b.userCheck32, + userRemove12: t < 0.5 ? a.userRemove12 : b.userRemove12, + userRemove16: t < 0.5 ? a.userRemove16 : b.userRemove16, + userRemove20: t < 0.5 ? a.userRemove20 : b.userRemove20, + userRemove32: t < 0.5 ? a.userRemove32 : b.userRemove32, + users12: t < 0.5 ? a.users12 : b.users12, + users16: t < 0.5 ? a.users16 : b.users16, + users20: t < 0.5 ? a.users20 : b.users20, + users32: t < 0.5 ? a.users32 : b.users32, + video12: t < 0.5 ? a.video12 : b.video12, + video16: t < 0.5 ? a.video16 : b.video16, + video20: t < 0.5 ? a.video20 : b.video20, + video32: t < 0.5 ? a.video32 : b.video32, + videoFill12: t < 0.5 ? a.videoFill12 : b.videoFill12, + videoFill16: t < 0.5 ? a.videoFill16 : b.videoFill16, + videoFill20: t < 0.5 ? a.videoFill20 : b.videoFill20, + videoFill32: t < 0.5 ? a.videoFill32 : b.videoFill32, + voice12: t < 0.5 ? a.voice12 : b.voice12, + voice16: t < 0.5 ? a.voice16 : b.voice16, + voice20: t < 0.5 ? a.voice20 : b.voice20, + voice32: t < 0.5 ? a.voice32 : b.voice32, + voiceFill12: t < 0.5 ? a.voiceFill12 : b.voiceFill12, + voiceFill16: t < 0.5 ? a.voiceFill16 : b.voiceFill16, + voiceFill20: t < 0.5 ? a.voiceFill20 : b.voiceFill20, + voiceFill32: t < 0.5 ? a.voiceFill32 : b.voiceFill32, + xCircle12: t < 0.5 ? a.xCircle12 : b.xCircle12, + xCircle16: t < 0.5 ? a.xCircle16 : b.xCircle16, + xCircle20: t < 0.5 ? a.xCircle20 : b.xCircle20, + xCircle32: t < 0.5 ? a.xCircle32 : b.xCircle32, + xmark12: t < 0.5 ? a.xmark12 : b.xmark12, + xmark16: t < 0.5 ? a.xmark16 : b.xmark16, + xmark20: t < 0.5 ? a.xmark20 : b.xmark20, + xmark32: t < 0.5 ? a.xmark32 : b.xmark32, giphy: t < 0.5 ? a.giphy : b.giphy, imgur: t < 0.5 ? a.imgur : b.imgur, ); } StreamIcons copyWith({ - IconData? apiAggregate, - IconData? apples, - IconData? archive1, - IconData? arrowBoxLeft, - IconData? arrowDown, - IconData? arrowDownCircle, - IconData? arrowLeft, - IconData? arrowRight, - IconData? arrowRotateClockwise, - IconData? arrowRotateRightLeftRepeatRefresh, - IconData? arrowShareLeft, - IconData? arrowShareRight, - IconData? arrowUp, - IconData? arrowUpRight, - IconData? arrowsRepeatLeftRight, - IconData? at, - IconData? atSolid, - IconData? bellNotification, - IconData? bellOff, - IconData? bookmark, - IconData? bookmarkRemove, - IconData? browserAISparkle, - IconData? bubble3ChatMessage, - IconData? bubble3Solid, - IconData? bubbleAnnotation2ChatMessage, - IconData? bubbleText6ChatMessage, - IconData? bubbleText6Solid, - IconData? bubbleWideNotificationChatMessage, - IconData? bubbleWideSparkleChatMessage, - IconData? bubbles, - IconData? calendar1, - IconData? callCancel, - IconData? camera1, - IconData? car1, - IconData? cat, - IconData? chainLink3, - IconData? chart5, - IconData? checkmark1Small, - IconData? checkmark2, - IconData? checkmark2Small, - IconData? chevronDown, - IconData? chevronGrabberVerticalSelector, - IconData? chevronLeft, - IconData? chevronRight, - IconData? chevronTop, - IconData? circleBanSign, - IconData? circleCheck, - IconData? circleInfoTooltip, - IconData? circleMinus, - IconData? circleQuestionmark, - IconData? circleQuestionmarkFilled, - IconData? circleX, - IconData? clock, - IconData? clockSolid, - IconData? closeQuote2, - IconData? cloudSimpleUpload, - IconData? code, - IconData? codeBrackets, - IconData? codeEditorInsert, - IconData? compass, - IconData? components, - IconData? creditCard2Billing, - IconData? crossMedium, - IconData? crossSmall, - IconData? dotGrid1x3Horizontal, - IconData? dotGrid2x3, - IconData? dotsGrid1x3Vertical, - IconData? doupleCheckmark1Small, - IconData? editBig, - IconData? editBigSolid, - IconData? emojiAddReaction, - IconData? emojiSad, - IconData? emojiSmile, - IconData? exclamationCircle, - IconData? exclamationCircle1, - IconData? exclamationTriangle, - IconData? exclamationTriangle1, - IconData? eyeOpen, - IconData? fileArrowLeftIn, - IconData? fileBend, - IconData? filledCircleInfoTooltip, - IconData? filter1, - IconData? flag2, - IconData? folder1, - IconData? gauge, - IconData? google, - IconData? hashtagChannel, - IconData? heart2, - IconData? history, - IconData? images1Alt, - IconData? invite, - IconData? layersBehind, - IconData? layoutAlignLeft, - IconData? layoutGrid1, - IconData? layoutGrid2, - IconData? layoutLeft, - IconData? lightBulbSimple, - IconData? limits, - IconData? lineChart3, - IconData? lock, - IconData? magnifyingGlassSearch, - IconData? mapPin, - IconData? microphone, - IconData? microphoneSolid, - IconData? minusLarge, - IconData? minusSmall, - IconData? mute, - IconData? newspaper2, - IconData? organization, - IconData? paperPlane, - IconData? paperPlaneTopRight, - IconData? paperclip1, - IconData? paragraphsText, - IconData? pause, - IconData? pencil, - IconData? people, - IconData? people2, - IconData? peopleAdd, - IconData? peopleAdded, - IconData? peopleCircle, - IconData? peopleCopy, - IconData? peopleEditUserRights, - IconData? peopleRemove, - IconData? persona, - IconData? pin, - IconData? playSolid, - IconData? plusLarge, - IconData? plusSmall, - IconData? runShortcut, - IconData? searchText, - IconData? settingsGear2, - IconData? settingsSliderVer, - IconData? shapesPlusCloseSquareCircle, - IconData? shapesTriangleSquareCircle, - IconData? shareOs, - IconData? shareRedirectLink, - IconData? shield, - IconData? squareBehindSquare2Copy, - IconData? squareCircleTopRightFeeds, - IconData? stop, - IconData? table, - IconData? team, - IconData? tennis, - IconData? textToImageURLEnrichment, - IconData? thunder, - IconData? translate, - IconData? trashBin, - IconData? trending4, - IconData? trophy, - IconData? unlocked, - IconData? unpin, - IconData? users, - IconData? video, - IconData? videoSolid, - IconData? voiceAndVideo, - IconData? voiceHigh, - IconData? volumeFull, - IconData? webhook, + IconData? account12, + IconData? account16, + IconData? account20, + IconData? account32, + IconData? archive12, + IconData? archive16, + IconData? archive20, + IconData? archive32, + IconData? arrowDown12, + IconData? arrowDown16, + IconData? arrowDown20, + IconData? arrowDown32, + IconData? arrowDownCircle12, + IconData? arrowDownCircle16, + IconData? arrowDownCircle20, + IconData? arrowDownCircle32, + IconData? arrowLeft12, + IconData? arrowLeft16, + IconData? arrowLeft20, + IconData? arrowLeft32, + IconData? arrowRight12, + IconData? arrowRight16, + IconData? arrowRight20, + IconData? arrowRight32, + IconData? arrowUp12, + IconData? arrowUp16, + IconData? arrowUp20, + IconData? arrowUp32, + IconData? arrowUpRight12, + IconData? arrowUpRight16, + IconData? arrowUpRight20, + IconData? arrowUpRight32, + IconData? attachment12, + IconData? attachment16, + IconData? attachment20, + IconData? attachment32, + IconData? audio12, + IconData? audio16, + IconData? audio20, + IconData? audio32, + IconData? bell12, + IconData? bell16, + IconData? bell20, + IconData? bell32, + IconData? bellOff12, + IconData? bellOff16, + IconData? bellOff20, + IconData? bellOff32, + IconData? bolt12, + IconData? bolt16, + IconData? bolt20, + IconData? bolt32, + IconData? camera12, + IconData? camera16, + IconData? camera20, + IconData? camera32, + IconData? checkmark12, + IconData? checkmark16, + IconData? checkmark20, + IconData? checkmark32, + IconData? checks12, + IconData? checks16, + IconData? checks20, + IconData? checks32, + IconData? chevronDown12, + IconData? chevronDown16, + IconData? chevronDown20, + IconData? chevronDown32, + IconData? chevronLeft12, + IconData? chevronLeft16, + IconData? chevronLeft20, + IconData? chevronLeft32, + IconData? chevronRight12, + IconData? chevronRight16, + IconData? chevronRight20, + IconData? chevronRight32, + IconData? chevronUp12, + IconData? chevronUp16, + IconData? chevronUp20, + IconData? chevronUp32, + IconData? clock12, + IconData? clock16, + IconData? clock20, + IconData? clock32, + IconData? command12, + IconData? command16, + IconData? command20, + IconData? command32, + IconData? copy12, + IconData? copy16, + IconData? copy20, + IconData? copy32, + IconData? delete12, + IconData? delete16, + IconData? delete20, + IconData? delete32, + IconData? download12, + IconData? download16, + IconData? download20, + IconData? download32, + IconData? edit12, + IconData? edit16, + IconData? edit20, + IconData? edit32, + IconData? emoji12, + IconData? emoji16, + IconData? emoji20, + IconData? emoji32, + IconData? emojiAdd12, + IconData? emojiAdd16, + IconData? emojiAdd20, + IconData? emojiAdd32, + IconData? exclamationCircle12, + IconData? exclamationCircle16, + IconData? exclamationCircle20, + IconData? exclamationCircle32, + IconData? exclamationCircleFill12, + IconData? exclamationCircleFill16, + IconData? exclamationCircleFill20, + IconData? exclamationCircleFill32, + IconData? exclamationMarkFill12, + IconData? exclamationMarkFill16, + IconData? exclamationMarkFill20, + IconData? exclamationMarkFill32, + IconData? exclamationTriangleFill12, + IconData? exclamationTriangleFill16, + IconData? exclamationTriangleFill20, + IconData? exclamationTriangleFill32, + IconData? export12, + IconData? export16, + IconData? export20, + IconData? export32, + IconData? eyeFill12, + IconData? eyeFill16, + IconData? eyeFill20, + IconData? eyeFill32, + IconData? file12, + IconData? file16, + IconData? file20, + IconData? file32, + IconData? flag12, + IconData? flag16, + IconData? flag20, + IconData? flag32, + IconData? folder12, + IconData? folder16, + IconData? folder20, + IconData? folder32, + IconData? gallery12, + IconData? gallery16, + IconData? gallery20, + IconData? gallery32, + IconData? image12, + IconData? image16, + IconData? image20, + IconData? image32, + IconData? info12, + IconData? info16, + IconData? info20, + IconData? info32, + IconData? leave12, + IconData? leave16, + IconData? leave20, + IconData? leave32, + IconData? link12, + IconData? link16, + IconData? link20, + IconData? link32, + IconData? location12, + IconData? location16, + IconData? location20, + IconData? location32, + IconData? lock12, + IconData? lock16, + IconData? lock20, + IconData? lock32, + IconData? mention12, + IconData? mention16, + IconData? mention20, + IconData? mention32, + IconData? messageBubble12, + IconData? messageBubble16, + IconData? messageBubble20, + IconData? messageBubble32, + IconData? messageBubbleFill12, + IconData? messageBubbleFill16, + IconData? messageBubbleFill20, + IconData? messageBubbleFill32, + IconData? messageBubbles12, + IconData? messageBubbles16, + IconData? messageBubbles20, + IconData? messageBubbles32, + IconData? minus12, + IconData? minus16, + IconData? minus20, + IconData? minus32, + IconData? minusCircle12, + IconData? minusCircle16, + IconData? minusCircle20, + IconData? minusCircle32, + IconData? more12, + IconData? more16, + IconData? more20, + IconData? more32, + IconData? mute12, + IconData? mute16, + IconData? mute20, + IconData? mute32, + IconData? noSign12, + IconData? noSign16, + IconData? noSign20, + IconData? noSign32, + IconData? notification12, + IconData? notification16, + IconData? notification20, + IconData? notification32, + IconData? pauseFill12, + IconData? pauseFill16, + IconData? pauseFill20, + IconData? pauseFill32, + IconData? pin12, + IconData? pin16, + IconData? pin20, + IconData? pin32, + IconData? playFill12, + IconData? playFill16, + IconData? playFill20, + IconData? playFill32, + IconData? plus12, + IconData? plus16, + IconData? plus20, + IconData? plus32, + IconData? poll12, + IconData? poll16, + IconData? poll20, + IconData? poll32, + IconData? quote12, + IconData? quote16, + IconData? quote20, + IconData? quote32, + IconData? refresh12, + IconData? refresh16, + IconData? refresh20, + IconData? refresh32, + IconData? reorder12, + IconData? reorder16, + IconData? reorder20, + IconData? reorder32, + IconData? reply12, + IconData? reply16, + IconData? reply20, + IconData? reply32, + IconData? retry12, + IconData? retry16, + IconData? retry20, + IconData? retry32, + IconData? save12, + IconData? save16, + IconData? save20, + IconData? save32, + IconData? search12, + IconData? search16, + IconData? search20, + IconData? search32, + IconData? send12, + IconData? send16, + IconData? send20, + IconData? send32, + IconData? share12, + IconData? share16, + IconData? share20, + IconData? share32, + IconData? sidebar12, + IconData? sidebar16, + IconData? sidebar20, + IconData? sidebar32, + IconData? stopFill12, + IconData? stopFill16, + IconData? stopFill20, + IconData? stopFill32, + IconData? thread12, + IconData? thread16, + IconData? thread20, + IconData? thread32, + IconData? threadFill12, + IconData? threadFill16, + IconData? threadFill20, + IconData? threadFill32, + IconData? translate12, + IconData? translate16, + IconData? translate20, + IconData? translate32, + IconData? trophy12, + IconData? trophy16, + IconData? trophy20, + IconData? trophy32, + IconData? unlock12, + IconData? unlock16, + IconData? unlock20, + IconData? unlock32, + IconData? unpin12, + IconData? unpin16, + IconData? unpin20, + IconData? unpin32, + IconData? unsave12, + IconData? unsave16, + IconData? unsave20, + IconData? unsave32, + IconData? upload12, + IconData? upload16, + IconData? upload20, + IconData? upload32, + IconData? user12, + IconData? user16, + IconData? user20, + IconData? user32, + IconData? userAdd12, + IconData? userAdd16, + IconData? userAdd20, + IconData? userAdd32, + IconData? userCheck12, + IconData? userCheck16, + IconData? userCheck20, + IconData? userCheck32, + IconData? userRemove12, + IconData? userRemove16, + IconData? userRemove20, + IconData? userRemove32, + IconData? users12, + IconData? users16, + IconData? users20, + IconData? users32, + IconData? video12, + IconData? video16, + IconData? video20, + IconData? video32, + IconData? videoFill12, + IconData? videoFill16, + IconData? videoFill20, + IconData? videoFill32, + IconData? voice12, + IconData? voice16, + IconData? voice20, + IconData? voice32, + IconData? voiceFill12, + IconData? voiceFill16, + IconData? voiceFill20, + IconData? voiceFill32, + IconData? xCircle12, + IconData? xCircle16, + IconData? xCircle20, + IconData? xCircle32, + IconData? xmark12, + IconData? xmark16, + IconData? xmark20, + IconData? xmark32, SvgIconData? giphy, SvgIconData? imgur, }) { final _this = (this as StreamIcons); return StreamIcons( - apiAggregate: apiAggregate ?? _this.apiAggregate, - apples: apples ?? _this.apples, - archive1: archive1 ?? _this.archive1, - arrowBoxLeft: arrowBoxLeft ?? _this.arrowBoxLeft, - arrowDown: arrowDown ?? _this.arrowDown, - arrowDownCircle: arrowDownCircle ?? _this.arrowDownCircle, - arrowLeft: arrowLeft ?? _this.arrowLeft, - arrowRight: arrowRight ?? _this.arrowRight, - arrowRotateClockwise: arrowRotateClockwise ?? _this.arrowRotateClockwise, - arrowRotateRightLeftRepeatRefresh: - arrowRotateRightLeftRepeatRefresh ?? - _this.arrowRotateRightLeftRepeatRefresh, - arrowShareLeft: arrowShareLeft ?? _this.arrowShareLeft, - arrowShareRight: arrowShareRight ?? _this.arrowShareRight, - arrowUp: arrowUp ?? _this.arrowUp, - arrowUpRight: arrowUpRight ?? _this.arrowUpRight, - arrowsRepeatLeftRight: - arrowsRepeatLeftRight ?? _this.arrowsRepeatLeftRight, - at: at ?? _this.at, - atSolid: atSolid ?? _this.atSolid, - bellNotification: bellNotification ?? _this.bellNotification, - bellOff: bellOff ?? _this.bellOff, - bookmark: bookmark ?? _this.bookmark, - bookmarkRemove: bookmarkRemove ?? _this.bookmarkRemove, - browserAISparkle: browserAISparkle ?? _this.browserAISparkle, - bubble3ChatMessage: bubble3ChatMessage ?? _this.bubble3ChatMessage, - bubble3Solid: bubble3Solid ?? _this.bubble3Solid, - bubbleAnnotation2ChatMessage: - bubbleAnnotation2ChatMessage ?? _this.bubbleAnnotation2ChatMessage, - bubbleText6ChatMessage: - bubbleText6ChatMessage ?? _this.bubbleText6ChatMessage, - bubbleText6Solid: bubbleText6Solid ?? _this.bubbleText6Solid, - bubbleWideNotificationChatMessage: - bubbleWideNotificationChatMessage ?? - _this.bubbleWideNotificationChatMessage, - bubbleWideSparkleChatMessage: - bubbleWideSparkleChatMessage ?? _this.bubbleWideSparkleChatMessage, - bubbles: bubbles ?? _this.bubbles, - calendar1: calendar1 ?? _this.calendar1, - callCancel: callCancel ?? _this.callCancel, - camera1: camera1 ?? _this.camera1, - car1: car1 ?? _this.car1, - cat: cat ?? _this.cat, - chainLink3: chainLink3 ?? _this.chainLink3, - chart5: chart5 ?? _this.chart5, - checkmark1Small: checkmark1Small ?? _this.checkmark1Small, - checkmark2: checkmark2 ?? _this.checkmark2, - checkmark2Small: checkmark2Small ?? _this.checkmark2Small, - chevronDown: chevronDown ?? _this.chevronDown, - chevronGrabberVerticalSelector: - chevronGrabberVerticalSelector ?? - _this.chevronGrabberVerticalSelector, - chevronLeft: chevronLeft ?? _this.chevronLeft, - chevronRight: chevronRight ?? _this.chevronRight, - chevronTop: chevronTop ?? _this.chevronTop, - circleBanSign: circleBanSign ?? _this.circleBanSign, - circleCheck: circleCheck ?? _this.circleCheck, - circleInfoTooltip: circleInfoTooltip ?? _this.circleInfoTooltip, - circleMinus: circleMinus ?? _this.circleMinus, - circleQuestionmark: circleQuestionmark ?? _this.circleQuestionmark, - circleQuestionmarkFilled: - circleQuestionmarkFilled ?? _this.circleQuestionmarkFilled, - circleX: circleX ?? _this.circleX, - clock: clock ?? _this.clock, - clockSolid: clockSolid ?? _this.clockSolid, - closeQuote2: closeQuote2 ?? _this.closeQuote2, - cloudSimpleUpload: cloudSimpleUpload ?? _this.cloudSimpleUpload, - code: code ?? _this.code, - codeBrackets: codeBrackets ?? _this.codeBrackets, - codeEditorInsert: codeEditorInsert ?? _this.codeEditorInsert, - compass: compass ?? _this.compass, - components: components ?? _this.components, - creditCard2Billing: creditCard2Billing ?? _this.creditCard2Billing, - crossMedium: crossMedium ?? _this.crossMedium, - crossSmall: crossSmall ?? _this.crossSmall, - dotGrid1x3Horizontal: dotGrid1x3Horizontal ?? _this.dotGrid1x3Horizontal, - dotGrid2x3: dotGrid2x3 ?? _this.dotGrid2x3, - dotsGrid1x3Vertical: dotsGrid1x3Vertical ?? _this.dotsGrid1x3Vertical, - doupleCheckmark1Small: - doupleCheckmark1Small ?? _this.doupleCheckmark1Small, - editBig: editBig ?? _this.editBig, - editBigSolid: editBigSolid ?? _this.editBigSolid, - emojiAddReaction: emojiAddReaction ?? _this.emojiAddReaction, - emojiSad: emojiSad ?? _this.emojiSad, - emojiSmile: emojiSmile ?? _this.emojiSmile, - exclamationCircle: exclamationCircle ?? _this.exclamationCircle, - exclamationCircle1: exclamationCircle1 ?? _this.exclamationCircle1, - exclamationTriangle: exclamationTriangle ?? _this.exclamationTriangle, - exclamationTriangle1: exclamationTriangle1 ?? _this.exclamationTriangle1, - eyeOpen: eyeOpen ?? _this.eyeOpen, - fileArrowLeftIn: fileArrowLeftIn ?? _this.fileArrowLeftIn, - fileBend: fileBend ?? _this.fileBend, - filledCircleInfoTooltip: - filledCircleInfoTooltip ?? _this.filledCircleInfoTooltip, - filter1: filter1 ?? _this.filter1, - flag2: flag2 ?? _this.flag2, - folder1: folder1 ?? _this.folder1, - gauge: gauge ?? _this.gauge, - google: google ?? _this.google, - hashtagChannel: hashtagChannel ?? _this.hashtagChannel, - heart2: heart2 ?? _this.heart2, - history: history ?? _this.history, - images1Alt: images1Alt ?? _this.images1Alt, - invite: invite ?? _this.invite, - layersBehind: layersBehind ?? _this.layersBehind, - layoutAlignLeft: layoutAlignLeft ?? _this.layoutAlignLeft, - layoutGrid1: layoutGrid1 ?? _this.layoutGrid1, - layoutGrid2: layoutGrid2 ?? _this.layoutGrid2, - layoutLeft: layoutLeft ?? _this.layoutLeft, - lightBulbSimple: lightBulbSimple ?? _this.lightBulbSimple, - limits: limits ?? _this.limits, - lineChart3: lineChart3 ?? _this.lineChart3, - lock: lock ?? _this.lock, - magnifyingGlassSearch: - magnifyingGlassSearch ?? _this.magnifyingGlassSearch, - mapPin: mapPin ?? _this.mapPin, - microphone: microphone ?? _this.microphone, - microphoneSolid: microphoneSolid ?? _this.microphoneSolid, - minusLarge: minusLarge ?? _this.minusLarge, - minusSmall: minusSmall ?? _this.minusSmall, - mute: mute ?? _this.mute, - newspaper2: newspaper2 ?? _this.newspaper2, - organization: organization ?? _this.organization, - paperPlane: paperPlane ?? _this.paperPlane, - paperPlaneTopRight: paperPlaneTopRight ?? _this.paperPlaneTopRight, - paperclip1: paperclip1 ?? _this.paperclip1, - paragraphsText: paragraphsText ?? _this.paragraphsText, - pause: pause ?? _this.pause, - pencil: pencil ?? _this.pencil, - people: people ?? _this.people, - people2: people2 ?? _this.people2, - peopleAdd: peopleAdd ?? _this.peopleAdd, - peopleAdded: peopleAdded ?? _this.peopleAdded, - peopleCircle: peopleCircle ?? _this.peopleCircle, - peopleCopy: peopleCopy ?? _this.peopleCopy, - peopleEditUserRights: peopleEditUserRights ?? _this.peopleEditUserRights, - peopleRemove: peopleRemove ?? _this.peopleRemove, - persona: persona ?? _this.persona, - pin: pin ?? _this.pin, - playSolid: playSolid ?? _this.playSolid, - plusLarge: plusLarge ?? _this.plusLarge, - plusSmall: plusSmall ?? _this.plusSmall, - runShortcut: runShortcut ?? _this.runShortcut, - searchText: searchText ?? _this.searchText, - settingsGear2: settingsGear2 ?? _this.settingsGear2, - settingsSliderVer: settingsSliderVer ?? _this.settingsSliderVer, - shapesPlusCloseSquareCircle: - shapesPlusCloseSquareCircle ?? _this.shapesPlusCloseSquareCircle, - shapesTriangleSquareCircle: - shapesTriangleSquareCircle ?? _this.shapesTriangleSquareCircle, - shareOs: shareOs ?? _this.shareOs, - shareRedirectLink: shareRedirectLink ?? _this.shareRedirectLink, - shield: shield ?? _this.shield, - squareBehindSquare2Copy: - squareBehindSquare2Copy ?? _this.squareBehindSquare2Copy, - squareCircleTopRightFeeds: - squareCircleTopRightFeeds ?? _this.squareCircleTopRightFeeds, - stop: stop ?? _this.stop, - table: table ?? _this.table, - team: team ?? _this.team, - tennis: tennis ?? _this.tennis, - textToImageURLEnrichment: - textToImageURLEnrichment ?? _this.textToImageURLEnrichment, - thunder: thunder ?? _this.thunder, - translate: translate ?? _this.translate, - trashBin: trashBin ?? _this.trashBin, - trending4: trending4 ?? _this.trending4, - trophy: trophy ?? _this.trophy, - unlocked: unlocked ?? _this.unlocked, - unpin: unpin ?? _this.unpin, - users: users ?? _this.users, - video: video ?? _this.video, - videoSolid: videoSolid ?? _this.videoSolid, - voiceAndVideo: voiceAndVideo ?? _this.voiceAndVideo, - voiceHigh: voiceHigh ?? _this.voiceHigh, - volumeFull: volumeFull ?? _this.volumeFull, - webhook: webhook ?? _this.webhook, + account12: account12 ?? _this.account12, + account16: account16 ?? _this.account16, + account20: account20 ?? _this.account20, + account32: account32 ?? _this.account32, + archive12: archive12 ?? _this.archive12, + archive16: archive16 ?? _this.archive16, + archive20: archive20 ?? _this.archive20, + archive32: archive32 ?? _this.archive32, + arrowDown12: arrowDown12 ?? _this.arrowDown12, + arrowDown16: arrowDown16 ?? _this.arrowDown16, + arrowDown20: arrowDown20 ?? _this.arrowDown20, + arrowDown32: arrowDown32 ?? _this.arrowDown32, + arrowDownCircle12: arrowDownCircle12 ?? _this.arrowDownCircle12, + arrowDownCircle16: arrowDownCircle16 ?? _this.arrowDownCircle16, + arrowDownCircle20: arrowDownCircle20 ?? _this.arrowDownCircle20, + arrowDownCircle32: arrowDownCircle32 ?? _this.arrowDownCircle32, + arrowLeft12: arrowLeft12 ?? _this.arrowLeft12, + arrowLeft16: arrowLeft16 ?? _this.arrowLeft16, + arrowLeft20: arrowLeft20 ?? _this.arrowLeft20, + arrowLeft32: arrowLeft32 ?? _this.arrowLeft32, + arrowRight12: arrowRight12 ?? _this.arrowRight12, + arrowRight16: arrowRight16 ?? _this.arrowRight16, + arrowRight20: arrowRight20 ?? _this.arrowRight20, + arrowRight32: arrowRight32 ?? _this.arrowRight32, + arrowUp12: arrowUp12 ?? _this.arrowUp12, + arrowUp16: arrowUp16 ?? _this.arrowUp16, + arrowUp20: arrowUp20 ?? _this.arrowUp20, + arrowUp32: arrowUp32 ?? _this.arrowUp32, + arrowUpRight12: arrowUpRight12 ?? _this.arrowUpRight12, + arrowUpRight16: arrowUpRight16 ?? _this.arrowUpRight16, + arrowUpRight20: arrowUpRight20 ?? _this.arrowUpRight20, + arrowUpRight32: arrowUpRight32 ?? _this.arrowUpRight32, + attachment12: attachment12 ?? _this.attachment12, + attachment16: attachment16 ?? _this.attachment16, + attachment20: attachment20 ?? _this.attachment20, + attachment32: attachment32 ?? _this.attachment32, + audio12: audio12 ?? _this.audio12, + audio16: audio16 ?? _this.audio16, + audio20: audio20 ?? _this.audio20, + audio32: audio32 ?? _this.audio32, + bell12: bell12 ?? _this.bell12, + bell16: bell16 ?? _this.bell16, + bell20: bell20 ?? _this.bell20, + bell32: bell32 ?? _this.bell32, + bellOff12: bellOff12 ?? _this.bellOff12, + bellOff16: bellOff16 ?? _this.bellOff16, + bellOff20: bellOff20 ?? _this.bellOff20, + bellOff32: bellOff32 ?? _this.bellOff32, + bolt12: bolt12 ?? _this.bolt12, + bolt16: bolt16 ?? _this.bolt16, + bolt20: bolt20 ?? _this.bolt20, + bolt32: bolt32 ?? _this.bolt32, + camera12: camera12 ?? _this.camera12, + camera16: camera16 ?? _this.camera16, + camera20: camera20 ?? _this.camera20, + camera32: camera32 ?? _this.camera32, + checkmark12: checkmark12 ?? _this.checkmark12, + checkmark16: checkmark16 ?? _this.checkmark16, + checkmark20: checkmark20 ?? _this.checkmark20, + checkmark32: checkmark32 ?? _this.checkmark32, + checks12: checks12 ?? _this.checks12, + checks16: checks16 ?? _this.checks16, + checks20: checks20 ?? _this.checks20, + checks32: checks32 ?? _this.checks32, + chevronDown12: chevronDown12 ?? _this.chevronDown12, + chevronDown16: chevronDown16 ?? _this.chevronDown16, + chevronDown20: chevronDown20 ?? _this.chevronDown20, + chevronDown32: chevronDown32 ?? _this.chevronDown32, + chevronLeft12: chevronLeft12 ?? _this.chevronLeft12, + chevronLeft16: chevronLeft16 ?? _this.chevronLeft16, + chevronLeft20: chevronLeft20 ?? _this.chevronLeft20, + chevronLeft32: chevronLeft32 ?? _this.chevronLeft32, + chevronRight12: chevronRight12 ?? _this.chevronRight12, + chevronRight16: chevronRight16 ?? _this.chevronRight16, + chevronRight20: chevronRight20 ?? _this.chevronRight20, + chevronRight32: chevronRight32 ?? _this.chevronRight32, + chevronUp12: chevronUp12 ?? _this.chevronUp12, + chevronUp16: chevronUp16 ?? _this.chevronUp16, + chevronUp20: chevronUp20 ?? _this.chevronUp20, + chevronUp32: chevronUp32 ?? _this.chevronUp32, + clock12: clock12 ?? _this.clock12, + clock16: clock16 ?? _this.clock16, + clock20: clock20 ?? _this.clock20, + clock32: clock32 ?? _this.clock32, + command12: command12 ?? _this.command12, + command16: command16 ?? _this.command16, + command20: command20 ?? _this.command20, + command32: command32 ?? _this.command32, + copy12: copy12 ?? _this.copy12, + copy16: copy16 ?? _this.copy16, + copy20: copy20 ?? _this.copy20, + copy32: copy32 ?? _this.copy32, + delete12: delete12 ?? _this.delete12, + delete16: delete16 ?? _this.delete16, + delete20: delete20 ?? _this.delete20, + delete32: delete32 ?? _this.delete32, + download12: download12 ?? _this.download12, + download16: download16 ?? _this.download16, + download20: download20 ?? _this.download20, + download32: download32 ?? _this.download32, + edit12: edit12 ?? _this.edit12, + edit16: edit16 ?? _this.edit16, + edit20: edit20 ?? _this.edit20, + edit32: edit32 ?? _this.edit32, + emoji12: emoji12 ?? _this.emoji12, + emoji16: emoji16 ?? _this.emoji16, + emoji20: emoji20 ?? _this.emoji20, + emoji32: emoji32 ?? _this.emoji32, + emojiAdd12: emojiAdd12 ?? _this.emojiAdd12, + emojiAdd16: emojiAdd16 ?? _this.emojiAdd16, + emojiAdd20: emojiAdd20 ?? _this.emojiAdd20, + emojiAdd32: emojiAdd32 ?? _this.emojiAdd32, + exclamationCircle12: exclamationCircle12 ?? _this.exclamationCircle12, + exclamationCircle16: exclamationCircle16 ?? _this.exclamationCircle16, + exclamationCircle20: exclamationCircle20 ?? _this.exclamationCircle20, + exclamationCircle32: exclamationCircle32 ?? _this.exclamationCircle32, + exclamationCircleFill12: + exclamationCircleFill12 ?? _this.exclamationCircleFill12, + exclamationCircleFill16: + exclamationCircleFill16 ?? _this.exclamationCircleFill16, + exclamationCircleFill20: + exclamationCircleFill20 ?? _this.exclamationCircleFill20, + exclamationCircleFill32: + exclamationCircleFill32 ?? _this.exclamationCircleFill32, + exclamationMarkFill12: + exclamationMarkFill12 ?? _this.exclamationMarkFill12, + exclamationMarkFill16: + exclamationMarkFill16 ?? _this.exclamationMarkFill16, + exclamationMarkFill20: + exclamationMarkFill20 ?? _this.exclamationMarkFill20, + exclamationMarkFill32: + exclamationMarkFill32 ?? _this.exclamationMarkFill32, + exclamationTriangleFill12: + exclamationTriangleFill12 ?? _this.exclamationTriangleFill12, + exclamationTriangleFill16: + exclamationTriangleFill16 ?? _this.exclamationTriangleFill16, + exclamationTriangleFill20: + exclamationTriangleFill20 ?? _this.exclamationTriangleFill20, + exclamationTriangleFill32: + exclamationTriangleFill32 ?? _this.exclamationTriangleFill32, + export12: export12 ?? _this.export12, + export16: export16 ?? _this.export16, + export20: export20 ?? _this.export20, + export32: export32 ?? _this.export32, + eyeFill12: eyeFill12 ?? _this.eyeFill12, + eyeFill16: eyeFill16 ?? _this.eyeFill16, + eyeFill20: eyeFill20 ?? _this.eyeFill20, + eyeFill32: eyeFill32 ?? _this.eyeFill32, + file12: file12 ?? _this.file12, + file16: file16 ?? _this.file16, + file20: file20 ?? _this.file20, + file32: file32 ?? _this.file32, + flag12: flag12 ?? _this.flag12, + flag16: flag16 ?? _this.flag16, + flag20: flag20 ?? _this.flag20, + flag32: flag32 ?? _this.flag32, + folder12: folder12 ?? _this.folder12, + folder16: folder16 ?? _this.folder16, + folder20: folder20 ?? _this.folder20, + folder32: folder32 ?? _this.folder32, + gallery12: gallery12 ?? _this.gallery12, + gallery16: gallery16 ?? _this.gallery16, + gallery20: gallery20 ?? _this.gallery20, + gallery32: gallery32 ?? _this.gallery32, + image12: image12 ?? _this.image12, + image16: image16 ?? _this.image16, + image20: image20 ?? _this.image20, + image32: image32 ?? _this.image32, + info12: info12 ?? _this.info12, + info16: info16 ?? _this.info16, + info20: info20 ?? _this.info20, + info32: info32 ?? _this.info32, + leave12: leave12 ?? _this.leave12, + leave16: leave16 ?? _this.leave16, + leave20: leave20 ?? _this.leave20, + leave32: leave32 ?? _this.leave32, + link12: link12 ?? _this.link12, + link16: link16 ?? _this.link16, + link20: link20 ?? _this.link20, + link32: link32 ?? _this.link32, + location12: location12 ?? _this.location12, + location16: location16 ?? _this.location16, + location20: location20 ?? _this.location20, + location32: location32 ?? _this.location32, + lock12: lock12 ?? _this.lock12, + lock16: lock16 ?? _this.lock16, + lock20: lock20 ?? _this.lock20, + lock32: lock32 ?? _this.lock32, + mention12: mention12 ?? _this.mention12, + mention16: mention16 ?? _this.mention16, + mention20: mention20 ?? _this.mention20, + mention32: mention32 ?? _this.mention32, + messageBubble12: messageBubble12 ?? _this.messageBubble12, + messageBubble16: messageBubble16 ?? _this.messageBubble16, + messageBubble20: messageBubble20 ?? _this.messageBubble20, + messageBubble32: messageBubble32 ?? _this.messageBubble32, + messageBubbleFill12: messageBubbleFill12 ?? _this.messageBubbleFill12, + messageBubbleFill16: messageBubbleFill16 ?? _this.messageBubbleFill16, + messageBubbleFill20: messageBubbleFill20 ?? _this.messageBubbleFill20, + messageBubbleFill32: messageBubbleFill32 ?? _this.messageBubbleFill32, + messageBubbles12: messageBubbles12 ?? _this.messageBubbles12, + messageBubbles16: messageBubbles16 ?? _this.messageBubbles16, + messageBubbles20: messageBubbles20 ?? _this.messageBubbles20, + messageBubbles32: messageBubbles32 ?? _this.messageBubbles32, + minus12: minus12 ?? _this.minus12, + minus16: minus16 ?? _this.minus16, + minus20: minus20 ?? _this.minus20, + minus32: minus32 ?? _this.minus32, + minusCircle12: minusCircle12 ?? _this.minusCircle12, + minusCircle16: minusCircle16 ?? _this.minusCircle16, + minusCircle20: minusCircle20 ?? _this.minusCircle20, + minusCircle32: minusCircle32 ?? _this.minusCircle32, + more12: more12 ?? _this.more12, + more16: more16 ?? _this.more16, + more20: more20 ?? _this.more20, + more32: more32 ?? _this.more32, + mute12: mute12 ?? _this.mute12, + mute16: mute16 ?? _this.mute16, + mute20: mute20 ?? _this.mute20, + mute32: mute32 ?? _this.mute32, + noSign12: noSign12 ?? _this.noSign12, + noSign16: noSign16 ?? _this.noSign16, + noSign20: noSign20 ?? _this.noSign20, + noSign32: noSign32 ?? _this.noSign32, + notification12: notification12 ?? _this.notification12, + notification16: notification16 ?? _this.notification16, + notification20: notification20 ?? _this.notification20, + notification32: notification32 ?? _this.notification32, + pauseFill12: pauseFill12 ?? _this.pauseFill12, + pauseFill16: pauseFill16 ?? _this.pauseFill16, + pauseFill20: pauseFill20 ?? _this.pauseFill20, + pauseFill32: pauseFill32 ?? _this.pauseFill32, + pin12: pin12 ?? _this.pin12, + pin16: pin16 ?? _this.pin16, + pin20: pin20 ?? _this.pin20, + pin32: pin32 ?? _this.pin32, + playFill12: playFill12 ?? _this.playFill12, + playFill16: playFill16 ?? _this.playFill16, + playFill20: playFill20 ?? _this.playFill20, + playFill32: playFill32 ?? _this.playFill32, + plus12: plus12 ?? _this.plus12, + plus16: plus16 ?? _this.plus16, + plus20: plus20 ?? _this.plus20, + plus32: plus32 ?? _this.plus32, + poll12: poll12 ?? _this.poll12, + poll16: poll16 ?? _this.poll16, + poll20: poll20 ?? _this.poll20, + poll32: poll32 ?? _this.poll32, + quote12: quote12 ?? _this.quote12, + quote16: quote16 ?? _this.quote16, + quote20: quote20 ?? _this.quote20, + quote32: quote32 ?? _this.quote32, + refresh12: refresh12 ?? _this.refresh12, + refresh16: refresh16 ?? _this.refresh16, + refresh20: refresh20 ?? _this.refresh20, + refresh32: refresh32 ?? _this.refresh32, + reorder12: reorder12 ?? _this.reorder12, + reorder16: reorder16 ?? _this.reorder16, + reorder20: reorder20 ?? _this.reorder20, + reorder32: reorder32 ?? _this.reorder32, + reply12: reply12 ?? _this.reply12, + reply16: reply16 ?? _this.reply16, + reply20: reply20 ?? _this.reply20, + reply32: reply32 ?? _this.reply32, + retry12: retry12 ?? _this.retry12, + retry16: retry16 ?? _this.retry16, + retry20: retry20 ?? _this.retry20, + retry32: retry32 ?? _this.retry32, + save12: save12 ?? _this.save12, + save16: save16 ?? _this.save16, + save20: save20 ?? _this.save20, + save32: save32 ?? _this.save32, + search12: search12 ?? _this.search12, + search16: search16 ?? _this.search16, + search20: search20 ?? _this.search20, + search32: search32 ?? _this.search32, + send12: send12 ?? _this.send12, + send16: send16 ?? _this.send16, + send20: send20 ?? _this.send20, + send32: send32 ?? _this.send32, + share12: share12 ?? _this.share12, + share16: share16 ?? _this.share16, + share20: share20 ?? _this.share20, + share32: share32 ?? _this.share32, + sidebar12: sidebar12 ?? _this.sidebar12, + sidebar16: sidebar16 ?? _this.sidebar16, + sidebar20: sidebar20 ?? _this.sidebar20, + sidebar32: sidebar32 ?? _this.sidebar32, + stopFill12: stopFill12 ?? _this.stopFill12, + stopFill16: stopFill16 ?? _this.stopFill16, + stopFill20: stopFill20 ?? _this.stopFill20, + stopFill32: stopFill32 ?? _this.stopFill32, + thread12: thread12 ?? _this.thread12, + thread16: thread16 ?? _this.thread16, + thread20: thread20 ?? _this.thread20, + thread32: thread32 ?? _this.thread32, + threadFill12: threadFill12 ?? _this.threadFill12, + threadFill16: threadFill16 ?? _this.threadFill16, + threadFill20: threadFill20 ?? _this.threadFill20, + threadFill32: threadFill32 ?? _this.threadFill32, + translate12: translate12 ?? _this.translate12, + translate16: translate16 ?? _this.translate16, + translate20: translate20 ?? _this.translate20, + translate32: translate32 ?? _this.translate32, + trophy12: trophy12 ?? _this.trophy12, + trophy16: trophy16 ?? _this.trophy16, + trophy20: trophy20 ?? _this.trophy20, + trophy32: trophy32 ?? _this.trophy32, + unlock12: unlock12 ?? _this.unlock12, + unlock16: unlock16 ?? _this.unlock16, + unlock20: unlock20 ?? _this.unlock20, + unlock32: unlock32 ?? _this.unlock32, + unpin12: unpin12 ?? _this.unpin12, + unpin16: unpin16 ?? _this.unpin16, + unpin20: unpin20 ?? _this.unpin20, + unpin32: unpin32 ?? _this.unpin32, + unsave12: unsave12 ?? _this.unsave12, + unsave16: unsave16 ?? _this.unsave16, + unsave20: unsave20 ?? _this.unsave20, + unsave32: unsave32 ?? _this.unsave32, + upload12: upload12 ?? _this.upload12, + upload16: upload16 ?? _this.upload16, + upload20: upload20 ?? _this.upload20, + upload32: upload32 ?? _this.upload32, + user12: user12 ?? _this.user12, + user16: user16 ?? _this.user16, + user20: user20 ?? _this.user20, + user32: user32 ?? _this.user32, + userAdd12: userAdd12 ?? _this.userAdd12, + userAdd16: userAdd16 ?? _this.userAdd16, + userAdd20: userAdd20 ?? _this.userAdd20, + userAdd32: userAdd32 ?? _this.userAdd32, + userCheck12: userCheck12 ?? _this.userCheck12, + userCheck16: userCheck16 ?? _this.userCheck16, + userCheck20: userCheck20 ?? _this.userCheck20, + userCheck32: userCheck32 ?? _this.userCheck32, + userRemove12: userRemove12 ?? _this.userRemove12, + userRemove16: userRemove16 ?? _this.userRemove16, + userRemove20: userRemove20 ?? _this.userRemove20, + userRemove32: userRemove32 ?? _this.userRemove32, + users12: users12 ?? _this.users12, + users16: users16 ?? _this.users16, + users20: users20 ?? _this.users20, + users32: users32 ?? _this.users32, + video12: video12 ?? _this.video12, + video16: video16 ?? _this.video16, + video20: video20 ?? _this.video20, + video32: video32 ?? _this.video32, + videoFill12: videoFill12 ?? _this.videoFill12, + videoFill16: videoFill16 ?? _this.videoFill16, + videoFill20: videoFill20 ?? _this.videoFill20, + videoFill32: videoFill32 ?? _this.videoFill32, + voice12: voice12 ?? _this.voice12, + voice16: voice16 ?? _this.voice16, + voice20: voice20 ?? _this.voice20, + voice32: voice32 ?? _this.voice32, + voiceFill12: voiceFill12 ?? _this.voiceFill12, + voiceFill16: voiceFill16 ?? _this.voiceFill16, + voiceFill20: voiceFill20 ?? _this.voiceFill20, + voiceFill32: voiceFill32 ?? _this.voiceFill32, + xCircle12: xCircle12 ?? _this.xCircle12, + xCircle16: xCircle16 ?? _this.xCircle16, + xCircle20: xCircle20 ?? _this.xCircle20, + xCircle32: xCircle32 ?? _this.xCircle32, + xmark12: xmark12 ?? _this.xmark12, + xmark16: xmark16 ?? _this.xmark16, + xmark20: xmark20 ?? _this.xmark20, + xmark32: xmark32 ?? _this.xmark32, giphy: giphy ?? _this.giphy, imgur: imgur ?? _this.imgur, ); @@ -592,166 +1175,362 @@ mixin _$StreamIcons { } return copyWith( - apiAggregate: other.apiAggregate, - apples: other.apples, - archive1: other.archive1, - arrowBoxLeft: other.arrowBoxLeft, - arrowDown: other.arrowDown, - arrowDownCircle: other.arrowDownCircle, - arrowLeft: other.arrowLeft, - arrowRight: other.arrowRight, - arrowRotateClockwise: other.arrowRotateClockwise, - arrowRotateRightLeftRepeatRefresh: - other.arrowRotateRightLeftRepeatRefresh, - arrowShareLeft: other.arrowShareLeft, - arrowShareRight: other.arrowShareRight, - arrowUp: other.arrowUp, - arrowUpRight: other.arrowUpRight, - arrowsRepeatLeftRight: other.arrowsRepeatLeftRight, - at: other.at, - atSolid: other.atSolid, - bellNotification: other.bellNotification, - bellOff: other.bellOff, - bookmark: other.bookmark, - bookmarkRemove: other.bookmarkRemove, - browserAISparkle: other.browserAISparkle, - bubble3ChatMessage: other.bubble3ChatMessage, - bubble3Solid: other.bubble3Solid, - bubbleAnnotation2ChatMessage: other.bubbleAnnotation2ChatMessage, - bubbleText6ChatMessage: other.bubbleText6ChatMessage, - bubbleText6Solid: other.bubbleText6Solid, - bubbleWideNotificationChatMessage: - other.bubbleWideNotificationChatMessage, - bubbleWideSparkleChatMessage: other.bubbleWideSparkleChatMessage, - bubbles: other.bubbles, - calendar1: other.calendar1, - callCancel: other.callCancel, - camera1: other.camera1, - car1: other.car1, - cat: other.cat, - chainLink3: other.chainLink3, - chart5: other.chart5, - checkmark1Small: other.checkmark1Small, - checkmark2: other.checkmark2, - checkmark2Small: other.checkmark2Small, - chevronDown: other.chevronDown, - chevronGrabberVerticalSelector: other.chevronGrabberVerticalSelector, - chevronLeft: other.chevronLeft, - chevronRight: other.chevronRight, - chevronTop: other.chevronTop, - circleBanSign: other.circleBanSign, - circleCheck: other.circleCheck, - circleInfoTooltip: other.circleInfoTooltip, - circleMinus: other.circleMinus, - circleQuestionmark: other.circleQuestionmark, - circleQuestionmarkFilled: other.circleQuestionmarkFilled, - circleX: other.circleX, - clock: other.clock, - clockSolid: other.clockSolid, - closeQuote2: other.closeQuote2, - cloudSimpleUpload: other.cloudSimpleUpload, - code: other.code, - codeBrackets: other.codeBrackets, - codeEditorInsert: other.codeEditorInsert, - compass: other.compass, - components: other.components, - creditCard2Billing: other.creditCard2Billing, - crossMedium: other.crossMedium, - crossSmall: other.crossSmall, - dotGrid1x3Horizontal: other.dotGrid1x3Horizontal, - dotGrid2x3: other.dotGrid2x3, - dotsGrid1x3Vertical: other.dotsGrid1x3Vertical, - doupleCheckmark1Small: other.doupleCheckmark1Small, - editBig: other.editBig, - editBigSolid: other.editBigSolid, - emojiAddReaction: other.emojiAddReaction, - emojiSad: other.emojiSad, - emojiSmile: other.emojiSmile, - exclamationCircle: other.exclamationCircle, - exclamationCircle1: other.exclamationCircle1, - exclamationTriangle: other.exclamationTriangle, - exclamationTriangle1: other.exclamationTriangle1, - eyeOpen: other.eyeOpen, - fileArrowLeftIn: other.fileArrowLeftIn, - fileBend: other.fileBend, - filledCircleInfoTooltip: other.filledCircleInfoTooltip, - filter1: other.filter1, - flag2: other.flag2, - folder1: other.folder1, - gauge: other.gauge, - google: other.google, - hashtagChannel: other.hashtagChannel, - heart2: other.heart2, - history: other.history, - images1Alt: other.images1Alt, - invite: other.invite, - layersBehind: other.layersBehind, - layoutAlignLeft: other.layoutAlignLeft, - layoutGrid1: other.layoutGrid1, - layoutGrid2: other.layoutGrid2, - layoutLeft: other.layoutLeft, - lightBulbSimple: other.lightBulbSimple, - limits: other.limits, - lineChart3: other.lineChart3, - lock: other.lock, - magnifyingGlassSearch: other.magnifyingGlassSearch, - mapPin: other.mapPin, - microphone: other.microphone, - microphoneSolid: other.microphoneSolid, - minusLarge: other.minusLarge, - minusSmall: other.minusSmall, - mute: other.mute, - newspaper2: other.newspaper2, - organization: other.organization, - paperPlane: other.paperPlane, - paperPlaneTopRight: other.paperPlaneTopRight, - paperclip1: other.paperclip1, - paragraphsText: other.paragraphsText, - pause: other.pause, - pencil: other.pencil, - people: other.people, - people2: other.people2, - peopleAdd: other.peopleAdd, - peopleAdded: other.peopleAdded, - peopleCircle: other.peopleCircle, - peopleCopy: other.peopleCopy, - peopleEditUserRights: other.peopleEditUserRights, - peopleRemove: other.peopleRemove, - persona: other.persona, - pin: other.pin, - playSolid: other.playSolid, - plusLarge: other.plusLarge, - plusSmall: other.plusSmall, - runShortcut: other.runShortcut, - searchText: other.searchText, - settingsGear2: other.settingsGear2, - settingsSliderVer: other.settingsSliderVer, - shapesPlusCloseSquareCircle: other.shapesPlusCloseSquareCircle, - shapesTriangleSquareCircle: other.shapesTriangleSquareCircle, - shareOs: other.shareOs, - shareRedirectLink: other.shareRedirectLink, - shield: other.shield, - squareBehindSquare2Copy: other.squareBehindSquare2Copy, - squareCircleTopRightFeeds: other.squareCircleTopRightFeeds, - stop: other.stop, - table: other.table, - team: other.team, - tennis: other.tennis, - textToImageURLEnrichment: other.textToImageURLEnrichment, - thunder: other.thunder, - translate: other.translate, - trashBin: other.trashBin, - trending4: other.trending4, - trophy: other.trophy, - unlocked: other.unlocked, - unpin: other.unpin, - users: other.users, - video: other.video, - videoSolid: other.videoSolid, - voiceAndVideo: other.voiceAndVideo, - voiceHigh: other.voiceHigh, - volumeFull: other.volumeFull, - webhook: other.webhook, + account12: other.account12, + account16: other.account16, + account20: other.account20, + account32: other.account32, + archive12: other.archive12, + archive16: other.archive16, + archive20: other.archive20, + archive32: other.archive32, + arrowDown12: other.arrowDown12, + arrowDown16: other.arrowDown16, + arrowDown20: other.arrowDown20, + arrowDown32: other.arrowDown32, + arrowDownCircle12: other.arrowDownCircle12, + arrowDownCircle16: other.arrowDownCircle16, + arrowDownCircle20: other.arrowDownCircle20, + arrowDownCircle32: other.arrowDownCircle32, + arrowLeft12: other.arrowLeft12, + arrowLeft16: other.arrowLeft16, + arrowLeft20: other.arrowLeft20, + arrowLeft32: other.arrowLeft32, + arrowRight12: other.arrowRight12, + arrowRight16: other.arrowRight16, + arrowRight20: other.arrowRight20, + arrowRight32: other.arrowRight32, + arrowUp12: other.arrowUp12, + arrowUp16: other.arrowUp16, + arrowUp20: other.arrowUp20, + arrowUp32: other.arrowUp32, + arrowUpRight12: other.arrowUpRight12, + arrowUpRight16: other.arrowUpRight16, + arrowUpRight20: other.arrowUpRight20, + arrowUpRight32: other.arrowUpRight32, + attachment12: other.attachment12, + attachment16: other.attachment16, + attachment20: other.attachment20, + attachment32: other.attachment32, + audio12: other.audio12, + audio16: other.audio16, + audio20: other.audio20, + audio32: other.audio32, + bell12: other.bell12, + bell16: other.bell16, + bell20: other.bell20, + bell32: other.bell32, + bellOff12: other.bellOff12, + bellOff16: other.bellOff16, + bellOff20: other.bellOff20, + bellOff32: other.bellOff32, + bolt12: other.bolt12, + bolt16: other.bolt16, + bolt20: other.bolt20, + bolt32: other.bolt32, + camera12: other.camera12, + camera16: other.camera16, + camera20: other.camera20, + camera32: other.camera32, + checkmark12: other.checkmark12, + checkmark16: other.checkmark16, + checkmark20: other.checkmark20, + checkmark32: other.checkmark32, + checks12: other.checks12, + checks16: other.checks16, + checks20: other.checks20, + checks32: other.checks32, + chevronDown12: other.chevronDown12, + chevronDown16: other.chevronDown16, + chevronDown20: other.chevronDown20, + chevronDown32: other.chevronDown32, + chevronLeft12: other.chevronLeft12, + chevronLeft16: other.chevronLeft16, + chevronLeft20: other.chevronLeft20, + chevronLeft32: other.chevronLeft32, + chevronRight12: other.chevronRight12, + chevronRight16: other.chevronRight16, + chevronRight20: other.chevronRight20, + chevronRight32: other.chevronRight32, + chevronUp12: other.chevronUp12, + chevronUp16: other.chevronUp16, + chevronUp20: other.chevronUp20, + chevronUp32: other.chevronUp32, + clock12: other.clock12, + clock16: other.clock16, + clock20: other.clock20, + clock32: other.clock32, + command12: other.command12, + command16: other.command16, + command20: other.command20, + command32: other.command32, + copy12: other.copy12, + copy16: other.copy16, + copy20: other.copy20, + copy32: other.copy32, + delete12: other.delete12, + delete16: other.delete16, + delete20: other.delete20, + delete32: other.delete32, + download12: other.download12, + download16: other.download16, + download20: other.download20, + download32: other.download32, + edit12: other.edit12, + edit16: other.edit16, + edit20: other.edit20, + edit32: other.edit32, + emoji12: other.emoji12, + emoji16: other.emoji16, + emoji20: other.emoji20, + emoji32: other.emoji32, + emojiAdd12: other.emojiAdd12, + emojiAdd16: other.emojiAdd16, + emojiAdd20: other.emojiAdd20, + emojiAdd32: other.emojiAdd32, + exclamationCircle12: other.exclamationCircle12, + exclamationCircle16: other.exclamationCircle16, + exclamationCircle20: other.exclamationCircle20, + exclamationCircle32: other.exclamationCircle32, + exclamationCircleFill12: other.exclamationCircleFill12, + exclamationCircleFill16: other.exclamationCircleFill16, + exclamationCircleFill20: other.exclamationCircleFill20, + exclamationCircleFill32: other.exclamationCircleFill32, + exclamationMarkFill12: other.exclamationMarkFill12, + exclamationMarkFill16: other.exclamationMarkFill16, + exclamationMarkFill20: other.exclamationMarkFill20, + exclamationMarkFill32: other.exclamationMarkFill32, + exclamationTriangleFill12: other.exclamationTriangleFill12, + exclamationTriangleFill16: other.exclamationTriangleFill16, + exclamationTriangleFill20: other.exclamationTriangleFill20, + exclamationTriangleFill32: other.exclamationTriangleFill32, + export12: other.export12, + export16: other.export16, + export20: other.export20, + export32: other.export32, + eyeFill12: other.eyeFill12, + eyeFill16: other.eyeFill16, + eyeFill20: other.eyeFill20, + eyeFill32: other.eyeFill32, + file12: other.file12, + file16: other.file16, + file20: other.file20, + file32: other.file32, + flag12: other.flag12, + flag16: other.flag16, + flag20: other.flag20, + flag32: other.flag32, + folder12: other.folder12, + folder16: other.folder16, + folder20: other.folder20, + folder32: other.folder32, + gallery12: other.gallery12, + gallery16: other.gallery16, + gallery20: other.gallery20, + gallery32: other.gallery32, + image12: other.image12, + image16: other.image16, + image20: other.image20, + image32: other.image32, + info12: other.info12, + info16: other.info16, + info20: other.info20, + info32: other.info32, + leave12: other.leave12, + leave16: other.leave16, + leave20: other.leave20, + leave32: other.leave32, + link12: other.link12, + link16: other.link16, + link20: other.link20, + link32: other.link32, + location12: other.location12, + location16: other.location16, + location20: other.location20, + location32: other.location32, + lock12: other.lock12, + lock16: other.lock16, + lock20: other.lock20, + lock32: other.lock32, + mention12: other.mention12, + mention16: other.mention16, + mention20: other.mention20, + mention32: other.mention32, + messageBubble12: other.messageBubble12, + messageBubble16: other.messageBubble16, + messageBubble20: other.messageBubble20, + messageBubble32: other.messageBubble32, + messageBubbleFill12: other.messageBubbleFill12, + messageBubbleFill16: other.messageBubbleFill16, + messageBubbleFill20: other.messageBubbleFill20, + messageBubbleFill32: other.messageBubbleFill32, + messageBubbles12: other.messageBubbles12, + messageBubbles16: other.messageBubbles16, + messageBubbles20: other.messageBubbles20, + messageBubbles32: other.messageBubbles32, + minus12: other.minus12, + minus16: other.minus16, + minus20: other.minus20, + minus32: other.minus32, + minusCircle12: other.minusCircle12, + minusCircle16: other.minusCircle16, + minusCircle20: other.minusCircle20, + minusCircle32: other.minusCircle32, + more12: other.more12, + more16: other.more16, + more20: other.more20, + more32: other.more32, + mute12: other.mute12, + mute16: other.mute16, + mute20: other.mute20, + mute32: other.mute32, + noSign12: other.noSign12, + noSign16: other.noSign16, + noSign20: other.noSign20, + noSign32: other.noSign32, + notification12: other.notification12, + notification16: other.notification16, + notification20: other.notification20, + notification32: other.notification32, + pauseFill12: other.pauseFill12, + pauseFill16: other.pauseFill16, + pauseFill20: other.pauseFill20, + pauseFill32: other.pauseFill32, + pin12: other.pin12, + pin16: other.pin16, + pin20: other.pin20, + pin32: other.pin32, + playFill12: other.playFill12, + playFill16: other.playFill16, + playFill20: other.playFill20, + playFill32: other.playFill32, + plus12: other.plus12, + plus16: other.plus16, + plus20: other.plus20, + plus32: other.plus32, + poll12: other.poll12, + poll16: other.poll16, + poll20: other.poll20, + poll32: other.poll32, + quote12: other.quote12, + quote16: other.quote16, + quote20: other.quote20, + quote32: other.quote32, + refresh12: other.refresh12, + refresh16: other.refresh16, + refresh20: other.refresh20, + refresh32: other.refresh32, + reorder12: other.reorder12, + reorder16: other.reorder16, + reorder20: other.reorder20, + reorder32: other.reorder32, + reply12: other.reply12, + reply16: other.reply16, + reply20: other.reply20, + reply32: other.reply32, + retry12: other.retry12, + retry16: other.retry16, + retry20: other.retry20, + retry32: other.retry32, + save12: other.save12, + save16: other.save16, + save20: other.save20, + save32: other.save32, + search12: other.search12, + search16: other.search16, + search20: other.search20, + search32: other.search32, + send12: other.send12, + send16: other.send16, + send20: other.send20, + send32: other.send32, + share12: other.share12, + share16: other.share16, + share20: other.share20, + share32: other.share32, + sidebar12: other.sidebar12, + sidebar16: other.sidebar16, + sidebar20: other.sidebar20, + sidebar32: other.sidebar32, + stopFill12: other.stopFill12, + stopFill16: other.stopFill16, + stopFill20: other.stopFill20, + stopFill32: other.stopFill32, + thread12: other.thread12, + thread16: other.thread16, + thread20: other.thread20, + thread32: other.thread32, + threadFill12: other.threadFill12, + threadFill16: other.threadFill16, + threadFill20: other.threadFill20, + threadFill32: other.threadFill32, + translate12: other.translate12, + translate16: other.translate16, + translate20: other.translate20, + translate32: other.translate32, + trophy12: other.trophy12, + trophy16: other.trophy16, + trophy20: other.trophy20, + trophy32: other.trophy32, + unlock12: other.unlock12, + unlock16: other.unlock16, + unlock20: other.unlock20, + unlock32: other.unlock32, + unpin12: other.unpin12, + unpin16: other.unpin16, + unpin20: other.unpin20, + unpin32: other.unpin32, + unsave12: other.unsave12, + unsave16: other.unsave16, + unsave20: other.unsave20, + unsave32: other.unsave32, + upload12: other.upload12, + upload16: other.upload16, + upload20: other.upload20, + upload32: other.upload32, + user12: other.user12, + user16: other.user16, + user20: other.user20, + user32: other.user32, + userAdd12: other.userAdd12, + userAdd16: other.userAdd16, + userAdd20: other.userAdd20, + userAdd32: other.userAdd32, + userCheck12: other.userCheck12, + userCheck16: other.userCheck16, + userCheck20: other.userCheck20, + userCheck32: other.userCheck32, + userRemove12: other.userRemove12, + userRemove16: other.userRemove16, + userRemove20: other.userRemove20, + userRemove32: other.userRemove32, + users12: other.users12, + users16: other.users16, + users20: other.users20, + users32: other.users32, + video12: other.video12, + video16: other.video16, + video20: other.video20, + video32: other.video32, + videoFill12: other.videoFill12, + videoFill16: other.videoFill16, + videoFill20: other.videoFill20, + videoFill32: other.videoFill32, + voice12: other.voice12, + voice16: other.voice16, + voice20: other.voice20, + voice32: other.voice32, + voiceFill12: other.voiceFill12, + voiceFill16: other.voiceFill16, + voiceFill20: other.voiceFill20, + voiceFill32: other.voiceFill32, + xCircle12: other.xCircle12, + xCircle16: other.xCircle16, + xCircle20: other.xCircle20, + xCircle32: other.xCircle32, + xmark12: other.xmark12, + xmark16: other.xmark16, + xmark20: other.xmark20, + xmark32: other.xmark32, giphy: other.giphy, imgur: other.imgur, ); @@ -770,170 +1549,362 @@ mixin _$StreamIcons { final _this = (this as StreamIcons); final _other = (other as StreamIcons); - return _other.apiAggregate == _this.apiAggregate && - _other.apples == _this.apples && - _other.archive1 == _this.archive1 && - _other.arrowBoxLeft == _this.arrowBoxLeft && - _other.arrowDown == _this.arrowDown && - _other.arrowDownCircle == _this.arrowDownCircle && - _other.arrowLeft == _this.arrowLeft && - _other.arrowRight == _this.arrowRight && - _other.arrowRotateClockwise == _this.arrowRotateClockwise && - _other.arrowRotateRightLeftRepeatRefresh == - _this.arrowRotateRightLeftRepeatRefresh && - _other.arrowShareLeft == _this.arrowShareLeft && - _other.arrowShareRight == _this.arrowShareRight && - _other.arrowUp == _this.arrowUp && - _other.arrowUpRight == _this.arrowUpRight && - _other.arrowsRepeatLeftRight == _this.arrowsRepeatLeftRight && - _other.at == _this.at && - _other.atSolid == _this.atSolid && - _other.bellNotification == _this.bellNotification && - _other.bellOff == _this.bellOff && - _other.bookmark == _this.bookmark && - _other.bookmarkRemove == _this.bookmarkRemove && - _other.browserAISparkle == _this.browserAISparkle && - _other.bubble3ChatMessage == _this.bubble3ChatMessage && - _other.bubble3Solid == _this.bubble3Solid && - _other.bubbleAnnotation2ChatMessage == - _this.bubbleAnnotation2ChatMessage && - _other.bubbleText6ChatMessage == _this.bubbleText6ChatMessage && - _other.bubbleText6Solid == _this.bubbleText6Solid && - _other.bubbleWideNotificationChatMessage == - _this.bubbleWideNotificationChatMessage && - _other.bubbleWideSparkleChatMessage == - _this.bubbleWideSparkleChatMessage && - _other.bubbles == _this.bubbles && - _other.calendar1 == _this.calendar1 && - _other.callCancel == _this.callCancel && - _other.camera1 == _this.camera1 && - _other.car1 == _this.car1 && - _other.cat == _this.cat && - _other.chainLink3 == _this.chainLink3 && - _other.chart5 == _this.chart5 && - _other.checkmark1Small == _this.checkmark1Small && - _other.checkmark2 == _this.checkmark2 && - _other.checkmark2Small == _this.checkmark2Small && - _other.chevronDown == _this.chevronDown && - _other.chevronGrabberVerticalSelector == - _this.chevronGrabberVerticalSelector && - _other.chevronLeft == _this.chevronLeft && - _other.chevronRight == _this.chevronRight && - _other.chevronTop == _this.chevronTop && - _other.circleBanSign == _this.circleBanSign && - _other.circleCheck == _this.circleCheck && - _other.circleInfoTooltip == _this.circleInfoTooltip && - _other.circleMinus == _this.circleMinus && - _other.circleQuestionmark == _this.circleQuestionmark && - _other.circleQuestionmarkFilled == _this.circleQuestionmarkFilled && - _other.circleX == _this.circleX && - _other.clock == _this.clock && - _other.clockSolid == _this.clockSolid && - _other.closeQuote2 == _this.closeQuote2 && - _other.cloudSimpleUpload == _this.cloudSimpleUpload && - _other.code == _this.code && - _other.codeBrackets == _this.codeBrackets && - _other.codeEditorInsert == _this.codeEditorInsert && - _other.compass == _this.compass && - _other.components == _this.components && - _other.creditCard2Billing == _this.creditCard2Billing && - _other.crossMedium == _this.crossMedium && - _other.crossSmall == _this.crossSmall && - _other.dotGrid1x3Horizontal == _this.dotGrid1x3Horizontal && - _other.dotGrid2x3 == _this.dotGrid2x3 && - _other.dotsGrid1x3Vertical == _this.dotsGrid1x3Vertical && - _other.doupleCheckmark1Small == _this.doupleCheckmark1Small && - _other.editBig == _this.editBig && - _other.editBigSolid == _this.editBigSolid && - _other.emojiAddReaction == _this.emojiAddReaction && - _other.emojiSad == _this.emojiSad && - _other.emojiSmile == _this.emojiSmile && - _other.exclamationCircle == _this.exclamationCircle && - _other.exclamationCircle1 == _this.exclamationCircle1 && - _other.exclamationTriangle == _this.exclamationTriangle && - _other.exclamationTriangle1 == _this.exclamationTriangle1 && - _other.eyeOpen == _this.eyeOpen && - _other.fileArrowLeftIn == _this.fileArrowLeftIn && - _other.fileBend == _this.fileBend && - _other.filledCircleInfoTooltip == _this.filledCircleInfoTooltip && - _other.filter1 == _this.filter1 && - _other.flag2 == _this.flag2 && - _other.folder1 == _this.folder1 && - _other.gauge == _this.gauge && - _other.google == _this.google && - _other.hashtagChannel == _this.hashtagChannel && - _other.heart2 == _this.heart2 && - _other.history == _this.history && - _other.images1Alt == _this.images1Alt && - _other.invite == _this.invite && - _other.layersBehind == _this.layersBehind && - _other.layoutAlignLeft == _this.layoutAlignLeft && - _other.layoutGrid1 == _this.layoutGrid1 && - _other.layoutGrid2 == _this.layoutGrid2 && - _other.layoutLeft == _this.layoutLeft && - _other.lightBulbSimple == _this.lightBulbSimple && - _other.limits == _this.limits && - _other.lineChart3 == _this.lineChart3 && - _other.lock == _this.lock && - _other.magnifyingGlassSearch == _this.magnifyingGlassSearch && - _other.mapPin == _this.mapPin && - _other.microphone == _this.microphone && - _other.microphoneSolid == _this.microphoneSolid && - _other.minusLarge == _this.minusLarge && - _other.minusSmall == _this.minusSmall && - _other.mute == _this.mute && - _other.newspaper2 == _this.newspaper2 && - _other.organization == _this.organization && - _other.paperPlane == _this.paperPlane && - _other.paperPlaneTopRight == _this.paperPlaneTopRight && - _other.paperclip1 == _this.paperclip1 && - _other.paragraphsText == _this.paragraphsText && - _other.pause == _this.pause && - _other.pencil == _this.pencil && - _other.people == _this.people && - _other.people2 == _this.people2 && - _other.peopleAdd == _this.peopleAdd && - _other.peopleAdded == _this.peopleAdded && - _other.peopleCircle == _this.peopleCircle && - _other.peopleCopy == _this.peopleCopy && - _other.peopleEditUserRights == _this.peopleEditUserRights && - _other.peopleRemove == _this.peopleRemove && - _other.persona == _this.persona && - _other.pin == _this.pin && - _other.playSolid == _this.playSolid && - _other.plusLarge == _this.plusLarge && - _other.plusSmall == _this.plusSmall && - _other.runShortcut == _this.runShortcut && - _other.searchText == _this.searchText && - _other.settingsGear2 == _this.settingsGear2 && - _other.settingsSliderVer == _this.settingsSliderVer && - _other.shapesPlusCloseSquareCircle == - _this.shapesPlusCloseSquareCircle && - _other.shapesTriangleSquareCircle == _this.shapesTriangleSquareCircle && - _other.shareOs == _this.shareOs && - _other.shareRedirectLink == _this.shareRedirectLink && - _other.shield == _this.shield && - _other.squareBehindSquare2Copy == _this.squareBehindSquare2Copy && - _other.squareCircleTopRightFeeds == _this.squareCircleTopRightFeeds && - _other.stop == _this.stop && - _other.table == _this.table && - _other.team == _this.team && - _other.tennis == _this.tennis && - _other.textToImageURLEnrichment == _this.textToImageURLEnrichment && - _other.thunder == _this.thunder && - _other.translate == _this.translate && - _other.trashBin == _this.trashBin && - _other.trending4 == _this.trending4 && - _other.trophy == _this.trophy && - _other.unlocked == _this.unlocked && - _other.unpin == _this.unpin && - _other.users == _this.users && - _other.video == _this.video && - _other.videoSolid == _this.videoSolid && - _other.voiceAndVideo == _this.voiceAndVideo && - _other.voiceHigh == _this.voiceHigh && - _other.volumeFull == _this.volumeFull && - _other.webhook == _this.webhook && + return _other.account12 == _this.account12 && + _other.account16 == _this.account16 && + _other.account20 == _this.account20 && + _other.account32 == _this.account32 && + _other.archive12 == _this.archive12 && + _other.archive16 == _this.archive16 && + _other.archive20 == _this.archive20 && + _other.archive32 == _this.archive32 && + _other.arrowDown12 == _this.arrowDown12 && + _other.arrowDown16 == _this.arrowDown16 && + _other.arrowDown20 == _this.arrowDown20 && + _other.arrowDown32 == _this.arrowDown32 && + _other.arrowDownCircle12 == _this.arrowDownCircle12 && + _other.arrowDownCircle16 == _this.arrowDownCircle16 && + _other.arrowDownCircle20 == _this.arrowDownCircle20 && + _other.arrowDownCircle32 == _this.arrowDownCircle32 && + _other.arrowLeft12 == _this.arrowLeft12 && + _other.arrowLeft16 == _this.arrowLeft16 && + _other.arrowLeft20 == _this.arrowLeft20 && + _other.arrowLeft32 == _this.arrowLeft32 && + _other.arrowRight12 == _this.arrowRight12 && + _other.arrowRight16 == _this.arrowRight16 && + _other.arrowRight20 == _this.arrowRight20 && + _other.arrowRight32 == _this.arrowRight32 && + _other.arrowUp12 == _this.arrowUp12 && + _other.arrowUp16 == _this.arrowUp16 && + _other.arrowUp20 == _this.arrowUp20 && + _other.arrowUp32 == _this.arrowUp32 && + _other.arrowUpRight12 == _this.arrowUpRight12 && + _other.arrowUpRight16 == _this.arrowUpRight16 && + _other.arrowUpRight20 == _this.arrowUpRight20 && + _other.arrowUpRight32 == _this.arrowUpRight32 && + _other.attachment12 == _this.attachment12 && + _other.attachment16 == _this.attachment16 && + _other.attachment20 == _this.attachment20 && + _other.attachment32 == _this.attachment32 && + _other.audio12 == _this.audio12 && + _other.audio16 == _this.audio16 && + _other.audio20 == _this.audio20 && + _other.audio32 == _this.audio32 && + _other.bell12 == _this.bell12 && + _other.bell16 == _this.bell16 && + _other.bell20 == _this.bell20 && + _other.bell32 == _this.bell32 && + _other.bellOff12 == _this.bellOff12 && + _other.bellOff16 == _this.bellOff16 && + _other.bellOff20 == _this.bellOff20 && + _other.bellOff32 == _this.bellOff32 && + _other.bolt12 == _this.bolt12 && + _other.bolt16 == _this.bolt16 && + _other.bolt20 == _this.bolt20 && + _other.bolt32 == _this.bolt32 && + _other.camera12 == _this.camera12 && + _other.camera16 == _this.camera16 && + _other.camera20 == _this.camera20 && + _other.camera32 == _this.camera32 && + _other.checkmark12 == _this.checkmark12 && + _other.checkmark16 == _this.checkmark16 && + _other.checkmark20 == _this.checkmark20 && + _other.checkmark32 == _this.checkmark32 && + _other.checks12 == _this.checks12 && + _other.checks16 == _this.checks16 && + _other.checks20 == _this.checks20 && + _other.checks32 == _this.checks32 && + _other.chevronDown12 == _this.chevronDown12 && + _other.chevronDown16 == _this.chevronDown16 && + _other.chevronDown20 == _this.chevronDown20 && + _other.chevronDown32 == _this.chevronDown32 && + _other.chevronLeft12 == _this.chevronLeft12 && + _other.chevronLeft16 == _this.chevronLeft16 && + _other.chevronLeft20 == _this.chevronLeft20 && + _other.chevronLeft32 == _this.chevronLeft32 && + _other.chevronRight12 == _this.chevronRight12 && + _other.chevronRight16 == _this.chevronRight16 && + _other.chevronRight20 == _this.chevronRight20 && + _other.chevronRight32 == _this.chevronRight32 && + _other.chevronUp12 == _this.chevronUp12 && + _other.chevronUp16 == _this.chevronUp16 && + _other.chevronUp20 == _this.chevronUp20 && + _other.chevronUp32 == _this.chevronUp32 && + _other.clock12 == _this.clock12 && + _other.clock16 == _this.clock16 && + _other.clock20 == _this.clock20 && + _other.clock32 == _this.clock32 && + _other.command12 == _this.command12 && + _other.command16 == _this.command16 && + _other.command20 == _this.command20 && + _other.command32 == _this.command32 && + _other.copy12 == _this.copy12 && + _other.copy16 == _this.copy16 && + _other.copy20 == _this.copy20 && + _other.copy32 == _this.copy32 && + _other.delete12 == _this.delete12 && + _other.delete16 == _this.delete16 && + _other.delete20 == _this.delete20 && + _other.delete32 == _this.delete32 && + _other.download12 == _this.download12 && + _other.download16 == _this.download16 && + _other.download20 == _this.download20 && + _other.download32 == _this.download32 && + _other.edit12 == _this.edit12 && + _other.edit16 == _this.edit16 && + _other.edit20 == _this.edit20 && + _other.edit32 == _this.edit32 && + _other.emoji12 == _this.emoji12 && + _other.emoji16 == _this.emoji16 && + _other.emoji20 == _this.emoji20 && + _other.emoji32 == _this.emoji32 && + _other.emojiAdd12 == _this.emojiAdd12 && + _other.emojiAdd16 == _this.emojiAdd16 && + _other.emojiAdd20 == _this.emojiAdd20 && + _other.emojiAdd32 == _this.emojiAdd32 && + _other.exclamationCircle12 == _this.exclamationCircle12 && + _other.exclamationCircle16 == _this.exclamationCircle16 && + _other.exclamationCircle20 == _this.exclamationCircle20 && + _other.exclamationCircle32 == _this.exclamationCircle32 && + _other.exclamationCircleFill12 == _this.exclamationCircleFill12 && + _other.exclamationCircleFill16 == _this.exclamationCircleFill16 && + _other.exclamationCircleFill20 == _this.exclamationCircleFill20 && + _other.exclamationCircleFill32 == _this.exclamationCircleFill32 && + _other.exclamationMarkFill12 == _this.exclamationMarkFill12 && + _other.exclamationMarkFill16 == _this.exclamationMarkFill16 && + _other.exclamationMarkFill20 == _this.exclamationMarkFill20 && + _other.exclamationMarkFill32 == _this.exclamationMarkFill32 && + _other.exclamationTriangleFill12 == _this.exclamationTriangleFill12 && + _other.exclamationTriangleFill16 == _this.exclamationTriangleFill16 && + _other.exclamationTriangleFill20 == _this.exclamationTriangleFill20 && + _other.exclamationTriangleFill32 == _this.exclamationTriangleFill32 && + _other.export12 == _this.export12 && + _other.export16 == _this.export16 && + _other.export20 == _this.export20 && + _other.export32 == _this.export32 && + _other.eyeFill12 == _this.eyeFill12 && + _other.eyeFill16 == _this.eyeFill16 && + _other.eyeFill20 == _this.eyeFill20 && + _other.eyeFill32 == _this.eyeFill32 && + _other.file12 == _this.file12 && + _other.file16 == _this.file16 && + _other.file20 == _this.file20 && + _other.file32 == _this.file32 && + _other.flag12 == _this.flag12 && + _other.flag16 == _this.flag16 && + _other.flag20 == _this.flag20 && + _other.flag32 == _this.flag32 && + _other.folder12 == _this.folder12 && + _other.folder16 == _this.folder16 && + _other.folder20 == _this.folder20 && + _other.folder32 == _this.folder32 && + _other.gallery12 == _this.gallery12 && + _other.gallery16 == _this.gallery16 && + _other.gallery20 == _this.gallery20 && + _other.gallery32 == _this.gallery32 && + _other.image12 == _this.image12 && + _other.image16 == _this.image16 && + _other.image20 == _this.image20 && + _other.image32 == _this.image32 && + _other.info12 == _this.info12 && + _other.info16 == _this.info16 && + _other.info20 == _this.info20 && + _other.info32 == _this.info32 && + _other.leave12 == _this.leave12 && + _other.leave16 == _this.leave16 && + _other.leave20 == _this.leave20 && + _other.leave32 == _this.leave32 && + _other.link12 == _this.link12 && + _other.link16 == _this.link16 && + _other.link20 == _this.link20 && + _other.link32 == _this.link32 && + _other.location12 == _this.location12 && + _other.location16 == _this.location16 && + _other.location20 == _this.location20 && + _other.location32 == _this.location32 && + _other.lock12 == _this.lock12 && + _other.lock16 == _this.lock16 && + _other.lock20 == _this.lock20 && + _other.lock32 == _this.lock32 && + _other.mention12 == _this.mention12 && + _other.mention16 == _this.mention16 && + _other.mention20 == _this.mention20 && + _other.mention32 == _this.mention32 && + _other.messageBubble12 == _this.messageBubble12 && + _other.messageBubble16 == _this.messageBubble16 && + _other.messageBubble20 == _this.messageBubble20 && + _other.messageBubble32 == _this.messageBubble32 && + _other.messageBubbleFill12 == _this.messageBubbleFill12 && + _other.messageBubbleFill16 == _this.messageBubbleFill16 && + _other.messageBubbleFill20 == _this.messageBubbleFill20 && + _other.messageBubbleFill32 == _this.messageBubbleFill32 && + _other.messageBubbles12 == _this.messageBubbles12 && + _other.messageBubbles16 == _this.messageBubbles16 && + _other.messageBubbles20 == _this.messageBubbles20 && + _other.messageBubbles32 == _this.messageBubbles32 && + _other.minus12 == _this.minus12 && + _other.minus16 == _this.minus16 && + _other.minus20 == _this.minus20 && + _other.minus32 == _this.minus32 && + _other.minusCircle12 == _this.minusCircle12 && + _other.minusCircle16 == _this.minusCircle16 && + _other.minusCircle20 == _this.minusCircle20 && + _other.minusCircle32 == _this.minusCircle32 && + _other.more12 == _this.more12 && + _other.more16 == _this.more16 && + _other.more20 == _this.more20 && + _other.more32 == _this.more32 && + _other.mute12 == _this.mute12 && + _other.mute16 == _this.mute16 && + _other.mute20 == _this.mute20 && + _other.mute32 == _this.mute32 && + _other.noSign12 == _this.noSign12 && + _other.noSign16 == _this.noSign16 && + _other.noSign20 == _this.noSign20 && + _other.noSign32 == _this.noSign32 && + _other.notification12 == _this.notification12 && + _other.notification16 == _this.notification16 && + _other.notification20 == _this.notification20 && + _other.notification32 == _this.notification32 && + _other.pauseFill12 == _this.pauseFill12 && + _other.pauseFill16 == _this.pauseFill16 && + _other.pauseFill20 == _this.pauseFill20 && + _other.pauseFill32 == _this.pauseFill32 && + _other.pin12 == _this.pin12 && + _other.pin16 == _this.pin16 && + _other.pin20 == _this.pin20 && + _other.pin32 == _this.pin32 && + _other.playFill12 == _this.playFill12 && + _other.playFill16 == _this.playFill16 && + _other.playFill20 == _this.playFill20 && + _other.playFill32 == _this.playFill32 && + _other.plus12 == _this.plus12 && + _other.plus16 == _this.plus16 && + _other.plus20 == _this.plus20 && + _other.plus32 == _this.plus32 && + _other.poll12 == _this.poll12 && + _other.poll16 == _this.poll16 && + _other.poll20 == _this.poll20 && + _other.poll32 == _this.poll32 && + _other.quote12 == _this.quote12 && + _other.quote16 == _this.quote16 && + _other.quote20 == _this.quote20 && + _other.quote32 == _this.quote32 && + _other.refresh12 == _this.refresh12 && + _other.refresh16 == _this.refresh16 && + _other.refresh20 == _this.refresh20 && + _other.refresh32 == _this.refresh32 && + _other.reorder12 == _this.reorder12 && + _other.reorder16 == _this.reorder16 && + _other.reorder20 == _this.reorder20 && + _other.reorder32 == _this.reorder32 && + _other.reply12 == _this.reply12 && + _other.reply16 == _this.reply16 && + _other.reply20 == _this.reply20 && + _other.reply32 == _this.reply32 && + _other.retry12 == _this.retry12 && + _other.retry16 == _this.retry16 && + _other.retry20 == _this.retry20 && + _other.retry32 == _this.retry32 && + _other.save12 == _this.save12 && + _other.save16 == _this.save16 && + _other.save20 == _this.save20 && + _other.save32 == _this.save32 && + _other.search12 == _this.search12 && + _other.search16 == _this.search16 && + _other.search20 == _this.search20 && + _other.search32 == _this.search32 && + _other.send12 == _this.send12 && + _other.send16 == _this.send16 && + _other.send20 == _this.send20 && + _other.send32 == _this.send32 && + _other.share12 == _this.share12 && + _other.share16 == _this.share16 && + _other.share20 == _this.share20 && + _other.share32 == _this.share32 && + _other.sidebar12 == _this.sidebar12 && + _other.sidebar16 == _this.sidebar16 && + _other.sidebar20 == _this.sidebar20 && + _other.sidebar32 == _this.sidebar32 && + _other.stopFill12 == _this.stopFill12 && + _other.stopFill16 == _this.stopFill16 && + _other.stopFill20 == _this.stopFill20 && + _other.stopFill32 == _this.stopFill32 && + _other.thread12 == _this.thread12 && + _other.thread16 == _this.thread16 && + _other.thread20 == _this.thread20 && + _other.thread32 == _this.thread32 && + _other.threadFill12 == _this.threadFill12 && + _other.threadFill16 == _this.threadFill16 && + _other.threadFill20 == _this.threadFill20 && + _other.threadFill32 == _this.threadFill32 && + _other.translate12 == _this.translate12 && + _other.translate16 == _this.translate16 && + _other.translate20 == _this.translate20 && + _other.translate32 == _this.translate32 && + _other.trophy12 == _this.trophy12 && + _other.trophy16 == _this.trophy16 && + _other.trophy20 == _this.trophy20 && + _other.trophy32 == _this.trophy32 && + _other.unlock12 == _this.unlock12 && + _other.unlock16 == _this.unlock16 && + _other.unlock20 == _this.unlock20 && + _other.unlock32 == _this.unlock32 && + _other.unpin12 == _this.unpin12 && + _other.unpin16 == _this.unpin16 && + _other.unpin20 == _this.unpin20 && + _other.unpin32 == _this.unpin32 && + _other.unsave12 == _this.unsave12 && + _other.unsave16 == _this.unsave16 && + _other.unsave20 == _this.unsave20 && + _other.unsave32 == _this.unsave32 && + _other.upload12 == _this.upload12 && + _other.upload16 == _this.upload16 && + _other.upload20 == _this.upload20 && + _other.upload32 == _this.upload32 && + _other.user12 == _this.user12 && + _other.user16 == _this.user16 && + _other.user20 == _this.user20 && + _other.user32 == _this.user32 && + _other.userAdd12 == _this.userAdd12 && + _other.userAdd16 == _this.userAdd16 && + _other.userAdd20 == _this.userAdd20 && + _other.userAdd32 == _this.userAdd32 && + _other.userCheck12 == _this.userCheck12 && + _other.userCheck16 == _this.userCheck16 && + _other.userCheck20 == _this.userCheck20 && + _other.userCheck32 == _this.userCheck32 && + _other.userRemove12 == _this.userRemove12 && + _other.userRemove16 == _this.userRemove16 && + _other.userRemove20 == _this.userRemove20 && + _other.userRemove32 == _this.userRemove32 && + _other.users12 == _this.users12 && + _other.users16 == _this.users16 && + _other.users20 == _this.users20 && + _other.users32 == _this.users32 && + _other.video12 == _this.video12 && + _other.video16 == _this.video16 && + _other.video20 == _this.video20 && + _other.video32 == _this.video32 && + _other.videoFill12 == _this.videoFill12 && + _other.videoFill16 == _this.videoFill16 && + _other.videoFill20 == _this.videoFill20 && + _other.videoFill32 == _this.videoFill32 && + _other.voice12 == _this.voice12 && + _other.voice16 == _this.voice16 && + _other.voice20 == _this.voice20 && + _other.voice32 == _this.voice32 && + _other.voiceFill12 == _this.voiceFill12 && + _other.voiceFill16 == _this.voiceFill16 && + _other.voiceFill20 == _this.voiceFill20 && + _other.voiceFill32 == _this.voiceFill32 && + _other.xCircle12 == _this.xCircle12 && + _other.xCircle16 == _this.xCircle16 && + _other.xCircle20 == _this.xCircle20 && + _other.xCircle32 == _this.xCircle32 && + _other.xmark12 == _this.xmark12 && + _other.xmark16 == _this.xmark16 && + _other.xmark20 == _this.xmark20 && + _other.xmark32 == _this.xmark32 && _other.giphy == _this.giphy && _other.imgur == _this.imgur; } @@ -944,164 +1915,362 @@ mixin _$StreamIcons { return Object.hashAll([ runtimeType, - _this.apiAggregate, - _this.apples, - _this.archive1, - _this.arrowBoxLeft, - _this.arrowDown, - _this.arrowDownCircle, - _this.arrowLeft, - _this.arrowRight, - _this.arrowRotateClockwise, - _this.arrowRotateRightLeftRepeatRefresh, - _this.arrowShareLeft, - _this.arrowShareRight, - _this.arrowUp, - _this.arrowUpRight, - _this.arrowsRepeatLeftRight, - _this.at, - _this.atSolid, - _this.bellNotification, - _this.bellOff, - _this.bookmark, - _this.bookmarkRemove, - _this.browserAISparkle, - _this.bubble3ChatMessage, - _this.bubble3Solid, - _this.bubbleAnnotation2ChatMessage, - _this.bubbleText6ChatMessage, - _this.bubbleText6Solid, - _this.bubbleWideNotificationChatMessage, - _this.bubbleWideSparkleChatMessage, - _this.bubbles, - _this.calendar1, - _this.callCancel, - _this.camera1, - _this.car1, - _this.cat, - _this.chainLink3, - _this.chart5, - _this.checkmark1Small, - _this.checkmark2, - _this.checkmark2Small, - _this.chevronDown, - _this.chevronGrabberVerticalSelector, - _this.chevronLeft, - _this.chevronRight, - _this.chevronTop, - _this.circleBanSign, - _this.circleCheck, - _this.circleInfoTooltip, - _this.circleMinus, - _this.circleQuestionmark, - _this.circleQuestionmarkFilled, - _this.circleX, - _this.clock, - _this.clockSolid, - _this.closeQuote2, - _this.cloudSimpleUpload, - _this.code, - _this.codeBrackets, - _this.codeEditorInsert, - _this.compass, - _this.components, - _this.creditCard2Billing, - _this.crossMedium, - _this.crossSmall, - _this.dotGrid1x3Horizontal, - _this.dotGrid2x3, - _this.dotsGrid1x3Vertical, - _this.doupleCheckmark1Small, - _this.editBig, - _this.editBigSolid, - _this.emojiAddReaction, - _this.emojiSad, - _this.emojiSmile, - _this.exclamationCircle, - _this.exclamationCircle1, - _this.exclamationTriangle, - _this.exclamationTriangle1, - _this.eyeOpen, - _this.fileArrowLeftIn, - _this.fileBend, - _this.filledCircleInfoTooltip, - _this.filter1, - _this.flag2, - _this.folder1, - _this.gauge, - _this.google, - _this.hashtagChannel, - _this.heart2, - _this.history, - _this.images1Alt, - _this.invite, - _this.layersBehind, - _this.layoutAlignLeft, - _this.layoutGrid1, - _this.layoutGrid2, - _this.layoutLeft, - _this.lightBulbSimple, - _this.limits, - _this.lineChart3, - _this.lock, - _this.magnifyingGlassSearch, - _this.mapPin, - _this.microphone, - _this.microphoneSolid, - _this.minusLarge, - _this.minusSmall, - _this.mute, - _this.newspaper2, - _this.organization, - _this.paperPlane, - _this.paperPlaneTopRight, - _this.paperclip1, - _this.paragraphsText, - _this.pause, - _this.pencil, - _this.people, - _this.people2, - _this.peopleAdd, - _this.peopleAdded, - _this.peopleCircle, - _this.peopleCopy, - _this.peopleEditUserRights, - _this.peopleRemove, - _this.persona, - _this.pin, - _this.playSolid, - _this.plusLarge, - _this.plusSmall, - _this.runShortcut, - _this.searchText, - _this.settingsGear2, - _this.settingsSliderVer, - _this.shapesPlusCloseSquareCircle, - _this.shapesTriangleSquareCircle, - _this.shareOs, - _this.shareRedirectLink, - _this.shield, - _this.squareBehindSquare2Copy, - _this.squareCircleTopRightFeeds, - _this.stop, - _this.table, - _this.team, - _this.tennis, - _this.textToImageURLEnrichment, - _this.thunder, - _this.translate, - _this.trashBin, - _this.trending4, - _this.trophy, - _this.unlocked, - _this.unpin, - _this.users, - _this.video, - _this.videoSolid, - _this.voiceAndVideo, - _this.voiceHigh, - _this.volumeFull, - _this.webhook, + _this.account12, + _this.account16, + _this.account20, + _this.account32, + _this.archive12, + _this.archive16, + _this.archive20, + _this.archive32, + _this.arrowDown12, + _this.arrowDown16, + _this.arrowDown20, + _this.arrowDown32, + _this.arrowDownCircle12, + _this.arrowDownCircle16, + _this.arrowDownCircle20, + _this.arrowDownCircle32, + _this.arrowLeft12, + _this.arrowLeft16, + _this.arrowLeft20, + _this.arrowLeft32, + _this.arrowRight12, + _this.arrowRight16, + _this.arrowRight20, + _this.arrowRight32, + _this.arrowUp12, + _this.arrowUp16, + _this.arrowUp20, + _this.arrowUp32, + _this.arrowUpRight12, + _this.arrowUpRight16, + _this.arrowUpRight20, + _this.arrowUpRight32, + _this.attachment12, + _this.attachment16, + _this.attachment20, + _this.attachment32, + _this.audio12, + _this.audio16, + _this.audio20, + _this.audio32, + _this.bell12, + _this.bell16, + _this.bell20, + _this.bell32, + _this.bellOff12, + _this.bellOff16, + _this.bellOff20, + _this.bellOff32, + _this.bolt12, + _this.bolt16, + _this.bolt20, + _this.bolt32, + _this.camera12, + _this.camera16, + _this.camera20, + _this.camera32, + _this.checkmark12, + _this.checkmark16, + _this.checkmark20, + _this.checkmark32, + _this.checks12, + _this.checks16, + _this.checks20, + _this.checks32, + _this.chevronDown12, + _this.chevronDown16, + _this.chevronDown20, + _this.chevronDown32, + _this.chevronLeft12, + _this.chevronLeft16, + _this.chevronLeft20, + _this.chevronLeft32, + _this.chevronRight12, + _this.chevronRight16, + _this.chevronRight20, + _this.chevronRight32, + _this.chevronUp12, + _this.chevronUp16, + _this.chevronUp20, + _this.chevronUp32, + _this.clock12, + _this.clock16, + _this.clock20, + _this.clock32, + _this.command12, + _this.command16, + _this.command20, + _this.command32, + _this.copy12, + _this.copy16, + _this.copy20, + _this.copy32, + _this.delete12, + _this.delete16, + _this.delete20, + _this.delete32, + _this.download12, + _this.download16, + _this.download20, + _this.download32, + _this.edit12, + _this.edit16, + _this.edit20, + _this.edit32, + _this.emoji12, + _this.emoji16, + _this.emoji20, + _this.emoji32, + _this.emojiAdd12, + _this.emojiAdd16, + _this.emojiAdd20, + _this.emojiAdd32, + _this.exclamationCircle12, + _this.exclamationCircle16, + _this.exclamationCircle20, + _this.exclamationCircle32, + _this.exclamationCircleFill12, + _this.exclamationCircleFill16, + _this.exclamationCircleFill20, + _this.exclamationCircleFill32, + _this.exclamationMarkFill12, + _this.exclamationMarkFill16, + _this.exclamationMarkFill20, + _this.exclamationMarkFill32, + _this.exclamationTriangleFill12, + _this.exclamationTriangleFill16, + _this.exclamationTriangleFill20, + _this.exclamationTriangleFill32, + _this.export12, + _this.export16, + _this.export20, + _this.export32, + _this.eyeFill12, + _this.eyeFill16, + _this.eyeFill20, + _this.eyeFill32, + _this.file12, + _this.file16, + _this.file20, + _this.file32, + _this.flag12, + _this.flag16, + _this.flag20, + _this.flag32, + _this.folder12, + _this.folder16, + _this.folder20, + _this.folder32, + _this.gallery12, + _this.gallery16, + _this.gallery20, + _this.gallery32, + _this.image12, + _this.image16, + _this.image20, + _this.image32, + _this.info12, + _this.info16, + _this.info20, + _this.info32, + _this.leave12, + _this.leave16, + _this.leave20, + _this.leave32, + _this.link12, + _this.link16, + _this.link20, + _this.link32, + _this.location12, + _this.location16, + _this.location20, + _this.location32, + _this.lock12, + _this.lock16, + _this.lock20, + _this.lock32, + _this.mention12, + _this.mention16, + _this.mention20, + _this.mention32, + _this.messageBubble12, + _this.messageBubble16, + _this.messageBubble20, + _this.messageBubble32, + _this.messageBubbleFill12, + _this.messageBubbleFill16, + _this.messageBubbleFill20, + _this.messageBubbleFill32, + _this.messageBubbles12, + _this.messageBubbles16, + _this.messageBubbles20, + _this.messageBubbles32, + _this.minus12, + _this.minus16, + _this.minus20, + _this.minus32, + _this.minusCircle12, + _this.minusCircle16, + _this.minusCircle20, + _this.minusCircle32, + _this.more12, + _this.more16, + _this.more20, + _this.more32, + _this.mute12, + _this.mute16, + _this.mute20, + _this.mute32, + _this.noSign12, + _this.noSign16, + _this.noSign20, + _this.noSign32, + _this.notification12, + _this.notification16, + _this.notification20, + _this.notification32, + _this.pauseFill12, + _this.pauseFill16, + _this.pauseFill20, + _this.pauseFill32, + _this.pin12, + _this.pin16, + _this.pin20, + _this.pin32, + _this.playFill12, + _this.playFill16, + _this.playFill20, + _this.playFill32, + _this.plus12, + _this.plus16, + _this.plus20, + _this.plus32, + _this.poll12, + _this.poll16, + _this.poll20, + _this.poll32, + _this.quote12, + _this.quote16, + _this.quote20, + _this.quote32, + _this.refresh12, + _this.refresh16, + _this.refresh20, + _this.refresh32, + _this.reorder12, + _this.reorder16, + _this.reorder20, + _this.reorder32, + _this.reply12, + _this.reply16, + _this.reply20, + _this.reply32, + _this.retry12, + _this.retry16, + _this.retry20, + _this.retry32, + _this.save12, + _this.save16, + _this.save20, + _this.save32, + _this.search12, + _this.search16, + _this.search20, + _this.search32, + _this.send12, + _this.send16, + _this.send20, + _this.send32, + _this.share12, + _this.share16, + _this.share20, + _this.share32, + _this.sidebar12, + _this.sidebar16, + _this.sidebar20, + _this.sidebar32, + _this.stopFill12, + _this.stopFill16, + _this.stopFill20, + _this.stopFill32, + _this.thread12, + _this.thread16, + _this.thread20, + _this.thread32, + _this.threadFill12, + _this.threadFill16, + _this.threadFill20, + _this.threadFill32, + _this.translate12, + _this.translate16, + _this.translate20, + _this.translate32, + _this.trophy12, + _this.trophy16, + _this.trophy20, + _this.trophy32, + _this.unlock12, + _this.unlock16, + _this.unlock20, + _this.unlock32, + _this.unpin12, + _this.unpin16, + _this.unpin20, + _this.unpin32, + _this.unsave12, + _this.unsave16, + _this.unsave20, + _this.unsave32, + _this.upload12, + _this.upload16, + _this.upload20, + _this.upload32, + _this.user12, + _this.user16, + _this.user20, + _this.user32, + _this.userAdd12, + _this.userAdd16, + _this.userAdd20, + _this.userAdd32, + _this.userCheck12, + _this.userCheck16, + _this.userCheck20, + _this.userCheck32, + _this.userRemove12, + _this.userRemove16, + _this.userRemove20, + _this.userRemove32, + _this.users12, + _this.users16, + _this.users20, + _this.users32, + _this.video12, + _this.video16, + _this.video20, + _this.video32, + _this.videoFill12, + _this.videoFill16, + _this.videoFill20, + _this.videoFill32, + _this.voice12, + _this.voice16, + _this.voice20, + _this.voice32, + _this.voiceFill12, + _this.voiceFill16, + _this.voiceFill20, + _this.voiceFill32, + _this.xCircle12, + _this.xCircle16, + _this.xCircle20, + _this.xCircle32, + _this.xmark12, + _this.xmark16, + _this.xmark20, + _this.xmark32, _this.giphy, _this.imgur, ]); diff --git a/packages/stream_core_flutter/stream_icons.yaml b/packages/stream_core_flutter/stream_icons.yaml index 902a5c67..b2394f04 100644 --- a/packages/stream_core_flutter/stream_icons.yaml +++ b/packages/stream_core_flutter/stream_icons.yaml @@ -15,6 +15,7 @@ input_svg_icon_dir: assets/icons/ output_font_file: lib/fonts/stream_icons_font.otf output_file: lib/src/theme/primitives/stream_icons.dart output_data_file: lib/src/theme/primitives/stream_icons.g.dart +output_log_file: assets_source/icon_log.g.txt # Class names class_name: StreamIcons @@ -24,3 +25,4 @@ package: stream_core_flutter # Font options font_name: Stream Icons + diff --git a/scripts/generate_icons.dart b/scripts/generate_icons.dart index 07574a58..926eb632 100644 --- a/scripts/generate_icons.dart +++ b/scripts/generate_icons.dart @@ -41,6 +41,7 @@ class IconGeneratorConfig { required this.outputFontFile, required this.outputFile, required this.outputDataFile, + required this.outputLogFile, required this.fontName, required this.className, required this.dataClassName, @@ -82,6 +83,7 @@ class IconGeneratorConfig { outputFontFile: resolvePath('output_font_file'), outputFile: resolvePath('output_file'), outputDataFile: resolvePath('output_data_file'), + outputLogFile: resolvePath('output_log_file'), fontName: config['font_name'] as String? ?? 'Stream Icons', className: config['class_name'] as String? ?? 'StreamIcons', dataClassName: config['data_class_name'] as String? ?? 'StreamIconData', @@ -99,6 +101,7 @@ class IconGeneratorConfig { final String outputFontFile; final String outputFile; final String outputDataFile; + final String outputLogFile; final String fontName; final String className; final String dataClassName; @@ -159,7 +162,12 @@ String _resolveConfigPath() { Future _generateIcons(IconGeneratorConfig config, String scriptDir) async { // 1. Read SVG files - final svgMap = _readSvgFiles(config.inputSvgDir, config.recursive, scriptDir); + final svgMap = _readSvgFiles( + config.inputSvgDir, + config.recursive, + scriptDir: scriptDir, + logFilePath: config.outputLogFile, + ); if (svgMap.isEmpty) { throw const IconGeneratorException('No SVG files found', exitCode: 2); } @@ -249,7 +257,12 @@ Future _generateIcons(IconGeneratorConfig config, String scriptDir) async } /// Reads all SVG files from a directory. -Map _readSvgFiles(String directory, bool recursive, String scriptDir) { +Map _readSvgFiles( + String directory, + bool recursive, { + required String scriptDir, + required String logFilePath, +}) { _log('🔍 Reading SVGs: ${p.relative(directory, from: scriptDir)}'); final dir = Directory(directory); @@ -260,16 +273,62 @@ Map _readSvgFiles(String directory, bool recursive, String scrip ); } + _log('🔍 Reading log file: ${p.relative(logFilePath, from: scriptDir)}'); + final logFile = File(logFilePath); + if (!logFile.existsSync()) { + throw IconGeneratorException( + 'Log file not found: $logFile', + exitCode: 2, + ); + } + final logContent = logFile.readAsStringSync(); + final logEntries = {}; + for (final line in logContent.split('\n')) { + final parts = line.split(';'); + if (parts.length == 2) { + logEntries[parts[0]] = parts[1]; + } + } + + final newAdditions = {}; + + String getAdditionDate(String fileName) { + if (logEntries.containsKey(fileName)) { + return logEntries[fileName]!; + } + final now = DateTime.now(); + newAdditions[fileName] = '${now.year}${now.month}${now.day}'; + return newAdditions[fileName]!; + } + final svgFiles = dir .listSync(recursive: recursive) .whereType() .where((f) => p.extension(f.path).toLowerCase() == '.svg') + .where((f) => !_excludedSvgIcons.contains(p.basenameWithoutExtension(f.path))) .toList() - ..sort((a, b) => p.basename(a.path).compareTo(p.basename(b.path))); + ..sort( + (a, b) { + final dateDiff = + getAdditionDate( + p.basenameWithoutExtension(a.path), + ).compareTo( + getAdditionDate(p.basenameWithoutExtension(b.path)), + ); + if (dateDiff != 0) { + return dateDiff; + } + return p.basenameWithoutExtension(a.path).compareTo(p.basenameWithoutExtension(b.path)); + }, + ); + + for (final entries in newAdditions.entries) { + logFile.writeAsStringSync('${entries.key};${entries.value}\n', mode: FileMode.append); + } return { - for (final file in svgFiles) p.basenameWithoutExtension(file.path): file.readAsStringSync(), + for (final file in svgFiles) p.basenameWithoutExtension(file.path).camelCase: file.readAsStringSync(), }; } @@ -606,7 +665,7 @@ class IconEntry { return IconEntry( fieldName: ReCase(withoutPrefix).camelCase, - constantName: 'icon${sanitized.startsWith('Icon') ? sanitized.substring(4) : ReCase(sanitized).pascalCase}', + constantName: ReCase(sanitized).camelCase, humanReadable: ReCase(withoutPrefix).sentenceCase.toLowerCase(), ); } @@ -685,3 +744,20 @@ class IconGeneratorException implements Exception { @override String toString() => message; } + +const _excludedSvgIcons = [ + // Multi color icons are added separately + 'giphy-12', + 'giphy-16', + 'giphy-20', + 'giphy-32', + 'imgur-12', + 'imgur-16', + 'imgur-20', + 'imgur-32', + // Loading icons are a Flutter widget + 'loading-12', + 'loading-16', + 'loading-20', + 'loading-32', +];